Index of /Album-Art
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | Tiësto, Becky Hill..> | 2026-05-22 20:11 | 474K | |
| yourstation.jpg | 2026-05-22 19:29 | 3.1K | |
| yougotstation2.jpg | 2026-05-22 19:29 | 3.1K | |
| yougotstation.jpg | 2026-05-22 19:29 | 3.1K | |
| will.i.am - Scream &..> | 2026-05-22 20:12 | 150K | |
| twocolors, Safri Duo..> | 2026-05-22 20:11 | 185K | |
| truegeneration.jpg | 2026-05-22 19:29 | 3.1K | |
| sheeran.jpg | 2026-05-22 19:29 | 3.1K | |
| saymore.jpg | 2026-05-22 19:29 | 3.1K | |
| roy orbison - you go..> | 2026-05-22 20:43 | 32K | |
| request.jpg | 2026-05-22 19:29 | 3.1K | |
| musicfits.jpg | 2026-05-22 19:29 | 3.1K | |
| morenext2.jpg | 2026-05-22 19:29 | 3.1K | |
| morenext.jpg | 2026-05-22 19:29 | 3.1K | |
| lovethisradio.jpg | 2026-05-22 19:29 | 3.1K | |
| loafersBadjackMaxim ..> | 2026-05-22 20:08 | 43K | |
| johnlipa.jpg | 2026-05-22 19:29 | 3.1K | |
| joe Cocker - summer ..> | 2026-05-22 20:38 | 139K | |
| jingles - A DJ Who's..> | 2026-05-22 19:29 | 3.1K | |
| hitmusicnow.jpg | 2026-05-22 19:29 | 3.1K | |
| elvis costello - she..> | 2026-05-22 20:34 | 221K | |
| elton john dua lipa ..> | 2026-05-22 20:06 | 259K | |
| cassö, RAYE, D-Bloc..> | 2026-05-22 20:05 | 154K | |
| brunomars.jpg | 2026-05-22 19:29 | 3.1K | |
| biggest hitmusic2.jpg | 2026-05-22 19:29 | 3.1K | |
| biggest hitmusic.jpg | 2026-05-22 19:29 | 3.1K | |
| beyedpeas.jpg | 2026-05-22 19:29 | 3.1K | |
| abba - Knowing Me Kn..> | 2026-05-22 19:36 | 78K | |
| Zz Top - Tush.jpg | 2026-05-22 19:36 | 262K | |
| Zz Top - Sharp Dress..> | 2026-05-22 19:45 | 28K | |
| Zz Top - La Grange.jpg | 2026-05-22 19:36 | 489K | |
| Zz Top - Gimme All Y..> | 2026-05-22 19:45 | 28K | |
| Zz & De Maskers - La..> | 2026-05-22 20:02 | 36K | |
| Zucchero Fornaciari ..> | 2026-05-22 20:12 | 33K | |
| Zucchero Fornaciari ..> | 2026-05-22 20:12 | 78K | |
| Zucchero Fornaciari ..> | 2026-05-22 20:12 | 76K | |
| Zucchero Fornaciari ..> | 2026-05-22 20:02 | 66K | |
| Zucchero - Il Volo (..> | 2026-05-22 20:02 | 185K | |
| Zucchero - Diamante.jpg | 2026-05-22 19:45 | 49K | |
| Zucchero & Paul Youn..> | 2026-05-22 19:45 | 53K | |
| Zouk Machine - Maldo..> | 2026-05-22 20:12 | 48K | |
| Zombies - Time Of Th..> | 2026-05-22 20:02 | 66K | |
| Zombies - She's Not ..> | 2026-05-22 19:45 | 210K | |
| Ziggy X - Bassdusche..> | 2026-05-22 20:12 | 212K | |
| Ziggy Marley & The M..> | 2026-05-22 19:45 | 18K | |
| Zen - Hair.jpg | 2026-05-22 19:36 | 56K | |
| Zedd Ft. Selena Gome..> | 2026-05-22 20:12 | 65K | |
| Zara Larsson - Lush ..> | 2026-05-22 20:12 | 84K | |
| Zara Larsson - Lay A..> | 2026-05-22 20:12 | 49K | |
| Zager & Evans - In T..> | 2026-05-22 20:46 | 470K | |
| Zager & Evans - Cary..> | 2026-05-22 20:46 | 140K | |
| ZZ Top - Legs.jpg | 2026-05-22 19:45 | 28K | |
| ZZ & Maskers - Goldf..> | 2026-05-22 20:46 | 96 | |
| Yvonne Elliman - Lov..> | 2026-05-22 20:02 | 45K | |
| Yvonne Elliman - Lov..> | 2026-05-22 19:45 | 45K | |
| Yvonne Elliman - Lov..> | 2026-05-22 19:36 | 209K | |
| Yvonne Elliman - If ..> | 2026-05-22 20:46 | 49K | |
| Yvonne Elliman - I D..> | 2026-05-22 19:36 | 632K | |
| Yves Montand - Les F..> | 2026-05-22 20:02 | 67K | |
| Yves Duteil - Prendr..> | 2026-05-22 20:46 | 66K | |
| Yusuf _ Cat Stevens ..> | 2026-05-22 19:36 | 25K | |
| Yusuf _ Cat Stevens ..> | 2026-05-22 19:36 | 216K | |
| Youssou N'dour & Nen..> | 2026-05-22 20:02 | 41K | |
| Your essential guide..> | 2026-05-22 19:29 | 3.1K | |
| Younotus & Janieck &..> | 2026-05-22 20:12 | 250K | |
| Young Rascals - Groo..> | 2026-05-22 20:46 | 42K | |
| Yolanda Be Cool & Dc..> | 2026-05-22 20:12 | 78K | |
| Yolanda Be Cool & Dc..> | 2026-05-22 20:12 | 180K | |
| Yola - Faraway Look.jpg | 2026-05-22 20:12 | 41K | |
| Yes -Owner of a Lone..> | 2026-05-22 19:45 | 23K | |
| Yello - Vicious Game..> | 2026-05-22 19:45 | 45K | |
| Yello - The Rhythm D..> | 2026-05-22 19:45 | 35K | |
| Yello - The Race.jpg | 2026-05-22 19:45 | 28K | |
| Yello - I Love You.jpg | 2026-05-22 19:45 | 75K | |
| Years & Years - King..> | 2026-05-22 20:12 | 56K | |
| Yazz & The Plastic P..> | 2026-05-22 19:45 | 84K | |
| Yazz & The Plastic P..> | 2026-05-22 19:45 | 123K | |
| Yazoo - Situation.jpg | 2026-05-22 19:45 | 24K | |
| Yazoo - Situation (D..> | 2026-05-22 20:02 | 22K | |
| Yazoo - Don't Go.jpg | 2026-05-22 19:45 | 24K | |
| Yardbirds - For your..> | 2026-05-22 20:46 | 48K | |
| Yarbrough & Peoples ..> | 2026-05-22 19:45 | 32K | |
| Yarbrough & Peoples ..> | 2026-05-22 20:02 | 20K | |
| Yannis Markopoulos -..> | 2026-05-22 20:46 | 89K | |
| Xzibit - Paparazzi.jpg | 2026-05-22 20:02 | 206K | |
| Xyp - Body To Body.jpg | 2026-05-22 20:12 | 47K | |
| Xtc - Senses Working..> | 2026-05-22 20:02 | 25K | |
| Xandra - Colorado (N..> | 2026-05-22 19:36 | 51K | |
| Wynonna Judd - Tell ..> | 2026-05-22 20:29 | 313K | |
| Wynonna Judd - She I..> | 2026-05-22 20:29 | 284K | |
| Wynonna Judd - No On..> | 2026-05-22 20:29 | 284K | |
| Wynonna Judd - My St..> | 2026-05-22 20:29 | 284K | |
| Wynonna Judd - I Saw..> | 2026-05-22 20:29 | 284K | |
| Wynonna - Rock Botto..> | 2026-05-22 20:29 | 113K | |
| Wynonna - Is It Over..> | 2026-05-22 20:29 | 113K | |
| Wynn Stewart - Love..> | 2026-05-22 20:29 | 102K | |
| Wyclef Jean - Guanta..> | 2026-05-22 20:02 | 25K | |
| Wyclef Jean & Queen ..> | 2026-05-22 20:12 | 83K | |
| Won Ton Ton - I Lie ..> | 2026-05-22 19:45 | 397K | |
| Womack & Womack - Te..> | 2026-05-22 20:02 | 34K | |
| Womack & Womack - T..> | 2026-05-22 19:45 | 54K | |
| Womack & Womack - Li..> | 2026-05-22 20:12 | 29K | |
| Wiz Stars - A Brand ..> | 2026-05-22 19:36 | 389K | |
| Wiz Stars & Diana Ro..> | 2026-05-22 19:36 | 107K | |
| Witt & Heppner - Die..> | 2026-05-22 20:02 | 168K | |
| Without A Doubt - Do..> | 2026-05-22 20:02 | 52K | |
| Within Temptation - ..> | 2026-05-22 20:46 | 39K | |
| Within Temptation - ..> | 2026-05-22 20:12 | 54K | |
| Within Temptation -F..> | 2026-05-22 20:46 | 28K | |
| Wings - Mary Had A L..> | 2026-05-22 19:36 | 389K | |
| Windjammer - Tossing..> | 2026-05-22 19:45 | 48K | |
| Windjammer - Harborl..> | 2026-05-22 19:36 | 217K | |
| Wind - Laß Die Sonn..> | 2026-05-22 19:45 | 46K | |
| Wim Sonneveld - Tear..> | 2026-05-22 20:46 | 9.9K | |
| Wilson Pickett - Mus..> | 2026-05-22 20:12 | 55K | |
| Wilson Pickett - Lan..> | 2026-05-22 20:46 | 42K | |
| Wilson Pickett - Hey..> | 2026-05-22 20:46 | 51K | |
| Wilson Phillips - Re..> | 2026-05-22 20:02 | 35K | |
| Wilson Phillips - Re..> | 2026-05-22 20:02 | 35K | |
| Wilson Phillips - Ho..> | 2026-05-22 20:46 | 69K | |
| Wilma Burgess - You ..> | 2026-05-22 20:29 | 42K | |
| Wilma Burgess - Ther..> | 2026-05-22 20:29 | 42K | |
| Wilma Burgess - Sati..> | 2026-05-22 20:29 | 332K | |
| Wilma Burgess - Ever..> | 2026-05-22 20:29 | 42K | |
| Willy Schobben - Som..> | 2026-05-22 20:46 | 68K | |
| Willy Schobben - Mex..> | 2026-05-22 20:46 | 60K | |
| Willy Deville - Hey ..> | 2026-05-22 20:02 | 213K | |
| Willy Batenburg - Oe..> | 2026-05-22 20:02 | 55K | |
| Willie Nelson with J..> | 2026-05-22 20:46 | 21K | |
| Willie Nelson Feat. ..> | 2026-05-22 20:29 | 9.4K | |
| Willie Nelson - Whis..> | 2026-05-22 20:29 | 130K | |
| Willie Nelson - Uncl..> | 2026-05-22 20:29 | 129K | |
| Willie Nelson - To A..> | 2026-05-22 20:29 | 150K | |
| Willie Nelson - The ..> | 2026-05-22 20:29 | 148K | |
| Willie Nelson - Star..> | 2026-05-22 20:29 | 221K | |
| Willie Nelson - Seve..> | 2026-05-22 20:29 | 250K | |
| Willie Nelson - Reme..> | 2026-05-22 20:29 | 252K | |
| Willie Nelson - Pret..> | 2026-05-22 20:29 | 357K | |
| Willie Nelson - On t..> | 2026-05-22 20:29 | 27K | |
| Willie Nelson - Noth..> | 2026-05-22 20:29 | 148K | |
| Willie Nelson - No P..> | 2026-05-22 20:29 | 166K | |
| Willie Nelson - Midn..> | 2026-05-22 20:29 | 191K | |
| Willie Nelson - Livi..> | 2026-05-22 20:29 | 148K | |
| Willie Nelson - Let ..> | 2026-05-22 20:29 | 238K | |
| Willie Nelson - If Y..> | 2026-05-22 20:29 | 148K | |
| Willie Nelson - Help..> | 2026-05-22 20:29 | 160K | |
| Willie Nelson - Hear..> | 2026-05-22 20:29 | 166K | |
| Willie Nelson - Geor..> | 2026-05-22 20:29 | 264K | |
| Willie Nelson - Funn..> | 2026-05-22 20:29 | 58K | |
| Willie Nelson - Forg..> | 2026-05-22 20:29 | 148K | |
| Willie Nelson - Ever..> | 2026-05-22 20:45 | 110K | |
| Willie Nelson - Ever..> | 2026-05-22 20:29 | 110K | |
| Willie Nelson - Craz..> | 2026-05-22 20:45 | 51K | |
| Willie Nelson - City..> | 2026-05-22 20:29 | 146K | |
| Willie Nelson - Blue..> | 2026-05-22 20:29 | 213K | |
| Willie Nelson - Blue..> | 2026-05-22 20:29 | 52K | |
| Willie Nelson - Ange..> | 2026-05-22 20:29 | 329K | |
| Willie Nelson - Alwa..> | 2026-05-22 20:45 | 48K | |
| Willie Nelson - Afte..> | 2026-05-22 20:29 | 154K | |
| Willie Nelson & Carl..> | 2026-05-22 20:46 | 27K | |
| William Pitt - City ..> | 2026-05-22 20:02 | 114K | |
| William Orbit -Barbe..> | 2026-05-22 20:45 | 49K | |
| Will To Power - Baby..> | 2026-05-22 19:45 | 104K | |
| Will To Power - Baby..> | 2026-05-22 19:45 | 32K | |
| Will Smith - Wild Wi..> | 2026-05-22 20:02 | 63K | |
| Will Smith - Miami.jpg | 2026-05-22 20:02 | 42K | |
| Will Smith - Men In ..> | 2026-05-22 20:02 | 42K | |
| Will Smith - Just Th..> | 2026-05-22 20:02 | 28K | |
| Will Smith - Gettin'..> | 2026-05-22 20:12 | 39K | |
| Will I Am & Nicki Mi..> | 2026-05-22 20:12 | 21K | |
| Will Andy - Oh what ..> | 2026-05-22 20:45 | 40K | |
| Will.i.am Ft. Britne..> | 2026-05-22 20:12 | 150K | |
| Will.I.Am ft. Eva - ..> | 2026-05-22 20:12 | 95K | |
| Will.I.Am Feat. Eva ..> | 2026-05-22 20:12 | 56K | |
| Will.I.Am & Nicki Mi..> | 2026-05-22 20:12 | 165K | |
| Wildboyz Ft. Ameera ..> | 2026-05-22 20:12 | 38K | |
| Wildboyz Feat. Ameer..> | 2026-05-22 20:12 | 526K | |
| Wild Cherry - Play T..> | 2026-05-22 19:36 | 153K | |
| Wild Cherry - Play T..> | 2026-05-22 19:45 | 33K | |
| Wil De Bras Combo - ..> | 2026-05-22 19:36 | 35K | |
| Wiegel Meirmans Snit..> | 2026-05-22 20:12 | 111K | |
| Who - You Better You..> | 2026-05-22 20:12 | 33K | |
| Who - Won't Get Fool..> | 2026-05-22 19:36 | 330K | |
| Whitney HoustonClean..> | 2026-05-22 20:12 | 3.7M | |
| Whitney Houston - St..> | 2026-05-22 20:02 | 21K | |
| Whitney Houston - So..> | 2026-05-22 20:02 | 39K | |
| Whitney Houston - Sa..> | 2026-05-22 19:45 | 61K | |
| Whitney Houston - Ru..> | 2026-05-22 20:02 | 23K | |
| Whitney Houston - On..> | 2026-05-22 19:45 | 49K | |
| Whitney Houston - My..> | 2026-05-22 20:11 | 27K | |
| Whitney Houston - Lo..> | 2026-05-22 19:45 | 42K | |
| Whitney Houston - It..> | 2026-05-22 20:11 | 27K | |
| Whitney Houston -I W..> | 2026-05-22 19:45 | 28K | |
| Whitney Houston - I ..> | 2026-05-22 19:45 | 39K | |
| Whitney Houston - I ..> | 2026-05-22 20:02 | 11K | |
| Whitney Houston - I'..> | 2026-05-22 20:02 | 62K | |
| Whitney Houston - I'..> | 2026-05-22 20:02 | 21K | |
| Whitney Houston - Ho..> | 2026-05-22 20:45 | 31K | |
| Whitney Houston - Ho..> | 2026-05-22 19:45 | 61K | |
| Whitney Houston - Gr..> | 2026-05-22 20:45 | 34K | |
| Whitney Houston - Di..> | 2026-05-22 19:45 | 59K | |
| Whitney Houston - Al..> | 2026-05-22 20:02 | 60K | |
| Whitney Houston - Al..> | 2026-05-22 19:45 | 61K | |
| Whitney Houston & Ge..> | 2026-05-22 20:11 | 27K | |
| Whitney Houston & Ci..> | 2026-05-22 19:45 | 38K | |
| Whitesnake - Is This..> | 2026-05-22 20:11 | 66K | |
| Whitesnake - Is This..> | 2026-05-22 19:45 | 122K | |
| Whitesnake - Here I ..> | 2026-05-22 20:02 | 101K | |
| Whitesnake - Here I ..> | 2026-05-22 19:45 | 101K | |
| White Stripes - Seve..> | 2026-05-22 20:11 | 35K | |
| White Plains - When ..> | 2026-05-22 19:36 | 124K | |
| Whistling Jack Smith..> | 2026-05-22 20:45 | 57K | |
| Whistle - Just Buggi..> | 2026-05-22 19:45 | 240K | |
| Whigfield - Think Of..> | 2026-05-22 20:11 | 72K | |
| Whigfield - Think Of..> | 2026-05-22 20:02 | 56K | |
| Whigfield - Sexy Eye..> | 2026-05-22 20:02 | 56K | |
| Whigfield - Saturday..> | 2026-05-22 20:02 | 56K | |
| Whigfield - Big Time..> | 2026-05-22 20:02 | 56K | |
| What Fun - The Right..> | 2026-05-22 19:45 | 110K | |
| Wham - Young Guns (G..> | 2026-05-22 19:45 | 31K | |
| Wham - Wake Me Up Be..> | 2026-05-22 19:45 | 41K | |
| Wham - The Edge Of H..> | 2026-05-22 20:02 | 36K | |
| Wham - I'm Your Man.jpg | 2026-05-22 19:45 | 68K | |
| Wham - Everything Sh..> | 2026-05-22 20:11 | 25K | |
| Wham - Everything Sh..> | 2026-05-22 19:45 | 255K | |
| Wham! - Young Guns (..> | 2026-05-22 20:11 | 15K | |
| Wham! - Wham rap.jpg | 2026-05-22 20:11 | 20K | |
| Wham! - The Edge Of ..> | 2026-05-22 19:45 | 36K | |
| Wham! - Freedom.jpg | 2026-05-22 19:45 | 62K | |
| Wham! - Club Tropica..> | 2026-05-22 19:45 | 31K | |
| Wham! - Bad Boys.jpg | 2026-05-22 19:45 | 31K | |
| Wet Wet Wet - Wishin..> | 2026-05-22 20:11 | 44K | |
| Wet Wet Wet - Sweet ..> | 2026-05-22 19:45 | 39K | |
| Wet Wet Wet - Sweet ..> | 2026-05-22 20:11 | 71K | |
| Wet Wet Wet - Love I..> | 2026-05-22 20:02 | 70K | |
| Wet Wet Wet - Goodni..> | 2026-05-22 20:02 | 56K | |
| Wet Wet Wet - Angel ..> | 2026-05-22 19:45 | 57K | |
| Westlife - You Raise..> | 2026-05-22 20:45 | 50K | |
| Westlife - Uptown Gi..> | 2026-05-22 20:11 | 42K | |
| Westlife - Tonight.jpg | 2026-05-22 20:11 | 40K | |
| Westlife - If I Let ..> | 2026-05-22 20:02 | 34K | |
| Westlife - Flying wi..> | 2026-05-22 20:45 | 34K | |
| Westbam - Celebratio..> | 2026-05-22 20:11 | 297K | |
| West Side Story Film..> | 2026-05-22 20:45 | 264K | |
| Wesley Tuttle - With..> | 2026-05-22 20:29 | 77K | |
| Wesley -You Raise Me..> | 2026-05-22 20:45 | 48K | |
| Wes - Alane.jpg | 2026-05-22 20:02 | 48K | |
| Wendy & Lisa - Water..> | 2026-05-22 19:45 | 184K | |
| Wendy & Lisa - Lolly..> | 2026-05-22 19:45 | 48K | |
| Wendy & Lisa - Are Y..> | 2026-05-22 20:02 | 49K | |
| Weeks & Company - Ro..> | 2026-05-22 20:02 | 40K | |
| Wee Papa Girl Rapper..> | 2026-05-22 19:45 | 86K | |
| Web - Baby Won't You..> | 2026-05-22 20:45 | 35K | |
| Weather Girls - Its ..> | 2026-05-22 19:45 | 58K | |
| We are taking your a..> | 2026-05-22 19:29 | 3.1K | |
| We Play a Better Mix..> | 2026-05-22 19:29 | 3.1K | |
| We Play The Music 2.jpg | 2026-05-22 19:29 | 3.1K | |
| We Play The Music 1.jpg | 2026-05-22 19:29 | 3.1K | |
| We Play The Best Mus..> | 2026-05-22 19:29 | 3.1K | |
| We Love Taylor Swift..> | 2026-05-22 20:11 | 166K | |
| Wayne Wade - Lady.jpg | 2026-05-22 20:45 | 82K | |
| Wayne Wade - Lady (S..> | 2026-05-22 19:45 | 75K | |
| Wayne Newton - Danke..> | 2026-05-22 20:11 | 34K | |
| Wayne Fontana & The ..> | 2026-05-22 20:45 | 177K | |
| Waylon Jennings - Wr..> | 2026-05-22 20:29 | 332K | |
| Waylon Jennings - Wo..> | 2026-05-22 20:29 | 153K | |
| Waylon Jennings - Wi..> | 2026-05-22 20:29 | 190K | |
| Waylon Jennings - Wh..> | 2026-05-22 20:29 | 190K | |
| Waylon Jennings -The..> | 2026-05-22 20:45 | 35K | |
| Waylon Jennings - Th..> | 2026-05-22 20:29 | 82K | |
| Waylon Jennings - Th..> | 2026-05-22 20:29 | 349K | |
| Waylon Jennings - Sw..> | 2026-05-22 20:28 | 160K | |
| Waylon Jennings - Sh..> | 2026-05-22 20:28 | 153K | |
| Waylon Jennings - Sa..> | 2026-05-22 20:28 | 18K | |
| Waylon Jennings - Ro..> | 2026-05-22 20:28 | 70K | |
| Waylon Jennings - Ro..> | 2026-05-22 20:28 | 128K | |
| Waylon Jennings - Ma..> | 2026-05-22 20:28 | 187K | |
| Waylon Jennings - Lu..> | 2026-05-22 20:28 | 186K | |
| Waylon Jennings - Lu..> | 2026-05-22 20:28 | 191K | |
| Waylon Jennings - Ju..> | 2026-05-22 20:28 | 187K | |
| Waylon Jennings - It..> | 2026-05-22 20:28 | 81K | |
| Waylon Jennings - I ..> | 2026-05-22 20:28 | 220K | |
| Waylon Jennings - I ..> | 2026-05-22 20:28 | 186K | |
| Waylon Jennings - I'..> | 2026-05-22 20:28 | 186K | |
| Waylon Jennings - Hi..> | 2026-05-22 20:28 | 13K | |
| Waylon Jennings - Bo..> | 2026-05-22 20:28 | 105K | |
| Waylon Jennings - Ar..> | 2026-05-22 20:28 | 177K | |
| Waylon Jennings - Am..> | 2026-05-22 20:28 | 186K | |
| Waylon Jennings - Am..> | 2026-05-22 20:28 | 254K | |
| Waylon Jennings, Wil..> | 2026-05-22 20:29 | 64K | |
| Waylon - Wicked Way.jpg | 2026-05-22 20:11 | 72K | |
| Waylon - Wicked Way ..> | 2026-05-22 20:11 | 287K | |
| Wax - Right Between ..> | 2026-05-22 20:02 | 41K | |
| Wax - Bridge To Your..> | 2026-05-22 19:45 | 122K | |
| Waterboys - The Whol..> | 2026-05-22 19:45 | 59K | |
| Waterboys - A Girl C..> | 2026-05-22 20:02 | 63K | |
| Was Not Was - Walk T..> | 2026-05-22 19:45 | 43K | |
| Was (Not Was) - Walk..> | 2026-05-22 20:02 | 62K | |
| Was (Not Was) - Spy ..> | 2026-05-22 19:44 | 62K | |
| Was (Not Was) - Papa..> | 2026-05-22 20:02 | 53K | |
| Warren G. & Nate Dog..> | 2026-05-22 20:11 | 79K | |
| Warm Sounds - Birds ..> | 2026-05-22 20:45 | 77K | |
| Wanted -Walks Like R..> | 2026-05-22 20:11 | 98K | |
| Wang Chung - Everybo..> | 2026-05-22 20:02 | 30K | |
| Wang Chung - Everybo..> | 2026-05-22 19:44 | 87K | |
| Wang Chung - Dance H..> | 2026-05-22 19:44 | 52K | |
| Wanda Jackson - Stup..> | 2026-05-22 20:28 | 42K | |
| Wanda Jackson - Sant..> | 2026-05-22 20:45 | 37K | |
| Wanda Jackson - Righ..> | 2026-05-22 20:28 | 30K | |
| Wanda Jackson - Let'..> | 2026-05-22 20:02 | 44K | |
| Wamdue Project - Kin..> | 2026-05-22 20:02 | 41K | |
| Walter Scott - Liste..> | 2026-05-22 19:36 | 325K | |
| Walter Nita - Ela El..> | 2026-05-22 19:44 | 74K | |
| Walter Murphy - A fi..> | 2026-05-22 19:44 | 86K | |
| Walter Murphy & The ..> | 2026-05-22 19:36 | 136K | |
| Wally Tax - Miss Won..> | 2026-05-22 20:45 | 38K | |
| Wally Tax - Let's Fo..> | 2026-05-22 20:01 | 63K | |
| Wally Tax - Bridges ..> | 2026-05-22 19:36 | 177K | |
| Wallace Collection -..> | 2026-05-22 20:45 | 64K | |
| Walkers - Oh, Loneso..> | 2026-05-22 19:36 | 170K | |
| Walkers - My Darling..> | 2026-05-22 19:36 | 80K | |
| Walker Brothers - Th..> | 2026-05-22 20:45 | 63K | |
| Walker Brothers - Ma..> | 2026-05-22 20:01 | 47K | |
| Walk The Moon - Shu..> | 2026-05-22 20:11 | 25K | |
| Waldo De Los Rios - ..> | 2026-05-22 20:45 | 4.1M | |
| Waldo De Los Rios - ..> | 2026-05-22 19:36 | 40K | |
| Wailers, The - Get U..> | 2026-05-22 19:36 | 272K | |
| Wade Hayes - Wichita..> | 2026-05-22 20:28 | 412K | |
| Wade Hayes - What I ..> | 2026-05-22 20:28 | 149K | |
| Wade Hayes - The Day..> | 2026-05-22 20:28 | 412K | |
| Wade Hayes - On a Go..> | 2026-05-22 20:28 | 330K | |
| Wade Hayes - I'm Sti..> | 2026-05-22 20:28 | 149K | |
| WTF! - Da Bop.jpg | 2026-05-22 20:12 | 4.7K | |
| W&WAXMO - Heaven Is ..> | 2026-05-22 20:11 | 3.8M | |
| Voice Of Holland -On..> | 2026-05-22 20:11 | 85K | |
| Vogues - You're the ..> | 2026-05-22 20:45 | 32K | |
| Voggue - Dancing The..> | 2026-05-22 19:44 | 97K | |
| Vize Feat. Laniia - ..> | 2026-05-22 20:11 | 207K | |
| Vitesse - Rosalyn.jpg | 2026-05-22 19:44 | 38K | |
| Vitesse - Good looki..> | 2026-05-22 19:44 | 85K | |
| Visage - Fade To Gre..> | 2026-05-22 19:44 | 29K | |
| Viola Wills - If You..> | 2026-05-22 19:44 | 60K | |
| Viola Wills - Gonna ..> | 2026-05-22 19:36 | 224K | |
| Viola Wills - Gonna ..> | 2026-05-22 20:01 | 52K | |
| Vince Vance & The Va..> | 2026-05-22 20:45 | 61K | |
| Vince Gill with Reba..> | 2026-05-22 20:45 | 420K | |
| Vince Gill - You and..> | 2026-05-22 20:28 | 602K | |
| Vince Gill - Worlds ..> | 2026-05-22 20:28 | 602K | |
| Vince Gill - Wheneve..> | 2026-05-22 20:28 | 225K | |
| Vince Gill - When I ..> | 2026-05-22 20:28 | 262K | |
| Vince Gill - Tryin' ..> | 2026-05-22 20:28 | 255K | |
| Vince Gill - Take Yo..> | 2026-05-22 20:28 | 305K | |
| Vince Gill - Pocket ..> | 2026-05-22 20:28 | 305K | |
| Vince Gill - One Mor..> | 2026-05-22 20:28 | 255K | |
| Vince Gill - Oklahom..> | 2026-05-22 20:28 | 231K | |
| Vince Gill - No Futu..> | 2026-05-22 20:28 | 201K | |
| Vince Gill - Never K..> | 2026-05-22 20:28 | 255K | |
| Vince Gill - Look At..> | 2026-05-22 20:28 | 255K | |
| Vince Gill - Liza Ja..> | 2026-05-22 20:28 | 184K | |
| Vince Gill - If You ..> | 2026-05-22 20:28 | 22K | |
| Vince Gill - I Still..> | 2026-05-22 20:28 | 262K | |
| Vince Gill - I Can't..> | 2026-05-22 20:28 | 358K | |
| Vince Gill - Go Rest..> | 2026-05-22 20:28 | 133K | |
| Vince Gill - Don't L..> | 2026-05-22 20:28 | 255K | |
| Vince Gill - Cindere..> | 2026-05-22 20:28 | 50K | |
| Vince Gill - Ain’t..> | 2026-05-22 20:28 | 39K | |
| Village People - Y.M..> | 2026-05-22 19:36 | 333K | |
| Village People - Y.M..> | 2026-05-22 20:01 | 44K | |
| Village People - In ..> | 2026-05-22 19:36 | 35K | |
| Village People - Go ..> | 2026-05-22 19:36 | 59K | |
| Viktor Lazlo - Breat..> | 2026-05-22 20:45 | 48K | |
| Viktor Lazlo - Backd..> | 2026-05-22 19:44 | 28K | |
| Vikki Carr - It Must..> | 2026-05-22 20:01 | 35K | |
| Vikki Carr - It Must..> | 2026-05-22 20:45 | 81K | |
| Videokids - Woodpeck..> | 2026-05-22 19:44 | 281K | |
| Vicky Leandros - The..> | 2026-05-22 20:45 | 90K | |
| Vicky Leandros - Je ..> | 2026-05-22 19:36 | 38K | |
| Vicky Leandros - Ich..> | 2026-05-22 19:36 | 85K | |
| Vicky Leandros - Die..> | 2026-05-22 19:36 | 154K | |
| Vicky Leandros - Apr..> | 2026-05-22 19:44 | 103K | |
| Vicky Brown - Warm A..> | 2026-05-22 20:45 | 21K | |
| Vicky Brown - To Me ..> | 2026-05-22 20:45 | 21K | |
| Vicky Brown - Sunflo..> | 2026-05-22 20:45 | 21K | |
| Vicky Brown - Shallo..> | 2026-05-22 20:45 | 34K | |
| Vicky Brown - Once A..> | 2026-05-22 20:45 | 48K | |
| Vicky Brown - Night ..> | 2026-05-22 20:45 | 21K | |
| Vicky Brown - Look F..> | 2026-05-22 20:45 | 49K | |
| Vicky Brown - Lazy A..> | 2026-05-22 20:45 | 34K | |
| Vicky Brown - Lady S..> | 2026-05-22 20:45 | 21K | |
| Vicky Brown - Lady O..> | 2026-05-22 20:45 | 21K | |
| Vicky Brown - Is It ..> | 2026-05-22 20:45 | 21K | |
| Vicky Brown - I Walk..> | 2026-05-22 20:45 | 31K | |
| Vicky Brown - I Reme..> | 2026-05-22 20:45 | 33K | |
| Vicky Brown - I'm Th..> | 2026-05-22 20:45 | 21K | |
| Vicky Brown - I'll A..> | 2026-05-22 20:45 | 34K | |
| Vicky Brown - Going ..> | 2026-05-22 20:45 | 21K | |
| Vicky Brown - Go Lea..> | 2026-05-22 20:45 | 34K | |
| Vicki Sue Robinson -..> | 2026-05-22 19:36 | 275K | |
| Vicki Brown - Season..> | 2026-05-22 20:45 | 21K | |
| Vic Dana - Red Roses..> | 2026-05-22 20:45 | 48K | |
| Vic Dana - Bring a L..> | 2026-05-22 20:45 | 386K | |
| Vic Damone - On the ..> | 2026-05-22 20:45 | 61K | |
| Vic Damone - Again.jpg | 2026-05-22 20:45 | 26K | |
| Vesta Williams - Onc..> | 2026-05-22 19:44 | 60K | |
| Verve - Bitter Sweet..> | 2026-05-22 20:01 | 47K | |
| Veronica Unlimited -..> | 2026-05-22 19:36 | 65K | |
| Veronica Unlimited -..> | 2026-05-22 19:36 | 79K | |
| Vern Gosdin - Who Yo..> | 2026-05-22 20:28 | 16K | |
| Vern Gosdin - That J..> | 2026-05-22 20:28 | 128K | |
| Vern Gosdin - Set'Em..> | 2026-05-22 20:28 | 208K | |
| Vern Gosdin - Right ..> | 2026-05-22 20:28 | 88K | |
| Vern Gosdin - If You..> | 2026-05-22 20:28 | 227K | |
| Vern Gosdin - I Can ..> | 2026-05-22 20:28 | 25K | |
| Vern Gosdin - I'm St..> | 2026-05-22 20:28 | 89K | |
| Vern Gosdin - Do You..> | 2026-05-22 20:28 | 275K | |
| Vern Gosdin - Chisel..> | 2026-05-22 20:28 | 88K | |
| Veracocha - Carte Bl..> | 2026-05-22 20:11 | 38K | |
| Vera Lynn - We'll Me..> | 2026-05-22 20:01 | 52K | |
| Vera Lynn - Land Of ..> | 2026-05-22 20:45 | 33K | |
| Vera Lynn - From The..> | 2026-05-22 20:01 | 57K | |
| Ventures - Walk Don'..> | 2026-05-22 20:11 | 48K | |
| Vengaboys - We Like ..> | 2026-05-22 20:01 | 46K | |
| Vengaboys - We're Go..> | 2026-05-22 20:01 | 28K | |
| Vengaboys - Up & Dow..> | 2026-05-22 20:01 | 46K | |
| Vengaboys - Uncle Jo..> | 2026-05-22 20:11 | 71K | |
| Vengaboys - To Brazi..> | 2026-05-22 20:01 | 46K | |
| Vengaboys - Shalala ..> | 2026-05-22 20:11 | 71K | |
| Vengaboys - Parada d..> | 2026-05-22 20:01 | 46K | |
| Vengaboys - Kiss (Wh..> | 2026-05-22 20:01 | 18K | |
| Vengaboys - Boom Boo..> | 2026-05-22 20:01 | 50K | |
| Vengaboys & Cheekah ..> | 2026-05-22 20:11 | 71K | |
| Venga Boys - Up And ..> | 2026-05-22 20:01 | 40K | |
| Venga Boys - Boom, B..> | 2026-05-22 20:01 | 46K | |
| Vaya Con Dios - What..> | 2026-05-22 19:44 | 44K | |
| Vaya Con Dios - Nah ..> | 2026-05-22 20:01 | 44K | |
| Vaya Con Dios - Head..> | 2026-05-22 20:01 | 96K | |
| Vaughan Brothers - T..> | 2026-05-22 20:01 | 49K | |
| Various artists - Gr..> | 2026-05-22 20:45 | 359K | |
| Various Artists { Mi..> | 2026-05-22 20:01 | 67K | |
| Various Artists - Th..> | 2026-05-22 20:01 | 93K | |
| Various Artists -Per..> | 2026-05-22 20:45 | 40K | |
| Vanvelzen - Baby Get..> | 2026-05-22 20:11 | 89K | |
| Vanity Fare - Early ..> | 2026-05-22 20:45 | 55K | |
| Vanity 6 - Nasty Gir..> | 2026-05-22 19:44 | 29K | |
| Vanilla Ice - Play T..> | 2026-05-22 20:01 | 39K | |
| Vanilla Ice - Ice Ic..> | 2026-05-22 20:01 | 65K | |
| Vanilla Fudge - You ..> | 2026-05-22 20:45 | 130K | |
| Vangelis - West Acro..> | 2026-05-22 20:45 | 25K | |
| Vangelis - Twenty Ei..> | 2026-05-22 20:45 | 25K | |
| Vangelis - To The Un..> | 2026-05-22 20:45 | 52K | |
| Vangelis - To The Un..> | 2026-05-22 19:36 | 72K | |
| Vangelis - Sunlight.jpg | 2026-05-22 20:45 | 9.2K | |
| Vangelis - Starstuff..> | 2026-05-22 20:45 | 9.2K | |
| Vangelis - Rosetta.jpg | 2026-05-22 20:45 | 9.2K | |
| Vangelis - Return to..> | 2026-05-22 20:45 | 9.2K | |
| Vangelis - Pinta, Ni..> | 2026-05-22 20:45 | 25K | |
| Vangelis - Philae’..> | 2026-05-22 20:45 | 9.2K | |
| Vangelis - Perihelio..> | 2026-05-22 20:45 | 9.2K | |
| Vangelis - Origins (..> | 2026-05-22 20:45 | 9.2K | |
| Vangelis - Opening.jpg | 2026-05-22 20:45 | 25K | |
| Vangelis - Moxica An..> | 2026-05-22 20:45 | 25K | |
| Vangelis - Monastery..> | 2026-05-22 20:45 | 25K | |
| Vangelis - Mission A..> | 2026-05-22 20:45 | 9.2K | |
| Vangelis - Light And..> | 2026-05-22 20:45 | 25K | |
| Vangelis - Infinitud..> | 2026-05-22 20:45 | 9.2K | |
| Vangelis - Hispanola..> | 2026-05-22 20:45 | 25K | |
| Vangelis - Exo Genes..> | 2026-05-22 20:45 | 9.2K | |
| Vangelis - Eternity.jpg | 2026-05-22 20:45 | 25K | |
| Vangelis - Elegy.jpg | 2026-05-22 20:45 | 9.2K | |
| Vangelis - Deliveran..> | 2026-05-22 20:45 | 25K | |
| Vangelis - Conquest ..> | 2026-05-22 20:45 | 36K | |
| Vangelis - City Of I..> | 2026-05-22 20:45 | 25K | |
| Vangelis - Chariots ..> | 2026-05-22 19:44 | 23K | |
| Vangelis - Celestial..> | 2026-05-22 20:45 | 9.2K | |
| Vangelis - Albedo 0...> | 2026-05-22 20:45 | 9.2K | |
| Vanessa Williams - S..> | 2026-05-22 20:45 | 19K | |
| Vanessa Paradis - Jo..> | 2026-05-22 19:44 | 28K | |
| Vanessa Paradis - Be..> | 2026-05-22 20:01 | 39K | |
| Vanessa Carlton - A ..> | 2026-05-22 20:45 | 73K | |
| Vanessa - Upside Dow..> | 2026-05-22 19:44 | 53K | |
| Vanessa - Dynamite.jpg | 2026-05-22 19:44 | 53K | |
| Vanessa - Cheerio.jpg | 2026-05-22 19:44 | 36K | |
| Vanessa & David McWi..> | 2026-05-22 20:01 | 67K | |
| Vandenberg - Burning..> | 2026-05-22 19:44 | 25K | |
| Vance Joy - Riptide.jpg | 2026-05-22 20:11 | 252K | |
| Van Velzen -When Sum..> | 2026-05-22 20:45 | 15K | |
| Van Morrison - Have ..> | 2026-05-22 20:45 | 19K | |
| Van Morrison - Brown..> | 2026-05-22 20:45 | 63K | |
| Van Morrison - Brigh..> | 2026-05-22 20:01 | 24K | |
| Van Morrison & Linda..> | 2026-05-22 20:28 | 117K | |
| Van Morrison & John ..> | 2026-05-22 20:01 | 43K | |
| Van Mccoy - Soul Cha..> | 2026-05-22 19:36 | 188K | |
| Van McCoy - The Hust..> | 2026-05-22 19:36 | 74K | |
| Van Halen - You Real..> | 2026-05-22 19:36 | 354K | |
| Van Halen - Why Can'..> | 2026-05-22 19:44 | 29K | |
| Van Halen - Why Can..> | 2026-05-22 20:01 | 53K | |
| Van Halen - Running ..> | 2026-05-22 19:36 | 24K | |
| Van Halen - Runnin' ..> | 2026-05-22 19:44 | 24K | |
| Van Halen - Jump.jpg | 2026-05-22 19:44 | 29K | |
| Van Halen - (Oh) Pre..> | 2026-05-22 19:44 | 434K | |
| Valensia - Gaia.jpg | 2026-05-22 20:45 | 73K | |
| VINAI - Rise Up (fea..> | 2026-05-22 20:11 | 162K | |
| V.O.F. De Kunst - Su..> | 2026-05-22 19:44 | 87K | |
| Usura - Open Your Mi..> | 2026-05-22 20:01 | 16K | |
| Usher Ft. Pitbull - ..> | 2026-05-22 20:11 | 49K | |
| Us3 - Cantaloop (Fli..> | 2026-05-22 20:11 | 50K | |
| Uriah Heep - Easy Li..> | 2026-05-22 20:45 | 14K | |
| Uriah Heep - Easy Li..> | 2026-05-22 19:36 | 33K | |
| Urban Cookie Collect..> | 2026-05-22 20:01 | 48K | |
| Underworld - Born Sl..> | 2026-05-22 20:11 | 34K | |
| Underdog Project Vs...> | 2026-05-22 20:11 | 95K | |
| Undercover - Never L..> | 2026-05-22 20:01 | 47K | |
| Undercover - Baker S..> | 2026-05-22 20:01 | 47K | |
| Umberto Tozzi - Ti A..> | 2026-05-22 20:45 | 34K | |
| Umberto Tozzi - Glor..> | 2026-05-22 19:36 | 438K | |
| Ultravox - Vienna.jpg | 2026-05-22 19:44 | 63K | |
| Ultravox - Dancing W..> | 2026-05-22 19:44 | 9.9K | |
| Ultra Nate - Free.jpg | 2026-05-22 20:11 | 20K | |
| Ultimate Kaos - Casa..> | 2026-05-22 20:01 | 133K | |
| Ulli Martin - Monika..> | 2026-05-22 19:36 | 162K | |
| Uk - Rendezvous 6.02..> | 2026-05-22 19:36 | 363K | |
| Ugly Kid Joe - Cats ..> | 2026-05-22 20:01 | 69K | |
| Udo Jürgens - Zeig ..> | 2026-05-22 20:45 | 38K | |
| Udo Jürgens - Griec..> | 2026-05-22 19:36 | 142K | |
| Ub40 - Where Did I G..> | 2026-05-22 19:44 | 30K | |
| Ub40 - Sing Our Own ..> | 2026-05-22 19:44 | 21K | |
| Ub40 - Red Red Wine.jpg | 2026-05-22 20:01 | 35K | |
| Ub40 - Reckless (Fea..> | 2026-05-22 20:11 | 80K | |
| Ub40 - Rat In Mi Kit..> | 2026-05-22 19:44 | 43K | |
| Ub40 - Please Don't ..> | 2026-05-22 19:44 | 35K | |
| Ub40 - Kingston Town..> | 2026-05-22 20:01 | 13K | |
| Ub40 - If It Happens..> | 2026-05-22 19:44 | 35K | |
| Ub40 - Homely Girl.jpg | 2026-05-22 19:44 | 72K | |
| Ub40 - Food For Thou..> | 2026-05-22 19:44 | 45K | |
| Ub40 - Cherry Oh Bab..> | 2026-05-22 19:44 | 35K | |
| Ub40 - Can't Help Fa..> | 2026-05-22 20:01 | 16K | |
| Ub40 - (I Can't Help..> | 2026-05-22 20:11 | 91K | |
| Ub40 & Chrissie Hynd..> | 2026-05-22 19:44 | 59K | |
| Ub40 & Chrissie Hynd..> | 2026-05-22 19:44 | 30K | |
| USA For Africa - We ..> | 2026-05-22 19:44 | 41K | |
| UB40 -Red Red Wine.jpg | 2026-05-22 19:44 | 35K | |
| UB40 - Rat In Mi Kit..> | 2026-05-22 20:11 | 69K | |
| UB40 - Maybe Tomorro..> | 2026-05-22 19:44 | 307K | |
| UB40 - Here I Am (Co..> | 2026-05-22 20:01 | 91K | |
| UB40 - Don't Break M..> | 2026-05-22 19:44 | 59K | |
| U96 - Das Boot.jpg | 2026-05-22 20:01 | 64K | |
| U2 - With Or Without..> | 2026-05-22 19:44 | 26K | |
| U2 - Who's Gonna Rid..> | 2026-05-22 20:01 | 99K | |
| U2 - Where The Stree..> | 2026-05-22 20:01 | 41K | |
| U2 - The Unforgettab..> | 2026-05-22 20:01 | 59K | |
| U2 - The Sweetest Th..> | 2026-05-22 20:01 | 58K | |
| U2 - Sunday Bloody S..> | 2026-05-22 19:44 | 69K | |
| U2 - Pride (In The N..> | 2026-05-22 19:44 | 69K | |
| U2 - Ordinary Love.jpg | 2026-05-22 20:11 | 91K | |
| U2 - One.jpg | 2026-05-22 20:01 | 99K | |
| U2 - New Year's Day.jpg | 2026-05-22 20:01 | 41K | |
| U2 - New Year's Day ..> | 2026-05-22 19:44 | 69K | |
| U2 - Mysterious Ways..> | 2026-05-22 20:01 | 99K | |
| U2 - I Will Follow (..> | 2026-05-22 19:44 | 32K | |
| U2 - I Still Haven't..> | 2026-05-22 19:44 | 26K | |
| U2 - Desire.jpg | 2026-05-22 19:44 | 103K | |
| U2 - Beautiful Day.jpg | 2026-05-22 20:11 | 35K | |
| U2 - Bad.jpg | 2026-05-22 20:01 | 37K | |
| U2 - Angel Of Harlem..> | 2026-05-22 20:01 | 16K | |
| U2 & Bb King - When ..> | 2026-05-22 19:44 | 44K | |
| Typically Tropical -..> | 2026-05-22 19:36 | 165K | |
| Tyler England - Shou..> | 2026-05-22 20:28 | 344K | |
| Ty Herndon - What Ma..> | 2026-05-22 20:28 | 225K | |
| Ty Herndon - Loved T..> | 2026-05-22 20:28 | 119K | |
| Ty Herndon - Living ..> | 2026-05-22 20:28 | 137K | |
| Ty Herndon - It Must..> | 2026-05-22 20:28 | 3.3M | |
| Ty Herndon - Hands O..> | 2026-05-22 20:28 | 221K | |
| Ty Herndon - A Man H..> | 2026-05-22 20:28 | 221K | |
| Twocolors - Lovefool..> | 2026-05-22 20:11 | 287K | |
| Two Man Sound - Disc..> | 2026-05-22 19:44 | 35K | |
| Two Man Sound - Copa..> | 2026-05-22 19:36 | 36K | |
| Twice As Much - True..> | 2026-05-22 20:45 | 688K | |
| Twice As Much - Sitt..> | 2026-05-22 20:45 | 19K | |
| Twenty 4 Seven - Sla..> | 2026-05-22 20:01 | 63K | |
| Twarres - Wêr Bisto..> | 2026-05-22 20:45 | 58K | |
| Tumbleweeds - Sweet ..> | 2026-05-22 19:36 | 286K | |
| Tumbleweeds - Somewh..> | 2026-05-22 20:28 | 311K | |
| Tumbleweeds - It Mig..> | 2026-05-22 19:36 | 286K | |
| Tumbleweeds - Bobby ..> | 2026-05-22 20:28 | 42K | |
| Tubeway Army - Are F..> | 2026-05-22 20:01 | 58K | |
| Tubeway Army - Are '..> | 2026-05-22 19:36 | 257K | |
| Troye Sivan feat. Pi..> | 2026-05-22 20:11 | 156K | |
| Troggs - With A Girl..> | 2026-05-22 20:45 | 92K | |
| Troggs - Wild thing.jpg | 2026-05-22 20:45 | 27K | |
| Troggs - Love is all..> | 2026-05-22 20:45 | 47K | |
| Trisha Yearwood duet..> | 2026-05-22 20:45 | 12K | |
| Trisha Yearwood - XX..> | 2026-05-22 20:45 | 34K | |
| Trisha Yearwood - Wa..> | 2026-05-22 20:45 | 32K | |
| Trisha Yearwood - To..> | 2026-05-22 20:28 | 58K | |
| Trisha Yearwood - Th..> | 2026-05-22 20:45 | 34K | |
| Trisha Yearwood - Th..> | 2026-05-22 20:45 | 495K | |
| Trisha Yearwood - Th..> | 2026-05-22 20:45 | 34K | |
| Trisha Yearwood - Th..> | 2026-05-22 20:45 | 34K | |
| Trisha Yearwood - Th..> | 2026-05-22 20:45 | 34K | |
| Trisha Yearwood - Th..> | 2026-05-22 20:28 | 178K | |
| Trisha Yearwood - Th..> | 2026-05-22 20:45 | 178K | |
| Trisha Yearwood - Sh..> | 2026-05-22 20:45 | 32K | |
| Trisha Yearwood - Po..> | 2026-05-22 20:45 | 36K | |
| Trisha Yearwood - Pe..> | 2026-05-22 20:45 | 28K | |
| Trisha Yearwood - Li..> | 2026-05-22 20:45 | 34K | |
| Trisha Yearwood - I..> | 2026-05-22 20:45 | 36K | |
| Trisha Yearwood - Ho..> | 2026-05-22 20:28 | 176K | |
| Trisha Yearwood - He..> | 2026-05-22 20:28 | 35K | |
| Trisha Yearwood - Ev..> | 2026-05-22 20:45 | 304K | |
| Trisha Yearwood - Do..> | 2026-05-22 20:45 | 34K | |
| Trisha Yearwood - Be..> | 2026-05-22 20:45 | 34K | |
| Trisha Yearwood - (Y..> | 2026-05-22 20:28 | 152K | |
| Trisha Yearwood & Ga..> | 2026-05-22 20:45 | 36K | |
| Trisha Yearwood & Aa..> | 2026-05-22 20:45 | 39K | |
| Trio Hellenique - La..> | 2026-05-22 20:45 | 94K | |
| Trio Hellenique - El..> | 2026-05-22 20:45 | 21K | |
| Trio - Da da da I do..> | 2026-05-22 19:44 | 14K | |
| Trinix - Sweet Dream..> | 2026-05-22 20:11 | 26K | |
| Trinity - 002 345 70..> | 2026-05-22 19:44 | 257K | |
| Trinity - 002.345.70..> | 2026-05-22 19:36 | 52K | |
| Trini Triggs - Horse..> | 2026-05-22 20:28 | 325K | |
| Trini Lopez - This L..> | 2026-05-22 20:45 | 84K | |
| Trini Lopez - Lemon ..> | 2026-05-22 20:45 | 50K | |
| Trini Lopez - La Bam..> | 2026-05-22 20:45 | 42K | |
| Trini Lopez - If I H..> | 2026-05-22 19:44 | 209K | |
| Trini Lopez - Americ..> | 2026-05-22 20:01 | 84K | |
| Trine Triggs - Strai..> | 2026-05-22 20:28 | 16K | |
| Trijntje Oosterhuis ..> | 2026-05-22 20:11 | 30K | |
| Trijntje Oosterhuis ..> | 2026-05-22 20:11 | 38K | |
| Triggerfinger - I Fo..> | 2026-05-22 20:45 | 256K | |
| Tremeloes - Silence ..> | 2026-05-22 20:45 | 29K | |
| Tremeloes - My littl..> | 2026-05-22 20:45 | 47K | |
| Tremeloes - Here com..> | 2026-05-22 20:45 | 323K | |
| Tremeloes - Even the..> | 2026-05-22 20:45 | 20K | |
| Trea Dobbs - You’v..> | 2026-05-22 20:45 | 137K | |
| Travis Tritt - Where..> | 2026-05-22 20:28 | 266K | |
| Travis Tritt - Tell ..> | 2026-05-22 20:28 | 166K | |
| Travis Tritt - Take ..> | 2026-05-22 20:28 | 266K | |
| Travis Tritt - T-R-O..> | 2026-05-22 20:28 | 233K | |
| Travis Tritt - Nothi..> | 2026-05-22 20:28 | 197K | |
| Travis Tritt - More ..> | 2026-05-22 20:28 | 134K | |
| Travis Tritt - Lord ..> | 2026-05-22 20:28 | 173K | |
| Travis Tritt - I'm G..> | 2026-05-22 20:28 | 266K | |
| Travis Tritt - Here'..> | 2026-05-22 20:28 | 233K | |
| Travis Tritt - Help ..> | 2026-05-22 20:28 | 233K | |
| Travis Tritt - Fooli..> | 2026-05-22 20:28 | 233K | |
| Travis Tritt - Drift..> | 2026-05-22 20:28 | 275K | |
| Travis Tritt - Can I..> | 2026-05-22 20:28 | 164K | |
| Travis Tritt - Anymo..> | 2026-05-22 20:28 | 197K | |
| Travie Mccoy Ft. Bru..> | 2026-05-22 20:11 | 68K | |
| Travelling Willbury'..> | 2026-05-22 19:44 | 61K | |
| Transition 4.jpg | 2026-05-22 19:29 | 3.1K | |
| Transition 3.jpg | 2026-05-22 19:29 | 3.1K | |
| Transition 2.jpg | 2026-05-22 19:29 | 3.1K | |
| Transition 1.jpg | 2026-05-22 19:29 | 3.1K | |
| Trans X - Living On ..> | 2026-05-22 19:44 | 42K | |
| Trammps - New York C..> | 2026-05-22 19:36 | 58K | |
| Trammps - Hold Back ..> | 2026-05-22 19:36 | 54K | |
| Trammps - (The Night..> | 2026-05-22 19:36 | 75K | |
| Train - Hey Soul Sis..> | 2026-05-22 20:45 | 79K | |
| Train - Drops Of Jup..> | 2026-05-22 20:45 | 17K | |
| Train - Drive By.jpg | 2026-05-22 20:11 | 53K | |
| Train - Angel In Blu..> | 2026-05-22 20:11 | 47K | |
| Train - 50 Ways To S..> | 2026-05-22 20:11 | 53K | |
| Tracy Ullman - Break..> | 2026-05-22 19:44 | 238K | |
| Tracy Lawrence - Tod..> | 2026-05-22 20:28 | 122K | |
| Tracy Lawrence - Tim..> | 2026-05-22 20:28 | 214K | |
| Tracy Lawrence - Tex..> | 2026-05-22 20:28 | 302K | |
| Tracy Lawrence - Sti..> | 2026-05-22 20:28 | 122K | |
| Tracy Lawrence - Sta..> | 2026-05-22 20:28 | 214K | |
| Tracy Lawrence - Som..> | 2026-05-22 20:28 | 122K | |
| Tracy Lawrence - Run..> | 2026-05-22 20:28 | 122K | |
| Tracy Lawrence - Ren..> | 2026-05-22 20:28 | 125K | |
| Tracy Lawrence - My ..> | 2026-05-22 20:28 | 165K | |
| Tracy Lawrence - Is ..> | 2026-05-22 20:28 | 214K | |
| Tracy Lawrence - If ..> | 2026-05-22 20:28 | 174K | |
| Tracy Lawrence - I S..> | 2026-05-22 20:28 | 174K | |
| Tracy Lawrence - How..> | 2026-05-22 20:28 | 195K | |
| Tracy Lawrence - Can..> | 2026-05-22 20:28 | 165K | |
| Tracy Lawrence - Bet..> | 2026-05-22 20:28 | 195K | |
| Tracy Lawrence - As ..> | 2026-05-22 20:28 | 174K | |
| Tracy Lawrence - Ali..> | 2026-05-22 20:28 | 165K | |
| Tracy Chapman - Fast..> | 2026-05-22 19:44 | 129K | |
| Tracy Chapman - Baby..> | 2026-05-22 19:44 | 46K | |
| Tracy Byrd - Waterme..> | 2026-05-22 20:28 | 206K | |
| Tracy Byrd - Love Le..> | 2026-05-22 20:28 | 282K | |
| Tracy Byrd - Lifesty..> | 2026-05-22 20:28 | 206K | |
| Tracy Byrd - Keeper ..> | 2026-05-22 20:28 | 282K | |
| Tracy Byrd - I Wanna..> | 2026-05-22 20:28 | 120K | |
| Tracy Byrd - I'm Fro..> | 2026-05-22 20:28 | 282K | |
| Tracy Byrd - Holdin'..> | 2026-05-22 20:28 | 163K | |
| Tracy Byrd - Heaven ..> | 2026-05-22 20:28 | 166K | |
| Tracy Byrd - Don't T..> | 2026-05-22 20:28 | 319K | |
| Tracy Byrd - Don't L..> | 2026-05-22 20:28 | 99K | |
| Tracy Byrd - Big Lov..> | 2026-05-22 20:28 | 282K | |
| Tracey Ullman - They..> | 2026-05-22 19:44 | 38K | |
| Tracey Ullman - Sung..> | 2026-05-22 19:44 | 26K | |
| Tracey Ullman - My G..> | 2026-05-22 19:44 | 38K | |
| Tracey Ullman - Move..> | 2026-05-22 19:44 | 38K | |
| Trace Adkins - The R..> | 2026-05-22 20:28 | 84K | |
| Trace Adkins - I Lef..> | 2026-05-22 20:28 | 178K | |
| Trace Adkins - Every..> | 2026-05-22 20:28 | 178K | |
| Trace Adkins - (This..> | 2026-05-22 20:28 | 163K | |
| Tozzi & Raf - Gente ..> | 2026-05-22 19:44 | 72K | |
| Toybox - Tarzan & Ja..> | 2026-05-22 20:01 | 78K | |
| Toy Boy - Careless W..> | 2026-05-22 20:01 | 75K | |
| Toy Box - Best Frien..> | 2026-05-22 20:01 | 78K | |
| Toy-Box -The Sailor ..> | 2026-05-22 20:11 | 83K | |
| Tower Of Power - Sou..> | 2026-05-22 20:11 | 58K | |
| Tower - See you toni..> | 2026-05-22 19:44 | 50K | |
| Toto Cutugno - L'ita..> | 2026-05-22 19:44 | 39K | |
| Toto Cutugno - Insie..> | 2026-05-22 20:01 | 34K | |
| Toto - Stop Loving Y..> | 2026-05-22 20:45 | 30K | |
| Toto - Rosanna.jpg | 2026-05-22 19:44 | 120K | |
| Toto - Pamela.jpg | 2026-05-22 19:44 | 22K | |
| Toto - Mushanga.jpg | 2026-05-22 20:45 | 39K | |
| Toto - Ill Be Over Y..> | 2026-05-22 20:45 | 39K | |
| Toto - I'll Supply T..> | 2026-05-22 20:01 | 47K | |
| Toto - Hold The Line..> | 2026-05-22 19:36 | 25K | |
| Toto - Georgy Porgy.jpg | 2026-05-22 19:36 | 229K | |
| Toto - Don't Chain M..> | 2026-05-22 20:01 | 50K | |
| Toto - Africa.jpg | 2026-05-22 19:44 | 22K | |
| Toto - 99.jpg | 2026-05-22 19:36 | 136K | |
| Toto - '99.jpg | 2026-05-22 20:01 | 30K | |
| Total Touch - Touch ..> | 2026-05-22 20:01 | 32K | |
| Total Touch - Somebo..> | 2026-05-22 20:01 | 32K | |
| Total Touch - Love M..> | 2026-05-22 20:01 | 55K | |
| Total Touch - I'll S..> | 2026-05-22 20:01 | 55K | |
| Tornados - Telstar.jpg | 2026-05-22 20:01 | 43K | |
| Torero's - As tears ..> | 2026-05-22 20:45 | 110K | |
| Toploader - Dancing ..> | 2026-05-22 20:11 | 48K | |
| Toon Hermans - 24 Ro..> | 2026-05-22 20:45 | 28K | |
| Tony y los santos - ..> | 2026-05-22 19:36 | 152K | |
| Tony Sherman - I Wro..> | 2026-05-22 19:36 | 400K | |
| Tony Scott - Love Do..> | 2026-05-22 20:45 | 281K | |
| Tony Scott - Get Int..> | 2026-05-22 20:01 | 51K | |
| Tony Orlando & Dawn ..> | 2026-05-22 19:36 | 379K | |
| Tony Orlando & Dawn ..> | 2026-05-22 19:36 | 88K | |
| Tony Marshall - Sch..> | 2026-05-22 20:01 | 41K | |
| Tony Joe White - Gro..> | 2026-05-22 20:28 | 46K | |
| Tony Esposito - Papa..> | 2026-05-22 19:44 | 44K | |
| Tony Esposito - Kali..> | 2026-05-22 19:44 | 34K | |
| Tony Christie Feat. ..> | 2026-05-22 20:01 | 28K | |
| Tony Christie - I Di..> | 2026-05-22 19:36 | 168K | |
| Tony Christie - (Is ..> | 2026-05-22 19:36 | 108K | |
| Tony Bennett - The S..> | 2026-05-22 20:45 | 131K | |
| Tony Bennett - Chica..> | 2026-05-22 20:45 | 96K | |
| Tony Bennet - I Left..> | 2026-05-22 20:45 | 261K | |
| Tony Bass - Gina Lol..> | 2026-05-22 20:45 | 120K | |
| Toni Braxton - You'r..> | 2026-05-22 20:11 | 24K | |
| Toni Braxton - Un-Br..> | 2026-05-22 20:45 | 40K | |
| Toni Braxton -Spanis..> | 2026-05-22 20:45 | 48K | |
| Toni Braxton - He Wa..> | 2026-05-22 20:11 | 20K | |
| Toni Braxton - Breat..> | 2026-05-22 20:01 | 62K | |
| Tone Loc - Wild Thin..> | 2026-05-22 19:44 | 73K | |
| Tommy Roe - Sheila.jpg | 2026-05-22 20:45 | 146K | |
| Tommy Roe - Dizzy.jpg | 2026-05-22 20:45 | 64K | |
| Tommy Mooney - Bingo..> | 2026-05-22 20:28 | 77K | |
| Tommy James & the Sh..> | 2026-05-22 20:45 | 108K | |
| Tommy James & the Sh..> | 2026-05-22 20:45 | 123K | |
| Tommy James & The Sh..> | 2026-05-22 20:45 | 195K | |
| Tommy Cash - Six Whi..> | 2026-05-22 20:28 | 202K | |
| Tommy Cash - Devil W..> | 2026-05-22 20:28 | 27K | |
| Tommy Cash - Coward ..> | 2026-05-22 20:28 | 244K | |
| Tom Tom Club - Wordy..> | 2026-05-22 19:44 | 223K | |
| Tom Tom Club - Under..> | 2026-05-22 19:44 | 39K | |
| Tom T. Hall - The Ye..> | 2026-05-22 20:28 | 255K | |
| Tom T. Hall - P.S. I..> | 2026-05-22 20:28 | 255K | |
| Tom T. Hall - I Love..> | 2026-05-22 20:28 | 255K | |
| Tom T. Hall - Ballad..> | 2026-05-22 20:28 | 255K | |
| Tom Santa - Rainfall..> | 2026-05-22 20:11 | 202K | |
| Tom RobinsonSteve La..> | 2026-05-22 19:44 | 34K | |
| Tom Robinson - Liste..> | 2026-05-22 20:45 | 22K | |
| Tom Petty And The He..> | 2026-05-22 20:11 | 48K | |
| Tom Petty - Mary Jan..> | 2026-05-22 20:11 | 59K | |
| Tom Petty - Learning..> | 2026-05-22 20:01 | 53K | |
| Tom Petty - Into The..> | 2026-05-22 20:01 | 53K | |
| Tom Petty - Free Fal..> | 2026-05-22 20:45 | 33K | |
| Tom Petty & The Hear..> | 2026-05-22 20:01 | 54K | |
| Tom OdellTiësto - A..> | 2026-05-22 20:11 | 20K | |
| Tom Odell -Another L..> | 2026-05-22 20:45 | 44K | |
| Tom Jones - What's n..> | 2026-05-22 20:45 | 42K | |
| Tom Jones - She's A ..> | 2026-05-22 20:45 | 48K | |
| Tom Jones - Love Me ..> | 2026-05-22 20:11 | 39K | |
| Tom Jones - It's Not..> | 2026-05-22 20:45 | 76K | |
| Tom Jones - I'm Comi..> | 2026-05-22 19:36 | 94K | |
| Tom Jones - I'll nev..> | 2026-05-22 20:45 | 40K | |
| Tom Jones - Help You..> | 2026-05-22 20:45 | 34K | |
| Tom Jones - Green Gr..> | 2026-05-22 20:45 | 650K | |
| Tom Jones - Green, G..> | 2026-05-22 20:45 | 54K | |
| Tom Jones - Funny Fa..> | 2026-05-22 20:45 | 129K | |
| Tom Jones - Detroit ..> | 2026-05-22 20:45 | 39K | |
| Tom Jones - Delilah.jpg | 2026-05-22 20:45 | 39K | |
| Tom Jones & Stereoph..> | 2026-05-22 20:11 | 46K | |
| Tom Jones & Mousse T..> | 2026-05-22 20:11 | 55K | |
| Tom Cochrane - Life ..> | 2026-05-22 20:01 | 49K | |
| Tom Browne - Funkin ..> | 2026-05-22 20:01 | 96K | |
| Tom Browne - Funkin'..> | 2026-05-22 19:44 | 44K | |
| Tom & Dick - Bloody ..> | 2026-05-22 20:45 | 68K | |
| Tol & Tol - Sedalia.jpg | 2026-05-22 20:01 | 16K | |
| Tol & Tol - Eleni.jpg | 2026-05-22 19:44 | 14K | |
| Tokens - The Lion Sl..> | 2026-05-22 20:45 | 232K | |
| Todd Rundgren - I Sa..> | 2026-05-22 19:36 | 304K | |
| Todays Best Music.jpg | 2026-05-22 19:29 | 3.1K | |
| Toby Keith - You Ain..> | 2026-05-22 20:28 | 262K | |
| Toby Keith - Wish I ..> | 2026-05-22 20:28 | 262K | |
| Toby Keith - Who's T..> | 2026-05-22 20:28 | 522K | |
| Toby Keith - We Were..> | 2026-05-22 20:28 | 262K | |
| Toby Keith - Should'..> | 2026-05-22 20:28 | 262K | |
| Toby Keith - Me Too.jpg | 2026-05-22 20:28 | 262K | |
| Toby Keith - I'm So ..> | 2026-05-22 20:28 | 383K | |
| Toby Keith - He Ain'..> | 2026-05-22 20:28 | 262K | |
| Toby Keith - Getcha ..> | 2026-05-22 20:28 | 262K | |
| Toby Keith - Dream W..> | 2026-05-22 20:28 | 262K | |
| Toby Keith - Does Th..> | 2026-05-22 20:28 | 262K | |
| Toby Keith - A Littl..> | 2026-05-22 20:28 | 275K | |
| Tlc - Waterfalls.jpg | 2026-05-22 20:01 | 47K | |
| Tlc - Unpretty.jpg | 2026-05-22 20:01 | 20K | |
| Tlc - No Scrubs.jpg | 2026-05-22 20:01 | 244K | |
| Tiziano Ferro - Perd..> | 2026-05-22 20:11 | 41K | |
| Titiyo - Come Along.jpg | 2026-05-22 20:11 | 36K | |
| Tippa Irie - Hello D..> | 2026-05-22 19:44 | 39K | |
| Tina Turner - When T..> | 2026-05-22 20:11 | 14K | |
| Tina Turner - Whats ..> | 2026-05-22 19:44 | 60K | |
| Tina Turner - What's..> | 2026-05-22 20:01 | 36K | |
| Tina Turner - We Don..> | 2026-05-22 19:44 | 60K | |
| Tina Turner - Typica..> | 2026-05-22 19:44 | 53K | |
| Tina Turner - Two Pe..> | 2026-05-22 19:44 | 53K | |
| Tina Turner - The Be..> | 2026-05-22 19:44 | 55K | |
| Tina Turner - Steamy..> | 2026-05-22 19:44 | 60K | |
| Tina Turner - Privat..> | 2026-05-22 19:44 | 55K | |
| Tina Turner - Nutbus..> | 2026-05-22 20:01 | 48K | |
| Tina Turner - Let's ..> | 2026-05-22 19:44 | 80K | |
| Tina Turner - I Don'..> | 2026-05-22 20:01 | 60K | |
| Tina Turner - I Don'..> | 2026-05-22 20:01 | 37K | |
| Tina Turner - Golden..> | 2026-05-22 20:01 | 45K | |
| Tina Turner - Disco ..> | 2026-05-22 20:01 | 46K | |
| Tina Turner & Rod St..> | 2026-05-22 20:01 | 85K | |
| Tina Turner & Robert..> | 2026-05-22 19:44 | 55K | |
| Tina Turner & David ..> | 2026-05-22 19:44 | 58K | |
| Tina Charles - I Lov..> | 2026-05-22 19:36 | 359K | |
| Tina Charles - Dance..> | 2026-05-22 19:44 | 44K | |
| Tina Arena & Marc An..> | 2026-05-22 20:45 | 39K | |
| Timon & Pumbaa - Sta..> | 2026-05-22 20:01 | 46K | |
| Timmy Thomas - Why C..> | 2026-05-22 19:36 | 227K | |
| Timmy Thomas - Why C..> | 2026-05-22 20:45 | 68K | |
| Timmy T - One more t..> | 2026-05-22 20:45 | 20K | |
| Timi Yuro - You Are ..> | 2026-05-22 20:45 | 55K | |
| Timi Yuro - Hurt.jpg | 2026-05-22 20:45 | 45K | |
| Timi Yuro - Hurt (19..> | 2026-05-22 19:44 | 38K | |
| Timi Yuro - Crazy.jpg | 2026-05-22 20:28 | 36K | |
| Timi Yuro - All Alon..> | 2026-05-22 19:44 | 88K | |
| Timex Social Club - ..> | 2026-05-22 19:44 | 51K | |
| Time Bandits - Live ..> | 2026-05-22 19:44 | 94K | |
| Time Bandits - Liste..> | 2026-05-22 20:45 | 40K | |
| Time Bandits - I'm S..> | 2026-05-22 20:45 | 40K | |
| Timbaland & Onerepub..> | 2026-05-22 20:11 | 57K | |
| Tim McGraw - Where T..> | 2026-05-22 20:28 | 146K | |
| Tim McGraw - Somethi..> | 2026-05-22 20:28 | 251K | |
| Tim McGraw - She Nev..> | 2026-05-22 20:28 | 162K | |
| Tim McGraw - Refried..> | 2026-05-22 20:28 | 277K | |
| Tim McGraw - Please ..> | 2026-05-22 20:28 | 146K | |
| Tim McGraw - One Of ..> | 2026-05-22 20:28 | 229K | |
| Tim McGraw - Not A M..> | 2026-05-22 20:28 | 146K | |
| Tim McGraw - My Best..> | 2026-05-22 20:28 | 96K | |
| Tim McGraw - Maybe W..> | 2026-05-22 20:28 | 162K | |
| Tim McGraw - Just To..> | 2026-05-22 20:28 | 96K | |
| Tim McGraw - It's Yo..> | 2026-05-22 20:28 | 96K | |
| Tim McGraw - Indian ..> | 2026-05-22 20:28 | 146K | |
| Tim McGraw - I Like ..> | 2026-05-22 20:28 | 162K | |
| Tim McGraw - For A L..> | 2026-05-22 20:28 | 229K | |
| Tim McGraw - Everywh..> | 2026-05-22 20:28 | 146K | |
| Tim McGraw - Down On..> | 2026-05-22 20:28 | 277K | |
| Tim McGraw - Don't T..> | 2026-05-22 20:28 | 251K | |
| Tim McGraw - Can't B..> | 2026-05-22 20:28 | 162K | |
| Tim Hardin - Simple ..> | 2026-05-22 20:45 | 27K | |
| Tim Hardin - How Can..> | 2026-05-22 20:45 | 70K | |
| Tim Finn - Fraction ..> | 2026-05-22 20:45 | 172K | |
| Tim Dawn - To Love S..> | 2026-05-22 20:11 | 143K | |
| Tim Berg -Bromance.jpg | 2026-05-22 20:11 | 51K | |
| Tight Fit - The Lion..> | 2026-05-22 19:44 | 49K | |
| Tiga & Zyntherius - ..> | 2026-05-22 20:11 | 68K | |
| Tiga & Zyntherius -S..> | 2026-05-22 20:11 | 68K | |
| Tiffany - I Think We..> | 2026-05-22 19:44 | 36K | |
| Tiffany - Could've B..> | 2026-05-22 19:44 | 355K | |
| Tiesto Vs. Diplo Fea..> | 2026-05-22 20:11 | 55K | |
| Tielman Brothers - M..> | 2026-05-22 20:45 | 13K | |
| Tielman Brothers - L..> | 2026-05-22 20:01 | 62K | |
| Tiësto - The Busine..> | 2026-05-22 20:11 | 121K | |
| Tiësto - C’mon (C..> | 2026-05-22 20:11 | 84K | |
| Tiësto - Baila Conm..> | 2026-05-22 20:11 | 173K | |
| Tiësto & Sevenn - B..> | 2026-05-22 20:11 | 142K | |
| Thunderclap Newman -..> | 2026-05-22 20:45 | 191K | |
| Three Dog Night - Ma..> | 2026-05-22 19:36 | 379K | |
| Three Dog Night - Jo..> | 2026-05-22 19:36 | 349K | |
| Three Degrees - The ..> | 2026-05-22 20:01 | 15K | |
| Three Degrees - Take..> | 2026-05-22 19:36 | 212K | |
| Three Degrees - Givi..> | 2026-05-22 19:36 | 171K | |
| Three Degrees - Get ..> | 2026-05-22 19:36 | 298K | |
| Thompson Twins - Doc..> | 2026-05-22 19:44 | 367K | |
| Thomas Dolby - I Sca..> | 2026-05-22 20:45 | 83K | |
| This Mortal Coil - Y..> | 2026-05-22 20:01 | 43K | |
| Thirty Seconds To Ma..> | 2026-05-22 20:11 | 40K | |
| Third World - Try Ja..> | 2026-05-22 19:44 | 84K | |
| Third World - Now Th..> | 2026-05-22 19:36 | 358K | |
| Thin Lizzy - Whisky ..> | 2026-05-22 19:36 | 188K | |
| Thin Lizzy - The Boy..> | 2026-05-22 20:45 | 96K | |
| Thin Lizzy - Dancin'..> | 2026-05-22 19:36 | 208K | |
| Thijs Van Leer - Bol..> | 2026-05-22 19:44 | 48K | |
| The three degrees - ..> | 2026-05-22 19:36 | 26K | |
| Then Jerico - The Mo..> | 2026-05-22 20:01 | 72K | |
| Thembi - Take Me Bac..> | 2026-05-22 19:36 | 313K | |
| ThemVan Morrison - H..> | 2026-05-22 20:45 | 27K | |
| ThemVan Morrison - B..> | 2026-05-22 20:45 | 37K | |
| Them - Here Comes Th..> | 2026-05-22 19:36 | 192K | |
| Them - Gloria.jpg | 2026-05-22 20:45 | 95K | |
| Thelma Houston - Don..> | 2026-05-22 20:45 | 32K | |
| Thelma Houston - Don..> | 2026-05-22 19:36 | 218K | |
| The Zombies - Time O..> | 2026-05-22 20:45 | 112K | |
| The Zombies - She's ..> | 2026-05-22 20:45 | 211K | |
| The Youngbloods - Ge..> | 2026-05-22 20:45 | 145K | |
| The Wiz Stars - A Br..> | 2026-05-22 19:36 | 389K | |
| The Wilkinsons - 26 ..> | 2026-05-22 20:28 | 293K | |
| The Who - Who Are Yo..> | 2026-05-22 19:36 | 577K | |
| The Who - See Me, Fe..> | 2026-05-22 19:36 | 58K | |
| The Who - Pinball Wi..> | 2026-05-22 20:45 | 224K | |
| The Who - Overture F..> | 2026-05-22 20:45 | 37K | |
| The Who - My Generat..> | 2026-05-22 19:44 | 107K | |
| The Who - Behind Blu..> | 2026-05-22 19:36 | 325K | |
| The Who - Baba O'Ril..> | 2026-05-22 19:36 | 325K | |
| The Whispers - It's ..> | 2026-05-22 19:44 | 44K | |
| The Whispers - And t..> | 2026-05-22 19:36 | 494K | |
| The Weeknd Feat. Daf..> | 2026-05-22 20:11 | 61K | |
| The Weeknd - In Your..> | 2026-05-22 20:11 | 36K | |
| The Weeknd - In The ..> | 2026-05-22 20:11 | 43K | |
| The Weeknd - Can't F..> | 2026-05-22 20:11 | 43K | |
| The Weeknd - Blindin..> | 2026-05-22 20:11 | 252K | |
| The Weather Girls - ..> | 2026-05-22 19:44 | 91K | |
| The Walkers My Darl..> | 2026-05-22 19:36 | 50K | |
| The Walkers - There..> | 2026-05-22 20:28 | 50K | |
| The Walkers - Oh Lon..> | 2026-05-22 20:28 | 50K | |
| The Walker Brothers ..> | 2026-05-22 19:36 | 170K | |
| The Walker Brothers ..> | 2026-05-22 19:36 | 186K | |
| The Walker Brothers ..> | 2026-05-22 20:45 | 229K | |
| The Village People -..> | 2026-05-22 19:36 | 44K | |
| The Village People -..> | 2026-05-22 19:36 | 59K | |
| The Veronicas - Unto..> | 2026-05-22 20:11 | 84K | |
| The Veronicas -4Ever..> | 2026-05-22 20:11 | 84K | |
| The Union Gap Featur..> | 2026-05-22 19:36 | 11K | |
| The Underdog Project..> | 2026-05-22 20:11 | 19K | |
| The Turtles - Happy ..> | 2026-05-22 19:44 | 169K | |
| The Tubes - Don't Wa..> | 2026-05-22 20:11 | 30K | |
| The Tremeloes - I Li..> | 2026-05-22 19:36 | 382K | |
| The Traveling Wilbur..> | 2026-05-22 20:28 | 561K | |
| The Trammps - Zing W..> | 2026-05-22 19:36 | 46K | |
| The Trammps - Shout.jpg | 2026-05-22 19:36 | 176K | |
| The Trammps - Love E..> | 2026-05-22 19:36 | 176K | |
| The Trammps - Hold B..> | 2026-05-22 19:44 | 54K | |
| The Trammps - Disco ..> | 2026-05-22 19:36 | 34K | |
| The Trammps - (The L..> | 2026-05-22 19:36 | 105K | |
| The Tornados - Telst..> | 2026-05-22 20:45 | 159K | |
| The Timelords - Gary..> | 2026-05-22 19:44 | 26K | |
| The Three Degrees - ..> | 2026-05-22 19:36 | 205K | |
| The Three Degrees - ..> | 2026-05-22 19:36 | 300K | |
| The Three Degrees - ..> | 2026-05-22 19:36 | 298K | |
| The The - Uncertain ..> | 2026-05-22 20:01 | 63K | |
| The Temptations - Pa..> | 2026-05-22 19:36 | 265K | |
| The Temptations - My..> | 2026-05-22 20:45 | 296K | |
| The Tee Set - She Li..> | 2026-05-22 19:36 | 467K | |
| The Tech Thieves - B..> | 2026-05-22 20:11 | 9.8K | |
| The Tamperer - Feel ..> | 2026-05-22 20:01 | 34K | |
| The Tamperer (Feat. ..> | 2026-05-22 20:11 | 40K | |
| The Swinging Blue Je..> | 2026-05-22 20:45 | 119K | |
| The Swinging Blue Je..> | 2026-05-22 20:45 | 212K | |
| The Sweet - Poppa Jo..> | 2026-05-22 20:01 | 52K | |
| The Sweet - Love Is ..> | 2026-05-22 20:11 | 64K | |
| The Sweet - Blockbus..> | 2026-05-22 20:01 | 42K | |
| The Sweet - Ballroom..> | 2026-05-22 19:36 | 112K | |
| The Surfaris - Wipe ..> | 2026-05-22 20:45 | 213K | |
| The Supremes - You C..> | 2026-05-22 19:36 | 287K | |
| The Supremes - Where..> | 2026-05-22 19:36 | 42K | |
| The Stylistics - Can..> | 2026-05-22 19:36 | 337K | |
| The Stray Cats - Str..> | 2026-05-22 19:44 | 106K | |
| The Stories - Brothe..> | 2026-05-22 19:36 | 472K | |
| The Steve Miller Ban..> | 2026-05-22 19:36 | 149K | |
| The Statler Brothers..> | 2026-05-22 20:45 | 41K | |
| The Spinners - It's ..> | 2026-05-22 20:11 | 44K | |
| The Spinners - Could..> | 2026-05-22 19:36 | 416K | |
| The Spencer Davis Gr..> | 2026-05-22 20:45 | 213K | |
| The Specials - Ghost..> | 2026-05-22 19:44 | 101K | |
| The Specials - A Mes..> | 2026-05-22 20:01 | 33K | |
| The Source Ft. Candi..> | 2026-05-22 20:11 | 22K | |
| The Sounds Of Garth ..> | 2026-05-22 20:28 | 181K | |
| The Sounds Of Garth ..> | 2026-05-22 20:28 | 181K | |
| The Sounds Of Garth ..> | 2026-05-22 20:28 | 193K | |
| The Sounds Of Garth ..> | 2026-05-22 20:28 | 181K | |
| The Sounds Of Garth ..> | 2026-05-22 20:28 | 181K | |
| The Sounds Of Garth ..> | 2026-05-22 20:28 | 181K | |
| The Sounds Of Garth ..> | 2026-05-22 20:28 | 181K | |
| The Soggy Bottom Boy..> | 2026-05-22 20:28 | 42K | |
| The Shuffles - Sha L..> | 2026-05-22 20:45 | 33K | |
| The Shorts - Comment..> | 2026-05-22 20:11 | 56K | |
| The Shirts - Tell Me..> | 2026-05-22 19:36 | 223K | |
| The Shires - My Univ..> | 2026-05-22 20:28 | 58K | |
| The Shirelles - Will..> | 2026-05-22 20:45 | 245K | |
| The Shirelles - To K..> | 2026-05-22 20:28 | 45K | |
| The Shangri-Las - Le..> | 2026-05-22 20:45 | 336K | |
| The Shake Spears - S..> | 2026-05-22 20:45 | 233K | |
| The Shadows - The Th..> | 2026-05-22 19:36 | 126K | |
| The Shadows - Don't ..> | 2026-05-22 20:45 | 290K | |
| The Selecter - On my..> | 2026-05-22 19:36 | 138K | |
| The Searchers - Take..> | 2026-05-22 20:45 | 295K | |
| The Searchers - Need..> | 2026-05-22 20:45 | 496K | |
| The Script Feat. Wil..> | 2026-05-22 20:11 | 43K | |
| The Script - The Man..> | 2026-05-22 20:11 | 45K | |
| The Script - The Las..> | 2026-05-22 20:11 | 66K | |
| The Script - Superhe..> | 2026-05-22 20:11 | 37K | |
| The Script - No Good..> | 2026-05-22 20:11 | 37K | |
| The Script - If You ..> | 2026-05-22 20:11 | 30K | |
| The Scorpions - (Bab..> | 2026-05-22 20:45 | 27K | |
| The Rubettes - Tonig..> | 2026-05-22 19:36 | 299K | |
| The Rubettes - Sugar..> | 2026-05-22 19:36 | 219K | |
| The Rubettes - Juke ..> | 2026-05-22 19:36 | 219K | |
| The Royal Scots Drag..> | 2026-05-22 20:45 | 66K | |
| The Royal Guardsmen ..> | 2026-05-22 20:45 | 354K | |
| The Romantics - Talk..> | 2026-05-22 20:45 | 52K | |
| The Rolling Stones -..> | 2026-05-22 20:45 | 45K | |
| The Rolling Stones -..> | 2026-05-22 19:44 | 59K | |
| The Rolling Stones -..> | 2026-05-22 20:45 | 42K | |
| The Rolling Stones -..> | 2026-05-22 20:45 | 36K | |
| The Rolling Stones -..> | 2026-05-22 20:45 | 45K | |
| The Rolling Stones -..> | 2026-05-22 19:36 | 56K | |
| The Rolling Stones -..> | 2026-05-22 19:36 | 76K | |
| The Rolling Stones -..> | 2026-05-22 19:36 | 278K | |
| The Ritchie Family -..> | 2026-05-22 19:36 | 40K | |
| The Righteous Brothe..> | 2026-05-22 20:45 | 66K | |
| The Remingtons - Two..> | 2026-05-22 20:28 | 196K | |
| The Real Thing - Can..> | 2026-05-22 19:36 | 380K | |
| The Real Thing - Can..> | 2026-05-22 19:36 | 425K | |
| The Ray Conniff Sing..> | 2026-05-22 20:45 | 84K | |
| The Ray Conniff Sing..> | 2026-05-22 19:36 | 71K | |
| The Rah Band - Cloud..> | 2026-05-22 20:45 | 30K | |
| The Radios - I'm int..> | 2026-05-22 19:44 | 161K | |
| The Proclaimers - I ..> | 2026-05-22 20:45 | 91K | |
| The Proclaimers - I'..> | 2026-05-22 20:45 | 30K | |
| The Pretenders - Thi..> | 2026-05-22 20:45 | 42K | |
| The Police - Walking..> | 2026-05-22 19:36 | 78K | |
| The Police - Spirits..> | 2026-05-22 19:44 | 25K | |
| The Police - So Lone..> | 2026-05-22 19:36 | 201K | |
| The Police - Roxanne..> | 2026-05-22 19:36 | 91K | |
| The Police - Message..> | 2026-05-22 19:36 | 201K | |
| The Police - Every b..> | 2026-05-22 20:44 | 47K | |
| The Police - Don't S..> | 2026-05-22 19:44 | 57K | |
| The Police - De Do D..> | 2026-05-22 19:44 | 57K | |
| The Police - Can't S..> | 2026-05-22 19:36 | 32K | |
| The Pointer Sisters ..> | 2026-05-22 19:44 | 45K | |
| The Pointer Sisters ..> | 2026-05-22 19:44 | 58K | |
| The Pointer Sisters ..> | 2026-05-22 19:36 | 189K | |
| The Pipes & Drums & ..> | 2026-05-22 20:44 | 66K | |
| The Pasadenas - Ridi..> | 2026-05-22 20:01 | 59K | |
| The Pacific Prince -..> | 2026-05-22 20:01 | 68K | |
| The OutfieldDiplo - ..> | 2026-05-22 20:11 | 1.2M | |
| The Outfield - Your ..> | 2026-05-22 20:01 | 55K | |
| The Osmonds - Down B..> | 2026-05-22 19:36 | 20K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:28 | 353K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:28 | 478K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:28 | 105K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:28 | 49K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:28 | 57K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:28 | 181K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:28 | 478K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:28 | 222K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:28 | 88K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:28 | 27K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:28 | 356K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:28 | 222K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:28 | 259K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:27 | 73K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:27 | 73K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:27 | 222K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:27 | 157K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:27 | 246K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:27 | 258K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:27 | 250K | |
| The Oak Ridge Boys -..> | 2026-05-22 20:27 | 222K | |
| The O'jays - Love Tr..> | 2026-05-22 20:01 | 44K | |
| The O'jays - I Love ..> | 2026-05-22 20:01 | 42K | |
| The O'Kanes - One Tr..> | 2026-05-22 20:28 | 396K | |
| The O'Kanes - I Can'..> | 2026-05-22 20:28 | 428K | |
| The O'Jays - Used Ta..> | 2026-05-22 19:36 | 184K | |
| The O'Jays - Back St..> | 2026-05-22 19:36 | 224K | |
| The Nitty Gritty Dir..> | 2026-05-22 20:44 | 72K | |
| The Nits - The Train..> | 2026-05-22 19:44 | 28K | |
| The New Seekers - I'..> | 2026-05-22 19:36 | 353K | |
| The Motions - It s t..> | 2026-05-22 20:44 | 160K | |
| The Motions - Every ..> | 2026-05-22 20:44 | 51K | |
| The Motels - Suddenl..> | 2026-05-22 20:44 | 48K | |
| The Monkees - I m a ..> | 2026-05-22 20:44 | 57K | |
| The Monkees - A Litt..> | 2026-05-22 20:44 | 25K | |
| The Mindbenders - A ..> | 2026-05-22 20:44 | 27K | |
| The Mills Brothers -..> | 2026-05-22 20:27 | 70K | |
| The Mike Sammes Sing..> | 2026-05-22 20:44 | 83K | |
| The Mighty Dub Cats ..> | 2026-05-22 20:01 | 192K | |
| The Mavericks - What..> | 2026-05-22 20:27 | 293K | |
| The Mavericks - What..> | 2026-05-22 20:27 | 139K | |
| The Mavericks - Tomo..> | 2026-05-22 20:27 | 42K | |
| The Mavericks - Some..> | 2026-05-22 20:44 | 22K | |
| The Marvelettes - Pl..> | 2026-05-22 20:44 | 222K | |
| The Marshall Tucker ..> | 2026-05-22 20:27 | 220K | |
| The Marshall Tucker ..> | 2026-05-22 20:44 | 46K | |
| The Marcels - Blue M..> | 2026-05-22 20:44 | 220K | |
| The Manhattans - Kis..> | 2026-05-22 19:36 | 205K | |
| The Mamas and The Pa..> | 2026-05-22 20:01 | 46K | |
| The Mamas & the Papa..> | 2026-05-22 20:44 | 303K | |
| The Mamas & The Papa..> | 2026-05-22 20:44 | 89K | |
| The Mamas & The Papa..> | 2026-05-22 20:44 | 401K | |
| The Mamas & The Papa..> | 2026-05-22 20:44 | 94K | |
| The Lumineers - Ho H..> | 2026-05-22 20:11 | 92K | |
| The Limit - Say yeah..> | 2026-05-22 19:44 | 26K | |
| The Les Humphries Si..> | 2026-05-22 19:36 | 416K | |
| The La's - There She..> | 2026-05-22 20:11 | 61K | |
| The Knack - My Sharo..> | 2026-05-22 19:36 | 51K | |
| The Kinleys - Please..> | 2026-05-22 20:27 | 442K | |
| The Kinleys - Just B..> | 2026-05-22 20:27 | 33K | |
| The Kinks - You Real..> | 2026-05-22 20:44 | 75K | |
| The Kinks - Wonderbo..> | 2026-05-22 20:44 | 36K | |
| The Kinks - Till The..> | 2026-05-22 20:44 | 291K | |
| The Kinks - Sunny Af..> | 2026-05-22 20:01 | 82K | |
| The Kinks - Lola (20..> | 2026-05-22 19:36 | 52K | |
| The Kinks - Dedicate..> | 2026-05-22 20:44 | 257K | |
| The Kingston Trio - ..> | 2026-05-22 20:27 | 34K | |
| The King - Take Me H..> | 2026-05-22 20:27 | 143K | |
| The King - King of t..> | 2026-05-22 20:27 | 143K | |
| The Killers - Human.jpg | 2026-05-22 20:44 | 41K | |
| The Kentucky Headhun..> | 2026-05-22 20:44 | 57K | |
| The Kentucky Headhun..> | 2026-05-22 20:27 | 167K | |
| The Kendalls - Thank..> | 2026-05-22 20:27 | 189K | |
| The Kendalls - Sweet..> | 2026-05-22 20:27 | 94K | |
| The Kendalls - Heave..> | 2026-05-22 20:27 | 66K | |
| The Kane Gang - Clos..> | 2026-05-22 20:01 | 51K | |
| The Kaiser Chiefs - ..> | 2026-05-22 20:11 | 53K | |
| The KLF - Justified ..> | 2026-05-22 20:11 | 37K | |
| The KLF - Justified ..> | 2026-05-22 20:01 | 11K | |
| The Judds - Young Lo..> | 2026-05-22 20:44 | 53K | |
| The Judds - Young Lo..> | 2026-05-22 20:27 | 206K | |
| The Judds - Why Not ..> | 2026-05-22 20:27 | 39K | |
| The Judds - Why Not ..> | 2026-05-22 20:27 | 206K | |
| The Judds - Water of..> | 2026-05-22 20:27 | 45K | |
| The Judds - Turn It ..> | 2026-05-22 20:27 | 168K | |
| The Judds - Sleeping..> | 2026-05-22 20:27 | 7.8K | |
| The Judds - Rockin..> | 2026-05-22 20:27 | 82K | |
| The Judds - One Man ..> | 2026-05-22 20:27 | 257K | |
| The Judds - One Hund..> | 2026-05-22 20:27 | 188K | |
| The Judds - My Baby(..> | 2026-05-22 20:27 | 7.8K | |
| The Judds - Mr. Pain..> | 2026-05-22 20:27 | 7.8K | |
| The Judds - Mama He(..> | 2026-05-22 20:27 | 68K | |
| The Judds - Mama He..> | 2026-05-22 20:44 | 42K | |
| The Judds - Love Is ..> | 2026-05-22 20:27 | 276K | |
| The Judds - Love Can..> | 2026-05-22 20:27 | 206K | |
| The Judds - Let Me T..> | 2026-05-22 20:27 | 257K | |
| The Judds - I Know W..> | 2026-05-22 20:27 | 237K | |
| The Judds - Have Mer..> | 2026-05-22 20:27 | 314K | |
| The Judds - Grandpa ..> | 2026-05-22 20:27 | 276K | |
| The Judds - Grandpa ..> | 2026-05-22 20:44 | 51K | |
| The Judds - Give A L..> | 2026-05-22 20:27 | 276K | |
| The Judds - Girls Ni..> | 2026-05-22 20:27 | 234K | |
| The Judds - Endless ..> | 2026-05-22 20:27 | 7.8K | |
| The Judds - Drops of..> | 2026-05-22 20:27 | 7.8K | |
| The Judds - Don't Be..> | 2026-05-22 20:27 | 237K | |
| The Judds - Cry Myse..> | 2026-05-22 20:27 | 82K | |
| The Judds - Change O..> | 2026-05-22 20:27 | 301K | |
| The Judds - Bye Bye ..> | 2026-05-22 20:27 | 7.8K | |
| The Judds - Born To ..> | 2026-05-22 20:27 | 188K | |
| The Jive Five - My T..> | 2026-05-22 20:44 | 19K | |
| The Jimi Hendrix Exp..> | 2026-05-22 19:36 | 259K | |
| The Jets - Goldfinge..> | 2026-05-22 20:44 | 331K | |
| The Jayhawks - Take ..> | 2026-05-22 20:01 | 46K | |
| The Jam - A Town Cal..> | 2026-05-22 19:44 | 67K | |
| The Jacksons Five - ..> | 2026-05-22 19:36 | 64K | |
| The Jacksons - Can Y..> | 2026-05-22 19:44 | 25K | |
| The Jackson Sisters ..> | 2026-05-22 20:11 | 52K | |
| The Isley Brothers -..> | 2026-05-22 20:01 | 198K | |
| The Isley Brothers -..> | 2026-05-22 20:11 | 45K | |
| The Isley Brothers -..> | 2026-05-22 20:44 | 36K | |
| The Illegal Eagles -..> | 2026-05-22 20:27 | 310K | |
| The Illegal Eagles -..> | 2026-05-22 20:27 | 310K | |
| The Ian Carey Projec..> | 2026-05-22 20:11 | 179K | |
| The Hunters - Mr. Ta..> | 2026-05-22 20:44 | 49K | |
| The Human League - T..> | 2026-05-22 20:11 | 63K | |
| The Human League - D..> | 2026-05-22 19:44 | 256K | |
| The Hues Corporation..> | 2026-05-22 19:36 | 188K | |
| The Housemartins - C..> | 2026-05-22 19:44 | 166K | |
| The Hollies - The Ai..> | 2026-05-22 19:36 | 165K | |
| The Hollies - Sandy ..> | 2026-05-22 19:36 | 67K | |
| The Hollies - Long C..> | 2026-05-22 19:35 | 229K | |
| The Hollies - I m Al..> | 2026-05-22 20:44 | 95K | |
| The Hollies - I Can'..> | 2026-05-22 20:44 | 380K | |
| The Hollies - Dear E..> | 2026-05-22 20:44 | 4.0M | |
| The Hollies - Blowin..> | 2026-05-22 20:44 | 18K | |
| The Hollies - Blowin..> | 2026-05-22 20:01 | 50K | |
| The Harmony Group - ..> | 2026-05-22 19:44 | 8.5K | |
| The Guess Who - Clap..> | 2026-05-22 19:35 | 447K | |
| The Guess Who - Amer..> | 2026-05-22 19:35 | 94K | |
| The Greg Kihn band -..> | 2026-05-22 19:44 | 195K | |
| The Good Men - Give ..> | 2026-05-22 20:01 | 42K | |
| The Goo Goo Dolls - ..> | 2026-05-22 20:11 | 43K | |
| The Gibson Brothers ..> | 2026-05-22 19:44 | 290K | |
| The Gap Band - Oops..> | 2026-05-22 19:44 | 150K | |
| The Free - Because I..> | 2026-05-22 20:44 | 59K | |
| The Fray - How To Sa..> | 2026-05-22 20:11 | 32K | |
| The Fratellis - Chel..> | 2026-05-22 20:11 | 42K | |
| The Four Tops - Bern..> | 2026-05-22 19:44 | 279K | |
| The Four Seasons - B..> | 2026-05-22 20:44 | 246K | |
| The Four Aces - Thre..> | 2026-05-22 20:44 | 51K | |
| The Fortunes - Seaso..> | 2026-05-22 20:44 | 233K | |
| The Forester Sisters..> | 2026-05-22 20:27 | 200K | |
| The Forester Sisters..> | 2026-05-22 20:27 | 202K | |
| The Forester Sisters..> | 2026-05-22 20:27 | 190K | |
| The Forester Sisters..> | 2026-05-22 20:27 | 155K | |
| The Forester Sisters..> | 2026-05-22 20:27 | 271K | |
| The Forester Sisters..> | 2026-05-22 20:27 | 255K | |
| The Forester Sisters..> | 2026-05-22 20:27 | 115K | |
| The Forester Sisters..> | 2026-05-22 20:27 | 202K | |
| The Forester Sisters..> | 2026-05-22 20:27 | 530K | |
| The Forester Sisters..> | 2026-05-22 20:27 | 155K | |
| The Forester Sisters..> | 2026-05-22 20:27 | 155K | |
| The Flying Burrito B..> | 2026-05-22 20:27 | 58K | |
| The Flirts - Passion..> | 2026-05-22 19:44 | 74K | |
| The Farm - All Toget..> | 2026-05-22 20:44 | 34K | |
| The Family Dogg & St..> | 2026-05-22 19:35 | 71K | |
| The Exciters - Tell ..> | 2026-05-22 20:44 | 225K | |
| The Everly Brothers ..> | 2026-05-22 20:44 | 262K | |
| The Everly Brothers ..> | 2026-05-22 20:44 | 15K | |
| The Everly Brothers ..> | 2026-05-22 20:44 | 264K | |
| The Everly Brothers ..> | 2026-05-22 20:44 | 22K | |
| The Everly Brothers ..> | 2026-05-22 20:44 | 23K | |
| The Emotions - Best ..> | 2026-05-22 20:44 | 46K | |
| The Eagles - Take It..> | 2026-05-22 19:35 | 23K | |
| The Eagles - One Of ..> | 2026-05-22 19:35 | 57K | |
| The Eagles - New Kid..> | 2026-05-22 19:35 | 44K | |
| The Eagles - Lyin' E..> | 2026-05-22 19:35 | 31K | |
| The Eagles - Heartac..> | 2026-05-22 19:35 | 246K | |
| The Eagles - Desper..> | 2026-05-22 20:44 | 30K | |
| The Drifters - Under..> | 2026-05-22 20:44 | 220K | |
| The Drifters - Save ..> | 2026-05-22 20:44 | 400K | |
| The Doors - Riders o..> | 2026-05-22 19:35 | 140K | |
| The Doobie Brothers ..> | 2026-05-22 20:01 | 46K | |
| The Dizzy Man's Band..> | 2026-05-22 19:35 | 40K | |
| The Dirt Band - Amer..> | 2026-05-22 19:44 | 28K | |
| The Detroit Emeralds..> | 2026-05-22 19:35 | 34K | |
| The Dells - Love Is ..> | 2026-05-22 20:44 | 205K | |
| The Dave Clark Five ..> | 2026-05-22 20:44 | 75K | |
| The Cure - Lullaby.jpg | 2026-05-22 20:01 | 66K | |
| The Cure - In Betwee..> | 2026-05-22 20:01 | 68K | |
| The Cure - Friday I'..> | 2026-05-22 20:01 | 53K | |
| The Cure - Boys Don'..> | 2026-05-22 20:11 | 66K | |
| The Cult - She Sells..> | 2026-05-22 19:44 | 27K | |
| The Crystals - Then ..> | 2026-05-22 20:44 | 326K | |
| The Crystals - Da Do..> | 2026-05-22 20:44 | 326K | |
| The Crusaders - Stre..> | 2026-05-22 19:35 | 195K | |
| The Cranberries - Zo..> | 2026-05-22 20:01 | 44K | |
| The Cranberries - Od..> | 2026-05-22 20:01 | 33K | |
| The Cranberries - Li..> | 2026-05-22 20:01 | 37K | |
| The Cover Girls - Wi..> | 2026-05-22 20:01 | 23K | |
| The Corrs - Radio.jpg | 2026-05-22 20:11 | 42K | |
| The Coolest Station.jpg | 2026-05-22 19:29 | 3.1K | |
| The Contours - Do Yo..> | 2026-05-22 20:44 | 252K | |
| The Common Linnets -..> | 2026-05-22 20:27 | 34K | |
| The Commodores - Thr..> | 2026-05-22 19:35 | 186K | |
| The Commodores - Sti..> | 2026-05-22 19:44 | 26K | |
| The Commodores - Nig..> | 2026-05-22 19:35 | 119K | |
| The Commodores - Eas..> | 2026-05-22 19:35 | 307K | |
| The Clash - Should I..> | 2026-05-22 20:01 | 29K | |
| The Clash - Magnific..> | 2026-05-22 19:44 | 29K | |
| The Clash - London C..> | 2026-05-22 19:35 | 81K | |
| The Chimes - I Still..> | 2026-05-22 20:01 | 67K | |
| The Chiffons - Sweet..> | 2026-05-22 20:44 | 199K | |
| The Chiffons - One F..> | 2026-05-22 20:44 | 166K | |
| The Chiffons - He's ..> | 2026-05-22 20:44 | 199K | |
| The Chicks - I Can L..> | 2026-05-22 20:27 | 38K | |
| The Chi-Lites - Have..> | 2026-05-22 19:35 | 83K | |
| The Charlie Daniels ..> | 2026-05-22 20:27 | 37K | |
| The Charlie Daniels ..> | 2026-05-22 20:27 | 376K | |
| The Charlie Daniels ..> | 2026-05-22 20:27 | 403K | |
| The Chaps - Rawhide.jpg | 2026-05-22 20:27 | 65K | |
| The Cats - Why.jpg | 2026-05-22 20:44 | 431K | |
| The Cats - Where Hav..> | 2026-05-22 19:35 | 250K | |
| The Cats - What s th..> | 2026-05-22 20:44 | 63K | |
| The Cats - Vaya Con ..> | 2026-05-22 19:35 | 49K | |
| The Cats - There Has..> | 2026-05-22 19:35 | 49K | |
| The Cats - Save The ..> | 2026-05-22 19:35 | 291K | |
| The Cats - Rock 'N R..> | 2026-05-22 19:35 | 250K | |
| The Cats - One Way W..> | 2026-05-22 19:35 | 12K | |
| The Cats - Let's Dan..> | 2026-05-22 19:35 | 250K | |
| The Cats - Be My Day..> | 2026-05-22 19:35 | 250K | |
| The Cascades - Rhyth..> | 2026-05-22 20:44 | 114K | |
| The Byrds - Turn! Tu..> | 2026-05-22 20:01 | 898K | |
| The Byrds - Mr. Tamb..> | 2026-05-22 20:44 | 259K | |
| The Byrds - Jesus Is..> | 2026-05-22 19:35 | 41K | |
| The Byrds - All I Re..> | 2026-05-22 20:44 | 213K | |
| The Buoys - Give Up ..> | 2026-05-22 19:35 | 249K | |
| The Buffoons - Arizo..> | 2026-05-22 20:27 | 37K | |
| The Bucketheads - Th..> | 2026-05-22 20:01 | 41K | |
| The Browns - The Thr..> | 2026-05-22 20:27 | 259K | |
| The Brothers Johnson..> | 2026-05-22 20:11 | 42K | |
| The Braxtons - The B..> | 2026-05-22 20:01 | 59K | |
| The Brat - Chalk Dus..> | 2026-05-22 19:44 | 49K | |
| The Bollock Brothers..> | 2026-05-22 19:44 | 48K | |
| The Bobby Fuller Fou..> | 2026-05-22 20:44 | 317K | |
| The Blues BrothersAr..> | 2026-05-22 19:44 | 128K | |
| The Blues Brothers -..> | 2026-05-22 19:44 | 37K | |
| The Bluebells - Youn..> | 2026-05-22 19:44 | 210K | |
| The Blow Monkeys - I..> | 2026-05-22 19:44 | 54K | |
| The Black Eyed Peas ..> | 2026-05-22 20:11 | 112K | |
| The Black Eyed Peas ..> | 2026-05-22 20:44 | 30K | |
| The Best of Today.jpg | 2026-05-22 19:29 | 3.1K | |
| The Best Radio Stati..> | 2026-05-22 19:29 | 3.1K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 276K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 16K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 340K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 407K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 46K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 243K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 307K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 160K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 576K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 62K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 295K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 72K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 108K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 295K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 506K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 340K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 295K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 75K | |
| The Bellamy Brothers..> | 2026-05-22 20:27 | 243K | |
| The Bee Gees - You S..> | 2026-05-22 19:35 | 381K | |
| The Bee Gees - Trage..> | 2026-05-22 19:35 | 381K | |
| The Bee Gees - Too M..> | 2026-05-22 19:35 | 169K | |
| The Bee Gees - Run T..> | 2026-05-22 19:35 | 169K | |
| The Bee Gees - Night..> | 2026-05-22 19:35 | 169K | |
| The Bee Gees - Night..> | 2026-05-22 19:35 | 88K | |
| The Bee Gees - My Wo..> | 2026-05-22 19:35 | 540K | |
| The Bee Gees - Jive ..> | 2026-05-22 19:35 | 74K | |
| The Bee Gees - For W..> | 2026-05-22 20:01 | 74K | |
| The Beatles - What G..> | 2026-05-22 20:44 | 109K | |
| The Beatles - Twist ..> | 2026-05-22 20:44 | 291K | |
| The Beatles - The Lo..> | 2026-05-22 19:35 | 186K | |
| The Beatles - The Fo..> | 2026-05-22 20:44 | 165K | |
| The Beatles - The Ba..> | 2026-05-22 20:44 | 122K | |
| The Beatles - Strawb..> | 2026-05-22 20:44 | 97K | |
| The Beatles - Someth..> | 2026-05-22 20:44 | 61K | |
| The Beatles - Revolu..> | 2026-05-22 20:44 | 240K | |
| The Beatles - Penny ..> | 2026-05-22 20:44 | 97K | |
| The Beatles - Michel..> | 2026-05-22 20:44 | 84K | |
| The Beatles - Magica..> | 2026-05-22 20:44 | 97K | |
| The Beatles - Let It..> | 2026-05-22 19:35 | 186K | |
| The Beatles - In My ..> | 2026-05-22 20:01 | 37K | |
| The Beatles - I Am T..> | 2026-05-22 20:44 | 165K | |
| The Beatles - Hey Ju..> | 2026-05-22 19:35 | 165K | |
| The Beatles - Help.jpg | 2026-05-22 20:01 | 22K | |
| The Beatles - Flying..> | 2026-05-22 20:44 | 110K | |
| The Beatles - Drive ..> | 2026-05-22 19:44 | 164K | |
| The Beatles - Day Tr..> | 2026-05-22 20:44 | 119K | |
| The Beatles - Blue J..> | 2026-05-22 20:44 | 331K | |
| The Beatles - Bad Bo..> | 2026-05-22 20:44 | 46K | |
| The Beatles - Baby s..> | 2026-05-22 20:44 | 75K | |
| The Beatles - All To..> | 2026-05-22 19:35 | 189K | |
| The Beatles - All My..> | 2026-05-22 20:44 | 75K | |
| The Beatles - A Hard..> | 2026-05-22 20:11 | 18K | |
| The Beatles - A Day ..> | 2026-05-22 20:01 | 48K | |
| The Beatles - A Day ..> | 2026-05-22 20:44 | 397K | |
| The Beat - Can't Ge..> | 2026-05-22 20:44 | 48K | |
| The Beach Boys - Wou..> | 2026-05-22 20:44 | 41K | |
| The Beach Boys - Tea..> | 2026-05-22 19:35 | 298K | |
| The Beach Boys - I G..> | 2026-05-22 20:11 | 44K | |
| The Beach Boys - Goo..> | 2026-05-22 20:44 | 1.9M | |
| The Beach Boys - God..> | 2026-05-22 20:44 | 41K | |
| The Beach Boys - Do ..> | 2026-05-22 20:44 | 214K | |
| The Beach Boys - Dar..> | 2026-05-22 20:44 | 214K | |
| The Beach Boys - Cot..> | 2026-05-22 20:44 | 262K | |
| The Beach Boys - Bre..> | 2026-05-22 20:44 | 37K | |
| The Beach Boys - Blu..> | 2026-05-22 20:44 | 335K | |
| The Baseballs - Umbr..> | 2026-05-22 20:11 | 128K | |
| The Bangles - Manic ..> | 2026-05-22 19:44 | 184K | |
| The Bangles - Hazy S..> | 2026-05-22 20:44 | 46K | |
| The Band - The Night..> | 2026-05-22 20:27 | 71K | |
| The Babys - Isn`t It..> | 2026-05-22 20:44 | 45K | |
| The Babys - Everytim..> | 2026-05-22 19:35 | 329K | |
| The Babys - Everytim..> | 2026-05-22 20:44 | 37K | |
| The B-52's - Love Sh..> | 2026-05-22 20:44 | 49K | |
| The Art Of Noise - M..> | 2026-05-22 19:44 | 149K | |
| The Animals - House ..> | 2026-05-22 20:44 | 223K | |
| The Alan Parsons Pro..> | 2026-05-22 20:44 | 58K | |
| The Alan Parsons Pro..> | 2026-05-22 19:44 | 44K | |
| The Alan Parsons Pro..> | 2026-05-22 20:44 | 42K | |
| The Alan Parsons Pro..> | 2026-05-22 20:44 | 93K | |
| Texas - Say What You..> | 2026-05-22 20:01 | 47K | |
| Texas - Prayer For Y..> | 2026-05-22 20:11 | 218K | |
| Texas - Inner Smile.jpg | 2026-05-22 20:11 | 31K | |
| Texas - I Don't Want..> | 2026-05-22 20:11 | 18K | |
| Texas - Black Eyed B..> | 2026-05-22 20:11 | 42K | |
| Terry Stafford - Sus..> | 2026-05-22 20:01 | 73K | |
| Terry Jacks - Season..> | 2026-05-22 20:44 | 27K | |
| Terry Jacks - If You..> | 2026-05-22 20:11 | 61K | |
| Terry Dactyl And The..> | 2026-05-22 19:35 | 265K | |
| Terrorgruppe - As Te..> | 2026-05-22 20:44 | 110K | |
| Terri Gibbs - Somebo..> | 2026-05-22 20:27 | 379K | |
| Terri Clark - You're..> | 2026-05-22 20:27 | 172K | |
| Terri Clark - Poor, ..> | 2026-05-22 20:27 | 409K | |
| Terri Clark - Just T..> | 2026-05-22 20:27 | 348K | |
| Terri Clark - If I W..> | 2026-05-22 20:27 | 409K | |
| Terri Clark - Better..> | 2026-05-22 20:27 | 172K | |
| Teresa Brewer - Musi..> | 2026-05-22 20:11 | 77K | |
| Teresa Brewer - Let ..> | 2026-05-22 20:11 | 48K | |
| Terence Trent D'arby..> | 2026-05-22 19:44 | 34K | |
| Terence Trent D'arby..> | 2026-05-22 19:44 | 34K | |
| Terence Trent D'arby..> | 2026-05-22 19:44 | 34K | |
| Terence Trent D'arby..> | 2026-05-22 19:44 | 34K | |
| Tenpole Tudor - Wund..> | 2026-05-22 19:44 | 36K | |
| Tennessee Ernie Ford..> | 2026-05-22 20:27 | 374K | |
| Tennessee Ernie Ford..> | 2026-05-22 19:44 | 81K | |
| Ten Sharp - You.jpg | 2026-05-22 20:44 | 22K | |
| Ten Sharp - Japanese..> | 2026-05-22 19:44 | 45K | |
| Temptations - Treat ..> | 2026-05-22 19:44 | 22K | |
| Temptations - Papa W..> | 2026-05-22 20:01 | 16K | |
| Temptations - Papa W..> | 2026-05-22 19:35 | 33K | |
| Temptations - My Gir..> | 2026-05-22 19:44 | 33K | |
| Temptations - Just M..> | 2026-05-22 20:11 | 62K | |
| Telly Savalas - Some..> | 2026-05-22 20:44 | 34K | |
| Telly Savalas - If.jpg | 2026-05-22 19:35 | 61K | |
| Tee Set - The Bandst..> | 2026-05-22 19:35 | 311K | |
| Tee Set - Tea is fam..> | 2026-05-22 20:44 | 100K | |
| Tee Set - Ma belle A..> | 2026-05-22 20:44 | 45K | |
| Tee Set - Linda Lind..> | 2026-05-22 19:35 | 256K | |
| Tee-Set - Now's the ..> | 2026-05-22 20:44 | 100K | |
| Tee-Set - Don't You ..> | 2026-05-22 19:44 | 1.0M | |
| Teddy SwimsCYRIL - T..> | 2026-05-22 20:11 | 16K | |
| Teddy Swims - Lose C..> | 2026-05-22 20:11 | 24K | |
| Teddy Pendergrass & ..> | 2026-05-22 19:44 | 11K | |
| Teddy Bears - To Kno..> | 2026-05-22 20:44 | 54K | |
| Technotronic Feat. K..> | 2026-05-22 19:44 | 48K | |
| Technotronic - This ..> | 2026-05-22 20:01 | 80K | |
| Technotronic - Pump ..> | 2026-05-22 20:01 | 46K | |
| Technotronic - Megam..> | 2026-05-22 20:01 | 20K | |
| Technotronic - Get U..> | 2026-05-22 20:01 | 67K | |
| Technotronic & Reggi..> | 2026-05-22 20:01 | 37K | |
| Technohead - I Wanna..> | 2026-05-22 20:01 | 58K | |
| Technohead - Banana-..> | 2026-05-22 20:01 | 323K | |
| Techno Mike - Let's ..> | 2026-05-22 20:11 | 278K | |
| Teaser Intro 02.jpg | 2026-05-22 19:29 | 3.1K | |
| Teaser Intro 01.jpg | 2026-05-22 19:29 | 3.1K | |
| Tears For Fears - Wo..> | 2026-05-22 20:01 | 70K | |
| Tears For Fears - So..> | 2026-05-22 19:44 | 44K | |
| Tears For Fears - Sh..> | 2026-05-22 19:44 | 42K | |
| Tears For Fears - Ma..> | 2026-05-22 19:44 | 17K | |
| Tears For Fears - Ev..> | 2026-05-22 19:44 | 42K | |
| Tears For Fears - Ch..> | 2026-05-22 20:01 | 17K | |
| Tears For Fears - Br..> | 2026-05-22 20:01 | 23K | |
| Tears & Joy - I Will..> | 2026-05-22 20:01 | 57K | |
| Teach In - Upside Do..> | 2026-05-22 19:35 | 66K | |
| Teach In - Ding A Do..> | 2026-05-22 20:44 | 53K | |
| Teach In - Dear John..> | 2026-05-22 19:35 | 15K | |
| Taylor Swift - We Ar..> | 2026-05-22 20:11 | 33K | |
| Taylor Swift - Shake..> | 2026-05-22 20:11 | 34K | |
| Taylor Swift - Love ..> | 2026-05-22 20:11 | 44K | |
| Taylor Swift -I Knew..> | 2026-05-22 20:11 | 25K | |
| Taylor Swift - Cruel..> | 2026-05-22 20:11 | 32K | |
| Taylor Swift - Blank..> | 2026-05-22 20:11 | 34K | |
| Taylor Dayne - Tell ..> | 2026-05-22 19:44 | 48K | |
| Taylor Dayne - Prove..> | 2026-05-22 20:11 | 55K | |
| Taylor Dayne - Can't..> | 2026-05-22 20:01 | 38K | |
| Tavares - More Than ..> | 2026-05-22 20:01 | 57K | |
| Tavares - It Only Ta..> | 2026-05-22 19:35 | 44K | |
| Tavares - Heaven Mus..> | 2026-05-22 19:35 | 64K | |
| Tavares - Don't take..> | 2026-05-22 19:44 | 45K | |
| Tavares - Don't Take..> | 2026-05-22 19:35 | 491K | |
| Tatu - How Soon Is N..> | 2026-05-22 20:11 | 11K | |
| Tatjana Simic - Chic..> | 2026-05-22 19:44 | 38K | |
| Taste Of Honey - Boo..> | 2026-05-22 20:11 | 46K | |
| Tasmin Archer - Slee..> | 2026-05-22 20:44 | 20K | |
| Tasmin Archer - Slee..> | 2026-05-22 20:44 | 36K | |
| Tarney Spencer Band ..> | 2026-05-22 19:44 | 74K | |
| Tarkan - Simarik.jpg | 2026-05-22 20:01 | 75K | |
| Tanya Tucker - Would..> | 2026-05-22 20:27 | 244K | |
| Tanya Tucker - What..> | 2026-05-22 20:27 | 30K | |
| Tanya Tucker - Walki..> | 2026-05-22 20:27 | 207K | |
| Tanya Tucker - Two S..> | 2026-05-22 20:27 | 297K | |
| Tanya Tucker - The B..> | 2026-05-22 20:27 | 35K | |
| Tanya Tucker - Texas..> | 2026-05-22 20:27 | 478K | |
| Tanya Tucker - Some ..> | 2026-05-22 20:27 | 127K | |
| Tanya Tucker - One L..> | 2026-05-22 20:27 | 102K | |
| Tanya Tucker - My Ar..> | 2026-05-22 20:27 | 173K | |
| Tanya Tucker - Lizzi..> | 2026-05-22 20:27 | 127K | |
| Tanya Tucker - Littl..> | 2026-05-22 20:27 | 189K | |
| Tanya Tucker - Just ..> | 2026-05-22 20:27 | 330K | |
| Tanya Tucker - It's ..> | 2026-05-22 20:27 | 308K | |
| Tanya Tucker - It's ..> | 2026-05-22 20:27 | 207K | |
| Tanya Tucker - If Yo..> | 2026-05-22 20:27 | 160K | |
| Tanya Tucker - If It..> | 2026-05-22 20:27 | 308K | |
| Tanya Tucker - I'll ..> | 2026-05-22 20:27 | 180K | |
| Tanya Tucker - Highw..> | 2026-05-22 20:27 | 179K | |
| Tanya Tucker - Here'..> | 2026-05-22 20:27 | 187K | |
| Tanya Tucker - Here'..> | 2026-05-22 20:27 | 486K | |
| Tanya Tucker - Down ..> | 2026-05-22 20:27 | 160K | |
| Tanya Tucker - Delta..> | 2026-05-22 20:27 | 187K | |
| Tanya Tucker - Can I..> | 2026-05-22 20:27 | 226K | |
| Tanya Tucker - Call ..> | 2026-05-22 20:27 | 179K | |
| Tanya Tucker - Blood..> | 2026-05-22 20:27 | 187K | |
| Tanya Tucker - (With..> | 2026-05-22 20:27 | 160K | |
| Tante Leen - Oh John..> | 2026-05-22 20:01 | 73K | |
| Tanita Tikaram - Twi..> | 2026-05-22 20:44 | 22K | |
| Tanita Tikaram - Cat..> | 2026-05-22 20:44 | 33K | |
| Tammy Wynette - Your..> | 2026-05-22 20:27 | 65K | |
| Tammy Wynette - The ..> | 2026-05-22 20:27 | 176K | |
| Tammy Wynette - Take..> | 2026-05-22 20:27 | 67K | |
| Tammy Wynette - Stan..> | 2026-05-22 20:27 | 33K | |
| Tammy Wynette - Stan..> | 2026-05-22 20:27 | 380K | |
| Tammy Wynette - Some..> | 2026-05-22 20:44 | 11K | |
| Tammy Wynette - No C..> | 2026-05-22 20:44 | 112K | |
| Tammy Wynette - Kids..> | 2026-05-22 20:27 | 158K | |
| Tammy Wynette - I Do..> | 2026-05-22 20:27 | 197K | |
| Tammy Wynette - I Do..> | 2026-05-22 20:44 | 30K | |
| Tammy Wynette - He L..> | 2026-05-22 20:27 | 176K | |
| Tammy Wynette - D.I...> | 2026-05-22 20:44 | 44K | |
| Tammy Wynette - D-I-..> | 2026-05-22 20:27 | 218K | |
| Tammy Wynette - Apar..> | 2026-05-22 20:44 | 59K | |
| Tammy Wynette - A Be..> | 2026-05-22 20:27 | 131K | |
| Tammy Wynette - 'Til..> | 2026-05-22 20:27 | 197K | |
| Tammy Wynette, Ricky..> | 2026-05-22 20:27 | 293K | |
| Tammy Wynette & Mark..> | 2026-05-22 20:44 | 92K | |
| Tambourine - High Un..> | 2026-05-22 19:44 | 63K | |
| Talking Heads - Slip..> | 2026-05-22 19:44 | 80K | |
| Talking Heads - Road..> | 2026-05-22 20:01 | 127K | |
| Talking Heads - Road..> | 2026-05-22 19:44 | 69K | |
| Talking Heads - Once..> | 2026-05-22 19:44 | 52K | |
| Talking Heads - And ..> | 2026-05-22 19:44 | 127K | |
| Talk Talk - Such A S..> | 2026-05-22 19:44 | 30K | |
| Talk Talk - Living I..> | 2026-05-22 20:01 | 63K | |
| Talk Talk - Live's W..> | 2026-05-22 19:44 | 94K | |
| Talk Talk - It's My ..> | 2026-05-22 19:44 | 32K | |
| Talk Talk - Dum Dum ..> | 2026-05-22 19:44 | 32K | |
| Take That - The Floo..> | 2026-05-22 20:11 | 30K | |
| Take That - How Deep..> | 2026-05-22 20:44 | 42K | |
| Take That - Everythi..> | 2026-05-22 20:01 | 61K | |
| Take That - Back For..> | 2026-05-22 20:01 | 41K | |
| Take That - Babe.jpg | 2026-05-22 20:01 | 61K | |
| Take That & Lulu - R..> | 2026-05-22 20:01 | 74K | |
| Taio Cruz Feat. Luda..> | 2026-05-22 20:11 | 145K | |
| Taio Cruz -Dynamite.jpg | 2026-05-22 20:11 | 32K | |
| Taio Cruz & Ludacris..> | 2026-05-22 20:11 | 32K | |
| Taco - Puttin' on th..> | 2026-05-22 19:44 | 52K | |
| Tacabro - Tacata.jpg | 2026-05-22 20:11 | 362K | |
| T Spoon - Sex On The..> | 2026-05-22 20:01 | 54K | |
| T Graham Brown - Hel..> | 2026-05-22 20:27 | 429K | |
| T. Rex - Hot Love.jpg | 2026-05-22 19:35 | 218K | |
| T. Rex - Get It On.jpg | 2026-05-22 19:35 | 107K | |
| T. Rex - Bang A Gong..> | 2026-05-22 20:11 | 48K | |
| T.N.N. - La Cucamarc..> | 2026-05-22 20:01 | 82K | |
| T. Graham Brown - Th..> | 2026-05-22 20:27 | 230K | |
| T. Graham Brown - I ..> | 2026-05-22 20:27 | 230K | |
| T. Graham Brown - I ..> | 2026-05-22 20:27 | 195K | |
| T. Graham Brown - He..> | 2026-05-22 20:27 | 42K | |
| T. Graham Brown - Do..> | 2026-05-22 20:27 | 278K | |
| T. Graham Brown - Da..> | 2026-05-22 20:27 | 306K | |
| T.G. Sheppard - Stro..> | 2026-05-22 20:27 | 118K | |
| T.G. Sheppard - Stro..> | 2026-05-22 20:27 | 293K | |
| T.G. Sheppard - Slow..> | 2026-05-22 20:27 | 158K | |
| T.G. Sheppard - Part..> | 2026-05-22 20:27 | 158K | |
| T.G. Sheppard - Part..> | 2026-05-22 20:27 | 155K | |
| T.G. Sheppard - Only..> | 2026-05-22 20:27 | 382K | |
| T.G. Sheppard - I Lo..> | 2026-05-22 20:27 | 267K | |
| T.G. Sheppard - I Fe..> | 2026-05-22 20:27 | 263K | |
| T.G. Sheppard - Do Y..> | 2026-05-22 20:27 | 158K | |
| T.A.T.U. - How Soon ..> | 2026-05-22 20:11 | 11K | |
| T.A.T.U. - All The T..> | 2026-05-22 20:11 | 11K | |
| T-Spoon - Sex On The..> | 2026-05-22 20:01 | 32K | |
| T-Spoon - No Time 2 ..> | 2026-05-22 20:01 | 21K | |
| T-Spoon - Mercedes B..> | 2026-05-22 20:01 | 24K | |
| T-Rex - Hot Love (Si..> | 2026-05-22 19:36 | 34K | |
| T'pau - China In You..> | 2026-05-22 19:44 | 54K | |
| SyzzNora Van Elken -..> | 2026-05-22 20:11 | 32K | |
| System F - Out Of Th..> | 2026-05-22 20:11 | 93K | |
| Sylvia - Tumbleweed.jpg | 2026-05-22 20:27 | 220K | |
| Sylvia - Nobody.jpg | 2026-05-22 20:27 | 165K | |
| Sylvia - Drifter.jpg | 2026-05-22 20:27 | 210K | |
| Sylvia, Michael John..> | 2026-05-22 20:27 | 294K | |
| Sylvester - You Make..> | 2026-05-22 19:35 | 32K | |
| Sylvester - You Make..> | 2026-05-22 19:44 | 134K | |
| Sylver - Why Worry.jpg | 2026-05-22 20:11 | 181K | |
| Sylver - Turn The Ti..> | 2026-05-22 20:11 | 140K | |
| Sylver -Forgiven.jpg | 2026-05-22 20:11 | 38K | |
| Sydney Youngblood - ..> | 2026-05-22 19:44 | 56K | |
| Sydney Youngblood - ..> | 2026-05-22 20:44 | 70K | |
| Sybil - Walk On By.jpg | 2026-05-22 20:01 | 80K | |
| Swv - Right Here.jpg | 2026-05-22 20:01 | 61K | |
| Swinging Soul Machin..> | 2026-05-22 20:44 | 67K | |
| Swing Out Sister - Y..> | 2026-05-22 20:01 | 36K | |
| Swing Out Sister - S..> | 2026-05-22 19:44 | 58K | |
| Swing Out Sister - B..> | 2026-05-22 20:01 | 56K | |
| Swing Out Sister - B..> | 2026-05-22 19:44 | 56K | |
| Swing Out Sister - A..> | 2026-05-22 20:01 | 28K | |
| Sweethearts of the R..> | 2026-05-22 20:27 | 152K | |
| Sweethearts of the R..> | 2026-05-22 20:27 | 198K | |
| Sweet Sixteen - Pete..> | 2026-05-22 20:01 | 73K | |
| Sweet Sensation - Sa..> | 2026-05-22 20:44 | 37K | |
| Sweet - Wig Wam Bam.jpg | 2026-05-22 19:35 | 234K | |
| Sweet - The Six Teen..> | 2026-05-22 19:35 | 460K | |
| Sweet - The Ballroom..> | 2026-05-22 19:35 | 112K | |
| Sweet - Fox on the R..> | 2026-05-22 20:44 | 75K | |
| Sweet, The - Block B..> | 2026-05-22 19:35 | 42K | |
| Swedish House Mafia ..> | 2026-05-22 20:11 | 15K | |
| Swedish House Mafia ..> | 2026-05-22 20:11 | 339K | |
| Swedish House Mafia ..> | 2026-05-22 20:11 | 102K | |
| Suzy Bogguss - Somed..> | 2026-05-22 20:27 | 146K | |
| Suzy Bogguss - Outbo..> | 2026-05-22 20:27 | 146K | |
| Suzy Bogguss - Letti..> | 2026-05-22 20:27 | 146K | |
| Suzy Bogguss - Just ..> | 2026-05-22 20:27 | 163K | |
| Suzy Bogguss - Drive..> | 2026-05-22 20:27 | 196K | |
| Suzy Bogguss - Aces.jpg | 2026-05-22 20:27 | 146K | |
| Suzi Quatro - Stumbl..> | 2026-05-22 19:35 | 49K | |
| Suzi Quatro - She's ..> | 2026-05-22 19:35 | 56K | |
| Suzi Quatro - If You..> | 2026-05-22 19:35 | 13K | |
| Suzi Quatro - Can Th..> | 2026-05-22 19:35 | 199K | |
| Suzi Quatro & Chris ..> | 2026-05-22 20:44 | 32K | |
| Suzanne Vega - Luka.jpg | 2026-05-22 20:44 | 64K | |
| Sutherland Brothers ..> | 2026-05-22 19:35 | 33K | |
| Survivor - Eye Of Th..> | 2026-05-22 19:44 | 52K | |
| Survivor - Burning H..> | 2026-05-22 19:44 | 26K | |
| Surfers - Windsurfin..> | 2026-05-22 19:35 | 89K | |
| Surf Mesa ft. Emilee..> | 2026-05-22 20:11 | 422K | |
| Supremes - You keep ..> | 2026-05-22 20:44 | 64K | |
| Supremes - Stop In T..> | 2026-05-22 20:44 | 150K | |
| Supremes - Reflectio..> | 2026-05-22 20:01 | 17K | |
| Supremes - Love is h..> | 2026-05-22 20:44 | 41K | |
| Supremes - Love Chil..> | 2026-05-22 19:35 | 28K | |
| Supremes - Come see ..> | 2026-05-22 20:44 | 41K | |
| Supremes - Baby love..> | 2026-05-22 20:44 | 41K | |
| Supremes & the Four ..> | 2026-05-22 19:35 | 40K | |
| Supertramp - The Log..> | 2026-05-22 19:35 | 32K | |
| Supertramp - Take Th..> | 2026-05-22 20:44 | 31K | |
| Supertramp - School.jpg | 2026-05-22 20:44 | 31K | |
| Supertramp - School ..> | 2026-05-22 19:35 | 177K | |
| Supertramp - Rudy.jpg | 2026-05-22 19:35 | 62K | |
| Supertramp - It's Ra..> | 2026-05-22 20:44 | 31K | |
| Supertramp - Hide In..> | 2026-05-22 19:35 | 62K | |
| Supertramp - Goodbye..> | 2026-05-22 19:35 | 37K | |
| Supertramp - Give A ..> | 2026-05-22 20:44 | 31K | |
| Supertramp - Give A ..> | 2026-05-22 19:35 | 91K | |
| Supertramp - From No..> | 2026-05-22 20:44 | 159K | |
| Supertramp - Fool's ..> | 2026-05-22 19:35 | 31K | |
| Supertramp - Dreamer..> | 2026-05-22 20:44 | 31K | |
| Supertramp - Dreamer..> | 2026-05-22 19:44 | 92K | |
| Supertramp - Crime O..> | 2026-05-22 19:35 | 159K | |
| Supertramp - Cannonb..> | 2026-05-22 19:44 | 20K | |
| Supertramp - Breakfa..> | 2026-05-22 19:35 | 37K | |
| Supertramp - Bloody ..> | 2026-05-22 20:44 | 159K | |
| SupermodeMEDUZA - Te..> | 2026-05-22 20:11 | 72K | |
| Supermode - Tell Me ..> | 2026-05-22 20:11 | 51K | |
| Sundance Kid - Doubl..> | 2026-05-22 20:01 | 56K | |
| Sunclub - Splash!.jpg | 2026-05-22 20:01 | 77K | |
| Sunclub - Movin' on.jpg | 2026-05-22 20:11 | 188K | |
| Sunclub - Fiesta Rel..> | 2026-05-22 20:11 | 44K | |
| Sunclub - Fiesta.jpg | 2026-05-22 20:01 | 197K | |
| Sunclub - Fiesta '98..> | 2026-05-22 20:01 | 20K | |
| Sunclub, The - Fiest..> | 2026-05-22 20:11 | 53K | |
| Sunblock Feat. Robin..> | 2026-05-22 20:11 | 88K | |
| Sugarhill Gang - Rap..> | 2026-05-22 19:35 | 36K | |
| Sugarhill Gang - Rap..> | 2026-05-22 19:44 | 37K | |
| Sugababes - Stronger..> | 2026-05-22 20:11 | 62K | |
| Sugababes - Round Ro..> | 2026-05-22 20:11 | 62K | |
| Sugababes - Push the..> | 2026-05-22 20:11 | 39K | |
| Sugababes - Hole In ..> | 2026-05-22 20:11 | 48K | |
| Sue Thompson - Norma..> | 2026-05-22 20:44 | 34K | |
| Sue Saad & The Next ..> | 2026-05-22 19:44 | 43K | |
| Styx - Sing For The ..> | 2026-05-22 19:35 | 21K | |
| Styx - Babe.jpg | 2026-05-22 20:44 | 35K | |
| Stylistics - You mak..> | 2026-05-22 19:35 | 39K | |
| Stylistics - Can't g..> | 2026-05-22 19:35 | 57K | |
| Style Council - Shou..> | 2026-05-22 20:01 | 65K | |
| Style Council - Shou..> | 2026-05-22 19:44 | 65K | |
| Style Council - My E..> | 2026-05-22 19:44 | 65K | |
| Studio Orkest O.L.V...> | 2026-05-22 20:44 | 53K | |
| Stu Philipps - Hello..> | 2026-05-22 20:27 | 42K | |
| Stromae - Tous Les M..> | 2026-05-22 20:11 | 17K | |
| Stromae - Ta Fête.jpg | 2026-05-22 20:11 | 17K | |
| Stromae - Papaoutai.jpg | 2026-05-22 20:11 | 62K | |
| Stromae - Formidable..> | 2026-05-22 20:11 | 62K | |
| Stromae - Alors On D..> | 2026-05-22 20:11 | 54K | |
| Stretch - Why Did Yo..> | 2026-05-22 19:35 | 284K | |
| Stray Cats - Runaway..> | 2026-05-22 19:44 | 26K | |
| Stray Cats - Rock Th..> | 2026-05-22 19:44 | 26K | |
| Stray Cats - (She's)..> | 2026-05-22 19:44 | 43K | |
| Strawberry Vocal Cho..> | 2026-05-22 19:44 | 56K | |
| Stranglers - Skin De..> | 2026-05-22 20:01 | 31K | |
| Stranglers - Golden ..> | 2026-05-22 20:44 | 56K | |
| Stranglers - Always ..> | 2026-05-22 20:11 | 27K | |
| Stranglers, The - Al..> | 2026-05-22 19:44 | 36K | |
| Storm - Storm.jpg | 2026-05-22 20:11 | 185K | |
| Stories - Brother Lo..> | 2026-05-22 19:35 | 67K | |
| Stone & Eric Charden..> | 2026-05-22 20:01 | 62K | |
| Stock, Aitken & Wate..> | 2026-05-22 19:44 | 86K | |
| Stingray & Sonic Dri..> | 2026-05-22 20:01 | 105K | |
| Sting - Russians.jpg | 2026-05-22 20:44 | 32K | |
| Sting - Love Is The ..> | 2026-05-22 19:44 | 30K | |
| Sting - If You Love ..> | 2026-05-22 19:44 | 30K | |
| Sting - If I Ever Lo..> | 2026-05-22 20:01 | 80K | |
| Sting - Fragile.jpg | 2026-05-22 20:44 | 43K | |
| Sting - Fields Of Go..> | 2026-05-22 20:44 | 80K | |
| Sting - Englishman I..> | 2026-05-22 19:44 | 22K | |
| Sting, Eric Clapton ..> | 2026-05-22 19:44 | 112K | |
| Sting & The Police -..> | 2026-05-22 20:01 | 56K | |
| Stig Rauno - Letkis.jpg | 2026-05-22 20:44 | 15K | |
| Stevie Wonder Ft. 98..> | 2026-05-22 20:11 | 534K | |
| Stevie Wonder - You ..> | 2026-05-22 20:44 | 40K | |
| Stevie Wonder - Yest..> | 2026-05-22 20:44 | 62K | |
| Stevie Wonder - Upti..> | 2026-05-22 19:35 | 146K | |
| Stevie Wonder - Upti..> | 2026-05-22 20:11 | 36K | |
| Stevie Wonder - Supe..> | 2026-05-22 20:44 | 40K | |
| Stevie Wonder - Supe..> | 2026-05-22 19:35 | 90K | |
| Stevie Wonder - Sir ..> | 2026-05-22 19:35 | 146K | |
| Stevie Wonder - Sign..> | 2026-05-22 19:35 | 226K | |
| Stevie Wonder - Part..> | 2026-05-22 20:11 | 70K | |
| Stevie Wonder - Part..> | 2026-05-22 19:44 | 65K | |
| Stevie Wonder - My C..> | 2026-05-22 20:44 | 62K | |
| Stevie Wonder - Mast..> | 2026-05-22 19:44 | 50K | |
| Stevie Wonder - Late..> | 2026-05-22 19:44 | 62K | |
| Stevie Wonder - Isn'..> | 2026-05-22 20:44 | 59K | |
| Stevie Wonder - I Ju..> | 2026-05-22 20:44 | 87K | |
| Stevie Wonder - High..> | 2026-05-22 19:44 | 32K | |
| Stevie Wonder - Happ..> | 2026-05-22 19:44 | 62K | |
| Stevie Wonder - For ..> | 2026-05-22 20:11 | 36K | |
| Stevie Wonder - Ebon..> | 2026-05-22 19:44 | 52K | |
| Stevie Wonder - Don'..> | 2026-05-22 19:35 | 37K | |
| Stevie Wonder - Do I..> | 2026-05-22 19:44 | 30K | |
| Stevie Wonder - Blow..> | 2026-05-22 20:44 | 146K | |
| Stevie Wonder - A pl..> | 2026-05-22 20:44 | 43K | |
| Stevie Wonder - Anot..> | 2026-05-22 20:01 | 70K | |
| Stevie Wonder & Baby..> | 2026-05-22 20:11 | 37K | |
| Stevie Nicks - Rooms..> | 2026-05-22 19:44 | 80K | |
| Steve Winwood - Whil..> | 2026-05-22 20:01 | 43K | |
| Steve Winwood - Whil..> | 2026-05-22 19:44 | 33K | |
| Steve Winwood - Vale..> | 2026-05-22 19:44 | 190K | |
| Steve Winwood - High..> | 2026-05-22 20:11 | 36K | |
| Steve Winwood - High..> | 2026-05-22 19:44 | 29K | |
| Steve Winwood - Back..> | 2026-05-22 20:11 | 36K | |
| Steve Wariner - You ..> | 2026-05-22 20:27 | 394K | |
| Steve Wariner - Wher..> | 2026-05-22 20:27 | 534K | |
| Steve Wariner - When..> | 2026-05-22 20:27 | 482K | |
| Steve Wariner - What..> | 2026-05-22 20:27 | 444K | |
| Steve Wariner - Two ..> | 2026-05-22 20:27 | 159K | |
| Steve Wariner - The ..> | 2026-05-22 20:27 | 316K | |
| Steve Wariner - The ..> | 2026-05-22 20:27 | 274K | |
| Steve Wariner - The ..> | 2026-05-22 20:27 | 379K | |
| Steve Wariner - Some..> | 2026-05-22 20:27 | 444K | |
| Steve Wariner - Smal..> | 2026-05-22 20:27 | 137K | |
| Steve Wariner - Lynd..> | 2026-05-22 20:27 | 316K | |
| Steve Wariner - Lone..> | 2026-05-22 20:27 | 274K | |
| Steve Wariner - Life..> | 2026-05-22 20:27 | 394K | |
| Steve Wariner - If I..> | 2026-05-22 20:27 | 38 | |
| Steve Wariner - I Sh..> | 2026-05-22 20:27 | 66K | |
| Steve Wariner - I Go..> | 2026-05-22 20:27 | 534K | |
| Steve Wariner - I'm ..> | 2026-05-22 20:27 | 325K | |
| Steve Wariner - Hear..> | 2026-05-22 20:27 | 444K | |
| Steve Wariner - Baby..> | 2026-05-22 20:27 | 1.4M | |
| Steve Wariner - All ..> | 2026-05-22 20:27 | 325K | |
| Steve Wariner - A Wo..> | 2026-05-22 20:27 | 210K | |
| Steve Rowland & The ..> | 2026-05-22 19:35 | 15K | |
| Steve Miller Band - ..> | 2026-05-22 19:35 | 54K | |
| Steve Miller Band - ..> | 2026-05-22 19:35 | 257K | |
| Steve Miller Band - ..> | 2026-05-22 19:44 | 76K | |
| Steve Miller Band - ..> | 2026-05-22 20:44 | 36K | |
| Steve Miller Band - ..> | 2026-05-22 19:44 | 19K | |
| Steve Harley & Cockn..> | 2026-05-22 19:35 | 597K | |
| Steve Harley & Cockn..> | 2026-05-22 19:35 | 43K | |
| Steve Harley & Cockn..> | 2026-05-22 20:01 | 84K | |
| Steve Forbert - Rome..> | 2026-05-22 19:35 | 162K | |
| Steve Earle - Guitar..> | 2026-05-22 20:27 | 82K | |
| Steve Earle - Copper..> | 2026-05-22 20:27 | 98K | |
| Steve Arrington - Fe..> | 2026-05-22 19:44 | 37K | |
| Steve Allen - Love I..> | 2026-05-22 19:44 | 36K | |
| Steve Allen - Letter..> | 2026-05-22 19:44 | 56K | |
| Steps - Tragedy.jpg | 2026-05-22 20:01 | 45K | |
| Steps - One For Sorr..> | 2026-05-22 20:01 | 45K | |
| Steps - Last Thing O..> | 2026-05-22 20:01 | 45K | |
| Steps - Heartbeat.jpg | 2026-05-22 20:01 | 45K | |
| Steps - 5, 6, 7, 8.jpg | 2026-05-22 20:01 | 45K | |
| Steppenwolf - Born t..> | 2026-05-22 20:44 | 47K | |
| Stephen Stills - Mar..> | 2026-05-22 19:35 | 537K | |
| Stephen 'tin Tin' Du..> | 2026-05-22 20:44 | 166K | |
| Stephanie Mills - Th..> | 2026-05-22 19:44 | 68K | |
| Stephanie Mills - Ne..> | 2026-05-22 19:44 | 17K | |
| Stephanie Mills - Me..> | 2026-05-22 20:11 | 44K | |
| Stephanie - Ouragan.jpg | 2026-05-22 19:44 | 16K | |
| Stephanie - Irrisist..> | 2026-05-22 19:44 | 16K | |
| Stef Bos - Papa.jpg | 2026-05-22 20:44 | 42K | |
| Stef Bos & Bob Saven..> | 2026-05-22 20:01 | 41K | |
| Steely Dan - Rikki D..> | 2026-05-22 20:44 | 43K | |
| Steely Dan - Do it a..> | 2026-05-22 19:35 | 24K | |
| Steely Dan - Do It A..> | 2026-05-22 20:01 | 47K | |
| Steeleye Span - All ..> | 2026-05-22 19:35 | 46K | |
| Steam - Na Na Hey He..> | 2026-05-22 20:44 | 252K | |
| Stealers Wheel - Stu..> | 2026-05-22 19:35 | 59K | |
| Stealers Wheel - Lat..> | 2026-05-22 19:35 | 59K | |
| Stax - Mary Had A Li..> | 2026-05-22 20:01 | 36K | |
| Status Quo - Whateve..> | 2026-05-22 19:35 | 50K | |
| Status Quo - What Yo..> | 2026-05-22 19:44 | 55K | |
| Status Quo - The Wan..> | 2026-05-22 19:44 | 73K | |
| Status Quo - Roll Ov..> | 2026-05-22 19:35 | 27K | |
| Status Quo - Rockin'..> | 2026-05-22 19:35 | 92K | |
| Status Quo - Rockin'..> | 2026-05-22 20:11 | 77K | |
| Status Quo - Rain.jpg | 2026-05-22 19:35 | 207K | |
| Status Quo - In The ..> | 2026-05-22 20:44 | 50K | |
| Status Quo - Down Do..> | 2026-05-22 19:35 | 238K | |
| Starsplash - Cold As..> | 2026-05-22 20:11 | 101K | |
| Stars on 45 - Stars ..> | 2026-05-22 19:43 | 96K | |
| Starship - We Built ..> | 2026-05-22 19:44 | 66K | |
| Starship - Sara.jpg | 2026-05-22 20:44 | 34K | |
| Starship - Nothing's..> | 2026-05-22 19:43 | 235K | |
| Stars On 45 - The Gr..> | 2026-05-22 19:43 | 50K | |
| Stars On 45 - Stars ..> | 2026-05-22 19:43 | 63K | |
| Stars On 45 - Stars ..> | 2026-05-22 20:01 | 75K | |
| Stars On 45 - Stars ..> | 2026-05-22 19:43 | 42K | |
| Stars On 45 - Stars ..> | 2026-05-22 19:43 | 143K | |
| Stars On 45 - Stars ..> | 2026-05-22 19:43 | 75K | |
| Stars On 45 - Proudl..> | 2026-05-22 19:43 | 61K | |
| Stars On 45 - More S..> | 2026-05-22 19:43 | 50K | |
| Starmaker (K-Otic) -..> | 2026-05-22 20:11 | 99K | |
| Starland Vocal Band ..> | 2026-05-22 19:35 | 300K | |
| Stardust - Music Sou..> | 2026-05-22 20:11 | 31K | |
| Star Sisters - Hoora..> | 2026-05-22 19:43 | 54K | |
| Star Sisters - A Tri..> | 2026-05-22 19:43 | 48K | |
| Staple Singers - Res..> | 2026-05-22 19:35 | 354K | |
| Stan Ridgway - Camou..> | 2026-05-22 20:44 | 48K | |
| Stan Ridgway - Calli..> | 2026-05-22 19:43 | 69K | |
| Stan Getz & Astrud G..> | 2026-05-22 19:43 | 40K | |
| Stampeders - Hit The..> | 2026-05-22 19:43 | 29K | |
| Stacy Lattisaw - Jum..> | 2026-05-22 19:43 | 97K | |
| Squeeze - Labelled W..> | 2026-05-22 20:27 | 42K | |
| Sq-1 - Dance! (Airpl..> | 2026-05-22 20:11 | 295K | |
| Springwater - I Will..> | 2026-05-22 19:35 | 131K | |
| Springfields - Islan..> | 2026-05-22 20:44 | 219K | |
| Spotnicks - Orange B..> | 2026-05-22 19:35 | 120K | |
| Spotnicks - Amapola.jpg | 2026-05-22 19:43 | 132K | |
| Spooky & Sue - You T..> | 2026-05-22 19:35 | 82K | |
| Spooky & Sue - Swing..> | 2026-05-22 19:35 | 82K | |
| Spooks - Things I've..> | 2026-05-22 20:11 | 49K | |
| Spooks -Things I've ..> | 2026-05-22 20:44 | 49K | |
| Split Enz - Message ..> | 2026-05-22 19:43 | 52K | |
| Split Enz - I Hope I..> | 2026-05-22 19:43 | 27K | |
| Spinners - Working M..> | 2026-05-22 19:35 | 53K | |
| Spin Doctors - Two P..> | 2026-05-22 20:01 | 52K | |
| Spiller - Groovejet ..> | 2026-05-22 20:11 | 27K | |
| Spider Murphy Gang -..> | 2026-05-22 19:43 | 49K | |
| Spider Murphy Gang -..> | 2026-05-22 19:43 | 54K | |
| Spice Girls - Who Do..> | 2026-05-22 20:01 | 45K | |
| Spice Girls - Wannab..> | 2026-05-22 20:11 | 18K | |
| Spice Girls - Wannab..> | 2026-05-22 20:01 | 24K | |
| Spice Girls - Viva F..> | 2026-05-22 20:00 | 53K | |
| Spice Girls - Too Mu..> | 2026-05-22 20:00 | 35K | |
| Spice Girls - Stop.jpg | 2026-05-22 20:00 | 52K | |
| Spice Girls - Spice ..> | 2026-05-22 20:11 | 32K | |
| Spice Girls - Say Yo..> | 2026-05-22 20:00 | 24K | |
| Spice Girls - Mama.jpg | 2026-05-22 20:00 | 45K | |
| Spice Girls - 2 Beco..> | 2026-05-22 20:00 | 24K | |
| Spencer Davis Group ..> | 2026-05-22 20:44 | 60K | |
| Spencer Davis Group ..> | 2026-05-22 19:35 | 80K | |
| Specials - A Message..> | 2026-05-22 19:43 | 33K | |
| Special D. - Forever..> | 2026-05-22 20:11 | 136K | |
| Special Aka - Nelson..> | 2026-05-22 19:43 | 35K | |
| Sparks -This Town Ai..> | 2026-05-22 19:35 | 37K | |
| Spargo - You And Me.jpg | 2026-05-22 19:43 | 69K | |
| Spargo - One Night A..> | 2026-05-22 19:43 | 46K | |
| Spargo - Just For Yo..> | 2026-05-22 19:43 | 46K | |
| Spargo - Hip Hap Hop..> | 2026-05-22 19:43 | 20K | |
| Spanic - Sister Gold..> | 2026-05-22 20:44 | 45K | |
| Spandau Ballet -True..> | 2026-05-22 19:43 | 21K | |
| Spandau Ballet - Thr..> | 2026-05-22 19:43 | 58K | |
| Spandau Ballet - Onl..> | 2026-05-22 19:43 | 21K | |
| Spandau Ballet - I'l..> | 2026-05-22 19:43 | 143K | |
| Spandau Ballet - Gol..> | 2026-05-22 19:43 | 99K | |
| Spagna - Easy Lady.jpg | 2026-05-22 19:43 | 36K | |
| Spagna - Call Me.jpg | 2026-05-22 19:43 | 65K | |
| Space - Magic Fly.jpg | 2026-05-22 19:35 | 38K | |
| Sounds Orchestral - ..> | 2026-05-22 20:44 | 14K | |
| Soulful Dynamics - M..> | 2026-05-22 19:35 | 149K | |
| Soul Sister - The Wa..> | 2026-05-22 19:43 | 33K | |
| Soul Ii Soul - Keep ..> | 2026-05-22 20:00 | 54K | |
| Soul Ii Soul - Back ..> | 2026-05-22 19:43 | 47K | |
| Soul II Soul - Get A..> | 2026-05-22 20:11 | 43K | |
| Soul Asylum - Runawa..> | 2026-05-22 20:00 | 49K | |
| Sophie Ellis-BextorP..> | 2026-05-22 20:11 | 2.2M | |
| Sophie Ellis-BextorD..> | 2026-05-22 20:11 | 36K | |
| Sophie Ellis-Bextor ..> | 2026-05-22 20:11 | 36K | |
| Sophie B. Hawkins - ..> | 2026-05-22 20:00 | 35K | |
| Sophie B. Hawkins - ..> | 2026-05-22 20:11 | 53K | |
| Sophia George - Girl..> | 2026-05-22 19:43 | 40K | |
| Sonny Wern; Still Lo..> | 2026-05-22 20:11 | 760K | |
| Sonny James - Young ..> | 2026-05-22 20:27 | 336K | |
| Sonny & Cher - The b..> | 2026-05-22 20:44 | 80K | |
| Sonny & Cher - Littl..> | 2026-05-22 20:44 | 80K | |
| Sonny & Cher - I got..> | 2026-05-22 20:44 | 44K | |
| Sommerset - There Go..> | 2026-05-22 19:35 | 62K | |
| Sommerset - The Fren..> | 2026-05-22 20:27 | 55K | |
| Sommerset - Lovelett..> | 2026-05-22 20:27 | 62K | |
| Sommerset - Another ..> | 2026-05-22 20:27 | 51K | |
| Sommerset - Almost P..> | 2026-05-22 20:44 | 100K | |
| Something Happens - ..> | 2026-05-22 20:00 | 60K | |
| Some Guys Have All t..> | 2026-05-22 19:35 | 47K | |
| Solomon King - She W..> | 2026-05-22 20:00 | 44K | |
| Solid Harmony - I'll..> | 2026-05-22 20:00 | 57K | |
| Solid Harmonie - I W..> | 2026-05-22 20:00 | 57K | |
| Soft Cell - Torch.jpg | 2026-05-22 19:43 | 37K | |
| Soft Cell - Tainted ..> | 2026-05-22 19:43 | 37K | |
| Soeur Sourire - Domi..> | 2026-05-22 20:44 | 205K | |
| Soeur Sourice - Domi..> | 2026-05-22 20:00 | 45K | |
| Soca Boys - Follow T..> | 2026-05-22 20:00 | 75K | |
| Snowy White - Bird O..> | 2026-05-22 20:44 | 36K | |
| Snow Patrol - Shut Y..> | 2026-05-22 20:11 | 61K | |
| Snow Patrol - Run.jpg | 2026-05-22 20:11 | 54K | |
| Snow Patrol - Just S..> | 2026-05-22 20:11 | 24K | |
| Snow Patrol - Chasin..> | 2026-05-22 20:11 | 96K | |
| Snow - Informer.jpg | 2026-05-22 20:00 | 41K | |
| Snoopy -It's All In ..> | 2026-05-22 19:35 | 18K | |
| Snoopy - It's All In..> | 2026-05-22 19:43 | 18K | |
| Sniff 'n The Tears -..> | 2026-05-22 20:44 | 47K | |
| Snap - Welcome To To..> | 2026-05-22 20:00 | 51K | |
| Snap - The First The..> | 2026-05-22 20:00 | 39K | |
| Snap - Ooops Up.jpg | 2026-05-22 20:00 | 74K | |
| Snap - Exterminate.jpg | 2026-05-22 20:00 | 17K | |
| Snap - Colour Of Lov..> | 2026-05-22 20:00 | 243K | |
| Snap! - The Power.jpg | 2026-05-22 20:00 | 84K | |
| Snap! - Rhythm Is A ..> | 2026-05-22 20:00 | 26K | |
| Snap! - Ooops Up!.jpg | 2026-05-22 20:00 | 445K | |
| Snap! - Megamix.jpg | 2026-05-22 20:00 | 1.4M | |
| Snap! - Mary Had A L..> | 2026-05-22 20:00 | 21K | |
| Snap! - Exterminate ..> | 2026-05-22 20:00 | 17K | |
| Snap! - Cult Of Snap..> | 2026-05-22 20:00 | 94K | |
| Smyle - It's Gonna B..> | 2026-05-22 19:35 | 7.5K | |
| Smokie - Oh Carol.jpg | 2026-05-22 19:35 | 106K | |
| Smokie - Needles And..> | 2026-05-22 19:35 | 106K | |
| Smokie - Mexican Gir..> | 2026-05-22 19:35 | 46K | |
| Smokie - Living Next..> | 2026-05-22 20:44 | 82K | |
| Smokie - Lay Back In..> | 2026-05-22 20:44 | 40K | |
| Smokie - It's Your L..> | 2026-05-22 19:35 | 146K | |
| Smokie - I'll Meet Y..> | 2026-05-22 19:35 | 66K | |
| Smokie - For A Few D..> | 2026-05-22 19:35 | 121K | |
| Smokey Robinson And ..> | 2026-05-22 19:43 | 84K | |
| Smokey Robinson & Th..> | 2026-05-22 20:44 | 359K | |
| Smokey Robinson & Th..> | 2026-05-22 20:44 | 32K | |
| Small Faces - Lazy S..> | 2026-05-22 20:44 | 51K | |
| Small Faces - Itchyc..> | 2026-05-22 20:44 | 51K | |
| Sly Fox - Let's Go A..> | 2026-05-22 19:43 | 31K | |
| Sly & The Family Sto..> | 2026-05-22 19:35 | 84K | |
| Slim Whitman - Tenne..> | 2026-05-22 20:26 | 42K | |
| Slim Whitman - Rose ..> | 2026-05-22 20:26 | 244K | |
| Slim Whitman - India..> | 2026-05-22 20:26 | 169K | |
| Slade - Merry Xmas E..> | 2026-05-22 19:35 | 203K | |
| Slade - Far Far Away..> | 2026-05-22 19:35 | 199K | |
| Slade - Cum On Feel ..> | 2026-05-22 19:35 | 48K | |
| Skylark - Wildflower..> | 2026-05-22 20:00 | 10K | |
| Sky - Toccata.jpg | 2026-05-22 19:43 | 53K | |
| Skunk Anansie - Hedo..> | 2026-05-22 20:00 | 32K | |
| Skrillex & Diplo Ft...> | 2026-05-22 20:11 | 115K | |
| Skipper Wise - Stand..> | 2026-05-22 20:00 | 25K | |
| Skip Ewing - The Gos..> | 2026-05-22 20:26 | 369K | |
| Skip Ewing - It's Yo..> | 2026-05-22 20:26 | 66K | |
| Skip Ewing - I Don't..> | 2026-05-22 20:26 | 66K | |
| Skip Ewing - Christm..> | 2026-05-22 20:26 | 39K | |
| Skeeter Davis - The ..> | 2026-05-22 20:26 | 351K | |
| Sixpence None The Ri..> | 2026-05-22 20:00 | 49K | |
| Siw Malmkvist - Lieb..> | 2026-05-22 20:00 | 40K | |
| Sita - Happy.jpg | 2026-05-22 20:11 | 55K | |
| Sita & Co - Dance Th..> | 2026-05-22 20:11 | 47K | |
| Sita & Bart - I was ..> | 2026-05-22 20:44 | 12K | |
| Sister Sledge - We A..> | 2026-05-22 19:43 | 38K | |
| Sister Sledge - We A..> | 2026-05-22 20:00 | 43K | |
| Sister Sledge - We A..> | 2026-05-22 19:35 | 42K | |
| Sister Sledge - Thin..> | 2026-05-22 20:00 | 61K | |
| Sister Sledge - Lost..> | 2026-05-22 19:43 | 37K | |
| Sister Sledge - Lost..> | 2026-05-22 19:35 | 74K | |
| Sister Sledge - He'..> | 2026-05-22 19:43 | 47K | |
| Sister Sledge - He's..> | 2026-05-22 19:35 | 26K | |
| Sister Sledge - Fran..> | 2026-05-22 19:43 | 51K | |
| Sister Sledge - All ..> | 2026-05-22 19:43 | 37K | |
| Sisqo Ft. Foxy Brown..> | 2026-05-22 20:11 | 68K | |
| Sisqo - Got To Get I..> | 2026-05-22 20:11 | 50K | |
| Sir Henry & his Butl..> | 2026-05-22 20:44 | 58K | |
| Sir Douglas Quintet ..> | 2026-05-22 20:44 | 710K | |
| Sir Douglas Quintet ..> | 2026-05-22 20:44 | 208K | |
| Sinitta - Toy Boy.jpg | 2026-05-22 19:43 | 243K | |
| Sinitta - Right Back..> | 2026-05-22 19:43 | 31K | |
| Sin With Sebastian -..> | 2026-05-22 20:00 | 63K | |
| Sinéad O'connor - W..> | 2026-05-22 20:44 | 7.8K | |
| Sinéad O'connor - T..> | 2026-05-22 19:43 | 23K | |
| Sinéad O'connor - S..> | 2026-05-22 20:44 | 7.8K | |
| Sinéad O'connor - S..> | 2026-05-22 20:44 | 7.8K | |
| Sinéad O'connor - S..> | 2026-05-22 20:44 | 7.8K | |
| Sinéad O'connor - N..> | 2026-05-22 20:00 | 32K | |
| Sinéad O'connor - L..> | 2026-05-22 20:44 | 7.8K | |
| Sinéad O'connor - I..> | 2026-05-22 20:44 | 7.8K | |
| Sinéad O'connor - H..> | 2026-05-22 20:44 | 7.8K | |
| Sinéad O'connor - G..> | 2026-05-22 20:44 | 7.8K | |
| Sinéad O'connor - D..> | 2026-05-22 20:44 | 7.8K | |
| Sinéad O'connor - D..> | 2026-05-22 20:44 | 7.8K | |
| Sinéad O'connor - B..> | 2026-05-22 20:44 | 7.8K | |
| Sinéad O'connor - B..> | 2026-05-22 20:44 | 7.8K | |
| Sinéad O’Connor -..> | 2026-05-22 19:43 | 32K | |
| Simply Red - Stars.jpg | 2026-05-22 20:00 | 22K | |
| Simply Red - Somethi..> | 2026-05-22 20:00 | 22K | |
| Simply Red - Remembe..> | 2026-05-22 20:00 | 38K | |
| Simply Red - Money's..> | 2026-05-22 19:43 | 80K | |
| Simply Red - Jericho..> | 2026-05-22 20:11 | 58K | |
| Simply Red - Jericho..> | 2026-05-22 19:43 | 58K | |
| Simply Red - If You ..> | 2026-05-22 20:44 | 41K | |
| Simply Red - Holding..> | 2026-05-22 19:43 | 153K | |
| Simply Red - Fake.jpg | 2026-05-22 20:11 | 24K | |
| Simply Red - Fairgro..> | 2026-05-22 20:00 | 67K | |
| Simple Minds - Water..> | 2026-05-22 20:00 | 55K | |
| Simple Minds - The A..> | 2026-05-22 19:43 | 79K | |
| Simple Minds - Someo..> | 2026-05-22 20:00 | 75K | |
| Simple Minds - Sanct..> | 2026-05-22 20:11 | 42K | |
| Simple Minds - Promi..> | 2026-05-22 19:43 | 94K | |
| Simple Minds - Let T..> | 2026-05-22 20:00 | 22K | |
| Simple Minds - Don't..> | 2026-05-22 19:43 | 59K | |
| Simple Minds - Belfa..> | 2026-05-22 20:44 | 37K | |
| Simple Minds - All T..> | 2026-05-22 20:00 | 47K | |
| Simple Minds - Alive..> | 2026-05-22 19:43 | 59K | |
| Simon Webbe - No Wor..> | 2026-05-22 20:11 | 26K | |
| Simon Webbe - Coming..> | 2026-05-22 20:44 | 37K | |
| Simon & Garfunkel - ..> | 2026-05-22 20:44 | 107K | |
| Simon & Garfunkel - ..> | 2026-05-22 20:44 | 36K | |
| Simon & Garfunkel - ..> | 2026-05-22 20:44 | 53K | |
| Simon & Garfunkel - ..> | 2026-05-22 20:44 | 49K | |
| Simon & Garfunkel - ..> | 2026-05-22 20:43 | 47K | |
| Simon & Garfunkel - ..> | 2026-05-22 20:43 | 37K | |
| Simon & Garfunkel - ..> | 2026-05-22 20:43 | 83K | |
| Simon & Garfunkel - ..> | 2026-05-22 19:35 | 219K | |
| Simon & Garfunkel - ..> | 2026-05-22 20:43 | 83K | |
| Simon & Garfunkel - ..> | 2026-05-22 20:43 | 36K | |
| Silvio - I'm Your So..> | 2026-05-22 19:43 | 32K | |
| Silver Pozzoli - Ste..> | 2026-05-22 19:43 | 51K | |
| Silver Pozzoli - Aro..> | 2026-05-22 19:43 | 29K | |
| Silver Convention - ..> | 2026-05-22 19:35 | 274K | |
| Silver Convention - ..> | 2026-05-22 19:35 | 55K | |
| Silkie - You've got ..> | 2026-05-22 20:43 | 12K | |
| Sigurd Barrett - Fli..> | 2026-05-22 20:11 | 32K | |
| Sidney Samson - Rive..> | 2026-05-22 20:11 | 85K | |
| Sidney Samson - Rive..> | 2026-05-22 20:11 | 85K | |
| Sia Ft Sean Paul - C..> | 2026-05-22 20:10 | 25K | |
| Sia - Chandelier.jpg | 2026-05-22 20:10 | 25K | |
| Sia & David Guetta -..> | 2026-05-22 20:10 | 135K | |
| Shuffles - Cha La La..> | 2026-05-22 20:43 | 86K | |
| Showtek - We like to..> | 2026-05-22 20:10 | 95K | |
| Showtek & Justin Pri..> | 2026-05-22 20:10 | 55K | |
| Showaddywaddy - Why ..> | 2026-05-22 19:43 | 73K | |
| Showaddywaddy - Unde..> | 2026-05-22 19:35 | 74K | |
| Shouse - love tonigh..> | 2026-05-22 20:10 | 64K | |
| Shorts -Je Suis Tu E..> | 2026-05-22 19:43 | 80K | |
| Shorts - Comment Ca ..> | 2026-05-22 19:43 | 313K | |
| Shola Ama - You Migh..> | 2026-05-22 20:10 | 26K | |
| Shoes - Osaka.jpg | 2026-05-22 19:35 | 70K | |
| Shoes - Na na na.jpg | 2026-05-22 20:43 | 84K | |
| Shocking Blue - Venu..> | 2026-05-22 20:43 | 71K | |
| Shocking Blue - Venu..> | 2026-05-22 19:35 | 40K | |
| Shocking Blue - Neve..> | 2026-05-22 20:43 | 75K | |
| Shirts - Tell Me You..> | 2026-05-22 19:35 | 223K | |
| Shirley Zwerus - Hee..> | 2026-05-22 19:43 | 103K | |
| Shirley Bassey - Thi..> | 2026-05-22 19:35 | 29K | |
| Shirley Bassey - Thi..> | 2026-05-22 20:10 | 554K | |
| Shirley Bassey - The..> | 2026-05-22 19:35 | 55K | |
| Shirley Bassey - The..> | 2026-05-22 20:43 | 33K | |
| Shirley Bassey - Som..> | 2026-05-22 20:43 | 71K | |
| Shirley Bassey - Nev..> | 2026-05-22 19:35 | 262K | |
| Shirley Bassey - Lov..> | 2026-05-22 20:43 | 66K | |
| Shirley Bassey - Gol..> | 2026-05-22 20:43 | 80K | |
| Shirley Bassey - Dia..> | 2026-05-22 20:10 | 28K | |
| Shirley Bassey - Big..> | 2026-05-22 20:10 | 26K | |
| Shirley And Company ..> | 2026-05-22 20:00 | 120K | |
| Shirley & Company -S..> | 2026-05-22 19:35 | 40K | |
| Shirley & Company - ..> | 2026-05-22 19:35 | 294K | |
| Shirak - Uhuh.jpg | 2026-05-22 20:10 | 47K | |
| Sheryl Lee Ralph - I..> | 2026-05-22 20:00 | 67K | |
| Sheryl Lee Ralph - I..> | 2026-05-22 19:43 | 21K | |
| Sheryl Crow - All I ..> | 2026-05-22 20:43 | 56K | |
| Sherbet - Howzat.jpg | 2026-05-22 19:35 | 253K | |
| Shepstone & Dibbens ..> | 2026-05-22 19:35 | 10K | |
| Sheppard - Learning ..> | 2026-05-22 20:43 | 48K | |
| Sheppard - Geronimo.jpg | 2026-05-22 20:10 | 58K | |
| Sheppard - Die Young..> | 2026-05-22 20:10 | 25K | |
| Sheppard - Coming Ho..> | 2026-05-22 20:10 | 57K | |
| Shenandoah - Two Doz..> | 2026-05-22 20:26 | 226K | |
| Shenandoah - The Chu..> | 2026-05-22 20:26 | 104K | |
| Shenandoah - Sunday ..> | 2026-05-22 20:26 | 104K | |
| Shenandoah - Somewhe..> | 2026-05-22 20:26 | 5.1M | |
| Shenandoah - Rock My..> | 2026-05-22 20:26 | 48K | |
| Shenandoah - Next to..> | 2026-05-22 20:26 | 104K | |
| Sheila E - The Glamo..> | 2026-05-22 19:43 | 36K | |
| Sheila E - The Belle..> | 2026-05-22 19:43 | 52K | |
| Sheila E - A Love Bi..> | 2026-05-22 19:43 | 36K | |
| Sheila & The Black D..> | 2026-05-22 19:35 | 22K | |
| Sheila & Black Devot..> | 2026-05-22 19:35 | 101K | |
| Sheila & B. Devotion..> | 2026-05-22 20:00 | 35K | |
| Sheena Easton - Morn..> | 2026-05-22 19:43 | 11K | |
| Sheena Easton - For ..> | 2026-05-22 20:43 | 47K | |
| Sheena Easton - Foll..> | 2026-05-22 20:00 | 114K | |
| Shawn Mendes - Treat..> | 2026-05-22 20:10 | 52K | |
| Shawn Mendes - There..> | 2026-05-22 20:10 | 52K | |
| Shawn Mendes - Stitc..> | 2026-05-22 20:10 | 40K | |
| Shawn Mendes - Mercy..> | 2026-05-22 20:10 | 52K | |
| Shawn Mendes - In My..> | 2026-05-22 20:10 | 56K | |
| Shawn Mendes - If I ..> | 2026-05-22 20:10 | 19K | |
| Shawn Mendes & Camil..> | 2026-05-22 20:10 | 33K | |
| Shawn Elliott - Sham..> | 2026-05-22 20:43 | 45K | |
| Sharon Redd - In The..> | 2026-05-22 19:43 | 47K | |
| Sharon Brown - I Spe..> | 2026-05-22 20:00 | 74K | |
| Sharif Dean - Do You..> | 2026-05-22 20:43 | 8.7K | |
| Sharam - Patt (Party..> | 2026-05-22 20:10 | 80K | |
| Sharam - P.A.T.T. (P..> | 2026-05-22 20:10 | 80K | |
| Shapeshifters - Lola..> | 2026-05-22 20:10 | 21K | |
| Shannon - Let The Mu..> | 2026-05-22 19:43 | 49K | |
| Shanice - I Love You..> | 2026-05-22 20:00 | 49K | |
| Shania Twain - You W..> | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - You'v..> | 2026-05-22 20:43 | 43K | |
| Shania Twain - You'v..> | 2026-05-22 20:43 | 41K | |
| Shania Twain - You'r..> | 2026-05-22 20:43 | 60K | |
| Shania Twain - You..> | 2026-05-22 20:26 | 10K | |
| Shania Twain - Whose..> | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - When.jpg | 2026-05-22 20:26 | 286K | |
| Shania Twain - Whate..> | 2026-05-22 20:26 | 10K | |
| Shania Twain - What ..> | 2026-05-22 20:26 | 77K | |
| Shania Twain - Up!.jpg | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - Today..> | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - The w..> | 2026-05-22 20:43 | 37K | |
| Shania Twain - The G..> | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - That ..> | 2026-05-22 20:43 | 44K | |
| Shania Twain - Shani..> | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - Shani..> | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - Rock ..> | 2026-05-22 20:26 | 10K | |
| Shania Twain - Rock ..> | 2026-05-22 20:26 | 24K | |
| Shania Twain - Red S..> | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - Openi..> | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - No On..> | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - Man !..> | 2026-05-22 20:43 | 67K | |
| Shania Twain - Love ..> | 2026-05-22 20:26 | 10K | |
| Shania Twain - Ka-Ch..> | 2026-05-22 20:43 | 38K | |
| Shania Twain - I Won..> | 2026-05-22 20:26 | 10K | |
| Shania Twain - I Ain..> | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - I'm G..> | 2026-05-22 20:43 | 31K | |
| Shania Twain - I’m..> | 2026-05-22 20:26 | 10K | |
| Shania Twain - Honey..> | 2026-05-22 20:43 | 60K | |
| Shania Twain - Don't..> | 2026-05-22 20:43 | 44K | |
| Shania Twain - Don't..> | 2026-05-22 20:43 | 60K | |
| Shania Twain - Don..> | 2026-05-22 20:26 | 58K | |
| Shania Twain -Come O..> | 2026-05-22 20:43 | 87K | |
| Shania Twain - Carri..> | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - C'est..> | 2026-05-22 20:43 | 23K | |
| Shania Twain - Black..> | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - Black..> | 2026-05-22 20:26 | 10K | |
| Shania Twain - Any M..> | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - (If Y..> | 2026-05-22 20:26 | 6.7K | |
| Shania Twain - (If Y..> | 2026-05-22 20:26 | 1.1M | |
| Shangri-Las - Leader..> | 2026-05-22 19:43 | 37K | |
| Shalamar - The Secon..> | 2026-05-22 19:43 | 60K | |
| Shalamar - Take That..> | 2026-05-22 20:00 | 62K | |
| Shalamar - I can mak..> | 2026-05-22 19:43 | 38K | |
| Shalamar - A Night T..> | 2026-05-22 19:43 | 54K | |
| Shalamar - A Night ..> | 2026-05-22 20:00 | 43K | |
| Shakira Feat. Wyclef..> | 2026-05-22 20:10 | 48K | |
| Shakira Feat. Santan..> | 2026-05-22 20:10 | 36K | |
| Shakira - Whenever, ..> | 2026-05-22 20:10 | 45K | |
| Shakira - Waka Waka ..> | 2026-05-22 20:10 | 52K | |
| Shakira - Waka Waka ..> | 2026-05-22 20:10 | 52K | |
| Shakira - Underneath..> | 2026-05-22 20:43 | 38K | |
| Shakira - Hips Don't..> | 2026-05-22 20:10 | 36K | |
| Shakira - Did It Aga..> | 2026-05-22 20:10 | 296K | |
| Shakin' Stevens - Yo..> | 2026-05-22 19:43 | 48K | |
| Shakin' Stevens - Th..> | 2026-05-22 19:43 | 48K | |
| Shakin' Stevens - Oh..> | 2026-05-22 19:43 | 35K | |
| Shakin' Stevens - Gr..> | 2026-05-22 19:43 | 61K | |
| Shakespears - Summer..> | 2026-05-22 19:35 | 62K | |
| Shake - You Know I L..> | 2026-05-22 19:35 | 109K | |
| Shakatak - Watching ..> | 2026-05-22 19:43 | 39K | |
| Shakatak - Watching ..> | 2026-05-22 20:10 | 73K | |
| Shakatak - Easier Sa..> | 2026-05-22 19:43 | 67K | |
| Shakatak - Down On T..> | 2026-05-22 19:43 | 39K | |
| Shakatak - Dark Is T..> | 2026-05-22 19:43 | 67K | |
| Shaggy Ft. Brian & T..> | 2026-05-22 20:10 | 42K | |
| Shaggy Featuring Bri..> | 2026-05-22 20:10 | 42K | |
| Shaggy - Oh Carolina..> | 2026-05-22 20:00 | 74K | |
| Shaggy - It Wasn't M..> | 2026-05-22 20:10 | 25K | |
| Shaggy - Boombastic.jpg | 2026-05-22 20:00 | 16K | |
| Shaggy - Angel (Radi..> | 2026-05-22 20:10 | 17K | |
| Shaggy & Ricardo 'Ri..> | 2026-05-22 20:10 | 17K | |
| Shadows - Wonderful ..> | 2026-05-22 20:43 | 26K | |
| Shadows -Theme From ..> | 2026-05-22 19:35 | 24K | |
| Shadows - Theme From..> | 2026-05-22 20:00 | 43K | |
| Shadows - Kon-Tiki.jpg | 2026-05-22 20:43 | 290K | |
| Shadows - Guitar Tan..> | 2026-05-22 20:00 | 54K | |
| Shadows - Foot Tappe..> | 2026-05-22 20:00 | 26K | |
| Shadows - F.b.i..jpg | 2026-05-22 20:43 | 26K | |
| Shadows - Atlantis.jpg | 2026-05-22 19:35 | 729K | |
| Shadows - Apache.jpg | 2026-05-22 20:43 | 54K | |
| Shadows - 36-24-36.jpg | 2026-05-22 20:10 | 37K | |
| Shaboozey - A Bar So..> | 2026-05-22 20:10 | 345K | |
| Sgt. Barry Sadler - ..> | 2026-05-22 20:43 | 37K | |
| Sertab Erener - Ever..> | 2026-05-22 20:10 | 188K | |
| Sertab - Every Way T..> | 2026-05-22 20:10 | 189K | |
| Sergio Mendes Feat. ..> | 2026-05-22 20:10 | 82K | |
| Sergio Mendes & Bras..> | 2026-05-22 20:43 | 81K | |
| Sergio Mendes & Bras..> | 2026-05-22 20:43 | 49K | |
| Serge Gainsbourg & J..> | 2026-05-22 19:35 | 37K | |
| Serebro - Mi Mi Mi.jpg | 2026-05-22 20:10 | 128K | |
| Sequencial - Psychot..> | 2026-05-22 20:00 | 102K | |
| September - Cry For ..> | 2026-05-22 20:10 | 29K | |
| Selector - On My Rad..> | 2026-05-22 19:43 | 44K | |
| Seemon & Marijke - I..> | 2026-05-22 20:43 | 47K | |
| Seekers - The carniv..> | 2026-05-22 20:43 | 79K | |
| Seekers - I'll Never..> | 2026-05-22 20:00 | 43K | |
| Seekers - Georgy Gir..> | 2026-05-22 20:00 | 43K | |
| Seekers - A world of..> | 2026-05-22 20:43 | 21K | |
| Secret Garden - Noct..> | 2026-05-22 20:43 | 488K | |
| SebastiAn - Beograd ..> | 2026-05-22 20:10 | 51K | |
| SebastiAn - Beograd ..> | 2026-05-22 20:10 | 174K | |
| Searchers - Take It ..> | 2026-05-22 19:43 | 1.6M | |
| Searchers - Needles ..> | 2026-05-22 19:43 | 144K | |
| Searchers - I don't ..> | 2026-05-22 20:43 | 103K | |
| Searchers - Goodbye ..> | 2026-05-22 20:43 | 240K | |
| Searchers - Don't Th..> | 2026-05-22 20:00 | 83K | |
| Searchers - Bumble B..> | 2026-05-22 20:43 | 288K | |
| Seal - The Beginning..> | 2026-05-22 20:00 | 42K | |
| Seal - Kiss From A R..> | 2026-05-22 20:00 | 18K | |
| Seal - Future Love P..> | 2026-05-22 20:00 | 17K | |
| Seal - Crazy.jpg | 2026-05-22 20:00 | 20K | |
| Scritti Politti - Th..> | 2026-05-22 19:43 | 41K | |
| Scritti Politti - Ab..> | 2026-05-22 19:43 | 44K | |
| Script - For The Fir..> | 2026-05-22 20:10 | 45K | |
| Scott Mckenzie - San..> | 2026-05-22 20:43 | 44K | |
| Scott McKenzie - San..> | 2026-05-22 20:43 | 73K | |
| Scott Fitzgerald - I..> | 2026-05-22 19:35 | 322K | |
| Scott Fitzgerald & Y..> | 2026-05-22 20:43 | 70K | |
| Scorpions - Wind Of ..> | 2026-05-22 20:43 | 39K | |
| Scorpions - Still Lo..> | 2026-05-22 20:43 | 45K | |
| Scorpions - Send Me ..> | 2026-05-22 20:00 | 38K | |
| Scorpions - Hello Jo..> | 2026-05-22 20:43 | 47K | |
| Scorpions - Greensle..> | 2026-05-22 20:43 | 27K | |
| Scorpions, The - Sti..> | 2026-05-22 19:43 | 61K | |
| Scooter - Weekend!.jpg | 2026-05-22 20:10 | 220K | |
| Scooter - The Logica..> | 2026-05-22 20:00 | 204K | |
| Scooter - One (Alway..> | 2026-05-22 20:00 | 49K | |
| Scooter - Nessaja.jpg | 2026-05-22 20:00 | 157K | |
| Scooter -Maria.jpg | 2026-05-22 20:00 | 49K | |
| Scooter - I Was Made..> | 2026-05-22 20:00 | 38K | |
| Scooter - Hyper Hype..> | 2026-05-22 20:00 | 65K | |
| Scooter - How Much I..> | 2026-05-22 20:00 | 38K | |
| Scooter - Endless Su..> | 2026-05-22 20:00 | 157K | |
| Scoop - Drop It.jpg | 2026-05-22 20:00 | 40K | |
| Scissor Sisters - I ..> | 2026-05-22 20:10 | 50K | |
| Schiller - Das Glock..> | 2026-05-22 20:10 | 1.6M | |
| Scatman John - Scatm..> | 2026-05-22 20:00 | 24K | |
| Scatman John - Scatm..> | 2026-05-22 20:00 | 24K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 16K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 34K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 70K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 51K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 88K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 34K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 16K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 16K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 34K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 34K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 51K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 16K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 51K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 27K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 16K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 27K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 16K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 49K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 122K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 50K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 34K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 51K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 18K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 88K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 25K | |
| Scala & Kolacny Brot..> | 2026-05-22 20:43 | 70K | |
| Scaffold - Thank u v..> | 2026-05-22 20:43 | 54K | |
| Scaffold - Lily the ..> | 2026-05-22 20:43 | 54K | |
| Saxon - Ride Like Th..> | 2026-05-22 20:43 | 50K | |
| Sawyer Brown - Used ..> | 2026-05-22 20:26 | 221K | |
| Sawyer Brown - Troub..> | 2026-05-22 20:26 | 221K | |
| Sawyer Brown - This ..> | 2026-05-22 20:26 | 143K | |
| Sawyer Brown - The W..> | 2026-05-22 20:26 | 192K | |
| Sawyer Brown - The R..> | 2026-05-22 20:26 | 307K | |
| Sawyer Brown - The B..> | 2026-05-22 20:26 | 230K | |
| Sawyer Brown - Thank..> | 2026-05-22 20:26 | 230K | |
| Sawyer Brown - Some ..> | 2026-05-22 20:26 | 307K | |
| Sawyer Brown - Six D..> | 2026-05-22 20:26 | 307K | |
| Sawyer Brown - Outsk..> | 2026-05-22 20:26 | 230K | |
| Sawyer Brown - Drive..> | 2026-05-22 20:26 | 221K | |
| Sawyer Brown - Betty..> | 2026-05-22 20:26 | 221K | |
| Sawyer Brown - All T..> | 2026-05-22 20:26 | 307K | |
| Savage Garden - Trul..> | 2026-05-22 20:00 | 43K | |
| Savage Garden - To T..> | 2026-05-22 20:00 | 11K | |
| Satisfy - Smoke Gets..> | 2026-05-22 19:43 | 51K | |
| Satisfy - For The Lo..> | 2026-05-22 19:43 | 120K | |
| Saskia & Serge - Yip..> | 2026-05-22 20:26 | 77K | |
| Saskia & Serge - Tog..> | 2026-05-22 20:26 | 77K | |
| Saskia & Serge - The..> | 2026-05-22 20:26 | 389K | |
| Saskia & Serge - Mam..> | 2026-05-22 20:43 | 78K | |
| Saskia & Serge - Bab..> | 2026-05-22 20:26 | 147K | |
| Saskia & Serge - 't ..> | 2026-05-22 20:43 | 43K | |
| Sasha - If You Belie..> | 2026-05-22 20:00 | 16K | |
| Sash - Stay.jpg | 2026-05-22 20:00 | 10K | |
| Sash - La Primavera.jpg | 2026-05-22 20:00 | 62K | |
| Sash - Encore Une Fo..> | 2026-05-22 20:00 | 38K | |
| Sash - Ecuador.jpg | 2026-05-22 20:00 | 72K | |
| Sash & Tina Cousins ..> | 2026-05-22 20:00 | 62K | |
| Sash! Feat. Tina Cou..> | 2026-05-22 20:10 | 62K | |
| Sash! Feat. Stunt - ..> | 2026-05-22 20:10 | 19K | |
| Sash! Feat. Rodrigue..> | 2026-05-22 20:00 | 78K | |
| Sash!, Stunt - Raind..> | 2026-05-22 20:10 | 1.6M | |
| Sarah Vaughan - My F..> | 2026-05-22 20:10 | 63K | |
| Sarah Vaughan - Have..> | 2026-05-22 20:43 | 99K | |
| Sarah Vaughan - C'es..> | 2026-05-22 20:43 | 39K | |
| Sarah Vaughan - Brok..> | 2026-05-22 20:43 | 687K | |
| Sarah Vaughan - Ain'..> | 2026-05-22 20:10 | 52K | |
| Sarah Connor - Skin ..> | 2026-05-22 20:10 | 129K | |
| Sarah Connor - From ..> | 2026-05-22 20:43 | 57K | |
| Saragossa Band - Aga..> | 2026-05-22 19:43 | 96K | |
| Sara Evans - No Plac..> | 2026-05-22 20:26 | 174K | |
| Sara Bareilles - Lov..> | 2026-05-22 20:10 | 61K | |
| Sara Bareilles - Lov..> | 2026-05-22 20:10 | 92K | |
| Sara Bareilles - Bot..> | 2026-05-22 20:10 | 195K | |
| Santana ft. The Proj..> | 2026-05-22 20:43 | 84K | |
| Santana Ft Michelle ..> | 2026-05-22 20:10 | 187K | |
| Santana - She's Not ..> | 2026-05-22 20:43 | 46K | |
| Santana - She's Not ..> | 2026-05-22 19:35 | 184K | |
| Santana - Samba Pa T..> | 2026-05-22 20:43 | 92K | |
| Santana - Oye Como V..> | 2026-05-22 20:43 | 79K | |
| Santana - Oye Come V..> | 2026-05-22 19:35 | 62K | |
| Santana - Maria Mari..> | 2026-05-22 20:10 | 89K | |
| Santana - Jin-Go-Lo-..> | 2026-05-22 19:35 | 289K | |
| Santana - I'll Be Wa..> | 2026-05-22 20:00 | 59K | |
| Santana - Hold on.jpg | 2026-05-22 19:43 | 62K | |
| Santana - Black Magi..> | 2026-05-22 19:35 | 50K | |
| Santana & Willie Nel..> | 2026-05-22 19:43 | 30K | |
| Santana & Rob Thomas..> | 2026-05-22 20:00 | 84K | |
| Santa Esmeralda - Th..> | 2026-05-22 19:35 | 8.3K | |
| Santa Esmeralda - Do..> | 2026-05-22 20:00 | 11K | |
| Santa Esmeralda -Do..> | 2026-05-22 19:35 | 359K | |
| Sandy Shaw - Puppet ..> | 2026-05-22 20:43 | 12K | |
| Sandy Posey - Single..> | 2026-05-22 20:00 | 46K | |
| Sandy Posey - Save t..> | 2026-05-22 20:26 | 167K | |
| Sandy Posey - I take..> | 2026-05-22 20:43 | 73K | |
| Sandy Marton - Peopl..> | 2026-05-22 19:43 | 40K | |
| Sandy Coast - We'll ..> | 2026-05-22 20:43 | 82K | |
| Sandy Coast - True L..> | 2026-05-22 20:43 | 84K | |
| Sandy Coast - The Ey..> | 2026-05-22 20:43 | 64K | |
| Sandy Coast - I See ..> | 2026-05-22 20:43 | 83K | |
| Sandy Coast - Capita..> | 2026-05-22 19:43 | 174K | |
| Sandra van Nieuwland..> | 2026-05-22 20:10 | 149K | |
| Sandra Vanreys - Let..> | 2026-05-22 20:26 | 68K | |
| Sandra Vanreys - I'm..> | 2026-05-22 20:26 | 68K | |
| Sandra Van Nieuwland..> | 2026-05-22 20:10 | 62K | |
| Sandra Reemer - The ..> | 2026-05-22 19:35 | 25K | |
| Sandra Reemer - La C..> | 2026-05-22 20:00 | 108K | |
| Sandra Reemer - All ..> | 2026-05-22 19:43 | 32K | |
| Sandra Kim - J'aime ..> | 2026-05-22 19:43 | 69K | |
| Sandra - Maria Magda..> | 2026-05-22 20:00 | 53K | |
| Sandra - In the Heat..> | 2026-05-22 19:43 | 38K | |
| Sandra - Everlasting..> | 2026-05-22 19:43 | 38K | |
| Sandra - (I'll Never..> | 2026-05-22 19:43 | 53K | |
| Sandra & Andres - Tr..> | 2026-05-22 19:35 | 526K | |
| Sandra & Andres - Th..> | 2026-05-22 19:35 | 304K | |
| Sandra & Andres - St..> | 2026-05-22 20:43 | 23K | |
| Sandra & Andres - Lo..> | 2026-05-22 19:35 | 18K | |
| Sandra & Andres - Le..> | 2026-05-22 19:35 | 304K | |
| Sandpipers - Guantan..> | 2026-05-22 20:43 | 52K | |
| Sandie Shaw - Those ..> | 2026-05-22 20:43 | 50K | |
| Sandie Shaw - Think ..> | 2026-05-22 20:43 | 15K | |
| Sandie Shaw - Long l..> | 2026-05-22 20:43 | 27K | |
| Sandie Shaw - Girl D..> | 2026-05-22 20:00 | 39K | |
| Sandie Shaw - (There..> | 2026-05-22 20:43 | 75K | |
| Samuel La Manna - Wi..> | 2026-05-22 20:10 | 16K | |
| Samuel La Manna - Wi..> | 2026-05-22 20:10 | 16K | |
| Sammy Renders & Vize..> | 2026-05-22 20:10 | 63K | |
| Sammy Kershaw - Yard..> | 2026-05-22 20:26 | 182K | |
| Sammy Kershaw - Vida..> | 2026-05-22 20:26 | 182K | |
| Sammy Kershaw - Thir..> | 2026-05-22 20:26 | 233K | |
| Sammy Kershaw - She ..> | 2026-05-22 20:26 | 182K | |
| Sammy Kershaw - Quee..> | 2026-05-22 20:26 | 182K | |
| Sammy Kershaw - Nati..> | 2026-05-22 20:26 | 233K | |
| Sammy Kershaw - Love..> | 2026-05-22 20:26 | 260K | |
| Sammy Kershaw - I Ca..> | 2026-05-22 20:26 | 234K | |
| Sammy Kershaw - Don'..> | 2026-05-22 20:26 | 182K | |
| Sammy Kershaw - Cadi..> | 2026-05-22 20:26 | 254K | |
| Sammy Kershaw, Lorri..> | 2026-05-22 20:26 | 196K | |
| Sammy Davis Nr - Ple..> | 2026-05-22 20:43 | 37K | |
| Sammy Davis Jr. - Yo..> | 2026-05-22 19:35 | 252K | |
| Sammy Davis Jr. - Th..> | 2026-05-22 20:43 | 31K | |
| Sammy Davis Jr. - Ba..> | 2026-05-22 19:35 | 22K | |
| Sammy Davis Jr - I A..> | 2026-05-22 20:43 | 36K | |
| Sammi Smith - Help M..> | 2026-05-22 20:43 | 15K | |
| Samantha Sang - Emot..> | 2026-05-22 19:35 | 38K | |
| Samantha Jones - No ..> | 2026-05-22 19:35 | 45K | |
| Samantha Jones - My ..> | 2026-05-22 19:35 | 32K | |
| Samantha Fox - Touch..> | 2026-05-22 19:43 | 40K | |
| Samantha Fox - Touch..> | 2026-05-22 20:00 | 34K | |
| Samantha Fox - Nothi..> | 2026-05-22 19:43 | 17K | |
| Samantha Fox - I Onl..> | 2026-05-22 19:43 | 17K | |
| Sam The Sham & The P..> | 2026-05-22 20:43 | 108K | |
| Sam Smith - Stay Wit..> | 2026-05-22 20:10 | 46K | |
| Sam Smith - Like I C..> | 2026-05-22 20:10 | 46K | |
| Sam Smith - I'm Not ..> | 2026-05-22 20:10 | 46K | |
| Sam Smith & Normani ..> | 2026-05-22 20:10 | 31K | |
| Sam Moore, Conway Tw..> | 2026-05-22 20:26 | 109K | |
| Sam Hunt - Take Your..> | 2026-05-22 20:10 | 59K | |
| Sam Feldt X Lucas & ..> | 2026-05-22 20:10 | 246K | |
| Sam FeldtJonas BlueE..> | 2026-05-22 20:10 | 65K | |
| Sam Feldt Feat. RANI..> | 2026-05-22 20:10 | 291K | |
| Sam Feldt Feat. RANI..> | 2026-05-22 20:10 | 86K | |
| Sam FeldtBenny Bridg..> | 2026-05-22 20:10 | 50K | |
| Sam Feldt, VIZE, Leo..> | 2026-05-22 20:10 | 75K | |
| Sam Feldt, Jonas Blu..> | 2026-05-22 20:10 | 83K | |
| Sam Feldt, Jonas Blu..> | 2026-05-22 20:10 | 559K | |
| Sam Feldt, Jonas Blu..> | 2026-05-22 20:10 | 8.9M | |
| Sam Feldt, Benny Bri..> | 2026-05-22 20:10 | 1.4M | |
| Sam Feldt & Vize Fea..> | 2026-05-22 20:10 | 181K | |
| Sam Cooke - You Send..> | 2026-05-22 20:43 | 44K | |
| Sam Cooke - Wonderfu..> | 2026-05-22 20:43 | 32K | |
| Sam Cooke - Only Six..> | 2026-05-22 20:43 | 44K | |
| Sam Cooke - Cupid.jpg | 2026-05-22 19:35 | 1.2M | |
| Sam Cooke - Chain Ga..> | 2026-05-22 20:43 | 28K | |
| Sam Cooke - (What A)..> | 2026-05-22 20:43 | 116K | |
| Sam Butera & The Wit..> | 2026-05-22 20:43 | 43K | |
| Sam Brown - Stop.jpg | 2026-05-22 20:43 | 95K | |
| Sam Brown - Stop (Si..> | 2026-05-22 19:43 | 75K | |
| Sam & Dave - When So..> | 2026-05-22 20:43 | 35K | |
| Sam & Dave - Soul Ma..> | 2026-05-22 20:43 | 71K | |
| Salvatore Adamo - Vo..> | 2026-05-22 20:43 | 449K | |
| Salvatore Adamo - To..> | 2026-05-22 20:43 | 11K | |
| Salvatore Adamo - Qu..> | 2026-05-22 20:10 | 28K | |
| Salt 'n' Pepa ft. En..> | 2026-05-22 20:10 | 50K | |
| Salt 'N Pepa - Twist..> | 2026-05-22 19:43 | 61K | |
| Salt 'N' Pepa - Push..> | 2026-05-22 19:43 | 46K | |
| Salt 'N' Pepa - Let'..> | 2026-05-22 20:00 | 105K | |
| Sak Noel - Paso.jpg | 2026-05-22 20:10 | 148K | |
| Sak Noel - Loca Peop..> | 2026-05-22 20:10 | 29K | |
| Sak Noel - Loca Peop..> | 2026-05-22 20:10 | 280K | |
| Sailor - Traffic Jam..> | 2026-05-22 20:43 | 24K | |
| Sailor - Sailor.jpg | 2026-05-22 20:43 | 33K | |
| Sailor - La Cumbia.jpg | 2026-05-22 20:43 | 18K | |
| Sailor - Girls, Girl..> | 2026-05-22 20:43 | 44K | |
| Safri Duo - Played-A..> | 2026-05-22 20:10 | 35K | |
| Safri Duo - Played-A..> | 2026-05-22 20:10 | 43K | |
| Safri Duo & Michael ..> | 2026-05-22 20:10 | 83K | |
| Sade - Your Love Is ..> | 2026-05-22 20:43 | 9.3K | |
| Sade - Why Can't We ..> | 2026-05-22 19:43 | 30K | |
| Sade - When Am I Goi..> | 2026-05-22 19:43 | 39K | |
| Sade - The Sweetest ..> | 2026-05-22 19:43 | 43K | |
| Sade - Smooth Operat..> | 2026-05-22 20:43 | 23K | |
| Sade - Smooth Operat..> | 2026-05-22 19:43 | 64K | |
| Sade - No Ordinary L..> | 2026-05-22 20:43 | 35K | |
| Sade - Never As Good..> | 2026-05-22 20:00 | 43K | |
| Sade - Never As Good..> | 2026-05-22 19:43 | 1.1M | |
| Sade - Love Is Stron..> | 2026-05-22 20:43 | 35K | |
| Sade - Hang On To Yo..> | 2026-05-22 19:43 | 39K | |
| Sade - Hang On To Yo..> | 2026-05-22 19:43 | 132K | |
| Sacha & Paul - I'm g..> | 2026-05-22 19:35 | 46K | |
| Sabrina - Boys Boys ..> | 2026-05-22 19:43 | 90K | |
| Sabrina - Boys (Summ..> | 2026-05-22 20:00 | 74K | |
| SSgt Barry Sadler - ..> | 2026-05-22 20:44 | 58K | |
| SP3CTRUM - Creepin'.jpg | 2026-05-22 20:11 | 151K | |
| SICK LEGEND - SUMMER..> | 2026-05-22 20:10 | 85K | |
| S Express - Theme Fr..> | 2026-05-22 19:43 | 21K | |
| SERA - I Can’t Be ..> | 2026-05-22 20:10 | 427K | |
| S Club 7 -S Club Par..> | 2026-05-22 20:10 | 72K | |
| S Club 7 - Bring It ..> | 2026-05-22 20:10 | 72K | |
| S.O.S. Band - The Fi..> | 2026-05-22 20:10 | 24K | |
| S.O.S. Band - Just B..> | 2026-05-22 19:43 | 53K | |
| S.O.S. Band - Borrow..> | 2026-05-22 20:10 | 24K | |
| S.O.S.Band, The - Bo..> | 2026-05-22 19:43 | 7.2K | |
| S.O.A.P. - This Is H..> | 2026-05-22 20:00 | 20K | |
| S'Express - Theme fr..> | 2026-05-22 20:00 | 25K | |
| Ryan Paris - Dolce V..> | 2026-05-22 20:00 | 43K | |
| Ryan Paris - Dolce V..> | 2026-05-22 19:43 | 46K | |
| Ryan Paris - Dolce V..> | 2026-05-22 20:00 | 17K | |
| Ry Cooder - Stand by..> | 2026-05-22 20:26 | 207K | |
| Ry Cooder - He'll Ha..> | 2026-05-22 19:35 | 50K | |
| Ruud Gullit - Not Th..> | 2026-05-22 19:43 | 73K | |
| Rusty Adams - Don't ..> | 2026-05-22 20:26 | 218K | |
| Russ Conway - Lesson..> | 2026-05-22 19:43 | 179K | |
| Rupert Holmes - Him.jpg | 2026-05-22 19:43 | 37K | |
| Rupert Holmes - Esca..> | 2026-05-22 19:35 | 73K | |
| Rupert Holmes - Esca..> | 2026-05-22 20:43 | 66K | |
| Rupert Holmes - Esca..> | 2026-05-22 19:43 | 43K | |
| Rupert Holme.jpg | 2026-05-22 20:00 | 37K | |
| Run Dmc Vs. Jason Ne..> | 2026-05-22 20:10 | 75K | |
| Run Dmc Vs. Jason Ne..> | 2026-05-22 20:00 | 262K | |
| Run Dmc - Walk This..> | 2026-05-22 20:00 | 57K | |
| Run Dmc & Aerosmith ..> | 2026-05-22 20:10 | 101K | |
| Run DMC - Walk This ..> | 2026-05-22 19:43 | 142K | |
| Rumba Tres - Baila M..> | 2026-05-22 20:00 | 128K | |
| Rumba Tres - Amazoni..> | 2026-05-22 20:00 | 128K | |
| Rufus Thomas - Do Th..> | 2026-05-22 19:35 | 167K | |
| Rufus & Chaka Khan -..> | 2026-05-22 19:43 | 16K | |
| Rudy Bennett - How c..> | 2026-05-22 20:43 | 84K | |
| Rudimental Feat. Joh..> | 2026-05-22 20:10 | 73K | |
| Ruby Turner - I'd Ra..> | 2026-05-22 20:43 | 71K | |
| Rubettes - Juke Box ..> | 2026-05-22 19:35 | 150K | |
| Rubettes, The - Toni..> | 2026-05-22 19:35 | 207K | |
| Rozalla - Everybody'..> | 2026-05-22 20:00 | 17K | |
| Rozalla - Are you re..> | 2026-05-22 20:00 | 349K | |
| Royal Philharmonic O..> | 2026-05-22 19:43 | 51K | |
| Royal Gigolos - Cali..> | 2026-05-22 20:10 | 37K | |
| Roy Orbison - Uptown..> | 2026-05-22 20:43 | 54K | |
| Roy Orbison - The Co..> | 2026-05-22 20:43 | 54K | |
| Roy Orbison - She's ..> | 2026-05-22 20:43 | 25K | |
| Roy Orbison - Runnin..> | 2026-05-22 20:43 | 54K | |
| Roy Orbison - Pretty..> | 2026-05-22 20:43 | 166K | |
| Roy Orbison - Ooby D..> | 2026-05-22 20:43 | 54K | |
| Roy Orbison - Only T..> | 2026-05-22 20:43 | 54K | |
| Roy Orbison - Only T..> | 2026-05-22 20:43 | 189K | |
| Roy Orbison - Oh Pre..> | 2026-05-22 20:43 | 54K | |
| Roy Orbison - Move O..> | 2026-05-22 20:43 | 54K | |
| Roy Orbison - Mean W..> | 2026-05-22 20:43 | 54K | |
| Roy Orbison - Leah.jpg | 2026-05-22 20:43 | 54K | |
| Roy Orbison - Lana.jpg | 2026-05-22 20:43 | 27K | |
| Roy Orbison - It's O..> | 2026-05-22 20:43 | 54K | |
| Roy Orbison - Indian..> | 2026-05-22 20:00 | 35K | |
| Roy Orbison - In Dre..> | 2026-05-22 20:43 | 54K | |
| Roy Orbison - I Drov..> | 2026-05-22 19:43 | 131K | |
| Roy Orbison - Goodni..> | 2026-05-22 20:00 | 32K | |
| Roy Orbison - Dream ..> | 2026-05-22 20:43 | 35K | |
| Roy Orbison - Crying..> | 2026-05-22 20:43 | 54K | |
| Roy Orbison - Candy ..> | 2026-05-22 20:43 | 54K | |
| Roy Orbison - Blue B..> | 2026-05-22 20:43 | 54K | |
| Roy Orbison - (All I..> | 2026-05-22 20:43 | 54K | |
| Roy Drusky - Room Fu..> | 2026-05-22 20:26 | 47K | |
| Roy Clark - Come Liv..> | 2026-05-22 20:26 | 145K | |
| Roy Black - Ganz In ..> | 2026-05-22 20:10 | 45K | |
| Roy Black & Anita - ..> | 2026-05-22 20:43 | 95K | |
| Roxy Music - More Th..> | 2026-05-22 20:00 | 27K | |
| Roxy Music - Love Is..> | 2026-05-22 20:00 | 45K | |
| Roxy Music -Jealous ..> | 2026-05-22 19:43 | 73K | |
| Roxy Music - Dance A..> | 2026-05-22 19:35 | 186K | |
| Roxy Music - Avalon.jpg | 2026-05-22 19:43 | 27K | |
| Roxette; Alle Farben..> | 2026-05-22 20:10 | 557K | |
| Roxette - The Look.jpg | 2026-05-22 19:43 | 53K | |
| Roxette - Spending M..> | 2026-05-22 20:00 | 42K | |
| Roxette - Listen To ..> | 2026-05-22 19:43 | 51K | |
| Roxette - Joyride.jpg | 2026-05-22 20:00 | 53K | |
| Roxette - It Must Ha..> | 2026-05-22 20:00 | 12K | |
| Roxette - It Must Ha..> | 2026-05-22 20:10 | 38K | |
| Roxette - I Wish I C..> | 2026-05-22 20:00 | 53K | |
| Roxette - How Do You..> | 2026-05-22 20:00 | 102K | |
| Roxette - Fading Lik..> | 2026-05-22 20:10 | 59K | |
| Roxette - Dangerous.jpg | 2026-05-22 20:00 | 53K | |
| Round One - In Zaire..> | 2026-05-22 19:43 | 63K | |
| Rosy & Andres - Saus..> | 2026-05-22 19:35 | 76K | |
| Rosy & Andres - I Be..> | 2026-05-22 19:35 | 216K | |
| Rosie Vela - Magic S..> | 2026-05-22 19:43 | 21K | |
| Rosemary Clooney - M..> | 2026-05-22 20:43 | 213K | |
| Rosemary Clloney - C..> | 2026-05-22 20:00 | 30K | |
| Rose Royce - Wishing..> | 2026-05-22 20:43 | 55K | |
| Rose Royce - Love Do..> | 2026-05-22 19:35 | 37K | |
| Rose Royce - Is It L..> | 2026-05-22 20:00 | 100K | |
| Rose Royce - Car Was..> | 2026-05-22 19:35 | 12K | |
| Rose Royce - Best Lo..> | 2026-05-22 19:43 | 134K | |
| Rosanne Cash - The W..> | 2026-05-22 20:26 | 230K | |
| Rosanne Cash - Tenne..> | 2026-05-22 20:26 | 252K | |
| Rosanne Cash - Seven..> | 2026-05-22 20:26 | 140K | |
| Rosanne Cash - Secon..> | 2026-05-22 20:26 | 174K | |
| Rosanne Cash - Runaw..> | 2026-05-22 20:26 | 252K | |
| Rosanne Cash - Never..> | 2026-05-22 20:26 | 174K | |
| Rosanne Cash - My Ba..> | 2026-05-22 20:26 | 140K | |
| Rosanne Cash - If Yo..> | 2026-05-22 20:26 | 230K | |
| Rosanne Cash - I Won..> | 2026-05-22 20:26 | 199K | |
| Rosanne Cash - I Don..> | 2026-05-22 20:26 | 252K | |
| Rosanne Cash - I Don..> | 2026-05-22 20:26 | 252K | |
| Rosanne Cash - Hold ..> | 2026-05-22 20:26 | 174K | |
| Rosanne Cash - Blue ..> | 2026-05-22 20:26 | 252K | |
| Rosanne Cash - Ain't..> | 2026-05-22 20:26 | 177K | |
| Rory Block - You've ..> | 2026-05-22 20:43 | 84K | |
| Rory Block - My Guy.jpg | 2026-05-22 20:43 | 84K | |
| Rory Block - Midnigh..> | 2026-05-22 20:43 | 84K | |
| Rory Block - Lovin' ..> | 2026-05-22 20:43 | 84K | |
| Rory Block - Love Ha..> | 2026-05-22 20:43 | 84K | |
| Rory Block - I'll Ta..> | 2026-05-22 20:43 | 84K | |
| Rory Block - I'd Rat..> | 2026-05-22 20:43 | 84K | |
| Rory Block - Freight..> | 2026-05-22 20:43 | 84K | |
| Rory Block - Fast Ca..> | 2026-05-22 20:43 | 84K | |
| Rory Block - Dancing..> | 2026-05-22 20:43 | 84K | |
| Rory Block - Cried L..> | 2026-05-22 20:43 | 84K | |
| Roots Syndicate - Mo..> | 2026-05-22 20:00 | 87K | |
| Root's Syndicate - W..> | 2026-05-22 20:00 | 87K | |
| Ronny - Eine Kleine ..> | 2026-05-22 20:43 | 91K | |
| Ronnie Milsap - Why ..> | 2026-05-22 20:26 | 249K | |
| Ronnie Milsap - Wher..> | 2026-05-22 20:26 | 300K | |
| Ronnie Milsap - What..> | 2026-05-22 20:26 | 169K | |
| Ronnie Milsap - What..> | 2026-05-22 20:26 | 204K | |
| Ronnie Milsap - Turn..> | 2026-05-22 20:26 | 206K | |
| Ronnie Milsap - Stra..> | 2026-05-22 20:26 | 211K | |
| Ronnie Milsap - Stra..> | 2026-05-22 20:26 | 298K | |
| Ronnie Milsap - Stil..> | 2026-05-22 20:26 | 220K | |
| Ronnie Milsap - Snap..> | 2026-05-22 20:26 | 298K | |
| Ronnie Milsap - Smok..> | 2026-05-22 20:26 | 206K | |
| Ronnie Milsap - She ..> | 2026-05-22 20:26 | 155K | |
| Ronnie Milsap - Pure..> | 2026-05-22 20:26 | 263K | |
| Ronnie Milsap - Pris..> | 2026-05-22 20:26 | 220K | |
| Ronnie Milsap - Old ..> | 2026-05-22 20:26 | 300K | |
| Ronnie Milsap - My H..> | 2026-05-22 20:26 | 249K | |
| Ronnie Milsap - Lost..> | 2026-05-22 20:26 | 298K | |
| Ronnie Milsap - Let'..> | 2026-05-22 20:26 | 202K | |
| Ronnie Milsap - It W..> | 2026-05-22 20:26 | 253K | |
| Ronnie Milsap - Insi..> | 2026-05-22 20:26 | 372K | |
| Ronnie Milsap - In L..> | 2026-05-22 20:26 | 367K | |
| Ronnie Milsap - I Wo..> | 2026-05-22 20:26 | 206K | |
| Ronnie Milsap - How ..> | 2026-05-22 20:26 | 206K | |
| Ronnie Milsap - Hous..> | 2026-05-22 20:26 | 211K | |
| Ronnie Milsap - He G..> | 2026-05-22 20:26 | 372K | |
| Ronnie Milsap - Happ..> | 2026-05-22 20:26 | 367K | |
| Ronnie Milsap - Don'..> | 2026-05-22 20:26 | 200K | |
| Ronnie Milsap - Don'..> | 2026-05-22 20:26 | 211K | |
| Ronnie Milsap - Dayd..> | 2026-05-22 20:26 | 142K | |
| Ronnie Milsap - Butt..> | 2026-05-22 20:26 | 300K | |
| Ronnie Milsap - Back..> | 2026-05-22 20:26 | 202K | |
| Ronnie Milsap - Any ..> | 2026-05-22 20:26 | 206K | |
| Ronnie Milsap - Am I..> | 2026-05-22 20:43 | 42K | |
| Ronnie Milsap - All ..> | 2026-05-22 20:26 | 253K | |
| Ronnie Milsap - (The..> | 2026-05-22 20:26 | 206K | |
| Ronnie Milsap - (I'm..> | 2026-05-22 20:26 | 204K | |
| Ronnie Milsap - (I'd..> | 2026-05-22 20:26 | 291K | |
| Ronnie Milsap, Kenny..> | 2026-05-22 20:26 | 84K | |
| Ronnie Hilton - Don'..> | 2026-05-22 20:43 | 34K | |
| Ronnie & The Big Bea..> | 2026-05-22 19:35 | 172K | |
| Ronettes - Be My Bab..> | 2026-05-22 20:43 | 51K | |
| Ronan Keating and Lu..> | 2026-05-22 20:43 | 13K | |
| Ronan Keating -When ..> | 2026-05-22 20:43 | 30K | |
| Ronan Keating - Life..> | 2026-05-22 20:10 | 30K | |
| Ronan Keating - If ..> | 2026-05-22 20:43 | 42K | |
| Ronald & Donald - Kw..> | 2026-05-22 19:35 | 206K | |
| Romeo - Secret Love.jpg | 2026-05-22 20:00 | 13K | |
| Romeo - Coming Home.jpg | 2026-05-22 20:00 | 13K | |
| Romantics - What I L..> | 2026-05-22 19:35 | 172K | |
| Romantics, The - Wha..> | 2026-05-22 19:43 | 44K | |
| Rolling Stones - [I ..> | 2026-05-22 20:43 | 20K | |
| Rolling Stones - You..> | 2026-05-22 20:00 | 46K | |
| Rolling Stones - Wai..> | 2026-05-22 19:43 | 59K | |
| Rolling Stones - Und..> | 2026-05-22 19:43 | 12K | |
| Rolling Stones - Tim..> | 2026-05-22 20:43 | 25K | |
| Rolling Stones - She..> | 2026-05-22 19:43 | 54K | |
| Rolling Stones - She..> | 2026-05-22 20:43 | 389K | |
| Rolling Stones - She..> | 2026-05-22 19:43 | 99K | |
| Rolling Stones - Rub..> | 2026-05-22 20:43 | 36K | |
| Rolling Stones - Mix..> | 2026-05-22 19:43 | 674K | |
| Rolling Stones - Lit..> | 2026-05-22 20:43 | 66K | |
| Rolling Stones - It'..> | 2026-05-22 19:35 | 94K | |
| Rolling Stones - Hon..> | 2026-05-22 20:00 | 54K | |
| Rolling Stones - Har..> | 2026-05-22 19:43 | 252K | |
| Rolling Stones - Gim..> | 2026-05-22 20:00 | 46K | |
| Rolling Stones - Emo..> | 2026-05-22 20:10 | 85K | |
| Rolling Stones - Com..> | 2026-05-22 20:43 | 56K | |
| Rolling Stones - Bro..> | 2026-05-22 19:35 | 71K | |
| Rolling Stones - Bea..> | 2026-05-22 19:35 | 241K | |
| Rolling Stones - As ..> | 2026-05-22 20:43 | 17K | |
| Rolling Stones - Ang..> | 2026-05-22 19:35 | 231K | |
| Rolling Stones - Alm..> | 2026-05-22 20:10 | 69K | |
| Rolling Stones - (I ..> | 2026-05-22 19:35 | 20K | |
| Rollergirl - Dear Je..> | 2026-05-22 20:00 | 25K | |
| Roland W. - Monja.jpg | 2026-05-22 20:43 | 42K | |
| Roland Kaiser - Sant..> | 2026-05-22 19:43 | 26K | |
| Rogier van Otterloo ..> | 2026-05-22 19:35 | 18K | |
| Rogier Van Otterloo ..> | 2026-05-22 19:35 | 84K | |
| Roger Whittaker - th..> | 2026-05-22 20:43 | 52K | |
| Roger Whittaker - Wh..> | 2026-05-22 19:35 | 42K | |
| Roger Whittaker - Wh..> | 2026-05-22 20:43 | 42K | |
| Roger Whittaker - Wh..> | 2026-05-22 20:43 | 17K | |
| Roger Whittaker - Un..> | 2026-05-22 20:43 | 17K | |
| Roger Whittaker - Th..> | 2026-05-22 20:43 | 60K | |
| Roger Whittaker - Th..> | 2026-05-22 20:43 | 17K | |
| Roger Whittaker - Th..> | 2026-05-22 20:43 | 159K | |
| Roger Whittaker - Sw..> | 2026-05-22 20:43 | 14K | |
| Roger Whittaker - Su..> | 2026-05-22 20:43 | 60K | |
| Roger Whittaker - St..> | 2026-05-22 20:43 | 159K | |
| Roger Whittaker - So..> | 2026-05-22 20:43 | 48K | |
| Roger Whittaker - So..> | 2026-05-22 20:43 | 17K | |
| Roger Whittaker - Sm..> | 2026-05-22 20:43 | 60K | |
| Roger Whittaker - Sc..> | 2026-05-22 20:43 | 159K | |
| Roger Whittaker - Sa..> | 2026-05-22 20:43 | 14K | |
| Roger Whittaker - Ri..> | 2026-05-22 20:43 | 159K | |
| Roger Whittaker - Ra..> | 2026-05-22 20:43 | 60K | |
| Roger Whittaker - Ol..> | 2026-05-22 20:43 | 60K | |
| Roger Whittaker - Ne..> | 2026-05-22 20:43 | 60K | |
| Roger Whittaker - Mo..> | 2026-05-22 20:43 | 14K | |
| Roger Whittaker - Mo..> | 2026-05-22 20:43 | 14K | |
| Roger Whittaker - Mo..> | 2026-05-22 20:43 | 159K | |
| Roger Whittaker - Mi..> | 2026-05-22 20:43 | 159K | |
| Roger Whittaker - Me..> | 2026-05-22 20:43 | 46K | |
| Roger Whittaker - Ma..> | 2026-05-22 20:43 | 14K | |
| Roger Whittaker - Ma..> | 2026-05-22 20:43 | 17K | |
| Roger Whittaker - Ma..> | 2026-05-22 20:43 | 33K | |
| Roger Whittaker - It..> | 2026-05-22 20:43 | 38K | |
| Roger Whittaker - It..> | 2026-05-22 20:43 | 60K | |
| Roger Whittaker - It..> | 2026-05-22 20:43 | 52K | |
| Roger Whittaker - If..> | 2026-05-22 20:43 | 224K | |
| Roger Whittaker - If..> | 2026-05-22 20:43 | 60K | |
| Roger Whittaker - I ..> | 2026-05-22 20:43 | 60K | |
| Roger Whittaker - I ..> | 2026-05-22 20:43 | 14K | |
| Roger Whittaker - I ..> | 2026-05-22 20:43 | 60K | |
| Roger Whittaker - He..> | 2026-05-22 20:43 | 60K | |
| Roger Whittaker - Gr..> | 2026-05-22 20:43 | 14K | |
| Roger Whittaker - Gr..> | 2026-05-22 20:42 | 52K | |
| Roger Whittaker - Go..> | 2026-05-22 20:42 | 14K | |
| Roger Whittaker - Fr..> | 2026-05-22 20:42 | 159K | |
| Roger Whittaker - Ev..> | 2026-05-22 20:42 | 48K | |
| Roger Whittaker - Ev..> | 2026-05-22 20:42 | 17K | |
| Roger Whittaker - Ea..> | 2026-05-22 20:42 | 159K | |
| Roger Whittaker - Du..> | 2026-05-22 20:42 | 60K | |
| Roger Whittaker - Di..> | 2026-05-22 20:42 | 159K | |
| Roger Whittaker - By..> | 2026-05-22 20:26 | 3.3M | |
| Roger Whittaker - Bo..> | 2026-05-22 20:42 | 17K | |
| Roger Whittaker - Bl..> | 2026-05-22 20:42 | 60K | |
| Roger Whittaker - Be..> | 2026-05-22 20:42 | 17K | |
| Roger Whittaker - An..> | 2026-05-22 20:42 | 60K | |
| Roger Whittaker - Al..> | 2026-05-22 20:42 | 52K | |
| Roger Whittaker - A ..> | 2026-05-22 20:42 | 42K | |
| Roger Whittaker - A ..> | 2026-05-22 20:42 | 88K | |
| Roger Sanchez - Anot..> | 2026-05-22 20:10 | 84K | |
| Roger Miller - King ..> | 2026-05-22 20:26 | 268K | |
| Roger Glover - Love ..> | 2026-05-22 19:35 | 207K | |
| Roger Glover & Guest..> | 2026-05-22 20:42 | 54K | |
| Roger Daltrey - With..> | 2026-05-22 19:43 | 13K | |
| Roger Daltrey - Givi..> | 2026-05-22 20:42 | 31K | |
| Roger - I Want To Be..> | 2026-05-22 19:35 | 47K | |
| Rodney Crowell - Wha..> | 2026-05-22 20:26 | 88K | |
| Rodney Crowell - Voi..> | 2026-05-22 20:42 | 17K | |
| Rodney Crowell - She..> | 2026-05-22 20:26 | 190K | |
| Rodney Crowell - Lov..> | 2026-05-22 20:26 | 190K | |
| Rodney Crowell - It'..> | 2026-05-22 20:26 | 339K | |
| Rodney Crowell - I C..> | 2026-05-22 20:26 | 183K | |
| Rodney Crowell - Aft..> | 2026-05-22 20:26 | 183K | |
| Rodney Crowell - Abo..> | 2026-05-22 20:26 | 339K | |
| Rodney Crowell - (No..> | 2026-05-22 20:42 | 20K | |
| Rodney Atkins - If Y..> | 2026-05-22 20:26 | 69K | |
| Rod Stewart - Young ..> | 2026-05-22 19:43 | 36K | |
| Rod Stewart - You're..> | 2026-05-22 19:35 | 29K | |
| Rod Stewart - Tonigh..> | 2026-05-22 20:00 | 34K | |
| Rod Stewart - Tonigh..> | 2026-05-22 20:00 | 51K | |
| Rod Stewart - Tonigh..> | 2026-05-22 19:35 | 74K | |
| Rod Stewart - Tongih..> | 2026-05-22 20:42 | 87K | |
| Rod Stewart - Tom Tr..> | 2026-05-22 20:00 | 18K | |
| Rod Stewart - Some G..> | 2026-05-22 19:43 | 40K | |
| Rod Stewart - Sailin..> | 2026-05-22 19:35 | 84K | |
| Rod Stewart - Ruby T..> | 2026-05-22 20:00 | 65K | |
| Rod Stewart - Passio..> | 2026-05-22 19:43 | 40K | |
| Rod Stewart - Maggie..> | 2026-05-22 19:35 | 50K | |
| Rod Stewart - I Don'..> | 2026-05-22 19:35 | 354K | |
| Rod Stewart - Hot Le..> | 2026-05-22 20:00 | 29K | |
| Rod Stewart - Every ..> | 2026-05-22 19:43 | 27K | |
| Rod Stewart - Da Ya ..> | 2026-05-22 19:35 | 27K | |
| Rod Stewart - Crazy ..> | 2026-05-22 19:43 | 31K | |
| Rod Stewart - Baby J..> | 2026-05-22 19:43 | 33K | |
| Rod Stewart, Sting &..> | 2026-05-22 20:00 | 11K | |
| Rod Mckuen - Without..> | 2026-05-22 19:35 | 67K | |
| Rod Mckuen - Soldier..> | 2026-05-22 20:26 | 364K | |
| Rod McKuen - They're..> | 2026-05-22 19:35 | 282K | |
| Rod McKuen - Amor Am..> | 2026-05-22 19:35 | 63K | |
| Roco & The Carnation..> | 2026-05-22 19:43 | 32K | |
| Rocky Sharpe & The R..> | 2026-05-22 19:43 | 335K | |
| Rocky Burnette - Tir..> | 2026-05-22 19:43 | 46K | |
| Rockwell - Somebody'..> | 2026-05-22 19:43 | 30K | |
| Rock Steady Crew - H..> | 2026-05-22 19:43 | 127K | |
| Rock Steady Crew -(H..> | 2026-05-22 19:43 | 87K | |
| Roch Voisine - On Th..> | 2026-05-22 20:00 | 29K | |
| Rocco Granata - Mari..> | 2026-05-22 20:42 | 420K | |
| Rocco Granata - Hell..> | 2026-05-22 20:42 | 165K | |
| Rocco Granata - Buon..> | 2026-05-22 19:35 | 36K | |
| Rocco - The Sign.jpg | 2026-05-22 20:10 | 39K | |
| Rocco - The Sign ((R..> | 2026-05-22 20:10 | 181K | |
| Robyn - With Every H..> | 2026-05-22 20:10 | 52K | |
| Robyn - Show Me Love..> | 2026-05-22 20:00 | 51K | |
| Robyn -Keep The Fire..> | 2026-05-22 20:10 | 72K | |
| Robin Thicke Ft. T.I..> | 2026-05-22 20:10 | 43K | |
| Robin Thicke Feat. T..> | 2026-05-22 20:10 | 43K | |
| Robin Thicke - Magic..> | 2026-05-22 20:10 | 89K | |
| Robin Schulz ft. Ali..> | 2026-05-22 20:10 | 9.7K | |
| Robin Schulz ft. Ali..> | 2026-05-22 20:10 | 213K | |
| Robin Schulz Feat. K..> | 2026-05-22 20:10 | 17K | |
| Robin Schulz Feat. K..> | 2026-05-22 20:10 | 128K | |
| Robin Schulz; Izzy B..> | 2026-05-22 20:10 | 217K | |
| Robin Schulz - Sugar..> | 2026-05-22 20:10 | 117K | |
| Robin Schulz - Sugar..> | 2026-05-22 20:10 | 307K | |
| Robin Schulz & Wes -..> | 2026-05-22 20:10 | 271K | |
| Robin Schulz & Wes -..> | 2026-05-22 20:10 | 20K | |
| Robin S. - Show Me L..> | 2026-05-22 20:00 | 26K | |
| Robin S - Luv 4 Luv.jpg | 2026-05-22 20:00 | 12K | |
| Robin Gibb - Juliet.jpg | 2026-05-22 19:43 | 62K | |
| Robin Beck - The fir..> | 2026-05-22 20:42 | 15K | |
| Robert plant -Big Lo..> | 2026-05-22 19:43 | 57K | |
| Roberto Mann Orchest..> | 2026-05-22 20:42 | 239K | |
| Roberto Mann Orchest..> | 2026-05-22 20:42 | 239K | |
| Roberto Mann & his O..> | 2026-05-22 20:42 | 239K | |
| Roberto Jacketti & T..> | 2026-05-22 20:00 | 76K | |
| Roberto Jacketti & T..> | 2026-05-22 19:43 | 169K | |
| Roberta Flack - The ..> | 2026-05-22 20:42 | 57K | |
| Roberta Flack - The ..> | 2026-05-22 19:35 | 37K | |
| Roberta Flack - Kill..> | 2026-05-22 20:42 | 62K | |
| Roberta Flack & Donn..> | 2026-05-22 20:00 | 117K | |
| Robert Strating - Ma..> | 2026-05-22 20:42 | 75K | |
| Robert Palmer - Ript..> | 2026-05-22 19:43 | 45K | |
| Robert Palmer - Merc..> | 2026-05-22 20:10 | 28K | |
| Robert Palmer - Look..> | 2026-05-22 19:43 | 411K | |
| Robert Palmer - Ever..> | 2026-05-22 20:42 | 71K | |
| Robert Palmer - Can ..> | 2026-05-22 19:35 | 58K | |
| Robert Palmer - Best..> | 2026-05-22 19:35 | 344K | |
| Robert Palmer - Bad ..> | 2026-05-22 20:10 | 47K | |
| Robert Palmer - Ad..> | 2026-05-22 20:10 | 59K | |
| Robert Palmer - Addi..> | 2026-05-22 19:43 | 56K | |
| Robert Palmer & Ub40..> | 2026-05-22 20:00 | 12K | |
| Robert Miles - Child..> | 2026-05-22 20:00 | 41K | |
| Robert Long - Let us..> | 2026-05-22 19:35 | 44K | |
| Robert Gordon - Sea ..> | 2026-05-22 19:35 | 31K | |
| Robert Gordon & Link..> | 2026-05-22 19:35 | 382K | |
| Robert Cray Band - R..> | 2026-05-22 20:42 | 76K | |
| Robert Cray Band - D..> | 2026-05-22 19:43 | 40K | |
| Robert Cray - Right ..> | 2026-05-22 19:43 | 165K | |
| Robby Valentine - Ov..> | 2026-05-22 20:00 | 12K | |
| Robbie Williams - Th..> | 2026-05-22 20:10 | 51K | |
| Robbie Williams - Su..> | 2026-05-22 20:10 | 51K | |
| Robbie Williams - Sh..> | 2026-05-22 20:10 | 33K | |
| Robbie Williams - Sh..> | 2026-05-22 20:10 | 38K | |
| Robbie Williams - Ro..> | 2026-05-22 20:10 | 51K | |
| Robbie Williams - No..> | 2026-05-22 20:00 | 65K | |
| Robbie Williams - Mr..> | 2026-05-22 20:42 | 47K | |
| Robbie Williams - Mr..> | 2026-05-22 20:42 | 41K | |
| Robbie Williams - Mi..> | 2026-05-22 20:00 | 65K | |
| Robbie Williams - Le..> | 2026-05-22 20:00 | 45K | |
| Robbie Williams - Fe..> | 2026-05-22 20:42 | 34K | |
| Robbie Williams - Fe..> | 2026-05-22 20:10 | 56K | |
| Robbie Williams - An..> | 2026-05-22 20:00 | 45K | |
| Robbie Williams & Pe..> | 2026-05-22 20:42 | 75K | |
| Robbie Williams & Ni..> | 2026-05-22 20:42 | 64K | |
| Robbie Robertson - S..> | 2026-05-22 19:43 | 44K | |
| Robbie Nevil - C'est..> | 2026-05-22 19:43 | 42K | |
| RobbePayback - Popco..> | 2026-05-22 20:10 | 30K | |
| Rob Mayth - Feel My ..> | 2026-05-22 20:10 | 31K | |
| Rob Mayth - Feel My ..> | 2026-05-22 20:10 | 149K | |
| Rob Hoeke Rhythm & B..> | 2026-05-22 20:42 | 598K | |
| Rob Hoeke Rhythm & B..> | 2026-05-22 20:42 | 598K | |
| Rob Hoeke Rhythm & B..> | 2026-05-22 20:42 | 598K | |
| Rob Hoeke - Everybod..> | 2026-05-22 19:35 | 308K | |
| Rob Hoeke's Boogie W..> | 2026-05-22 19:35 | 127K | |
| Rob 'N' Raz Feat. Le..> | 2026-05-22 19:43 | 74K | |
| Rob 'N' Raz & Leila ..> | 2026-05-22 20:00 | 62K | |
| Roachford - Cuddly T..> | 2026-05-22 19:43 | 66K | |
| Ro-D-Ys - Take Her H..> | 2026-05-22 20:00 | 77K | |
| Ro-D-Ys - Just Fancy..> | 2026-05-22 20:00 | 77K | |
| Ritty Mcgarrity - Gi..> | 2026-05-22 19:35 | 92K | |
| Riton x Oliver Helde..> | 2026-05-22 20:10 | 66K | |
| Riton x Oliver Helde..> | 2026-05-22 20:10 | 101K | |
| Riton X Nightcrawler..> | 2026-05-22 20:10 | 56K | |
| Riton, Nightcrawlers..> | 2026-05-22 20:10 | 231K | |
| Ritchie Valens - La ..> | 2026-05-22 20:42 | 38K | |
| Ritchie Valens - Don..> | 2026-05-22 20:42 | 44K | |
| Ritchie Family - The..> | 2026-05-22 19:35 | 45K | |
| Rita Ora -How We Do ..> | 2026-05-22 20:10 | 66K | |
| Rita Marley - One Dr..> | 2026-05-22 20:10 | 56K | |
| Rita Coolidge - We..> | 2026-05-22 20:42 | 46K | |
| Rita Coolidge - High..> | 2026-05-22 19:35 | 139K | |
| Rita Coolidge -All T..> | 2026-05-22 19:43 | 18K | |
| Rita Coolidge - (You..> | 2026-05-22 20:26 | 96K | |
| Risqué - The Girls ..> | 2026-05-22 19:43 | 338K | |
| Risqué - Jimmy Mack..> | 2026-05-22 19:43 | 338K | |
| Ringo Starr - It Don..> | 2026-05-22 19:35 | 386K | |
| Rika Zarai - Jerusha..> | 2026-05-22 20:42 | 67K | |
| Rika Zarai - Casatsc..> | 2026-05-22 20:42 | 433K | |
| Rika Zarai - Alours ..> | 2026-05-22 20:42 | 433K | |
| Rihanna Ft. Mikky Ek..> | 2026-05-22 20:10 | 57K | |
| Rihanna Ft. Calvin H..> | 2026-05-22 20:10 | 73K | |
| Rihanna Feat Jay-Z -..> | 2026-05-22 20:10 | 29K | |
| Rihanna - Take A Bow..> | 2026-05-22 20:10 | 29K | |
| Rihanna -Russian Rou..> | 2026-05-22 20:10 | 58K | |
| Rihanna -Only Girl (..> | 2026-05-22 20:10 | 77K | |
| Rihanna - Don't Stop..> | 2026-05-22 20:10 | 29K | |
| Rihanna -Diamonds.jpg | 2026-05-22 20:10 | 47K | |
| Righteous Brothers -..> | 2026-05-22 20:42 | 37K | |
| Right Said Fred - I'..> | 2026-05-22 20:00 | 34K | |
| Right Said Fred - I'..> | 2026-05-22 19:43 | 67K | |
| Right Said Fred - De..> | 2026-05-22 20:00 | 18K | |
| Right Said Fred & Jo..> | 2026-05-22 20:00 | 15K | |
| Righeira -Vamos A La..> | 2026-05-22 19:43 | 61K | |
| Righeira - Vamos A L..> | 2026-05-22 20:00 | 61K | |
| Righeira - No Tengo ..> | 2026-05-22 19:43 | 35K | |
| Ricochet - Daddy's M..> | 2026-05-22 20:26 | 90K | |
| Ricky Van Shelton - ..> | 2026-05-22 20:26 | 133K | |
| Ricky Van Shelton - ..> | 2026-05-22 20:26 | 183K | |
| Ricky Van Shelton - ..> | 2026-05-22 20:26 | 1.2M | |
| Ricky Van Shelton - ..> | 2026-05-22 20:26 | 61K | |
| Ricky Van Shelton - ..> | 2026-05-22 20:26 | 183K | |
| Ricky Van Shelton - ..> | 2026-05-22 20:26 | 151K | |
| Ricky Van Shelton - ..> | 2026-05-22 20:26 | 183K | |
| Ricky Van Shelton - ..> | 2026-05-22 20:26 | 133K | |
| Ricky Van Shelton - ..> | 2026-05-22 20:26 | 662K | |
| Ricky Van Shelton - ..> | 2026-05-22 20:26 | 133K | |
| Ricky Van Shelton - ..> | 2026-05-22 20:26 | 133K | |
| Ricky Van Shelton - ..> | 2026-05-22 20:26 | 22K | |
| Ricky Van Shelton - ..> | 2026-05-22 20:26 | 133K | |
| Ricky Van Shelton - ..> | 2026-05-22 20:26 | 119K | |
| Ricky Valance - Tell..> | 2026-05-22 20:42 | 40K | |
| Ricky Skaggs - You M..> | 2026-05-22 20:42 | 153K | |
| Ricky Skaggs - If Th..> | 2026-05-22 20:42 | 109K | |
| Ricky Scaggs - Don't..> | 2026-05-22 20:42 | 153K | |
| Ricky Nelson - Poor ..> | 2026-05-22 20:10 | 70K | |
| Ricky Nelson - Hello..> | 2026-05-22 20:10 | 54K | |
| Ricky Nelson - Hello..> | 2026-05-22 20:42 | 255K | |
| Ricky Nelson - Garde..> | 2026-05-22 20:26 | 51K | |
| Ricky Nelson & The S..> | 2026-05-22 20:00 | 64K | |
| Ricky Martin - Maria..> | 2026-05-22 20:00 | 146K | |
| Ricky Martin - Livin..> | 2026-05-22 20:00 | 221K | |
| Ricky Martin - (Un D..> | 2026-05-22 20:10 | 593K | |
| Ricky Gordon - Such ..> | 2026-05-22 19:35 | 55K | |
| Rickie Lee Jones - C..> | 2026-05-22 19:35 | 42K | |
| Rick Trevino - She C..> | 2026-05-22 20:26 | 203K | |
| Rick Trevino - Runni..> | 2026-05-22 20:26 | 203K | |
| Rick Trevino - Learn..> | 2026-05-22 20:26 | 203K | |
| Rick Trevino - I Onl..> | 2026-05-22 20:26 | 302K | |
| Rick Trevino - Docto..> | 2026-05-22 20:26 | 302K | |
| Rick Trevino - Bobbi..> | 2026-05-22 20:26 | 77K | |
| Rick Springfield - J..> | 2026-05-22 19:43 | 194K | |
| Rick Nelson - Garden..> | 2026-05-22 19:35 | 139K | |
| Rick Nelson & the St..> | 2026-05-22 20:26 | 41K | |
| Rick Nelson & the St..> | 2026-05-22 20:26 | 41K | |
| Rick James - Super F..> | 2026-05-22 19:43 | 45K | |
| Rick James - Glow.jpg | 2026-05-22 19:43 | 19K | |
| Rick Dee & His Cast ..> | 2026-05-22 19:35 | 45K | |
| Rick Astley - Whenev..> | 2026-05-22 19:43 | 52K | |
| Rick Astley - When I..> | 2026-05-22 20:42 | 52K | |
| Rick Astley - Togeth..> | 2026-05-22 19:43 | 52K | |
| Rick Astley - Never ..> | 2026-05-22 19:43 | 52K | |
| Rick Astley - Cry fo..> | 2026-05-22 19:43 | 33K | |
| Richenel - Dance Aro..> | 2026-05-22 19:43 | 51K | |
| Richard Rodgers & Os..> | 2026-05-22 20:42 | 33K | |
| Richard Marx - Satis..> | 2026-05-22 20:10 | 45K | |
| Richard Marx - Right..> | 2026-05-22 19:43 | 45K | |
| Richard Marx - Angel..> | 2026-05-22 20:00 | 45K | |
| Richard Harris - Mac..> | 2026-05-22 20:42 | 37K | |
| Richard Clayderman -..> | 2026-05-22 20:42 | 26K | |
| Ricchi & Poveri - M'..> | 2026-05-22 19:43 | 38K | |
| Riccardo Cocciante -..> | 2026-05-22 20:42 | 48K | |
| Riccardo Cocciante -..> | 2026-05-22 20:00 | 182K | |
| Ria Valk - Fernando,..> | 2026-05-22 20:42 | 29K | |
| Rhett Akins - That A..> | 2026-05-22 20:26 | 262K | |
| Rhett Akins - She Sa..> | 2026-05-22 20:26 | 262K | |
| Rhett Akins - More T..> | 2026-05-22 20:26 | 138K | |
| Rhett Akins - Don't ..> | 2026-05-22 20:26 | 183K | |
| Revolution System - ..> | 2026-05-22 19:35 | 52K | |
| Revelation Time & Ru..> | 2026-05-22 19:43 | 52K | |
| Retta Young - Sendin..> | 2026-05-22 19:35 | 42K | |
| Restless Heart - You..> | 2026-05-22 20:26 | 227K | |
| Restless Heart - Why..> | 2026-05-22 20:26 | 124K | |
| Restless Heart - Whe..> | 2026-05-22 20:26 | 124K | |
| Restless Heart - Whe..> | 2026-05-22 20:26 | 311K | |
| Restless Heart - The..> | 2026-05-22 20:26 | 227K | |
| Restless Heart - Tha..> | 2026-05-22 20:26 | 311K | |
| Restless Heart - Say..> | 2026-05-22 20:26 | 227K | |
| Restless Heart - Men..> | 2026-05-22 20:26 | 227K | |
| Restless Heart - I'l..> | 2026-05-22 20:26 | 124K | |
| Restless Heart - Fas..> | 2026-05-22 20:26 | 194K | |
| Restless Heart - Dan..> | 2026-05-22 20:26 | 124K | |
| Restless Heart - Big..> | 2026-05-22 20:26 | 264K | |
| Restless Heart - A T..> | 2026-05-22 20:26 | 227K | |
| Reparata & the Delro..> | 2026-05-22 20:42 | 84K | |
| Renee and Renato -Sa..> | 2026-05-22 19:43 | 340K | |
| Renee - High Time He..> | 2026-05-22 19:43 | 258K | |
| Renee - A whole lott..> | 2026-05-22 19:35 | 216K | |
| Rene Froger - Winter..> | 2026-05-22 19:43 | 59K | |
| Rene Froger - Callin..> | 2026-05-22 20:00 | 57K | |
| Renée - Sometimes Y..> | 2026-05-22 19:43 | 20K | |
| Renée - Come Closer..> | 2026-05-22 19:43 | 25K | |
| René Shuman & Angel..> | 2026-05-22 20:10 | 63K | |
| René Klijn - Mr. Bl..> | 2026-05-22 20:42 | 68K | |
| René Klijn -Mister ..> | 2026-05-22 20:42 | 34K | |
| René Froger - You'r..> | 2026-05-22 19:43 | 59K | |
| René Froger - This ..> | 2026-05-22 20:00 | 27K | |
| René Froger - Nobod..> | 2026-05-22 20:00 | 27K | |
| René Froger - Just ..> | 2026-05-22 20:00 | 53K | |
| René Froger - Are Y..> | 2026-05-22 20:00 | 27K | |
| René & Gaston - Val..> | 2026-05-22 20:00 | 85K | |
| René & Angela - Sav..> | 2026-05-22 19:43 | 55K | |
| Remember this - Duke..> | 2026-05-22 19:29 | 3.1K | |
| Rembrandts - I'll Be..> | 2026-05-22 20:00 | 87K | |
| Reinhard Mey - Gute ..> | 2026-05-22 20:42 | 47K | |
| Regento Stars - Lail..> | 2026-05-22 20:10 | 22K | |
| Regard, RAYE - Secre..> | 2026-05-22 20:10 | 180K | |
| Reel To Real - I Lik..> | 2026-05-22 20:00 | 86K | |
| Rednex - Old Pop in ..> | 2026-05-22 20:26 | 37K | |
| Rednex - Cotton Eye ..> | 2026-05-22 20:00 | 239K | |
| Redbone - We Were Al..> | 2026-05-22 20:42 | 41K | |
| Redbone - The Witch ..> | 2026-05-22 19:34 | 53K | |
| Redbone - Come And G..> | 2026-05-22 19:34 | 173K | |
| Red Sovine - Sixteen..> | 2026-05-22 20:26 | 278K | |
| Red Hot Chili Pepper..> | 2026-05-22 20:00 | 35K | |
| Red Hot Chili Pepper..> | 2026-05-22 20:10 | 42K | |
| Red Hot Chili Pepper..> | 2026-05-22 20:00 | 46K | |
| Red Hot Chili Pepper..> | 2026-05-22 20:00 | 46K | |
| Red Hot Chili Pepper..> | 2026-05-22 20:10 | 72K | |
| Red Hot Chili Pepper..> | 2026-05-22 20:00 | 46K | |
| Red Foley - Smoke on..> | 2026-05-22 20:26 | 41K | |
| Red Box - For Americ..> | 2026-05-22 19:43 | 51K | |
| Red 5 - Lift Me Up.jpg | 2026-05-22 20:10 | 275K | |
| Reba feat. Linda Dav..> | 2026-05-22 20:42 | 71K | |
| Reba Mcentire - Whoe..> | 2026-05-22 20:26 | 609K | |
| Reba Mcentire - Walk..> | 2026-05-22 20:26 | 223K | |
| Reba Mcentire - The ..> | 2026-05-22 20:26 | 191K | |
| Reba Mcentire - Take..> | 2026-05-22 20:26 | 367K | |
| Reba Mcentire - Some..> | 2026-05-22 20:26 | 50K | |
| Reba Mcentire - One ..> | 2026-05-22 20:26 | 367K | |
| Reba Mcentire - New ..> | 2026-05-22 20:26 | 367K | |
| Reba Mcentire - It's..> | 2026-05-22 20:25 | 367K | |
| Reba Mcentire - If Y..> | 2026-05-22 20:25 | 367K | |
| Reba Mcentire & Kell..> | 2026-05-22 20:26 | 104K | |
| Reba McEntire - You'..> | 2026-05-22 20:42 | 25K | |
| Reba McEntire - Wron..> | 2026-05-22 20:42 | 71K | |
| Reba McEntire - Why ..> | 2026-05-22 20:42 | 36K | |
| Reba McEntire - Whoe..> | 2026-05-22 20:42 | 32K | |
| Reba McEntire - What..> | 2026-05-22 20:42 | 32K | |
| Reba McEntire - What..> | 2026-05-22 20:42 | 71K | |
| Reba McEntire - Till..> | 2026-05-22 20:42 | 60K | |
| Reba McEntire - The ..> | 2026-05-22 20:42 | 42K | |
| Reba McEntire - The ..> | 2026-05-22 20:42 | 41K | |
| Reba McEntire - The ..> | 2026-05-22 20:42 | 32K | |
| Reba McEntire - Take..> | 2026-05-22 20:42 | 236K | |
| Reba McEntire - One ..> | 2026-05-22 20:42 | 236K | |
| Reba McEntire - On.jpg | 2026-05-22 20:42 | 236K | |
| Reba McEntire - New ..> | 2026-05-22 20:42 | 236K | |
| Reba McEntire - It's..> | 2026-05-22 20:42 | 236K | |
| Reba McEntire - It's..> | 2026-05-22 20:42 | 236K | |
| Reba McEntire - Is T..> | 2026-05-22 20:42 | 106K | |
| Reba McEntire - I’..> | 2026-05-22 20:42 | 35K | |
| Reba McEntire - How ..> | 2026-05-22 20:42 | 35K | |
| Reba McEntire - How ..> | 2026-05-22 20:42 | 71K | |
| Reba McEntire - Have..> | 2026-05-22 20:42 | 71K | |
| Reba McEntire - Fore..> | 2026-05-22 20:42 | 71K | |
| Reba McEntire - For ..> | 2026-05-22 20:42 | 71K | |
| Reba McEntire - Fanc..> | 2026-05-22 20:42 | 27K | |
| Reba McEntire - Can..> | 2026-05-22 20:42 | 25K | |
| Reba McEntire - And ..> | 2026-05-22 20:42 | 60K | |
| Reba McEntire - (You..> | 2026-05-22 20:42 | 236K | |
| Reba McEntire, Vince..> | 2026-05-22 20:26 | 305K | |
| Reba - You Lie.jpg | 2026-05-22 20:42 | 236K | |
| Reba - Why Haven’t..> | 2026-05-22 20:42 | 71K | |
| Reba - Walk On.jpg | 2026-05-22 20:42 | 71K | |
| Reba - The Fear of B..> | 2026-05-22 20:42 | 35K | |
| Reba - She Thinks Hi..> | 2026-05-22 20:42 | 60K | |
| Reba - Rumor Has It.jpg | 2026-05-22 20:42 | 71K | |
| Reba - One Honest He..> | 2026-05-22 20:42 | 71K | |
| Reba - Little Rock.jpg | 2026-05-22 20:42 | 71K | |
| Reba - I Know How He..> | 2026-05-22 20:42 | 71K | |
| Reba - Fallin’ Out..> | 2026-05-22 20:42 | 71K | |
| Reb Allen - Folsom P..> | 2026-05-22 20:25 | 139K | |
| Reamonn - Supergirl.jpg | 2026-05-22 20:10 | 44K | |
| Real Thing - You To ..> | 2026-05-22 20:42 | 51K | |
| Real Thing - You To ..> | 2026-05-22 19:43 | 68K | |
| Real Thing - Can Yo..> | 2026-05-22 19:43 | 73K | |
| Real Thing - Can You..> | 2026-05-22 19:34 | 65K | |
| Real McCoy - Come An..> | 2026-05-22 20:00 | 43K | |
| Real DJ - You Make M..> | 2026-05-22 20:00 | 55K | |
| Ready For The World ..> | 2026-05-22 19:43 | 38K | |
| Re-Flex - The Politi..> | 2026-05-22 19:43 | 38K | |
| Re‐Flex - Headbang..> | 2026-05-22 20:10 | 62K | |
| Razzy Bailey - Midni..> | 2026-05-22 20:25 | 171K | |
| Razorlight - America..> | 2026-05-22 20:10 | 42K | |
| Raymond Lefevre & Oc..> | 2026-05-22 20:00 | 46K | |
| Raymond Froggatt - C..> | 2026-05-22 20:42 | 108K | |
| Raymond Froggatt - C..> | 2026-05-22 20:42 | 108K | |
| Raydio Ft,Ray Parker..> | 2026-05-22 19:34 | 33K | |
| Raydio - Jack And Ji..> | 2026-05-22 19:34 | 37K | |
| Ray Willis - Oklahom..> | 2026-05-22 20:25 | 410K | |
| Ray Stevens - Misty.jpg | 2026-05-22 20:25 | 38K | |
| Ray Stevens - Everyt..> | 2026-05-22 19:34 | 39K | |
| Ray Price Mary Sarah..> | 2026-05-22 20:42 | 55K | |
| Ray Price - For the ..> | 2026-05-22 20:25 | 8.8K | |
| Ray Peterson - Tell ..> | 2026-05-22 20:42 | 199K | |
| Ray Paterson - Corri..> | 2026-05-22 20:42 | 27K | |
| Ray Parker Jr. - Jac..> | 2026-05-22 19:34 | 25K | |
| Ray Parker Jr. - Gho..> | 2026-05-22 19:43 | 65K | |
| Ray Parker Jr. & Ray..> | 2026-05-22 20:10 | 27K | |
| Ray Miranda Orchestr..> | 2026-05-22 20:42 | 174K | |
| Ray Miranda Orchestr..> | 2026-05-22 20:42 | 174K | |
| Ray Miranda Orchestr..> | 2026-05-22 20:42 | 174K | |
| Ray Conniff Singers ..> | 2026-05-22 20:42 | 79K | |
| Ray Conniff Singers ..> | 2026-05-22 20:42 | 39K | |
| Ray Conniff Singers ..> | 2026-05-22 20:42 | 79K | |
| Ray Conniff Singers ..> | 2026-05-22 20:42 | 48K | |
| Ray Conniff Singers ..> | 2026-05-22 20:10 | 84K | |
| Ray Conniff Singers ..> | 2026-05-22 19:34 | 23K | |
| Ray Charles - Yester..> | 2026-05-22 20:42 | 32K | |
| Ray Charles - Unchai..> | 2026-05-22 20:10 | 84K | |
| Ray Charles - Togeth..> | 2026-05-22 20:42 | 11K | |
| Ray Charles - I Can'..> | 2026-05-22 19:43 | 252K | |
| Ray Charles - Hit Th..> | 2026-05-22 20:42 | 37K | |
| Ray Charles - Here W..> | 2026-05-22 20:42 | 45K | |
| Ray Charles - Hallel..> | 2026-05-22 20:10 | 29K | |
| Ray Charles - Georgi..> | 2026-05-22 20:42 | 24K | |
| Ray Charles - Crying..> | 2026-05-22 20:00 | 84K | |
| Ray, Goodman & Brown..> | 2026-05-22 20:42 | 30K | |
| Ratty - Sunrise.jpg | 2026-05-22 20:10 | 18K | |
| Ratty - Sunrise ((Ra..> | 2026-05-22 20:10 | 185K | |
| Rasmus - In The Shad..> | 2026-05-22 20:10 | 33K | |
| Rare Earth - Get Rea..> | 2026-05-22 19:43 | 91K | |
| Rare Earth - Get Rea..> | 2026-05-22 20:42 | 89K | |
| Rare Earth - Get Rea..> | 2026-05-22 19:34 | 34K | |
| Rare Bird - Sympathy..> | 2026-05-22 20:42 | 41K | |
| Rank 1 - Airwave (Ra..> | 2026-05-22 20:10 | 5.5K | |
| Rank 1 - Airwave ((R..> | 2026-05-22 20:10 | 183K | |
| Randy Vanwarmer - Ju..> | 2026-05-22 20:42 | 39K | |
| Randy Travis - Would..> | 2026-05-22 20:25 | 148K | |
| Randy Travis - Too G..> | 2026-05-22 20:25 | 215K | |
| Randy Travis - Spiri..> | 2026-05-22 20:25 | 1.3M | |
| Randy Travis - Point..> | 2026-05-22 20:25 | 209K | |
| Randy Travis - Out o..> | 2026-05-22 20:25 | 360K | |
| Randy Travis - On th..> | 2026-05-22 20:25 | 215K | |
| Randy Travis - Mama ..> | 2026-05-22 20:25 | 360K | |
| Randy Travis - King ..> | 2026-05-22 20:25 | 256K | |
| Randy Travis - It's ..> | 2026-05-22 20:25 | 227K | |
| Randy Travis - Is It..> | 2026-05-22 20:25 | 227K | |
| Randy Travis - If I ..> | 2026-05-22 20:25 | 227K | |
| Randy Travis - I Won..> | 2026-05-22 20:25 | 180K | |
| Randy Travis - I Tol..> | 2026-05-22 20:25 | 215K | |
| Randy Travis - Heroe..> | 2026-05-22 20:25 | 179K | |
| Randy Travis - He Wa..> | 2026-05-22 20:25 | 215K | |
| Randy Travis - Hard ..> | 2026-05-22 20:25 | 107K | |
| Randy Travis - Forev..> | 2026-05-22 20:25 | 215K | |
| Randy Travis - Forev..> | 2026-05-22 20:25 | 215K | |
| Randy Travis - Diggi..> | 2026-05-22 20:25 | 215K | |
| Randy Travis - Deepe..> | 2026-05-22 20:25 | 278K | |
| Randy Travis - Bette..> | 2026-05-22 20:25 | 209K | |
| Randy Travis - Are W..> | 2026-05-22 20:25 | 148K | |
| Randy Travis - Ameri..> | 2026-05-22 20:25 | 249K | |
| Randy Travis - A Man..> | 2026-05-22 20:25 | 360K | |
| Randy Travis - 1982.jpg | 2026-05-22 20:25 | 235K | |
| Randy Newman - Short..> | 2026-05-22 20:42 | 63K | |
| Randy Newman - Rider..> | 2026-05-22 20:25 | 47K | |
| Randy Newman - Birmi..> | 2026-05-22 19:34 | 108K | |
| Randy Crawford - You..> | 2026-05-22 20:10 | 38K | |
| Randy Crawford - Sam..> | 2026-05-22 19:43 | 12K | |
| Randy Crawford - Rai..> | 2026-05-22 20:42 | 38K | |
| Randy Crawford - One..> | 2026-05-22 20:42 | 40K | |
| Randy Crawford - Nig..> | 2026-05-22 19:43 | 32K | |
| Randy Crawford - Kno..> | 2026-05-22 19:43 | 41K | |
| Randy Crawford - Alm..> | 2026-05-22 20:42 | 46K | |
| Ramses Shaffy - Samm..> | 2026-05-22 20:42 | 44K | |
| Ramones - Rock 'n' R..> | 2026-05-22 19:34 | 278K | |
| Ramones, The - Rock ..> | 2026-05-22 19:43 | 18K | |
| Rammstein - Sonne.jpg | 2026-05-22 20:10 | 23K | |
| Rammstein - Mutter.jpg | 2026-05-22 20:10 | 23K | |
| Rammstein - Ich Will..> | 2026-05-22 20:10 | 23K | |
| Ram Jam - Black Bett..> | 2026-05-22 19:34 | 38K | |
| Ralph Mctell - Stree..> | 2026-05-22 20:42 | 11K | |
| Rainbows - Balla, ba..> | 2026-05-22 20:42 | 16K | |
| Rainbow Train - Heav..> | 2026-05-22 19:34 | 366K | |
| Rage Against The Mac..> | 2026-05-22 20:00 | 49K | |
| Rag'n'bone Man - Hum..> | 2026-05-22 20:10 | 6.4K | |
| Rag'n'Bone Man - Ski..> | 2026-05-22 20:10 | 263K | |
| Raffa FL - Ritmo.jpg | 2026-05-22 20:10 | 155K | |
| Raff - Self Control.jpg | 2026-05-22 19:43 | 27K | |
| Rafaella Carra - A F..> | 2026-05-22 20:42 | 36K | |
| Radney Foster - Nobo..> | 2026-05-22 20:25 | 548K | |
| Radney Foster - Just..> | 2026-05-22 20:25 | 176K | |
| Radios - She Goes Na..> | 2026-05-22 20:00 | 76K | |
| Radiohead - Creep.jpg | 2026-05-22 20:00 | 93K | |
| Racoon - Took A Hit.jpg | 2026-05-22 20:10 | 35K | |
| Racoon - Shoes Of Li..> | 2026-05-22 20:10 | 51K | |
| Racoon - No Mercy.jpg | 2026-05-22 20:10 | 35K | |
| Racoon - Lucky All M..> | 2026-05-22 20:10 | 51K | |
| Racoon - Love You Mo..> | 2026-05-22 20:10 | 53K | |
| Racoon - Liverpool R..> | 2026-05-22 20:10 | 35K | |
| Racoon - Laugh About..> | 2026-05-22 20:10 | 16K | |
| Racoon - Don't Give ..> | 2026-05-22 20:10 | 13K | |
| Racoon - Brother.jpg | 2026-05-22 20:42 | 13K | |
| Racoon -Brick By Bri..> | 2026-05-22 20:42 | 96K | |
| Racey - Some Girls.jpg | 2026-05-22 19:34 | 36K | |
| Racey - Runaround Su..> | 2026-05-22 19:43 | 205K | |
| Racey - Lay Your Lov..> | 2026-05-22 19:34 | 39K | |
| RTISTS - To Love Som..> | 2026-05-22 20:10 | 20K | |
| RTIS - Cover Me In S..> | 2026-05-22 20:10 | 22K | |
| RMB - Spring 1996 (V..> | 2026-05-22 20:10 | 47K | |
| R Kelly - Gotham Cit..> | 2026-05-22 20:00 | 21K | |
| REO Speedwagon - Kee..> | 2026-05-22 20:42 | 35K | |
| R3HAB, Inna, Sash! -..> | 2026-05-22 20:10 | 524K | |
| R3HAB & A Touch of C..> | 2026-05-22 20:10 | 460K | |
| R.Kelly - If I Could..> | 2026-05-22 20:42 | 70K | |
| R. Kelly - I Believe..> | 2026-05-22 20:00 | 19K | |
| R. Kelly - Gotham Ci..> | 2026-05-22 20:00 | 47K | |
| R.I.O. The Hitmen & ..> | 2026-05-22 20:10 | 24K | |
| R.I.O. The Hitmen & ..> | 2026-05-22 20:10 | 196K | |
| R.I.O. Feat. U-Jean ..> | 2026-05-22 20:10 | 24K | |
| R.I.O., U‐Jean - T..> | 2026-05-22 20:10 | 44K | |
| R.E.M. - Shiny Happy..> | 2026-05-22 20:42 | 53K | |
| R.E.M. - Nightswimmi..> | 2026-05-22 20:10 | 55K | |
| R.E.M. - Everybodys ..> | 2026-05-22 20:42 | 55K | |
| R.E.M - Man On The M..> | 2026-05-22 20:00 | 438K | |
| R.E.M - Losing My Re..> | 2026-05-22 20:42 | 53K | |
| R.B. Greaves - Take ..> | 2026-05-22 20:42 | 28K | |
| Quinten CircleAudios..> | 2026-05-22 20:10 | 29K | |
| Quinten Circle, Mast..> | 2026-05-22 20:10 | 1.1M | |
| Quinten Circle, Mast..> | 2026-05-22 20:10 | 73K | |
| Quincy Jones - Ai No..> | 2026-05-22 20:00 | 26K | |
| Quiet Riot - Cum on ..> | 2026-05-22 19:43 | 245K | |
| Quick - The Rhythm O..> | 2026-05-22 19:43 | 354K | |
| Queen Vs. The Miami ..> | 2026-05-22 20:10 | 35K | |
| Queen Feat. Wyclef J..> | 2026-05-22 20:00 | 53K | |
| Queen - You Don't Fo..> | 2026-05-22 20:00 | 57K | |
| Queen - You're My Be..> | 2026-05-22 19:34 | 19K | |
| Queen - Who Wants To..> | 2026-05-22 20:42 | 56K | |
| Queen - Who Wants To..> | 2026-05-22 20:00 | 34K | |
| Queen - We will rock..> | 2026-05-22 19:34 | 65K | |
| Queen - We Are The C..> | 2026-05-22 19:34 | 56K | |
| Queen - Tie Your Mot..> | 2026-05-22 19:34 | 227K | |
| Queen - These Are Th..> | 2026-05-22 20:00 | 40K | |
| Queen - The Show Mus..> | 2026-05-22 20:00 | 40K | |
| Queen - The Miracle.jpg | 2026-05-22 19:43 | 64K | |
| Queen - The Invisibl..> | 2026-05-22 19:42 | 38K | |
| Queen - Thank God It..> | 2026-05-22 20:10 | 32K | |
| Queen - Somebody To ..> | 2026-05-22 19:34 | 39K | |
| Queen - Save Me.jpg | 2026-05-22 19:42 | 66K | |
| Queen - Radio Ga Ga.jpg | 2026-05-22 19:42 | 32K | |
| Queen - One Vision.jpg | 2026-05-22 19:42 | 66K | |
| Queen - Love Of My L..> | 2026-05-22 20:42 | 19K | |
| Queen - Love Of My L..> | 2026-05-22 19:34 | 110K | |
| Queen - Killer Queen..> | 2026-05-22 19:34 | 46K | |
| Queen - It's A Hard ..> | 2026-05-22 19:42 | 32K | |
| Queen - It's A Beaut..> | 2026-05-22 20:00 | 49K | |
| Queen - Innuendo.jpg | 2026-05-22 20:00 | 40K | |
| Queen - I Want To Br..> | 2026-05-22 19:42 | 32K | |
| Queen - I Want It Al..> | 2026-05-22 19:42 | 38K | |
| Queen - I'm Going Sl..> | 2026-05-22 20:00 | 408K | |
| Queen - Heaven For E..> | 2026-05-22 20:00 | 35K | |
| Queen - Friends Will..> | 2026-05-22 19:42 | 66K | |
| Queen - Flash.jpg | 2026-05-22 19:42 | 40K | |
| Queen - Fat Bottomed..> | 2026-05-22 19:34 | 314K | |
| Queen - Don't Stop M..> | 2026-05-22 19:34 | 321K | |
| Queen - Crazy Little..> | 2026-05-22 19:34 | 66K | |
| Queen - Breakthru.jpg | 2026-05-22 19:42 | 38K | |
| Queen - Bohemian Rha..> | 2026-05-22 20:42 | 19K | |
| Queen - Bohemian Rha..> | 2026-05-22 19:34 | 2.4M | |
| Queen - Body Languag..> | 2026-05-22 19:42 | 59K | |
| Queen - Bicycle Race..> | 2026-05-22 19:34 | 71K | |
| Queen - Another One ..> | 2026-05-22 19:42 | 66K | |
| Queen - A Kind Of Ma..> | 2026-05-22 19:42 | 66K | |
| Queen & Paul Rodgers..> | 2026-05-22 20:10 | 50K | |
| Queen & David Bowie ..> | 2026-05-22 19:43 | 25K | |
| Q65 - The Life I Liv..> | 2026-05-22 20:10 | 123K | |
| Q65 - Ann.jpg | 2026-05-22 19:59 | 123K | |
| Q65 - Ann (Stereo).jpg | 2026-05-22 20:42 | 80K | |
| Pussycat - Smile.jpg | 2026-05-22 19:34 | 38K | |
| Pussycat - My Broken..> | 2026-05-22 19:34 | 86K | |
| Pussycat - Mississip..> | 2026-05-22 19:34 | 44K | |
| Pussycat - Missisisi..> | 2026-05-22 20:25 | 44K | |
| Pussycat - It's The ..> | 2026-05-22 19:34 | 24K | |
| Pussycat - Georgie.jpg | 2026-05-22 19:34 | 44K | |
| Pussycat - Doin' La ..> | 2026-05-22 19:42 | 61K | |
| Pussycat - Desperado..> | 2026-05-22 20:25 | 49K | |
| Purple Disco Machine..> | 2026-05-22 20:10 | 32K | |
| Purple Disco Machine..> | 2026-05-22 20:10 | 133K | |
| Pure Prairie League ..> | 2026-05-22 20:42 | 42K | |
| Pulsedriver - Slammi..> | 2026-05-22 20:10 | 526K | |
| Pulsedriver & Tiscor..> | 2026-05-22 20:10 | 189K | |
| Pukka Orchestra - Li..> | 2026-05-22 19:42 | 324K | |
| Puff Daddy & Faith E..> | 2026-05-22 19:59 | 180K | |
| Psycho - Gangnam Sty..> | 2026-05-22 20:10 | 289K | |
| Psy - Gangnam Style.jpg | 2026-05-22 20:10 | 32K | |
| Propaganda - P Machi..> | 2026-05-22 19:42 | 77K | |
| Propaganda - Duel (E..> | 2026-05-22 19:59 | 128K | |
| Propaganda - Duel (E..> | 2026-05-22 19:42 | 78K | |
| Procol Harum - Hombu..> | 2026-05-22 20:42 | 24K | |
| Procol Harum - Hombu..> | 2026-05-22 19:59 | 46K | |
| Procol Harum - Hombu..> | 2026-05-22 19:34 | 44K | |
| Procol Harum - Conqu..> | 2026-05-22 20:42 | 40K | |
| Procol Harum - Conqu..> | 2026-05-22 19:34 | 44K | |
| Procol Harum - A Whi..> | 2026-05-22 20:42 | 40K | |
| Procol Harum - A Sal..> | 2026-05-22 19:34 | 268K | |
| Proclaimers - Letter..> | 2026-05-22 19:42 | 43K | |
| Princess - Say I'm Y..> | 2026-05-22 19:42 | 96K | |
| Princess - After The..> | 2026-05-22 19:42 | 204K | |
| Prince And The Revol..> | 2026-05-22 19:42 | 52K | |
| Prince And The Revol..> | 2026-05-22 19:59 | 132K | |
| Prince And The Revol..> | 2026-05-22 19:42 | 37K | |
| Prince - When Doves ..> | 2026-05-22 19:59 | 43K | |
| Prince - U Got The L..> | 2026-05-22 20:10 | 87K | |
| Prince - The Most Be..> | 2026-05-22 19:59 | 302K | |
| Prince - Sign O' The..> | 2026-05-22 19:42 | 64K | |
| Prince - Sexy M.F..jpg | 2026-05-22 19:59 | 47K | |
| Prince - Raspberry..> | 2026-05-22 19:59 | 87K | |
| Prince - Purple Rain..> | 2026-05-22 19:42 | 75K | |
| Prince - Money Don't..> | 2026-05-22 19:59 | 174K | |
| Prince - Little Red ..> | 2026-05-22 19:59 | 113K | |
| Prince - Let's Go Cr..> | 2026-05-22 19:59 | 28K | |
| Prince - Kiss.jpg | 2026-05-22 19:42 | 27K | |
| Prince - If I Was Yo..> | 2026-05-22 20:10 | 87K | |
| Prince - I Would Die..> | 2026-05-22 19:42 | 46K | |
| Prince - I Wanna Be ..> | 2026-05-22 19:34 | 27K | |
| Prince - Gold.jpg | 2026-05-22 19:59 | 48K | |
| Prince - Girls And B..> | 2026-05-22 19:42 | 30K | |
| Prince - Diamonds An..> | 2026-05-22 19:59 | 654K | |
| Prince - Cream.jpg | 2026-05-22 20:10 | 48K | |
| Prince - Controversy..> | 2026-05-22 20:10 | 42K | |
| Prince - 1999.jpg | 2026-05-22 19:42 | 94K | |
| Prince & The Revolut..> | 2026-05-22 19:42 | 30K | |
| Prince & The Revolut..> | 2026-05-22 19:59 | 642K | |
| Primo Scala & his Ac..> | 2026-05-22 20:42 | 61K | |
| Primo Scala & his Ac..> | 2026-05-22 20:42 | 61K | |
| Primo Scala & his Ac..> | 2026-05-22 20:42 | 61K | |
| Pretenders - I Go To..> | 2026-05-22 20:42 | 33K | |
| Pretenders - I'll St..> | 2026-05-22 19:59 | 175K | |
| Pretenders - Don't g..> | 2026-05-22 20:42 | 39K | |
| Pretenders - Brass I..> | 2026-05-22 19:34 | 28K | |
| Pretenders - Back on..> | 2026-05-22 19:42 | 35K | |
| Pretenders - 2000 Mi..> | 2026-05-22 19:42 | 58K | |
| Pretenders, The - Br..> | 2026-05-22 19:42 | 28K | |
| Press - Cantara Pepe..> | 2026-05-22 19:42 | 173K | |
| President - You're G..> | 2026-05-22 20:10 | 40K | |
| Pras Michel & Ol' Di..> | 2026-05-22 20:10 | 43K | |
| Ppk - Resurection.jpg | 2026-05-22 19:59 | 24K | |
| Poylow - Living On V..> | 2026-05-22 20:10 | 376K | |
| Powercut & Nubian Pr..> | 2026-05-22 19:59 | 61K | |
| Power Station - Some..> | 2026-05-22 19:42 | 41K | |
| Power Hit Radio.jpg | 2026-05-22 19:29 | 3.1K | |
| Postman Ft. Dignity ..> | 2026-05-22 19:59 | 8.9K | |
| Post Malone - Circle..> | 2026-05-22 20:10 | 95K | |
| Porter Wagoner - Ski..> | 2026-05-22 20:25 | 220K | |
| Porter Wagoner - Mis..> | 2026-05-22 20:25 | 195K | |
| Porter Wagoner - Gre..> | 2026-05-22 20:25 | 34K | |
| Poppy's - Isabelle, ..> | 2026-05-22 19:34 | 26K | |
| Popcorn Makers - Pop..> | 2026-05-22 19:34 | 116K | |
| Pop Tops - Mamy Blue..> | 2026-05-22 19:59 | 54K | |
| Pop Tops - Mammy Blu..> | 2026-05-22 19:34 | 64K | |
| Pop-Tops - Suzanne S..> | 2026-05-22 19:34 | 47K | |
| Police - Walking On ..> | 2026-05-22 19:34 | 75K | |
| Police - So Lonely.jpg | 2026-05-22 19:34 | 91K | |
| Police - Roxanne.jpg | 2026-05-22 19:34 | 91K | |
| Police - Message In ..> | 2026-05-22 19:34 | 75K | |
| Police -Every Breath..> | 2026-05-22 19:42 | 86K | |
| Police, The - Every ..> | 2026-05-22 19:42 | 25K | |
| Police, The - Can't ..> | 2026-05-22 19:34 | 25K | |
| Poison - Every Rose ..> | 2026-05-22 19:42 | 89K | |
| Pointer Sisters - Ne..> | 2026-05-22 19:42 | 72K | |
| Pointer Sisters - Ju..> | 2026-05-22 19:42 | 72K | |
| Pointer Sisters - He..> | 2026-05-22 19:59 | 33K | |
| Pointer Sisters - Ha..> | 2026-05-22 19:59 | 27K | |
| Pointer Sisters - Fi..> | 2026-05-22 19:34 | 57K | |
| Pointer Sisters - Au..> | 2026-05-22 19:42 | 72K | |
| Pointer Sisters, The..> | 2026-05-22 19:42 | 45K | |
| Pointer Sisters, The..> | 2026-05-22 19:42 | 497K | |
| Poco Loco Gang - Poc..> | 2026-05-22 19:59 | 363K | |
| Poco Loco Gang - Let..> | 2026-05-22 19:59 | 313K | |
| Poco - Rose Of Cimar..> | 2026-05-22 19:34 | 163K | |
| Poco - Call It Love.jpg | 2026-05-22 19:42 | 36K | |
| Playing you the grea..> | 2026-05-22 19:29 | 3.1K | |
| Playing the latest h..> | 2026-05-22 19:29 | 3.1K | |
| Playing the best und..> | 2026-05-22 19:29 | 3.1K | |
| Playing You Five Dec..> | 2026-05-22 19:29 | 3.1K | |
| Player - Baby Come B..> | 2026-05-22 19:34 | 238K | |
| Playahitty - The Sum..> | 2026-05-22 20:10 | 361K | |
| Playahitty - The Sum..> | 2026-05-22 19:59 | 361K | |
| Platters - Twilight ..> | 2026-05-22 20:42 | 52K | |
| Platters - The Great..> | 2026-05-22 20:42 | 40K | |
| Platters - Smoke Get..> | 2026-05-22 20:42 | 52K | |
| Platters - Only You.jpg | 2026-05-22 20:42 | 308K | |
| Platters - My Prayer..> | 2026-05-22 19:59 | 35K | |
| Plastic Bertrand - C..> | 2026-05-22 20:42 | 69K | |
| Plain White T's - He..> | 2026-05-22 20:42 | 64K | |
| Pixie Lott - Mama Do..> | 2026-05-22 20:10 | 52K | |
| Pitbull Ft. Ke$ha -T..> | 2026-05-22 20:10 | 27K | |
| Pitbull Ft. John Rya..> | 2026-05-22 20:10 | 27K | |
| Pitbull - I Know You..> | 2026-05-22 20:10 | 29K | |
| Pitbull - I Know You..> | 2026-05-22 20:09 | 247K | |
| Pitbull - Hotel Room..> | 2026-05-22 20:09 | 27K | |
| Pitbull - Fireball (..> | 2026-05-22 20:09 | 27K | |
| Pino D'angio - Ma Qu..> | 2026-05-22 20:09 | 13K | |
| Pink Ft. Nate Ruess ..> | 2026-05-22 20:09 | 43K | |
| Pink Floyd - Money.jpg | 2026-05-22 19:59 | 76K | |
| Pink Floyd - Comfort..> | 2026-05-22 19:34 | 152K | |
| Pink Floyd - Another..> | 2026-05-22 19:34 | 24K | |
| Pink Floyd - Another..> | 2026-05-22 19:59 | 32K | |
| Pink - What About Us..> | 2026-05-22 20:42 | 51K | |
| Pink - Walk Me Home.jpg | 2026-05-22 20:09 | 45K | |
| Pink - So What.jpg | 2026-05-22 20:09 | 101K | |
| Pink - Raise Your Gl..> | 2026-05-22 20:09 | 32K | |
| Pink - Please Don't ..> | 2026-05-22 20:09 | 31K | |
| Pink - Just Like A P..> | 2026-05-22 20:09 | 31K | |
| Pink - Get The Party..> | 2026-05-22 20:09 | 57K | |
| Pink -Funhouse.jpg | 2026-05-22 20:09 | 88K | |
| Pink - Fuckin' Perfe..> | 2026-05-22 20:09 | 59K | |
| Pink - Family Portra..> | 2026-05-22 20:09 | 31K | |
| Pink - Dear Mr Presi..> | 2026-05-22 20:09 | 60K | |
| Pin-Occhio - Tu Tatu..> | 2026-05-22 19:59 | 173K | |
| Pin-Occhio - Pinocch..> | 2026-05-22 19:59 | 16K | |
| Pilot - Magic.jpg | 2026-05-22 19:34 | 279K | |
| Piglets - Johnny Reg..> | 2026-05-22 19:34 | 48K | |
| Pigbag - Papa's Got ..> | 2026-05-22 19:42 | 63K | |
| Piet Veerman - Toget..> | 2026-05-22 20:25 | 40K | |
| Piet Veerman - Sai..> | 2026-05-22 20:42 | 41K | |
| Piet Veerman - Rolli..> | 2026-05-22 19:34 | 155K | |
| Piet Veerman - Arms ..> | 2026-05-22 20:25 | 40K | |
| Piet Veerman - Annie..> | 2026-05-22 20:25 | 40K | |
| Pierre Rapsat - Judy..> | 2026-05-22 19:42 | 31K | |
| Pierre Groscolas - L..> | 2026-05-22 19:34 | 43K | |
| Pierre Groscolas - E..> | 2026-05-22 19:34 | 18K | |
| Philip Bailey - Easy..> | 2026-05-22 19:42 | 212K | |
| Philip Bailey & Litt..> | 2026-05-22 19:42 | 94K | |
| Philadelphia Interna..> | 2026-05-22 19:59 | 55K | |
| Philadelphia Interna..> | 2026-05-22 19:34 | 289K | |
| Phil Lynott - Old To..> | 2026-05-22 20:09 | 54K | |
| Phil Collins - You C..> | 2026-05-22 19:42 | 60K | |
| Phil Collins - You'l..> | 2026-05-22 19:59 | 74K | |
| Phil Collins - Two H..> | 2026-05-22 19:42 | 68K | |
| Phil Collins - True ..> | 2026-05-22 19:59 | 74K | |
| Phil Collins - That'..> | 2026-05-22 19:59 | 52K | |
| Phil Collins - Take ..> | 2026-05-22 19:42 | 96K | |
| Phil Collins - Sussu..> | 2026-05-22 19:42 | 18K | |
| Phil Collins - Somet..> | 2026-05-22 20:09 | 49K | |
| Phil Collins - One M..> | 2026-05-22 19:42 | 18K | |
| Phil Collins - Look ..> | 2026-05-22 20:09 | 37K | |
| Phil Collins - In Th..> | 2026-05-22 19:42 | 71K | |
| Phil Collins - I Wis..> | 2026-05-22 19:59 | 52K | |
| Phil Collins - Groov..> | 2026-05-22 19:42 | 1.7M | |
| Phil Collins - Every..> | 2026-05-22 20:09 | 50K | |
| Phil Collins - Don't..> | 2026-05-22 20:09 | 49K | |
| Phil Collins - Do Yo..> | 2026-05-22 19:59 | 650K | |
| Phil Collins - Dance..> | 2026-05-22 19:59 | 39K | |
| Phil Collins - Can't..> | 2026-05-22 20:09 | 50K | |
| Phil Collins - Both ..> | 2026-05-22 19:59 | 78K | |
| Phil Collins - Anoth..> | 2026-05-22 19:42 | 34K | |
| Phil Collins - Anoth..> | 2026-05-22 19:59 | 34K | |
| Phil Collins - Again..> | 2026-05-22 20:42 | 106K | |
| Phil Collins - Again..> | 2026-05-22 19:42 | 106K | |
| Phil Collins - Again..> | 2026-05-22 19:59 | 37K | |
| Phil Collins - A Gro..> | 2026-05-22 19:59 | 32K | |
| Phil Collins & Phili..> | 2026-05-22 20:42 | 35K | |
| Phil Collins & Maryl..> | 2026-05-22 19:59 | 472K | |
| Phats & Small - Turn..> | 2026-05-22 19:59 | 184K | |
| Phats & Small - Toni..> | 2026-05-22 20:09 | 62K | |
| Pharrell Williams - ..> | 2026-05-22 20:09 | 33K | |
| Ph.D. - I Won't Let ..> | 2026-05-22 19:42 | 14K | |
| Ph.D - I Won't Let Y..> | 2026-05-22 19:59 | 24K | |
| Peyton Rivers - The ..> | 2026-05-22 20:25 | 475K | |
| Petula Clark - You'r..> | 2026-05-22 20:42 | 30K | |
| Petula Clark - With ..> | 2026-05-22 19:42 | 6.3M | |
| Petula Clark - This ..> | 2026-05-22 20:42 | 264K | |
| Petula Clark - My lo..> | 2026-05-22 20:42 | 45K | |
| Petula Clark - I Don..> | 2026-05-22 19:34 | 58K | |
| Petula Clark - Downt..> | 2026-05-22 20:42 | 37K | |
| Petula Clark - Don't..> | 2026-05-22 19:59 | 30K | |
| Petra & Co - Just Le..> | 2026-05-22 19:42 | 44K | |
| Peters & Lee - Song ..> | 2026-05-22 19:34 | 398K | |
| Peter Tosh - Johnny ..> | 2026-05-22 19:42 | 90K | |
| Peter Tosh & Mick Ja..> | 2026-05-22 19:34 | 48K | |
| Peter Tetteroo - Red..> | 2026-05-22 20:42 | 17K | |
| Peter Skellern - You..> | 2026-05-22 20:42 | 44K | |
| Peter Schilling - Ma..> | 2026-05-22 19:42 | 19K | |
| Peter Schilling - Ma..> | 2026-05-22 20:42 | 47K | |
| Peter Schilling - Ma..> | 2026-05-22 19:42 | 19K | |
| Peter Sarstedt - Whe..> | 2026-05-22 20:42 | 22K | |
| Peter Orloff - Ein M..> | 2026-05-22 19:34 | 41K | |
| Peter Maffay - Du.jpg | 2026-05-22 20:42 | 36K | |
| Peter Kent - It's A ..> | 2026-05-22 19:42 | 359K | |
| Peter Hollestelle - ..> | 2026-05-22 19:34 | 31K | |
| Peter Henn - Flip Fl..> | 2026-05-22 19:34 | 91K | |
| Peter Gabriel - Sols..> | 2026-05-22 20:42 | 93K | |
| Peter Gabriel - Sled..> | 2026-05-22 19:42 | 27K | |
| Peter Gabriel - Don'..> | 2026-05-22 19:42 | 143K | |
| Peter Frampton - Sho..> | 2026-05-22 20:42 | 36K | |
| Peter Frampton - Sho..> | 2026-05-22 19:42 | 46K | |
| Peter Frampton - Bab..> | 2026-05-22 19:34 | 210K | |
| Peter Frampton - Bab..> | 2026-05-22 19:42 | 46K | |
| Peter Fox - Haus Am ..> | 2026-05-22 20:42 | 49K | |
| Peter Cetera - The G..> | 2026-05-22 20:42 | 38K | |
| Peter Cetera - Glory..> | 2026-05-22 19:42 | 40K | |
| Peter Andre - Myster..> | 2026-05-22 19:59 | 320K | |
| Peter Allen - I Go T..> | 2026-05-22 19:34 | 16K | |
| Peter, Paul, & Mary ..> | 2026-05-22 20:42 | 29K | |
| Peter & Gordon - Wom..> | 2026-05-22 20:42 | 69K | |
| Peter & Gordon - Tru..> | 2026-05-22 20:42 | 64K | |
| Peter & Gordon - To ..> | 2026-05-22 20:42 | 46K | |
| Peter & Gordon - Lad..> | 2026-05-22 20:42 | 30K | |
| Peter & Gordon - A W..> | 2026-05-22 20:42 | 42K | |
| Pete Townshend - Fac..> | 2026-05-22 19:42 | 98K | |
| Pete Seeger - We Sha..> | 2026-05-22 20:42 | 57K | |
| Pet Shop Boys - Wher..> | 2026-05-22 19:59 | 336K | |
| Pet Shop Boys - What..> | 2026-05-22 19:59 | 50K | |
| Pet Shop Boys - West..> | 2026-05-22 19:42 | 125K | |
| Pet Shop Boys - Subu..> | 2026-05-22 19:42 | 25K | |
| Pet Shop Boys - Oppo..> | 2026-05-22 20:42 | 9.5K | |
| Pet Shop Boys - Oppo..> | 2026-05-22 19:42 | 7.3K | |
| Pet Shop Boys - It's..> | 2026-05-22 19:42 | 47K | |
| Pet Shop Boys - Go W..> | 2026-05-22 19:59 | 191K | |
| Pet Shop Boys - Domi..> | 2026-05-22 19:42 | 53K | |
| Pet Shop Boys - Alwa..> | 2026-05-22 19:42 | 53K | |
| Pet Shop Boys & Dust..> | 2026-05-22 19:42 | 47K | |
| Perry Como - Papa Lo..> | 2026-05-22 20:42 | 41K | |
| Perry Como - Mandoli..> | 2026-05-22 19:59 | 23K | |
| Perry Como - Magic M..> | 2026-05-22 20:42 | 240K | |
| Perry Como - It's Im..> | 2026-05-22 20:42 | 68K | |
| Perry Como - I Love ..> | 2026-05-22 19:34 | 173K | |
| Perry Como - For The..> | 2026-05-22 19:59 | 35K | |
| Perry Como - Don't L..> | 2026-05-22 20:42 | 43K | |
| Perry Como - Caterin..> | 2026-05-22 19:34 | 1.0M | |
| Perry Como - Catch A..> | 2026-05-22 20:42 | 129K | |
| Perry Como - And I L..> | 2026-05-22 19:34 | 61K | |
| Perplexer - Acid Fol..> | 2026-05-22 20:09 | 212K | |
| Perfect Stranger - Y..> | 2026-05-22 20:25 | 271K | |
| Perfect PitchRocco -..> | 2026-05-22 20:09 | 68K | |
| Perez Prado - Mambo ..> | 2026-05-22 20:42 | 37K | |
| Perez Prado - Cherry..> | 2026-05-22 20:42 | 37K | |
| Perez -Borriquito.jpg | 2026-05-22 19:34 | 34K | |
| Peret - Voy Voy (Sin..> | 2026-05-22 19:34 | 43K | |
| Percy Sledge - When ..> | 2026-05-22 20:42 | 237K | |
| Percy Sledge - Silen..> | 2026-05-22 20:42 | 28K | |
| Percy Sledge - My sp..> | 2026-05-22 20:42 | 34K | |
| Percy Faith - Theme ..> | 2026-05-22 20:09 | 57K | |
| Percy Faith & His Or..> | 2026-05-22 19:59 | 49K | |
| Pepsi & Shirlie - He..> | 2026-05-22 19:42 | 26K | |
| Pepe Goes To Cuba - ..> | 2026-05-22 19:42 | 88K | |
| People's Choice - Do..> | 2026-05-22 19:59 | 74K | |
| Penny Mclean - Lady ..> | 2026-05-22 19:34 | 264K | |
| Peggy March - I Will..> | 2026-05-22 20:42 | 404K | |
| Peggy Lee - Is That ..> | 2026-05-22 19:42 | 177K | |
| Peggy Lee - Fever.jpg | 2026-05-22 20:42 | 47K | |
| Peggy Lee - Always S..> | 2026-05-22 20:42 | 71K | |
| Peggy Lee & Judd Con..> | 2026-05-22 19:59 | 245K | |
| Peggy Lee & Jud Conl..> | 2026-05-22 20:25 | 245K | |
| Peggy Gou - (It Goes..> | 2026-05-22 20:09 | 28K | |
| Peggy Gou - (It Goes..> | 2026-05-22 20:09 | 127K | |
| Pearl Jam - Just Bre..> | 2026-05-22 20:42 | 116K | |
| Pearl Jam - Jeremy.jpg | 2026-05-22 20:09 | 55K | |
| Pearl Jam - Black.jpg | 2026-05-22 20:09 | 55K | |
| Pearl Jam - Alive.jpg | 2026-05-22 19:59 | 9.7K | |
| Peaches & Herb - Reu..> | 2026-05-22 19:34 | 44K | |
| Peace Choir - Give P..> | 2026-05-22 19:59 | 125K | |
| Peabo Bryson And Reg..> | 2026-05-22 19:59 | 21K | |
| Peabo Bryson & Rober..> | 2026-05-22 20:42 | 33K | |
| Peabo Bryson & Celin..> | 2026-05-22 20:42 | 7.3K | |
| Paul de Senneville e..> | 2026-05-22 20:42 | 410K | |
| Paula Abdul - Straig..> | 2026-05-22 19:42 | 40K | |
| Paula Abdul - Rush R..> | 2026-05-22 19:59 | 507K | |
| Paula Abdul - Opposi..> | 2026-05-22 19:59 | 37K | |
| Paula Abdul - Foreve..> | 2026-05-22 19:42 | 77K | |
| Paula Abdul & Wild P..> | 2026-05-22 19:42 | 72K | |
| Paul Young - Whereve..> | 2026-05-22 19:42 | 54K | |
| Paul Young - Love Wi..> | 2026-05-22 19:42 | 41K | |
| Paul Young - Love Of..> | 2026-05-22 19:42 | 77K | |
| Paul Young - Everyti..> | 2026-05-22 19:42 | 414K | |
| Paul Young - Come Ba..> | 2026-05-22 19:42 | 41K | |
| Paul Weller - You Do..> | 2026-05-22 20:09 | 70K | |
| Paul Weller - Wild W..> | 2026-05-22 20:09 | 20K | |
| Paul Simon - You Can..> | 2026-05-22 19:42 | 29K | |
| Paul Simon - Still C..> | 2026-05-22 19:34 | 34K | |
| Paul Simon - Slip Sl..> | 2026-05-22 19:34 | 169K | |
| Paul Simon - Mother ..> | 2026-05-22 19:34 | 30K | |
| Paul Simon - Me and ..> | 2026-05-22 19:34 | 296K | |
| Paul Simon - Late In..> | 2026-05-22 20:42 | 36K | |
| Paul Simon - Gracela..> | 2026-05-22 19:42 | 29K | |
| Paul Simon - 50 Ways..> | 2026-05-22 20:42 | 32K | |
| Paul Revere & The Ra..> | 2026-05-22 20:42 | 84K | |
| Paul Overstreet - So..> | 2026-05-22 20:25 | 114K | |
| Paul Overstreet - Lo..> | 2026-05-22 20:25 | 114K | |
| Paul Overstreet - He..> | 2026-05-22 20:25 | 157K | |
| Paul Overstreet - Da..> | 2026-05-22 20:25 | 112K | |
| Paul Overstreet - Ba..> | 2026-05-22 20:25 | 112K | |
| Paul Mccartney - The..> | 2026-05-22 19:59 | 34K | |
| Paul Mccartney - Onc..> | 2026-05-22 19:42 | 35K | |
| Paul Mccartney - My ..> | 2026-05-22 19:42 | 96K | |
| Paul Mccartney - Hop..> | 2026-05-22 19:59 | 335K | |
| Paul Mccartney & Win..> | 2026-05-22 19:34 | 42K | |
| Paul Mccartney & Win..> | 2026-05-22 19:34 | 53K | |
| Paul Mccartney & Win..> | 2026-05-22 19:42 | 49K | |
| Paul Mccartney & Win..> | 2026-05-22 20:09 | 61K | |
| Paul Mccartney & Win..> | 2026-05-22 20:09 | 23K | |
| Paul Mccartney & Win..> | 2026-05-22 19:34 | 22K | |
| Paul Mccartney & Win..> | 2026-05-22 19:59 | 23K | |
| Paul Mccartney & Win..> | 2026-05-22 19:34 | 26K | |
| Paul Mccartney & Win..> | 2026-05-22 19:34 | 55K | |
| Paul Mccartney & Win..> | 2026-05-22 19:34 | 55K | |
| Paul Mccartney & Ste..> | 2026-05-22 20:42 | 68K | |
| Paul Mccartney & Fro..> | 2026-05-22 20:42 | 197K | |
| Paul McCartney x Mic..> | 2026-05-22 19:42 | 65K | |
| Paul McCartney - Won..> | 2026-05-22 19:59 | 92K | |
| Paul McCartney - Won..> | 2026-05-22 19:34 | 414K | |
| Paul McCartney - We ..> | 2026-05-22 19:42 | 336K | |
| Paul McCartney - Liv..> | 2026-05-22 19:34 | 115K | |
| Paul Mauriat - Love ..> | 2026-05-22 20:42 | 51K | |
| Paul Mauriat - L'amo..> | 2026-05-22 20:42 | 139K | |
| Paul Jones - I've Be..> | 2026-05-22 20:42 | 185K | |
| Paul Hardcastle - Ni..> | 2026-05-22 19:42 | 394K | |
| Paul Hardcastle - Do..> | 2026-05-22 19:42 | 53K | |
| Paul Hardcastle - 19..> | 2026-05-22 20:09 | 51K | |
| Paul Davis - Sweet L..> | 2026-05-22 20:25 | 170K | |
| Paul Da Vinci - Your..> | 2026-05-22 19:34 | 72K | |
| Paul Carrack - When ..> | 2026-05-22 20:09 | 51K | |
| Paul Carrack - I Nee..> | 2026-05-22 19:42 | 42K | |
| Paul Carrack - Don't..> | 2026-05-22 20:42 | 51K | |
| Paul Carrack - Dedic..> | 2026-05-22 20:09 | 47K | |
| Paul Brandt - Do.jpg | 2026-05-22 20:25 | 172K | |
| Paul Anka - You Are ..> | 2026-05-22 20:42 | 387K | |
| Paul Anka - Put Your..> | 2026-05-22 20:42 | 41K | |
| Paul Anka - Puppy Lo..> | 2026-05-22 20:42 | 39K | |
| Paul Anka - Love Me ..> | 2026-05-22 20:09 | 17K | |
| Paul Anka - Lonely B..> | 2026-05-22 20:41 | 87K | |
| Paul Anka - I Love Y..> | 2026-05-22 20:41 | 40K | |
| Paul Anka - Hello Ji..> | 2026-05-22 20:41 | 41K | |
| Paul Anka - Eso Beso..> | 2026-05-22 20:09 | 42K | |
| Paul Anka - Diana.jpg | 2026-05-22 20:41 | 87K | |
| Paul Anka - Dance On..> | 2026-05-22 20:41 | 87K | |
| Paul Anka - A Steel ..> | 2026-05-22 20:41 | 266K | |
| Paul Anka & Odia Coa..> | 2026-05-22 19:34 | 38K | |
| Paul & Paula - Hey P..> | 2026-05-22 19:59 | 58K | |
| Patty Pravo - Pazza ..> | 2026-05-22 20:09 | 45K | |
| Patty Pravo - La Bam..> | 2026-05-22 20:09 | 33K | |
| Patty Loveless - You..> | 2026-05-22 20:25 | 21K | |
| Patty Loveless - You..> | 2026-05-22 20:25 | 21K | |
| Patty Loveless - You..> | 2026-05-22 20:25 | 213K | |
| Patty Loveless - To ..> | 2026-05-22 20:25 | 21K | |
| Patty Loveless - Tim..> | 2026-05-22 20:25 | 185K | |
| Patty Loveless - On ..> | 2026-05-22 20:25 | 21K | |
| Patty Loveless - Not..> | 2026-05-22 20:25 | 92K | |
| Patty Loveless - My ..> | 2026-05-22 20:25 | 21K | |
| Patty Loveless - Lon..> | 2026-05-22 20:25 | 213K | |
| Patty Loveless - Jea..> | 2026-05-22 20:25 | 344K | |
| Patty Loveless - I T..> | 2026-05-22 20:25 | 143K | |
| Patty Loveless - I'm..> | 2026-05-22 20:25 | 403K | |
| Patty Loveless - Hur..> | 2026-05-22 20:25 | 344K | |
| Patty Loveless - How..> | 2026-05-22 20:25 | 92K | |
| Patty Loveless - Her..> | 2026-05-22 20:25 | 42K | |
| Patty Loveless - Don..> | 2026-05-22 20:25 | 185K | |
| Patty Loveless - Cha..> | 2026-05-22 20:25 | 185K | |
| Patty Loveless - Blu..> | 2026-05-22 20:25 | 215K | |
| Patty Loveless - Bla..> | 2026-05-22 20:25 | 92K | |
| Patty & Shift - Wond..> | 2026-05-22 19:42 | 63K | |
| Pattie Austin & Jame..> | 2026-05-22 20:41 | 94K | |
| Patti Smith Group - ..> | 2026-05-22 19:34 | 9.9K | |
| Patti Page With Orch..> | 2026-05-22 20:25 | 55K | |
| Patti Page - The Ten..> | 2026-05-22 20:25 | 59K | |
| Patti Page - That Do..> | 2026-05-22 20:41 | 272K | |
| Patti Page - Tenness..> | 2026-05-22 20:25 | 35K | |
| Patti Page - Mockin'..> | 2026-05-22 20:41 | 35K | |
| Patti Page - (How Mu..> | 2026-05-22 20:41 | 38K | |
| Patti Labelle - Rele..> | 2026-05-22 19:42 | 21K | |
| Patti Labelle & Mich..> | 2026-05-22 19:42 | 47K | |
| Patti LaBelle, Travi..> | 2026-05-22 20:25 | 439K | |
| Patsy Gallant - From..> | 2026-05-22 19:34 | 34K | |
| Patsy Gallant - From..> | 2026-05-22 20:41 | 63K | |
| Patsy Cline - Walkin..> | 2026-05-22 20:25 | 759K | |
| Patsy Cline - Walkin..> | 2026-05-22 20:41 | 63K | |
| Patsy Cline - Tennes..> | 2026-05-22 20:41 | 53K | |
| Patsy Cline - Tennes..> | 2026-05-22 20:25 | 37K | |
| Patsy Cline - She()s..> | 2026-05-22 20:25 | 536K | |
| Patsy Cline - Love L..> | 2026-05-22 20:25 | 37K | |
| Patsy Cline - Crazy.jpg | 2026-05-22 20:41 | 48K | |
| Patrick Swayze - She..> | 2026-05-22 20:41 | 59K | |
| Patrick Hernandez - ..> | 2026-05-22 19:34 | 46K | |
| Patrick Hernandez - ..> | 2026-05-22 19:42 | 179K | |
| Patrick Hernandez & ..> | 2026-05-22 19:34 | 596K | |
| Patrick Cowley - Men..> | 2026-05-22 19:42 | 12K | |
| Patrick Cowley & Syl..> | 2026-05-22 20:09 | 34K | |
| Patrick Cowley & Syl..> | 2026-05-22 19:42 | 45K | |
| Patrick Bruel - Cass..> | 2026-05-22 19:59 | 47K | |
| Patricia Wheeler Huf..> | 2026-05-22 20:25 | 89K | |
| Patricia Paay -Who's..> | 2026-05-22 19:34 | 27K | |
| Patricia Paay - Who'..> | 2026-05-22 19:59 | 49K | |
| Patricia Paay - Tomo..> | 2026-05-22 19:42 | 34K | |
| Patricia Paay - Soli..> | 2026-05-22 19:42 | 249K | |
| Patricia Paay - Satu..> | 2026-05-22 19:42 | 52K | |
| Patricia Lavila - L'..> | 2026-05-22 19:59 | 230K | |
| Patrice Rushen - For..> | 2026-05-22 20:09 | 244K | |
| Patric Bruel - Casse..> | 2026-05-22 19:59 | 130K | |
| Pato Banton & Ub40 -..> | 2026-05-22 19:59 | 1.0M | |
| Pat Green - Wave on ..> | 2026-05-22 20:25 | 55K | |
| Pat Boone - Why, Bab..> | 2026-05-22 19:59 | 41K | |
| Pat Boone - Speedy G..> | 2026-05-22 20:41 | 38K | |
| Pat Boone - Moody Ri..> | 2026-05-22 19:42 | 88K | |
| Pat Boone - Love Let..> | 2026-05-22 20:41 | 72K | |
| Pat Boone - Jambalay..> | 2026-05-22 20:25 | 63K | |
| Pat Boone - I'll Be ..> | 2026-05-22 20:09 | 55K | |
| Pat Boone - Bernadin..> | 2026-05-22 19:59 | 31K | |
| Pat Boone - April Lo..> | 2026-05-22 20:41 | 523K | |
| Pat Benatar - We Bel..> | 2026-05-22 19:42 | 47K | |
| Pat Benatar - Love I..> | 2026-05-22 19:42 | 42K | |
| Pat Benatar - Invinc..> | 2026-05-22 19:42 | 61K | |
| Passion Fruit - The ..> | 2026-05-22 19:59 | 26K | |
| Passengers - Miss Sa..> | 2026-05-22 20:09 | 27K | |
| Passengers - Miss Sa..> | 2026-05-22 19:59 | 21K | |
| Passenger -Let Her G..> | 2026-05-22 20:41 | 94K | |
| Passenger - Holes.jpg | 2026-05-22 20:09 | 51K | |
| Pascal Letoublon Fea..> | 2026-05-22 20:09 | 20K | |
| Pascal Letoublon Fea..> | 2026-05-22 20:09 | 422K | |
| Pasadenas - Riding ..> | 2026-05-22 19:42 | 37K | |
| Pasadenas, The - Tri..> | 2026-05-22 19:42 | 50K | |
| Pasadena's - Tribute..> | 2026-05-22 19:59 | 46K | |
| Party Animals -Whate..> | 2026-05-22 20:09 | 210K | |
| Party Animals - We L..> | 2026-05-22 19:59 | 180K | |
| Party Animals - Have..> | 2026-05-22 19:59 | 135K | |
| Party Animals - Hava..> | 2026-05-22 19:59 | 261K | |
| Party Animals - Aqua..> | 2026-05-22 19:59 | 135K | |
| Partridge Family - L..> | 2026-05-22 19:34 | 61K | |
| Partridge Family - I..> | 2026-05-22 19:34 | 47K | |
| Parra For Cuva Ft. A..> | 2026-05-22 20:09 | 47K | |
| Parla & Pardoux - Vi..> | 2026-05-22 20:09 | 36K | |
| Parla & Pardoux - Li..> | 2026-05-22 20:09 | 36K | |
| Pappa Bear - Cherish..> | 2026-05-22 20:09 | 33K | |
| Pappa Bear & Van Der..> | 2026-05-22 20:09 | 33K | |
| Paper Lace - The Nig..> | 2026-05-22 20:41 | 68K | |
| Paper Lace - Billy D..> | 2026-05-22 19:34 | 68K | |
| Papa Bear -When The ..> | 2026-05-22 20:09 | 81K | |
| Paolo Nutini - New S..> | 2026-05-22 20:09 | 33K | |
| Paolo Conte - Via co..> | 2026-05-22 20:41 | 106K | |
| Paolo Conte - Max.jpg | 2026-05-22 20:41 | 55K | |
| Paolo Conte - Gli Im..> | 2026-05-22 20:41 | 23K | |
| Panic! At The Disco ..> | 2026-05-22 20:09 | 51K | |
| Panic! At The Disco ..> | 2026-05-22 20:09 | 51K | |
| Pam Tillis - The Riv..> | 2026-05-22 20:25 | 176K | |
| Pam Tillis - Spilled..> | 2026-05-22 20:25 | 176K | |
| Pam Tillis - Shake t..> | 2026-05-22 20:25 | 239K | |
| Pam Tillis - Maybe I..> | 2026-05-22 20:25 | 176K | |
| Pam Tillis - Let Tha..> | 2026-05-22 20:25 | 152K | |
| Pam Tillis - Land Of..> | 2026-05-22 20:41 | 40K | |
| Pam Tillis - In Betw..> | 2026-05-22 20:25 | 157K | |
| Pam Tillis - I Said ..> | 2026-05-22 20:25 | 124K | |
| Pam Tillis - Don't T..> | 2026-05-22 20:25 | 191K | |
| Pam Tillis - Do You ..> | 2026-05-22 20:25 | 151K | |
| Pam Tillis - Cleopat..> | 2026-05-22 20:25 | 370K | |
| Pam Tillis - All the..> | 2026-05-22 20:25 | 239K | |
| Pakito - Moving On S..> | 2026-05-22 20:09 | 63K | |
| Pakito - Living on V..> | 2026-05-22 20:09 | 63K | |
| Pakito - Living On V..> | 2026-05-22 20:09 | 63K | |
| Paffendorf -Where Ar..> | 2026-05-22 19:42 | 54K | |
| Paco Paco - Taka Tak..> | 2026-05-22 19:34 | 85K | |
| Paco - Amor De Mis A..> | 2026-05-22 19:42 | 46K | |
| Pacific Gas & Electr..> | 2026-05-22 19:34 | 74K | |
| P Lion - Happy Child..> | 2026-05-22 19:42 | 38K | |
| P.j. Proby - Today I..> | 2026-05-22 20:41 | 40K | |
| P.j. Proby - Somewhe..> | 2026-05-22 19:59 | 40K | |
| P.P. Arnold - Angel ..> | 2026-05-22 20:41 | 314K | |
| P.I.L. - This Is Not..> | 2026-05-22 19:42 | 18K | |
| P!nk Walk me home.jpg | 2026-05-22 20:09 | 33K | |
| P!nk -Sober.jpg | 2026-05-22 20:09 | 53K | |
| P!nk -I Don't Believ..> | 2026-05-22 20:09 | 53K | |
| P!nk - Funhouse.jpg | 2026-05-22 20:09 | 75K | |
| P!nk - Beautiful Tra..> | 2026-05-22 20:09 | 46K | |
| P!nk, Willow Sage Ha..> | 2026-05-22 20:09 | 134K | |
| P!nk, Nate Ruess - J..> | 2026-05-22 20:09 | 678K | |
| P!nk & Willow - Cove..> | 2026-05-22 20:09 | 22K | |
| P!Nk - Walk Me Home.jpg | 2026-05-22 20:09 | 19K | |
| P!Nk + Willow Sage H..> | 2026-05-22 20:09 | 77K | |
| Owl City - Fireflies..> | 2026-05-22 20:09 | 32K | |
| Owl City & Carly Rae..> | 2026-05-22 20:09 | 39K | |
| Owen Paul - My Favou..> | 2026-05-22 20:41 | 74K | |
| Overlanders - Michel..> | 2026-05-22 20:41 | 279K | |
| Outsiders - Touch.jpg | 2026-05-22 20:09 | 75K | |
| Outsiders - The Summ..> | 2026-05-22 20:41 | 310K | |
| Outsiders - Lying Al..> | 2026-05-22 19:59 | 75K | |
| Outsiders - Keep on ..> | 2026-05-22 20:41 | 310K | |
| Outlandish -Aïcha.jpg | 2026-05-22 20:09 | 34K | |
| Outkast - Ms Jackson..> | 2026-05-22 20:09 | 24K | |
| Outkast - Ms. Jackso..> | 2026-05-22 20:09 | 59K | |
| Outkast - Hey Ya!.jpg | 2026-05-22 20:09 | 59K | |
| Outhere Brothers - D..> | 2026-05-22 19:59 | 30K | |
| Outfield - Your Love..> | 2026-05-22 19:42 | 281K | |
| Otto Knows - Million..> | 2026-05-22 20:09 | 28K | |
| Otto Knows - Million..> | 2026-05-22 20:09 | 158K | |
| Ottawan - Hand Up.jpg | 2026-05-22 19:42 | 223K | |
| Ottawan - D.I.S.C.O...> | 2026-05-22 19:42 | 23K | |
| Otis Redding - Try A..> | 2026-05-22 20:41 | 44K | |
| Otis Redding - The H..> | 2026-05-22 20:41 | 206K | |
| Otis Redding - Sitti..> | 2026-05-22 20:41 | 70K | |
| Otis Redding - Papa'..> | 2026-05-22 20:41 | 34K | |
| Otis Redding - My gi..> | 2026-05-22 20:41 | 94K | |
| Otis Redding - I've ..> | 2026-05-22 20:41 | 28K | |
| Ot Quartet - Hold Th..> | 2026-05-22 20:09 | 29K | |
| Osmonds - Love Me Fo..> | 2026-05-22 19:34 | 168K | |
| Osmonds - Down by th..> | 2026-05-22 19:34 | 20K | |
| Osibisa - The Coffee..> | 2026-05-22 19:34 | 558K | |
| Oscar Harris - Song ..> | 2026-05-22 20:41 | 107K | |
| Oscar Harris & Twink..> | 2026-05-22 20:41 | 367K | |
| Oscar Harris & The T..> | 2026-05-22 19:59 | 165K | |
| Oscar Harris & Debbi..> | 2026-05-22 19:42 | 39K | |
| Oscar Benton - Benso..> | 2026-05-22 19:42 | 50K | |
| Orleans - Dance With..> | 2026-05-22 20:09 | 61K | |
| Orkest Gudrun Jankis..> | 2026-05-22 20:41 | 83K | |
| Orchestre Eric Demar..> | 2026-05-22 20:41 | 153K | |
| Orchestre De Paris -..> | 2026-05-22 20:41 | 37K | |
| Orchestral Manoeuvre..> | 2026-05-22 20:41 | 38K | |
| Orchestral Manoeuvre..> | 2026-05-22 19:42 | 71K | |
| Orchestral Manoeuvre..> | 2026-05-22 19:42 | 32K | |
| Orchestral Manoeuvre..> | 2026-05-22 19:42 | 67K | |
| Orchestral Manoeuvre..> | 2026-05-22 19:42 | 7.1K | |
| Orchestral Manoeuvre..> | 2026-05-22 20:09 | 18K | |
| Orchestral Manoeuvre..> | 2026-05-22 19:42 | 81K | |
| Oran 'Juice' Jones -..> | 2026-05-22 19:42 | 76K | |
| Opus Iii - It's a Fi..> | 2026-05-22 20:25 | 46K | |
| Opus Ft. Jerry - Liv..> | 2026-05-22 20:09 | 40K | |
| Opus - Live Is Life.jpg | 2026-05-22 19:42 | 43K | |
| Only the best music ..> | 2026-05-22 19:29 | 3.1K | |
| Online, All The Time..> | 2026-05-22 19:29 | 3.1K | |
| Onerepublic - Counti..> | 2026-05-22 20:09 | 46K | |
| Onerepublic -All The..> | 2026-05-22 20:09 | 76K | |
| One Direction - What..> | 2026-05-22 20:09 | 50K | |
| One Direction - Stor..> | 2026-05-22 20:09 | 63K | |
| One Direction - Litt..> | 2026-05-22 20:09 | 58K | |
| One Direction - Hist..> | 2026-05-22 20:09 | 61K | |
| One Direction - Best..> | 2026-05-22 20:09 | 63K | |
| One Day Fly - I Wann..> | 2026-05-22 20:09 | 51K | |
| Omi - Cheerleader (F..> | 2026-05-22 20:09 | 6.2K | |
| Omc - How Bizarre.jpg | 2026-05-22 19:59 | 59K | |
| Olympic Orchestra - ..> | 2026-05-22 20:41 | 302K | |
| Olly Alexander (Year..> | 2026-05-22 20:09 | 56K | |
| Olivia Newton John -..> | 2026-05-22 19:34 | 70K | |
| Olivia Newton John -..> | 2026-05-22 19:59 | 40K | |
| Olivia Newton John -..> | 2026-05-22 19:42 | 28K | |
| Olivia Newton John -..> | 2026-05-22 19:42 | 43K | |
| Olivia Newton John -..> | 2026-05-22 20:41 | 40K | |
| Olivia Newton John -..> | 2026-05-22 19:34 | 12K | |
| Olivia Newton John &..> | 2026-05-22 19:42 | 30K | |
| Olivia Newton John &..> | 2026-05-22 19:42 | 28K | |
| Olivia Newton-John -..> | 2026-05-22 20:41 | 37K | |
| Olivia Newton-John -..> | 2026-05-22 20:41 | 29K | |
| Olivia Newton-John -..> | 2026-05-22 19:59 | 23K | |
| Olivia Newton-John -..> | 2026-05-22 20:25 | 49K | |
| Olivia Newton-John -..> | 2026-05-22 19:42 | 32K | |
| Olivia Newton()John ..> | 2026-05-22 20:25 | 70K | |
| Olivia Newton & John..> | 2026-05-22 19:34 | 37K | |
| Olivia Newton & John..> | 2026-05-22 19:34 | 37K | |
| Oliver Onions - Sand..> | 2026-05-22 19:34 | 181K | |
| Oliver Heldens; Nile..> | 2026-05-22 20:09 | 52K | |
| Oliver Heldens; Nile..> | 2026-05-22 20:09 | 355K | |
| Oliver Heldens; DJs ..> | 2026-05-22 20:09 | 24K | |
| Oliver Heldens; DJs ..> | 2026-05-22 20:09 | 164K | |
| Oliver Heldens -Geck..> | 2026-05-22 20:09 | 31K | |
| Oliver Heldens & Bec..> | 2026-05-22 20:09 | 112K | |
| Oliver Heldens & Bec..> | 2026-05-22 20:09 | 424K | |
| Oliver Cheatham - Ge..> | 2026-05-22 20:09 | 52K | |
| Oliver - Good Mornin..> | 2026-05-22 20:41 | 38K | |
| Oleta Adams - Window..> | 2026-05-22 20:41 | 26K | |
| Oleta Adams - Rhythm..> | 2026-05-22 19:59 | 110K | |
| Oleta Adams - I just..> | 2026-05-22 20:41 | 24K | |
| Oleta Adams - Get He..> | 2026-05-22 19:59 | 52K | |
| Oleta Adams - Don't ..> | 2026-05-22 19:59 | 21K | |
| Old Jim, Caro van Ee..> | 2026-05-22 20:09 | 36K | |
| Old Jim, Caro van Ee..> | 2026-05-22 20:09 | 213K | |
| Ohio Express - Yummy..> | 2026-05-22 20:41 | 57K | |
| Offspring - Why Don'..> | 2026-05-22 19:59 | 24K | |
| Offspring - Why Don'..> | 2026-05-22 20:09 | 24K | |
| Offspring - Pretty F..> | 2026-05-22 19:59 | 92K | |
| Off - Electrica Sals..> | 2026-05-22 19:42 | 48K | |
| Ofenbach; Norma Jean..> | 2026-05-22 20:09 | 147K | |
| Ofenbach - Hurricane..> | 2026-05-22 20:09 | 263K | |
| Of Monsters And Men ..> | 2026-05-22 20:41 | 62K | |
| Odyssey - Use It Up ..> | 2026-05-22 19:42 | 45K | |
| Odyssey - Going Back..> | 2026-05-22 19:59 | 66K | |
| Odyssey - Going Back..> | 2026-05-22 19:42 | 63K | |
| Octopus - South Of T..> | 2026-05-22 19:34 | 289K | |
| Octopus - I’m So i..> | 2026-05-22 20:25 | 42K | |
| Oceana - Endless Sum..> | 2026-05-22 20:09 | 87K | |
| Oceana - Endless Sum..> | 2026-05-22 20:09 | 16K | |
| Ocean, The - Put You..> | 2026-05-22 19:34 | 20K | |
| Ocarina - Zamba (ver..> | 2026-05-22 20:41 | 73K | |
| Ocarina - Song of Oc..> | 2026-05-22 20:41 | 73K | |
| Ocarina - Song of Oc..> | 2026-05-22 20:41 | 73K | |
| Ocarina - Moonlight ..> | 2026-05-22 20:41 | 73K | |
| Ocarina - Montego Ba..> | 2026-05-22 20:41 | 73K | |
| Ocarina - Implora.jpg | 2026-05-22 20:41 | 73K | |
| Ocarina - Hotel la L..> | 2026-05-22 20:41 | 73K | |
| Ocarina - Girl from ..> | 2026-05-22 20:41 | 73K | |
| Ocarina - Bonecas de..> | 2026-05-22 20:41 | 73K | |
| Ocarina - Birth of A..> | 2026-05-22 20:41 | 73K | |
| Ocarina - Bag Pipe R..> | 2026-05-22 20:41 | 73K | |
| Ocarina - Amara.jpg | 2026-05-22 20:41 | 73K | |
| Oasis - Wonderwall.jpg | 2026-05-22 19:59 | 26K | |
| Oasis - Don't Look B..> | 2026-05-22 19:59 | 75K | |
| Oasis - Don't Look B..> | 2026-05-22 20:09 | 65K | |
| Oak Ridge Boys - Tha..> | 2026-05-22 20:25 | 202K | |
| ONEILEly May - They ..> | 2026-05-22 20:09 | 34K | |
| ONEILEly May - They ..> | 2026-05-22 20:09 | 34K | |
| OMI feat. AronChupa ..> | 2026-05-22 20:09 | 90K | |
| OMI feat. AronChupa ..> | 2026-05-22 20:09 | 260K | |
| OMI - Cheerleader.jpg | 2026-05-22 20:09 | 25K | |
| OMI - Cheerleader - ..> | 2026-05-22 20:09 | 25K | |
| OMI - Cheerleader (F..> | 2026-05-22 20:09 | 147K | |
| OMD - Enola Gay.jpg | 2026-05-22 19:42 | 91K | |
| O.c. Smith - Little ..> | 2026-05-22 20:41 | 30K | |
| O.P.M.C. - Live For ..> | 2026-05-22 19:34 | 37K | |
| O-Zone - Dragostea D..> | 2026-05-22 20:09 | 63K | |
| O'jays - Use Ta Be M..> | 2026-05-22 19:34 | 34K | |
| O'jays - Love Train.jpg | 2026-05-22 19:34 | 41K | |
| O'jays - I Love Musi..> | 2026-05-22 19:59 | 173K | |
| O'chi Brown - A Whit..> | 2026-05-22 19:42 | 14K | |
| O'Hara Playboys - Sp..> | 2026-05-22 20:41 | 82K | |
| O’g3ne - Magic.jpg | 2026-05-22 20:09 | 352K | |
| Nu Shooz - I Can't W..> | 2026-05-22 19:42 | 37K | |
| Now Hear This.jpg | 2026-05-22 19:29 | 3.1K | |
| Novo Band - Let's Go..> | 2026-05-22 19:42 | 68K | |
| Novastar - Wrong.jpg | 2026-05-22 20:09 | 34K | |
| Novastar - The Best ..> | 2026-05-22 20:09 | 34K | |
| Novaspace - To Franc..> | 2026-05-22 20:09 | 49K | |
| Novaspace - Time Aft..> | 2026-05-22 20:09 | 34K | |
| Novaspace - Love Cha..> | 2026-05-22 20:09 | 49K | |
| Novaspace - Love Cha..> | 2026-05-22 20:09 | 172K | |
| Novaspace - Dancing ..> | 2026-05-22 19:59 | 85K | |
| Nova - Aurora.jpg | 2026-05-22 19:42 | 60K | |
| Nouky - When The Rai..> | 2026-05-22 20:09 | 66K | |
| Nottingham Forrest &..> | 2026-05-22 19:34 | 51K | |
| Nottingham Forest - ..> | 2026-05-22 19:34 | 50K | |
| Notting Hillbillies ..> | 2026-05-22 19:59 | 46K | |
| Nothing But Thieves ..> | 2026-05-22 20:09 | 19K | |
| Not Fair Niklas Dee,..> | 2026-05-22 20:09 | 49K | |
| Not Fair Niklas Dee,..> | 2026-05-22 20:09 | 311K | |
| Norman Greenbaum - S..> | 2026-05-22 19:34 | 26K | |
| Norah Jones - Don't ..> | 2026-05-22 20:41 | 26K | |
| Norah Jones - Come A..> | 2026-05-22 20:41 | 26K | |
| Nora En PureLika Mor..> | 2026-05-22 20:09 | 20K | |
| Nora En PureLika Mor..> | 2026-05-22 20:09 | 1.1M | |
| Nonnenkoor Uit The S..> | 2026-05-22 20:41 | 126K | |
| Nona - Forever Yours..> | 2026-05-22 20:09 | 226K | |
| Non Stop Music.jpg | 2026-05-22 19:29 | 3.1K | |
| Nomads - Yakalelo.jpg | 2026-05-22 19:59 | 118K | |
| Nomad - (I Wanna Giv..> | 2026-05-22 20:09 | 28K | |
| Nolan Sisters - I'm ..> | 2026-05-22 19:34 | 92K | |
| Nolan Sisters, The -..> | 2026-05-22 19:42 | 92K | |
| No Mercy - When I Di..> | 2026-05-22 20:41 | 46K | |
| No Mercy - Please Do..> | 2026-05-22 19:59 | 257K | |
| No Doubt - Just A Gi..> | 2026-05-22 19:59 | 41K | |
| No Doubt - It's My L..> | 2026-05-22 20:09 | 41K | |
| No Doubt - Don't Spe..> | 2026-05-22 19:59 | 32K | |
| Nitty Gritty Dirt Ba..> | 2026-05-22 20:25 | 39K | |
| Nitty Gritty Dirt Ba..> | 2026-05-22 20:25 | 197K | |
| Nitty Gritty Dirt Ba..> | 2026-05-22 20:25 | 271K | |
| Nitty Gritty Dirt Ba..> | 2026-05-22 20:25 | 231K | |
| Nitty Gritty Dirt Ba..> | 2026-05-22 20:25 | 285K | |
| Nitty Gritty Dirt Ba..> | 2026-05-22 19:34 | 116K | |
| Nitty Gritty Dirt Ba..> | 2026-05-22 20:25 | 116K | |
| Nitty Gritty Dirt Ba..> | 2026-05-22 20:25 | 197K | |
| Nitty Gritty Dirt Ba..> | 2026-05-22 20:25 | 197K | |
| Nitty Gritty Dirt Ba..> | 2026-05-22 20:25 | 220K | |
| Nitty Gritty Dirt Ba..> | 2026-05-22 20:25 | 197K | |
| Nitty Gritty Dirt Ba..> | 2026-05-22 20:25 | 499K | |
| Nits - Sketches of S..> | 2026-05-22 19:42 | 63K | |
| Nits - Nescio.jpg | 2026-05-22 19:42 | 32K | |
| Nits - Jos Days.jpg | 2026-05-22 19:42 | 208K | |
| Nits - In The Dutch ..> | 2026-05-22 20:41 | 73K | |
| Nits - Adieu, Sweet ..> | 2026-05-22 19:42 | 208K | |
| Nirvana - The Man Wh..> | 2026-05-22 20:09 | 69K | |
| Nirvana - Smells Lik..> | 2026-05-22 19:59 | 35K | |
| Nirvana - Come As Yo..> | 2026-05-22 19:59 | 53K | |
| Nino Tempo & April S..> | 2026-05-22 19:34 | 272K | |
| Nino Ferrer - Agatha..> | 2026-05-22 19:59 | 75K | |
| Nino Ferrer - Agata.jpg | 2026-05-22 19:34 | 29K | |
| Nino De Angelo - Jen..> | 2026-05-22 19:42 | 59K | |
| Nini Rosso - Il Sile..> | 2026-05-22 20:41 | 51K | |
| Nina Simone - Try a ..> | 2026-05-22 20:41 | 71K | |
| Nina Simone - To lov..> | 2026-05-22 20:41 | 44K | |
| Nina Simone - My Bab..> | 2026-05-22 20:41 | 33K | |
| Nina Simone - Mr Boj..> | 2026-05-22 19:34 | 17K | |
| Nina Simone - It Don..> | 2026-05-22 20:41 | 55K | |
| Nina Simone - Ain't ..> | 2026-05-22 20:41 | 41K | |
| Nina Hagen Band - Un..> | 2026-05-22 19:34 | 221K | |
| Nina & Frederik - Li..> | 2026-05-22 20:09 | 59K | |
| Nils Lofgren - Shine..> | 2026-05-22 19:34 | 25K | |
| Niklas Dee & Old Jim..> | 2026-05-22 20:09 | 88K | |
| Nikki - What Did I D..> | 2026-05-22 20:09 | 31K | |
| Nik Kershaw - Wouldn..> | 2026-05-22 19:42 | 86K | |
| Nik Kershaw - The Ri..> | 2026-05-22 19:42 | 61K | |
| Nik Kershaw - I Won'..> | 2026-05-22 19:42 | 86K | |
| Nightcrawlers - Push..> | 2026-05-22 19:59 | 2.2M | |
| Nigel Kennedy - Spri..> | 2026-05-22 19:59 | 60K | |
| Niels Van Gogh Vs. E..> | 2026-05-22 20:09 | 34K | |
| Niels Van Gogh - Pul..> | 2026-05-22 19:59 | 27K | |
| Niels Geusebroek - T..> | 2026-05-22 20:41 | 68K | |
| Nicole McCloud - Don..> | 2026-05-22 19:42 | 51K | |
| Nicole Kidman & Robb..> | 2026-05-22 20:41 | 64K | |
| Nicole - Meine Klein..> | 2026-05-22 19:42 | 229K | |
| Nicole -Ein Bisschen..> | 2026-05-22 19:42 | 76K | |
| Nicole - Ein Bissche..> | 2026-05-22 19:59 | 46K | |
| Nicole - Don't You W..> | 2026-05-22 19:42 | 24K | |
| Nico & Vinz - Am I W..> | 2026-05-22 20:09 | 21K | |
| Nicky Jam & Enrique ..> | 2026-05-22 20:09 | 208K | |
| Nicki Minaj Feat. Wi..> | 2026-05-22 20:09 | 36K | |
| Nicki Minaj -Pound ..> | 2026-05-22 20:09 | 60K | |
| Nicki French - Total..> | 2026-05-22 19:59 | 14K | |
| Nickelback - How Y..> | 2026-05-22 20:09 | 58K | |
| Nick McKenzie - One ..> | 2026-05-22 19:34 | 64K | |
| Nick Mackenzie - Hel..> | 2026-05-22 19:42 | 95K | |
| Nick MacKenzie - Jua..> | 2026-05-22 19:34 | 308K | |
| Nick Lowe - I Love T..> | 2026-05-22 19:34 | 27K | |
| Nick Lowe - Half A B..> | 2026-05-22 19:42 | 44K | |
| Nick Kamen - Loving ..> | 2026-05-22 19:59 | 52K | |
| Nick Kamen - I Promi..> | 2026-05-22 19:42 | 4.4K | |
| Nick Kamen - Each Ti..> | 2026-05-22 19:42 | 15K | |
| Nick Cave & Kylie Mi..> | 2026-05-22 19:59 | 286K | |
| Nick & Simon - Rosan..> | 2026-05-22 20:41 | 74K | |
| Nice Device - Cool C..> | 2026-05-22 19:59 | 144K | |
| Nice - Country Pie -..> | 2026-05-22 19:34 | 221K | |
| Nice - America (Sing..> | 2026-05-22 20:41 | 893K | |
| Niall Horan - This T..> | 2026-05-22 20:09 | 19K | |
| Niall Horan - This T..> | 2026-05-22 20:09 | 46K | |
| Niall Horan - This T..> | 2026-05-22 20:09 | 249K | |
| Niall Horan - Slow H..> | 2026-05-22 20:09 | 40K | |
| Niall Horan - On The..> | 2026-05-22 20:09 | 40K | |
| Next One - Little sp..> | 2026-05-22 19:34 | 38K | |
| Next One - Goodbye A..> | 2026-05-22 19:34 | 38K | |
| Next One - Cats Fore..> | 2026-05-22 19:42 | 307K | |
| Newbeats - Bread and..> | 2026-05-22 20:41 | 52K | |
| New Vaudeville Band ..> | 2026-05-22 20:41 | 47K | |
| New Seekers - You wo..> | 2026-05-22 19:34 | 22K | |
| New Seekers -Pinball..> | 2026-05-22 19:34 | 131K | |
| New Seekers - I'd Li..> | 2026-05-22 19:34 | 76K | |
| New Seekers - Beg, S..> | 2026-05-22 20:41 | 71K | |
| New Seekers, The - B..> | 2026-05-22 19:34 | 39K | |
| New Riders Of The Pu..> | 2026-05-22 20:41 | 131K | |
| New Radicals - You G..> | 2026-05-22 19:59 | 41K | |
| New Order - The Beac..> | 2026-05-22 19:42 | 38K | |
| New Order - Blue Mon..> | 2026-05-22 19:42 | 38K | |
| New London Chorale &..> | 2026-05-22 20:41 | 62K | |
| New Kids On The Bloc..> | 2026-05-22 19:59 | 20K | |
| New Kids On The Bloc..> | 2026-05-22 19:59 | 187K | |
| New Jersey Mass Choi..> | 2026-05-22 19:42 | 33K | |
| New Dutch Organ Grou..> | 2026-05-22 19:34 | 194K | |
| New Christy Minstrel..> | 2026-05-22 19:59 | 52K | |
| Neon Trees -Animal.jpg | 2026-05-22 20:09 | 22K | |
| Neneh Cherry - Manch..> | 2026-05-22 19:42 | 3.6K | |
| Neneh Cherry - Buffa..> | 2026-05-22 19:42 | 63K | |
| Nena - Rette Mich.jpg | 2026-05-22 19:42 | 41K | |
| Nena - Nur Geträumt..> | 2026-05-22 19:42 | 42K | |
| Nena - Leuchtturm.jpg | 2026-05-22 19:42 | 41K | |
| Nena - Irgendwie, Ir..> | 2026-05-22 19:42 | 28K | |
| Nena - 99 Red Balloo..> | 2026-05-22 19:42 | 210K | |
| Nena - 99 Luftballon..> | 2026-05-22 19:42 | 41K | |
| Nena - 99 Luftballon..> | 2026-05-22 20:09 | 34K | |
| Nena - (Fragezeichen..> | 2026-05-22 19:42 | 31K | |
| Nena & Kim Wilde - A..> | 2026-05-22 20:09 | 76K | |
| Nelly Furtado - Say ..> | 2026-05-22 20:09 | 68K | |
| Nelly Furtado - Powe..> | 2026-05-22 20:09 | 42K | |
| Nelly Furtado - I'm ..> | 2026-05-22 20:09 | 40K | |
| Nelly Furtado - All ..> | 2026-05-22 20:09 | 68K | |
| Nek - Laura Non C'e.jpg | 2026-05-22 19:59 | 19K | |
| Neil Young - Oh, Lon..> | 2026-05-22 19:34 | 278K | |
| Neil Young - Heart O..> | 2026-05-22 19:34 | 66K | |
| Neil Young - Comes a..> | 2026-05-22 20:41 | 14K | |
| Neil Sekada - Laught..> | 2026-05-22 19:34 | 41K | |
| Neil Sedaka - Oh! Ca..> | 2026-05-22 20:41 | 256K | |
| Neil Sedaka - Happy ..> | 2026-05-22 19:59 | 55K | |
| Neil Sedaka - Calend..> | 2026-05-22 19:42 | 173K | |
| Neil Sedaka - Breaki..> | 2026-05-22 19:59 | 22K | |
| Neil Sedaka - Breaki..> | 2026-05-22 19:42 | 17K | |
| Neil Macarthur - She..> | 2026-05-22 20:41 | 82K | |
| Neil Diamond feat. D..> | 2026-05-22 20:41 | 29K | |
| Neil Diamond With Th..> | 2026-05-22 20:41 | 221K | |
| Neil Diamond With Th..> | 2026-05-22 20:41 | 221K | |
| Neil Diamond With Th..> | 2026-05-22 20:41 | 221K | |
| Neil Diamond With Th..> | 2026-05-22 20:41 | 221K | |
| Neil Diamond With Th..> | 2026-05-22 20:41 | 221K | |
| Neil Diamond With Th..> | 2026-05-22 20:41 | 221K | |
| Neil Diamond With Th..> | 2026-05-22 20:41 | 221K | |
| Neil Diamond With Th..> | 2026-05-22 20:41 | 221K | |
| Neil Diamond With Th..> | 2026-05-22 20:41 | 221K | |
| Neil Diamond With Th..> | 2026-05-22 20:41 | 221K | |
| Neil Diamond With Th..> | 2026-05-22 20:41 | 221K | |
| Neil Diamond With Th..> | 2026-05-22 20:41 | 221K | |
| Neil Diamond With Th..> | 2026-05-22 20:41 | 221K | |
| Neil Diamond With Th..> | 2026-05-22 20:41 | 221K | |
| Neil Diamond - You G..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - You A..> | 2026-05-22 20:41 | 8.2K | |
| Neil Diamond - Yeste..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Walk ..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Up on..> | 2026-05-22 20:41 | 64K | |
| Neil Diamond - The S..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - The L..> | 2026-05-22 20:41 | 8.2K | |
| Neil Diamond - The A..> | 2026-05-22 20:41 | 8.2K | |
| Neil Diamond - Thank..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Sweet..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Sweet..> | 2026-05-22 19:34 | 136K | |
| Neil Diamond - Stone..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Starg..> | 2026-05-22 20:41 | 91K | |
| Neil Diamond - Soola..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Song ..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Solit..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Skybi..> | 2026-05-22 20:41 | 36K | |
| Neil Diamond - Septe..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Red, ..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Play ..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Mr. B..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Morni..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Medle..> | 2026-05-22 20:41 | 8.2K | |
| Neil Diamond - Love ..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Longf..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Lonel..> | 2026-05-22 20:41 | 8.2K | |
| Neil Diamond - Let M..> | 2026-05-22 19:34 | 36K | |
| Neil Diamond - Lady-..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Kentu..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - If Yo..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - I Hav..> | 2026-05-22 20:41 | 8.2K | |
| Neil Diamond - I Got..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - I Am...> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - I Am...> | 2026-05-22 19:34 | 326K | |
| Neil Diamond - I (Wh..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - I've ..> | 2026-05-22 20:41 | 8.2K | |
| Neil Diamond - I'm a..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Holy,..> | 2026-05-22 20:41 | 55K | |
| Neil Diamond - Hello..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Heart..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Heade..> | 2026-05-22 20:41 | 8.2K | |
| Neil Diamond - He Ai..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Girl,..> | 2026-05-22 20:41 | 36K | |
| Neil Diamond - Forev..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Every..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Do It..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Desir..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Crack..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Cherr..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Chels..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Broth..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Beaut..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond - Ameri..> | 2026-05-22 20:41 | 56K | |
| Neil Diamond & Barbr..> | 2026-05-22 19:34 | 36K | |
| Neil Christian - Tha..> | 2026-05-22 20:41 | 16K | |
| Ned Miller - From A ..> | 2026-05-22 20:25 | 297K | |
| Neal McCoy - They're..> | 2026-05-22 20:25 | 127K | |
| Neal McCoy - The Sha..> | 2026-05-22 20:25 | 119K | |
| Neal McCoy - The Cit..> | 2026-05-22 20:25 | 219K | |
| Neal McCoy - Party O..> | 2026-05-22 20:25 | 143K | |
| Neal McCoy - No Doub..> | 2026-05-22 20:25 | 219K | |
| Neal McCoy - If I Wa..> | 2026-05-22 20:25 | 187K | |
| Nea - Some Say ((Fel..> | 2026-05-22 20:09 | 226K | |
| Nea, Felix Jaehn - ..> | 2026-05-22 20:09 | 22K | |
| Nea, Felix Jaehn - S..> | 2026-05-22 20:09 | 226K | |
| Ne Yo -Miss Independ..> | 2026-05-22 20:09 | 34K | |
| Ne-Yo - Closer.jpg | 2026-05-22 20:09 | 43K | |
| Nazareth - Love Hurt..> | 2026-05-22 20:41 | 79K | |
| Nazareth - Love Hurt..> | 2026-05-22 19:34 | 291K | |
| Nazareth - I Don't W..> | 2026-05-22 19:42 | 49K | |
| Nazareth - Dream On.jpg | 2026-05-22 19:42 | 333K | |
| Nathan Evans - Welle..> | 2026-05-22 20:09 | 120K | |
| Nathan Evans - Welle..> | 2026-05-22 20:09 | 50K | |
| Nathan Evans - Welle..> | 2026-05-22 20:09 | 120K | |
| Nathan Dawe feat. El..> | 2026-05-22 20:09 | 66K | |
| Nathan Dawe feat. El..> | 2026-05-22 20:09 | 317K | |
| Nathalie - My Love W..> | 2026-05-22 19:42 | 316K | |
| Natasha Bedingfield ..> | 2026-05-22 20:09 | 45K | |
| Natasha Bedingfield ..> | 2026-05-22 20:41 | 63K | |
| Natasha - Iko Iko.jpg | 2026-05-22 19:42 | 109K | |
| Natalie Wood - I Fee..> | 2026-05-22 20:41 | 75K | |
| Natalie Imbruglia - ..> | 2026-05-22 20:41 | 30K | |
| Natalie ColeReba McE..> | 2026-05-22 20:25 | 378K | |
| Natalie Cole - This ..> | 2026-05-22 19:34 | 45K | |
| Natalie Cole - Miss ..> | 2026-05-22 19:42 | 32K | |
| Natalie Cole & Nat K..> | 2026-05-22 19:59 | 59K | |
| Natalia & Gabriel Ri..> | 2026-05-22 20:09 | 45K | |
| Nat Stuckey - Lucill..> | 2026-05-22 20:25 | 291K | |
| Nat Stuckey - I Beli..> | 2026-05-22 20:25 | 291K | |
| Nat Stuckey - Good H..> | 2026-05-22 20:25 | 223K | |
| Nat King Cole - When..> | 2026-05-22 20:41 | 26K | |
| Nat King Cole - Too ..> | 2026-05-22 20:41 | 393K | |
| Nat King Cole - Thos..> | 2026-05-22 20:41 | 45K | |
| Nat King Cole - Star..> | 2026-05-22 19:59 | 33K | |
| Nat King Cole - Smil..> | 2026-05-22 19:34 | 33K | |
| Nat King Cole - Ramb..> | 2026-05-22 19:42 | 138K | |
| Nat King Cole - Pret..> | 2026-05-22 19:34 | 40K | |
| Nat King Cole - Mona..> | 2026-05-22 19:59 | 33K | |
| Nat King Cole & Geor..> | 2026-05-22 20:41 | 40K | |
| Nat Gonella & The Te..> | 2026-05-22 20:41 | 66K | |
| Narada Michael Walde..> | 2026-05-22 19:59 | 30K | |
| Narada Michael Walde..> | 2026-05-22 19:42 | 68K | |
| Napoleon XIV - They'..> | 2026-05-22 20:41 | 41K | |
| Nany Sinatra & Lee H..> | 2026-05-22 20:25 | 259K | |
| Nancy Wilson - The V..> | 2026-05-22 20:41 | 30K | |
| Nancy Wilson - Spinn..> | 2026-05-22 20:41 | 41K | |
| Nancy Sinatra - Thes..> | 2026-05-22 20:41 | 55K | |
| Nancy Sinatra - Like..> | 2026-05-22 19:34 | 35K | |
| Nancy Sinatra - How ..> | 2026-05-22 20:41 | 50K | |
| Nancy Sinatra & Lee ..> | 2026-05-22 19:42 | 255K | |
| Nancy Sinatra & Lee ..> | 2026-05-22 20:41 | 61K | |
| Nancy Sinatra & Lee ..> | 2026-05-22 19:59 | 36K | |
| Nancy Sinatra & Lee ..> | 2026-05-22 20:25 | 61K | |
| Nancy Sinatra & Fran..> | 2026-05-22 20:41 | 64K | |
| Nancy Boyd - Working..> | 2026-05-22 19:42 | 95K | |
| Nancy Boyd - A - Jus..> | 2026-05-22 19:59 | 14K | |
| Nancy Boyd & Demis R..> | 2026-05-22 19:42 | 30K | |
| Nancy Boyd & Darry C..> | 2026-05-22 19:42 | 26K | |
| Nancy Boyd & Cappell..> | 2026-05-22 19:42 | 11K | |
| Nanci Griffith - Fro..> | 2026-05-22 20:25 | 35K | |
| Nana Mouskouri - Why..> | 2026-05-22 19:42 | 85K | |
| Nana Mouskouri - Wei..> | 2026-05-22 20:09 | 42K | |
| Nana Mouskouri - Try..> | 2026-05-22 20:41 | 129K | |
| Nana Mouskouri - The..> | 2026-05-22 19:34 | 213K | |
| Nana Mouskouri - Onl..> | 2026-05-22 19:42 | 85K | |
| Nakatomi - Sing.jpg | 2026-05-22 19:59 | 74K | |
| Nakatomi - Children ..> | 2026-05-22 19:59 | 38K | |
| Nadieh - Windforce 1..> | 2026-05-22 20:41 | 76K | |
| N Sync - I Want You ..> | 2026-05-22 19:59 | 90K | |
| N-sync - Tearin' Up ..> | 2026-05-22 19:59 | 87K | |
| N-Trance - Set You F..> | 2026-05-22 20:09 | 27K | |
| N-Sync - Bye Bye Bye..> | 2026-05-22 20:09 | 56K | |
| Mystic - Ritmo De La..> | 2026-05-22 19:59 | 22K | |
| Mysterious Art - Das..> | 2026-05-22 19:42 | 253K | |
| Mylène Farmer - Dé..> | 2026-05-22 19:59 | 92K | |
| My Mine - Hypnotic T..> | 2026-05-22 19:42 | 39K | |
| Muskee - Brother Boo..> | 2026-05-22 19:59 | 27K | |
| Musical Youth - Pass..> | 2026-05-22 19:42 | 57K | |
| Music Instructor - H..> | 2026-05-22 20:09 | 19K | |
| Music Instructor - H..> | 2026-05-22 20:09 | 63K | |
| Muse - Uprising.jpg | 2026-05-22 20:41 | 54K | |
| Murray Head - One Ni..> | 2026-05-22 19:59 | 32K | |
| Murray Head - One Ni..> | 2026-05-22 19:42 | 20K | |
| Murray Head - Bangko..> | 2026-05-22 19:42 | 91K | |
| Muppets - Mah-Na-Mah..> | 2026-05-22 19:34 | 49K | |
| Mungo Jerry - In The..> | 2026-05-22 20:41 | 108K | |
| Mumford & Sons - Lit..> | 2026-05-22 20:09 | 47K | |
| Muddy Waters - Manni..> | 2026-05-22 19:42 | 23K | |
| Mud - Tiger Feet.jpg | 2026-05-22 19:34 | 83K | |
| Mud - Shake It Down.jpg | 2026-05-22 19:34 | 207K | |
| Mud - Lonely This Ch..> | 2026-05-22 19:34 | 41K | |
| Mud - Dyna-Mite.jpg | 2026-05-22 19:34 | 32K | |
| Mr Probz - Waves.jpg | 2026-05-22 20:41 | 42K | |
| Mr. Probz - Nothing ..> | 2026-05-22 20:41 | 47K | |
| Mr. President - Coco..> | 2026-05-22 19:59 | 16K | |
| Mr. Mister - Kyrie.jpg | 2026-05-22 19:42 | 55K | |
| Mr. Mister - Broken ..> | 2026-05-22 19:42 | 75K | |
| Mr. Lee - Get Busy.jpg | 2026-05-22 19:59 | 59K | |
| Mr.Bloe - Groovin' W..> | 2026-05-22 19:34 | 79K | |
| Mr. Big - Wild World..> | 2026-05-22 20:09 | 17K | |
| Mr. Big - To Be With..> | 2026-05-22 20:41 | 54K | |
| Mr. Acker Bilk - Str..> | 2026-05-22 19:59 | 44K | |
| Mr. Acker Bilk & His..> | 2026-05-22 20:41 | 299K | |
| Moya Brennan - The W..> | 2026-05-22 20:41 | 99K | |
| Moya Brennan - The M..> | 2026-05-22 20:41 | 99K | |
| Moya Brennan - The D..> | 2026-05-22 20:41 | 99K | |
| Moya Brennan - Pilgr..> | 2026-05-22 20:41 | 99K | |
| Moya Brennan - Misty..> | 2026-05-22 20:41 | 99K | |
| Moya Brennan - Heroe..> | 2026-05-22 20:41 | 99K | |
| Moya Brennan - Dream..> | 2026-05-22 20:41 | 99K | |
| Moya Brennan - Big Y..> | 2026-05-22 20:41 | 99K | |
| Moya Brennan - An Fh..> | 2026-05-22 20:41 | 99K | |
| Moya Brennan - A Pla..> | 2026-05-22 20:41 | 99K | |
| Moya Brennan - Éiri..> | 2026-05-22 20:41 | 99K | |
| Move It - I Save the..> | 2026-05-22 20:09 | 64K | |
| Move-it -I Save The ..> | 2026-05-22 20:09 | 47K | |
| Move - Tonight.jpg | 2026-05-22 19:34 | 107K | |
| Move - I can hear th..> | 2026-05-22 20:41 | 62K | |
| Move - Flowers in th..> | 2026-05-22 20:41 | 62K | |
| Move - Blackberry wa..> | 2026-05-22 20:41 | 40K | |
| Mouth & Macneal - Yo..> | 2026-05-22 19:34 | 49K | |
| Mouth & Macneal - Ho..> | 2026-05-22 19:34 | 30K | |
| Mouth & Macneal - He..> | 2026-05-22 19:34 | 39K | |
| Mousse T. & Tom Jone..> | 2026-05-22 19:59 | 69K | |
| Motors - Airport.jpg | 2026-05-22 20:41 | 62K | |
| Motions - Why Don't ..> | 2026-05-22 20:09 | 74K | |
| Motions - Wasted Wor..> | 2026-05-22 20:41 | 74K | |
| Motions - It's the s..> | 2026-05-22 20:41 | 160K | |
| Motions - I Ain't Go..> | 2026-05-22 20:41 | 300K | |
| Mother's Finest - Ba..> | 2026-05-22 19:34 | 107K | |
| Motels - Suddenly La..> | 2026-05-22 19:42 | 53K | |
| Moses - We Just.jpg | 2026-05-22 19:42 | 15K | |
| Mory Kante - Yeke Ye..> | 2026-05-22 19:42 | 53K | |
| Mortimer Shuman - Le..> | 2026-05-22 19:34 | 35K | |
| Mort Shuman - Le Lac..> | 2026-05-22 20:41 | 42K | |
| Morris Albert - Feel..> | 2026-05-22 19:34 | 25K | |
| Moroder -Together in..> | 2026-05-22 19:42 | 61K | |
| Moris Albert - Feeli..> | 2026-05-22 19:59 | 37K | |
| Moony - Dove.jpg | 2026-05-22 20:09 | 226K | |
| Moody Blues - Tuesda..> | 2026-05-22 19:42 | 643K | |
| Moody Blues - Questi..> | 2026-05-22 19:59 | 76K | |
| Moody Blues - Nights..> | 2026-05-22 20:41 | 84K | |
| Moody Blues - I'm Ju..> | 2026-05-22 19:59 | 49K | |
| Moody Blues - Go Now..> | 2026-05-22 20:41 | 53K | |
| Monyaka - Go Deh Yak..> | 2026-05-22 19:42 | 172K | |
| Monty Python - Alway..> | 2026-05-22 20:41 | 55K | |
| Monty Python - Alway..> | 2026-05-22 19:42 | 41K | |
| Montgomery Gentry - ..> | 2026-05-22 20:25 | 236K | |
| Montell Jordan - Thi..> | 2026-05-22 19:59 | 19K | |
| Monotones - Mono.jpg | 2026-05-22 19:42 | 53K | |
| Monkees - Last train..> | 2026-05-22 20:41 | 87K | |
| Monkees - I'm A Beli..> | 2026-05-22 20:41 | 36K | |
| Monkees - Daydream B..> | 2026-05-22 20:41 | 20K | |
| Monie Love Vs. Adeva..> | 2026-05-22 19:59 | 165K | |
| Moments And Whatnaut..> | 2026-05-22 19:59 | 38 | |
| Moloko - Sing It Bac..> | 2026-05-22 19:59 | 24K | |
| Mohombi -Bumpy Ride.jpg | 2026-05-22 20:09 | 39K | |
| Moe Bandy - Till I'm..> | 2026-05-22 20:25 | 241K | |
| Moe Bandy - She's No..> | 2026-05-22 20:25 | 577K | |
| Moe Bandy - It's a C..> | 2026-05-22 20:25 | 290K | |
| Moe Bandy - I Cheate..> | 2026-05-22 20:25 | 64K | |
| Moe Bandy - I Cheate..> | 2026-05-22 20:25 | 577K | |
| Moe Bandy - Hank Wil..> | 2026-05-22 20:25 | 293K | |
| Modo - Eins Zwei Pol..> | 2026-05-22 19:59 | 18K | |
| Modjo - Lady (Hear M..> | 2026-05-22 20:09 | 41K | |
| Modern Talking Feat...> | 2026-05-22 19:59 | 36K | |
| Modern Talking - You..> | 2026-05-22 19:42 | 60K | |
| Modern Talking - You..> | 2026-05-22 19:42 | 36K | |
| Modern Talking - You..> | 2026-05-22 19:59 | 36K | |
| Modern Talking - Ger..> | 2026-05-22 19:42 | 25K | |
| Modern Talking - Che..> | 2026-05-22 19:42 | 44K | |
| Modern Talking - Bro..> | 2026-05-22 19:42 | 44K | |
| Modern Talking - Atl..> | 2026-05-22 19:42 | 44K | |
| Mocedades - Eres Tu.jpg | 2026-05-22 20:41 | 45K | |
| Mocedades - Eres Tu ..> | 2026-05-22 19:34 | 44K | |
| Moby - Why Does My H..> | 2026-05-22 19:59 | 49K | |
| Moby - Porcelain.jpg | 2026-05-22 20:09 | 49K | |
| Mo & Po - Nathalie.jpg | 2026-05-22 20:40 | 178K | |
| Mixed Emotions - You..> | 2026-05-22 19:42 | 53K | |
| Mitch Miller - The Y..> | 2026-05-22 20:40 | 110K | |
| Mitch Miller - March..> | 2026-05-22 20:40 | 1.4M | |
| Mitch Miller & Orche..> | 2026-05-22 19:59 | 73K | |
| Mitch Miller & His O..> | 2026-05-22 20:25 | 162K | |
| Mistral - Starship 1..> | 2026-05-22 19:34 | 83K | |
| Miss Montreal - Wish..> | 2026-05-22 20:09 | 34K | |
| Miss Montreal - Just..> | 2026-05-22 20:09 | 481K | |
| Miriam Makeba - Pata..> | 2026-05-22 20:40 | 29K | |
| Mireille Mathieu and..> | 2026-05-22 19:42 | 32K | |
| Mireille Mathieu - L..> | 2026-05-22 19:42 | 29K | |
| Mireille Mathieu - E..> | 2026-05-22 19:41 | 148K | |
| Mireille Mathieu - A..> | 2026-05-22 19:34 | 32K | |
| Miranda Lambert - Th..> | 2026-05-22 20:25 | 47K | |
| Miranda - Vamos A La..> | 2026-05-22 19:59 | 16K | |
| Miquel Brown - So Ma..> | 2026-05-22 19:41 | 70K | |
| Miquel Brown - Close..> | 2026-05-22 19:41 | 63K | |
| Minnie Riperton - Lo..> | 2026-05-22 20:40 | 41K | |
| Minnie Riperton - Lo..> | 2026-05-22 19:34 | 178K | |
| Mink Deville - Spani..> | 2026-05-22 19:34 | 27K | |
| Mink Deville - Demas..> | 2026-05-22 19:41 | 30K | |
| Mindy McCready - Ten..> | 2026-05-22 20:25 | 137K | |
| Mindy McCready - Guy..> | 2026-05-22 20:25 | 134K | |
| Mindy McCready - A G..> | 2026-05-22 20:25 | 175K | |
| Milow - You Don't Kn..> | 2026-05-22 20:09 | 15K | |
| Milow - You Don't Kn..> | 2026-05-22 20:09 | 198K | |
| Milow - Ayo Technolo..> | 2026-05-22 20:09 | 65K | |
| Mills Brothers & Cou..> | 2026-05-22 19:41 | 296K | |
| Millie Small - My Bo..> | 2026-05-22 20:09 | 47K | |
| Millie - My Boy Loll..> | 2026-05-22 20:40 | 175K | |
| Milli Vanilli - Girl..> | 2026-05-22 19:41 | 53K | |
| Milli Vanilli - Girl..> | 2026-05-22 19:41 | 53K | |
| Milli Vanilli - Blam..> | 2026-05-22 19:59 | 101K | |
| Milky Chance - Stole..> | 2026-05-22 20:09 | 65K | |
| Milk Inc. - Walk On ..> | 2026-05-22 20:09 | 75K | |
| Milk Inc. - Livin' a..> | 2026-05-22 20:09 | 22K | |
| Milk Inc - Livin' A ..> | 2026-05-22 20:09 | 22K | |
| Milk Inc - Land Of T..> | 2026-05-22 20:09 | 22K | |
| Milk And Sugar Feat...> | 2026-05-22 20:09 | 60K | |
| Milk & Sugar Vs. Vay..> | 2026-05-22 20:09 | 42K | |
| Milk & Sugar Vs. Vay..> | 2026-05-22 20:09 | 1.3M | |
| Milk & Sugar Feat. M..> | 2026-05-22 20:09 | 33K | |
| Milk & Honey - Halle..> | 2026-05-22 20:40 | 129K | |
| Milk & Honey & Gali ..> | 2026-05-22 19:59 | 1.7M | |
| Miley Cyrus - Wrecki..> | 2026-05-22 20:09 | 44K | |
| Mila Mason - The Str..> | 2026-05-22 20:25 | 202K | |
| Mikis Theodorakis - ..> | 2026-05-22 20:40 | 68K | |
| Mikis Theodorakis - ..> | 2026-05-22 20:40 | 42K | |
| Mike Reid - Walk on ..> | 2026-05-22 20:40 | 60K | |
| Mike Posner - I took..> | 2026-05-22 20:09 | 9.6K | |
| Mike Posner - I Took..> | 2026-05-22 20:09 | 94K | |
| Mike Pender's Search..> | 2026-05-22 20:40 | 48K | |
| Mike Oldfield - Tubu..> | 2026-05-22 19:34 | 100K | |
| Mike Oldfield - Shad..> | 2026-05-22 19:41 | 21K | |
| Mike Oldfield - Moon..> | 2026-05-22 20:40 | 21K | |
| Mike Oldfield - In D..> | 2026-05-22 19:34 | 89K | |
| Mike Oldfield & Magg..> | 2026-05-22 19:41 | 49K | |
| Mike Oldfield & Magg..> | 2026-05-22 19:59 | 64K | |
| Mike Massé -Let It ..> | 2026-05-22 20:40 | 27K | |
| Mike Mareen - Love ..> | 2026-05-22 19:41 | 72K | |
| Mike Mago & Dragonet..> | 2026-05-22 20:09 | 76K | |
| Mike Candys & Evelyn..> | 2026-05-22 20:09 | 112K | |
| Mike Berry - Tribute..> | 2026-05-22 19:34 | 199K | |
| Mike Berry - Don't b..> | 2026-05-22 19:34 | 38K | |
| Mike Batt - Lady Of ..> | 2026-05-22 19:34 | 69K | |
| Mike Anthony - Why C..> | 2026-05-22 19:41 | 70K | |
| Mike And The Mechani..> | 2026-05-22 19:59 | 359K | |
| Mike + The Mechanics..> | 2026-05-22 19:41 | 157K | |
| Mike & The Mechanics..> | 2026-05-22 20:40 | 80K | |
| Mika - We Are Golden..> | 2026-05-22 20:09 | 103K | |
| Mika - Relax Take It..> | 2026-05-22 20:09 | 94K | |
| Mika -Love Today.jpg | 2026-05-22 20:09 | 81K | |
| Mika -Lollipop.jpg | 2026-05-22 20:09 | 81K | |
| Mika - Grace Kelly.jpg | 2026-05-22 20:09 | 94K | |
| Mika - Big Girl (You..> | 2026-05-22 20:09 | 94K | |
| Miguel Rios - Song O..> | 2026-05-22 19:34 | 87K | |
| Mighty Sparrow With ..> | 2026-05-22 19:34 | 56K | |
| Mighty Sparrow & Byr..> | 2026-05-22 20:40 | 401K | |
| Midnight Star - Mida..> | 2026-05-22 19:41 | 55K | |
| Midnight Oil - Beds ..> | 2026-05-22 19:41 | 33K | |
| Midge Ure - If I Was..> | 2026-05-22 20:40 | 26K | |
| Midge Ure - If I Was..> | 2026-05-22 19:41 | 223K | |
| Middle Of The Road -..> | 2026-05-22 20:40 | 33K | |
| Middle Of The Road -..> | 2026-05-22 19:34 | 43K | |
| Middle Of The Road -..> | 2026-05-22 20:40 | 43K | |
| Middle Of The Road -..> | 2026-05-22 19:34 | 43K | |
| Middle Of The Road -..> | 2026-05-22 20:40 | 38K | |
| Middle Of The Road -..> | 2026-05-22 19:34 | 32K | |
| Middle Of The Roa - ..> | 2026-05-22 20:40 | 88K | |
| Mickey Gilley - You ..> | 2026-05-22 20:25 | 497K | |
| Mickey Gilley - You ..> | 2026-05-22 20:25 | 380K | |
| Mickey Gilley - You'..> | 2026-05-22 20:25 | 213K | |
| Mickey Gilley - Wind..> | 2026-05-22 20:25 | 180K | |
| Mickey Gilley - True..> | 2026-05-22 20:40 | 53K | |
| Mickey Gilley - True..> | 2026-05-22 20:25 | 209K | |
| Mickey Gilley - Too ..> | 2026-05-22 20:25 | 196K | |
| Mickey Gilley - That..> | 2026-05-22 20:25 | 497K | |
| Mickey Gilley - Talk..> | 2026-05-22 20:25 | 43K | |
| Mickey Gilley - Stan..> | 2026-05-22 20:25 | 183K | |
| Mickey Gilley - Stan..> | 2026-05-22 20:40 | 75K | |
| Mickey Gilley - Put ..> | 2026-05-22 20:25 | 269K | |
| Mickey Gilley - Para..> | 2026-05-22 20:25 | 423K | |
| Mickey Gilley - Lone..> | 2026-05-22 20:25 | 155K | |
| Mickey Gilley - Fool..> | 2026-05-22 20:25 | 213K | |
| Mickey Gilley - Don'..> | 2026-05-22 20:25 | 213K | |
| Mickey Gilley - Cand..> | 2026-05-22 20:25 | 213K | |
| Mickey Gilley - Brin..> | 2026-05-22 20:25 | 149K | |
| Mickey Gilley - A He..> | 2026-05-22 20:25 | 107K | |
| Mickey Day - Oh what..> | 2026-05-22 20:40 | 8.2K | |
| Mick Jagger - Let's ..> | 2026-05-22 19:41 | 32K | |
| Mick Jagger - Just A..> | 2026-05-22 19:41 | 36K | |
| Michelle Wright - Ta..> | 2026-05-22 20:25 | 85K | |
| Michelle - Johnny Ho..> | 2026-05-22 20:40 | 334K | |
| Michel Teló - Ai Si..> | 2026-05-22 20:09 | 18K | |
| Michel Sardou - Les ..> | 2026-05-22 20:40 | 30K | |
| Michel Sardou - La M..> | 2026-05-22 20:40 | 181K | |
| Michel Polnareff - T..> | 2026-05-22 20:40 | 142K | |
| Michel Polnareff - L..> | 2026-05-22 20:09 | 76K | |
| Michel Polnareff - L..> | 2026-05-22 20:40 | 76K | |
| Michel Polnareff - L..> | 2026-05-22 20:40 | 49K | |
| Michel Fugain - Une ..> | 2026-05-22 19:34 | 134K | |
| Michel Fugain - Une ..> | 2026-05-22 20:40 | 50K | |
| Michel Fugain & Le B..> | 2026-05-22 19:59 | 50K | |
| Michel Fugain & Le B..> | 2026-05-22 19:34 | 32K | |
| Michel Fugain & Le B..> | 2026-05-22 19:34 | 191K | |
| Michel Fugain & Le B..> | 2026-05-22 19:34 | 267K | |
| Michel Delpech - Pou..> | 2026-05-22 20:40 | 64K | |
| Michaela - La Isla B..> | 2026-05-22 19:41 | 49K | |
| Michael Zager Band -..> | 2026-05-22 19:34 | 81K | |
| Michael Sembello - M..> | 2026-05-22 19:41 | 89K | |
| Michael Peterson - W..> | 2026-05-22 20:25 | 191K | |
| Michael Peterson - T..> | 2026-05-22 20:25 | 191K | |
| Michael Peterson - F..> | 2026-05-22 20:25 | 191K | |
| Michael Peterson - D..> | 2026-05-22 20:25 | 191K | |
| Michael Peterson - B..> | 2026-05-22 20:25 | 191K | |
| Michael Mcdonald - S..> | 2026-05-22 19:41 | 47K | |
| Michael Martin Murph..> | 2026-05-22 20:40 | 24K | |
| Michael Martin Murph..> | 2026-05-22 20:25 | 240K | |
| Michael Martin Murph..> | 2026-05-22 20:25 | 180K | |
| Michael Martin Murph..> | 2026-05-22 20:25 | 191K | |
| Michael Martin Murph..> | 2026-05-22 20:25 | 150K | |
| Michael Martin Murph..> | 2026-05-22 20:25 | 150K | |
| Michael Martin Murph..> | 2026-05-22 20:25 | 302K | |
| Michael Kiwanuka - C..> | 2026-05-22 20:09 | 45K | |
| Michael Johnson - Th..> | 2026-05-22 20:25 | 220K | |
| Michael Johnson - Gi..> | 2026-05-22 20:25 | 220K | |
| Michael Johnson - Cr..> | 2026-05-22 20:25 | 220K | |
| Michael Jackson Ft. ..> | 2026-05-22 20:09 | 59K | |
| Michael Jackson - Yo..> | 2026-05-22 19:59 | 40K | |
| Michael Jackson - Yo..> | 2026-05-22 20:09 | 28K | |
| Michael Jackson - Yo..> | 2026-05-22 20:40 | 38K | |
| Michael Jackson - Wi..> | 2026-05-22 19:59 | 64K | |
| Michael Jackson - Wh..> | 2026-05-22 20:09 | 78K | |
| Michael Jackson - Wa..> | 2026-05-22 19:59 | 55K | |
| Michael Jackson - Wa..> | 2026-05-22 19:41 | 43K | |
| Michael Jackson - Th..> | 2026-05-22 19:41 | 52K | |
| Michael Jackson - Th..> | 2026-05-22 19:41 | 35K | |
| Michael Jackson - Th..> | 2026-05-22 19:59 | 1.2M | |
| Michael Jackson - Th..> | 2026-05-22 19:41 | 43K | |
| Michael Jackson - St..> | 2026-05-22 20:40 | 20K | |
| Michael Jackson - Sm..> | 2026-05-22 19:41 | 43K | |
| Michael Jackson - Sh..> | 2026-05-22 20:40 | 37K | |
| Michael Jackson - Sh..> | 2026-05-22 19:34 | 172K | |
| Michael Jackson - Ro..> | 2026-05-22 19:34 | 21K | |
| Michael Jackson - Re..> | 2026-05-22 19:59 | 40K | |
| Michael Jackson - P...> | 2026-05-22 19:41 | 59K | |
| Michael Jackson - On..> | 2026-05-22 19:34 | 41K | |
| Michael Jackson - Ma..> | 2026-05-22 19:41 | 43K | |
| Michael Jackson - Ma..> | 2026-05-22 20:09 | 23K | |
| Michael Jackson - Li..> | 2026-05-22 19:41 | 43K | |
| Michael Jackson - Le..> | 2026-05-22 19:41 | 43K | |
| Michael Jackson - I ..> | 2026-05-22 20:40 | 41K | |
| Michael Jackson - Hu..> | 2026-05-22 19:41 | 59K | |
| Michael Jackson - He..> | 2026-05-22 19:59 | 40K | |
| Michael Jackson - Go..> | 2026-05-22 20:40 | 109K | |
| Michael Jackson - Gi..> | 2026-05-22 20:09 | 78K | |
| Michael Jackson - Ea..> | 2026-05-22 20:40 | 38K | |
| Michael Jackson - Do..> | 2026-05-22 19:34 | 26K | |
| Michael Jackson - Di..> | 2026-05-22 19:41 | 43K | |
| Michael Jackson - Bl..> | 2026-05-22 20:09 | 37K | |
| Michael Jackson - Bl..> | 2026-05-22 20:40 | 20K | |
| Michael Jackson - Bi..> | 2026-05-22 19:41 | 59K | |
| Michael Jackson - Be..> | 2026-05-22 19:34 | 43K | |
| Michael Jackson - Be..> | 2026-05-22 19:41 | 59K | |
| Michael Jackson - Ba..> | 2026-05-22 19:41 | 43K | |
| Michael Jackson - A..> | 2026-05-22 19:41 | 58K | |
| Michael Jackson - Ai..> | 2026-05-22 19:34 | 39K | |
| Michael Jackson & Si..> | 2026-05-22 19:59 | 73K | |
| Michael Jackson & Si..> | 2026-05-22 19:41 | 73K | |
| Michael Jackson & Pa..> | 2026-05-22 19:41 | 40K | |
| Michael Jackson & Ju..> | 2026-05-22 20:09 | 67K | |
| Michael Jackson & Ja..> | 2026-05-22 19:34 | 86K | |
| Michael Holliday - S..> | 2026-05-22 20:40 | 71K | |
| Michael Buble - It's..> | 2026-05-22 20:40 | 41K | |
| Michael Bublé - Som..> | 2026-05-22 20:40 | 46K | |
| Michael Bublé - Los..> | 2026-05-22 20:09 | 17K | |
| Michael Bublé - Hom..> | 2026-05-22 20:40 | 22K | |
| Michael Bublé - Hav..> | 2026-05-22 20:40 | 39K | |
| Michael Bublé - Geo..> | 2026-05-22 20:40 | 46K | |
| Michael Bublé - Fee..> | 2026-05-22 20:40 | 20K | |
| Michael Bublé - Eve..> | 2026-05-22 20:40 | 17K | |
| Michael Bublé - Cry..> | 2026-05-22 20:40 | 46K | |
| Michael Bublé - At ..> | 2026-05-22 20:40 | 46K | |
| Michael Bublé - All..> | 2026-05-22 20:40 | 46K | |
| Michael Bublé - All..> | 2026-05-22 20:40 | 46K | |
| Michael Bolton - Whe..> | 2026-05-22 19:59 | 35K | |
| Michael Bolton - How..> | 2026-05-22 20:40 | 42K | |
| Michael Andrews Ft. ..> | 2026-05-22 20:40 | 35K | |
| Miami Sound Machine ..> | 2026-05-22 19:41 | 59K | |
| Mezzoforte - Garden ..> | 2026-05-22 20:40 | 38K | |
| Metro Boomin, The We..> | 2026-05-22 20:09 | 83K | |
| Metro Boomin, The We..> | 2026-05-22 20:09 | 86K | |
| Metallica - Whiskey ..> | 2026-05-22 19:59 | 116K | |
| Metallica - One.jpg | 2026-05-22 19:59 | 69K | |
| Metallica - Nothing ..> | 2026-05-22 19:59 | 11K | |
| Metallica - Enter Sa..> | 2026-05-22 19:59 | 9.0K | |
| Merrymen - Mary Ann.jpg | 2026-05-22 19:41 | 130K | |
| Merrymen - Big Bambo..> | 2026-05-22 20:40 | 42K | |
| Merrilee Rush - Ange..> | 2026-05-22 20:40 | 60K | |
| Merle Travis - Sixte..> | 2026-05-22 20:25 | 88K | |
| Merle Haggard - Yest..> | 2026-05-22 20:25 | 181K | |
| Merle Haggard - Work..> | 2026-05-22 20:25 | 244K | |
| Merle Haggard - The ..> | 2026-05-22 20:25 | 508K | |
| Merle Haggard - The ..> | 2026-05-22 20:25 | 266K | |
| Merle Haggard - The ..> | 2026-05-22 20:25 | 383K | |
| Merle Haggard - The ..> | 2026-05-22 20:25 | 74K | |
| Merle Haggard - That..> | 2026-05-22 20:25 | 169K | |
| Merle Haggard - Swin..> | 2026-05-22 20:25 | 74K | |
| Merle Haggard - Swin..> | 2026-05-22 20:25 | 571K | |
| Merle Haggard - Sing..> | 2026-05-22 20:25 | 74K | |
| Merle Haggard - Reas..> | 2026-05-22 20:25 | 186K | |
| Merle Haggard - Rain..> | 2026-05-22 20:25 | 394K | |
| Merle Haggard - Panc..> | 2026-05-22 20:25 | 186K | |
| Merle Haggard - Old ..> | 2026-05-22 20:25 | 74K | |
| Merle Haggard - Okie..> | 2026-05-22 20:25 | 74K | |
| Merle Haggard - Okie..> | 2026-05-22 20:25 | 266K | |
| Merle Haggard - Natu..> | 2026-05-22 20:25 | 88K | |
| Merle Haggard - My F..> | 2026-05-22 20:25 | 151K | |
| Merle Haggard - Mama..> | 2026-05-22 20:25 | 309K | |
| Merle Haggard - Let'..> | 2026-05-22 20:25 | 270K | |
| Merle Haggard - Lege..> | 2026-05-22 20:40 | 24K | |
| Merle Haggard - Kern..> | 2026-05-22 20:25 | 249K | |
| Merle Haggard - Jesu..> | 2026-05-22 20:25 | 173K | |
| Merle Haggard - It's..> | 2026-05-22 20:24 | 74K | |
| Merle Haggard - It's..> | 2026-05-22 20:24 | 74K | |
| Merle Haggard - It's..> | 2026-05-22 20:24 | 74K | |
| Merle Haggard - If W..> | 2026-05-22 20:24 | 74K | |
| Merle Haggard - I Th..> | 2026-05-22 20:24 | 268K | |
| Merle Haggard - I Ca..> | 2026-05-22 20:24 | 42K | |
| Merle Haggard - Hung..> | 2026-05-22 20:40 | 24K | |
| Merle Haggard - Goin..> | 2026-05-22 20:24 | 169K | |
| Merle Haggard - Dadd..> | 2026-05-22 20:24 | 74K | |
| Merle Haggard - Chil..> | 2026-05-22 20:24 | 357K | |
| Merle Haggard - Cher..> | 2026-05-22 20:24 | 74K | |
| Merle Haggard - Bran..> | 2026-05-22 20:24 | 74K | |
| Merle Haggard - Big ..> | 2026-05-22 20:24 | 169K | |
| Merle Haggard - Are ..> | 2026-05-22 20:24 | 169K | |
| Merle Haggard - Alwa..> | 2026-05-22 20:24 | 74K | |
| Merle Haggard, Willi..> | 2026-05-22 20:25 | 1.0M | |
| Meredith Brooks - Bi..> | 2026-05-22 19:59 | 401K | |
| Mental Theo - Stars ..> | 2026-05-22 20:09 | 53K | |
| Men Without Hats - T..> | 2026-05-22 19:41 | 64K | |
| Men At Work - Overki..> | 2026-05-22 19:59 | 778K | |
| Men At Work - Down U..> | 2026-05-22 19:41 | 25K | |
| Members of Mayday - ..> | 2026-05-22 20:08 | 144K | |
| Members Of Mayday - ..> | 2026-05-22 20:09 | 17K | |
| Mellow Trax - Phutur..> | 2026-05-22 20:08 | 17K | |
| Mellow Trax - Phutur..> | 2026-05-22 20:08 | 146K | |
| Melissa Etheridge - ..> | 2026-05-22 19:59 | 33K | |
| Melissa Etheridge - ..> | 2026-05-22 19:41 | 33K | |
| Melee - Build To Las..> | 2026-05-22 20:08 | 48K | |
| Melba Montgomery & G..> | 2026-05-22 20:24 | 84K | |
| Melanie C - I Turn T..> | 2026-05-22 20:08 | 62K | |
| Melanie C & Lisa Lef..> | 2026-05-22 20:08 | 38K | |
| Melanie - Ruby Tuesd..> | 2026-05-22 19:34 | 25K | |
| Melanie - Lay Down (..> | 2026-05-22 20:40 | 25K | |
| Melanie - Brand New ..> | 2026-05-22 20:40 | 57K | |
| Melanie - Beautiful ..> | 2026-05-22 20:40 | 57K | |
| Melanie & The Edwin ..> | 2026-05-22 19:34 | 25K | |
| Melanie & Edwin Hawk..> | 2026-05-22 19:59 | 177K | |
| Mel Torme - You're G..> | 2026-05-22 20:40 | 71K | |
| Mel Torme - Midnight..> | 2026-05-22 20:40 | 47K | |
| Mel Tillis - I Got T..> | 2026-05-22 20:24 | 375K | |
| Mel Tillis - Coca-Co..> | 2026-05-22 20:24 | 182K | |
| Mel McDaniel - Real ..> | 2026-05-22 20:24 | 139K | |
| Mel McDaniel - Louis..> | 2026-05-22 20:24 | 161K | |
| Mel McDaniel - Baby'..> | 2026-05-22 20:24 | 315K | |
| Mel Brooks - The Hit..> | 2026-05-22 19:41 | 107K | |
| Mel & Kim - That's T..> | 2026-05-22 20:08 | 21K | |
| Mel & Kim - Showing ..> | 2026-05-22 19:41 | 39K | |
| Mel & Kim - Respecta..> | 2026-05-22 19:41 | 39K | |
| Mel & Kim - F.L.M..jpg | 2026-05-22 19:41 | 36K | |
| Meja - All 'bout The..> | 2026-05-22 19:59 | 24K | |
| Meghan Trainor - All..> | 2026-05-22 20:08 | 63K | |
| Megara vs. DJ Lee - ..> | 2026-05-22 20:08 | 104K | |
| Megara & DJ Lee - Mu..> | 2026-05-22 20:08 | 20K | |
| Meduza Feat. Hozier ..> | 2026-05-22 20:08 | 165K | |
| Meduza, Onerepublic ..> | 2026-05-22 20:08 | 297K | |
| Medicine Head - One ..> | 2026-05-22 19:34 | 74K | |
| Meco - Star Wars Tit..> | 2026-05-22 19:34 | 88K | |
| Meck Feat. Leo Sayer..> | 2026-05-22 20:08 | 12K | |
| Mecano - Hijo De La ..> | 2026-05-22 19:41 | 289K | |
| Meat Loaf Feat. Mari..> | 2026-05-22 20:40 | 53K | |
| Meat Loaf -You Took ..> | 2026-05-22 19:34 | 40K | |
| Meat Loaf - You Took..> | 2026-05-22 19:59 | 45K | |
| Meat Loaf - Two Out ..> | 2026-05-22 19:34 | 446K | |
| Meat Loaf - Paradise..> | 2026-05-22 19:34 | 245K | |
| Meat Loaf - I'd Lie ..> | 2026-05-22 20:08 | 36K | |
| Meat Loaf - I'd Do A..> | 2026-05-22 19:59 | 16K | |
| Meat Loaf - Bat Out ..> | 2026-05-22 19:34 | 40K | |
| Meat Loaf - Bat Ou..> | 2026-05-22 19:41 | 45K | |
| Mcguire Sisters - Su..> | 2026-05-22 20:08 | 50K | |
| Mcguire Sisters - Si..> | 2026-05-22 20:08 | 36K | |
| Mcguinness Flint - W..> | 2026-05-22 19:34 | 48K | |
| Mcfadden & Whitehead..> | 2026-05-22 19:34 | 236K | |
| Mc Sar & The Real Mc..> | 2026-05-22 19:59 | 29K | |
| Mc Miker G & Dj Sven..> | 2026-05-22 19:41 | 26K | |
| Mc Hammer - U Can't ..> | 2026-05-22 19:59 | 19K | |
| McGuire Sisters - Go..> | 2026-05-22 20:40 | 285K | |
| McCoys - Hang on Slo..> | 2026-05-22 20:40 | 21K | |
| McBride And The Ride..> | 2026-05-22 20:24 | 163K | |
| McBride And The Ride..> | 2026-05-22 20:24 | 163K | |
| McBride And The Ride..> | 2026-05-22 20:24 | 325K | |
| McBride & the Ride -..> | 2026-05-22 20:24 | 430K | |
| Mc B. & Daisy Dee - ..> | 2026-05-22 19:59 | 95K | |
| Maywood - Standing I..> | 2026-05-22 19:41 | 62K | |
| Maywood - Rio.jpg | 2026-05-22 19:41 | 62K | |
| Maywood - Mother, Ho..> | 2026-05-22 19:41 | 62K | |
| Maywood - Mano.jpg | 2026-05-22 19:41 | 277K | |
| Maywood - Late At Ni..> | 2026-05-22 20:40 | 41K | |
| Maywood - Give Me Ba..> | 2026-05-22 19:41 | 62K | |
| Maxx - You Can Get I..> | 2026-05-22 19:59 | 53K | |
| Maxx - Get Away.jpg | 2026-05-22 19:59 | 69K | |
| Maxine Nightingale -..> | 2026-05-22 19:34 | 26K | |
| Maxi Priest - Wild W..> | 2026-05-22 20:40 | 84K | |
| Maxi Priest - Some G..> | 2026-05-22 19:41 | 25K | |
| Maxi Priest - Close ..> | 2026-05-22 19:59 | 26K | |
| Max Werner - Rain In..> | 2026-05-22 19:41 | 103K | |
| Max Graham Vs. Yes -..> | 2026-05-22 20:08 | 80K | |
| Max Graham Vs. Yes -..> | 2026-05-22 20:08 | 80K | |
| Mavericks - Dance Th..> | 2026-05-22 19:59 | 144K | |
| Mauro Picotto - Prox..> | 2026-05-22 20:08 | 12K | |
| Mauro Picotto - Prox..> | 2026-05-22 20:08 | 164K | |
| Mauro Picotto - Komo..> | 2026-05-22 20:08 | 38K | |
| Maureen Mcgovern - T..> | 2026-05-22 19:34 | 13K | |
| Matthias Reim - Verd..> | 2026-05-22 20:40 | 58K | |
| Matthews' Southern C..> | 2026-05-22 19:34 | 54K | |
| Matthew Wilder - The..> | 2026-05-22 19:41 | 79K | |
| Matthew Wilder - Bre..> | 2026-05-22 19:41 | 79K | |
| Matt Simons - With Y..> | 2026-05-22 20:08 | 44K | |
| Matt Simons - We Can..> | 2026-05-22 20:08 | 24K | |
| Matt Simons - Catch ..> | 2026-05-22 20:08 | 38K | |
| Matt Simons - Catch ..> | 2026-05-22 20:08 | 48K | |
| Matt Sassari - Give ..> | 2026-05-22 20:08 | 60K | |
| Matt Sassari - Give ..> | 2026-05-22 20:08 | 155K | |
| Matt Monro - Walk Aw..> | 2026-05-22 20:40 | 41K | |
| Matt Monro - Todo Pa..> | 2026-05-22 20:40 | 99K | |
| Matt Monro - Strange..> | 2026-05-22 20:40 | 14K | |
| Matt Monro - Honey O..> | 2026-05-22 20:40 | 14K | |
| Matt Monro - From Ru..> | 2026-05-22 20:08 | 30K | |
| Matt Monro - Born Fr..> | 2026-05-22 20:40 | 71K | |
| Matt King - Rub It I..> | 2026-05-22 20:24 | 213K | |
| Matt Corby -Brother.jpg | 2026-05-22 20:40 | 64K | |
| Matt Bianco - Yeh Ye..> | 2026-05-22 19:41 | 40K | |
| Matt Bianco - Whose ..> | 2026-05-22 19:41 | 25K | |
| Matt Bianco - More T..> | 2026-05-22 19:41 | 40K | |
| Matt Bianco - Get Ou..> | 2026-05-22 19:41 | 40K | |
| Matt Bianco - Don't ..> | 2026-05-22 19:41 | 22K | |
| Matia Bazar - Ti Sen..> | 2026-05-22 19:41 | 34K | |
| Mathou - You Never W..> | 2026-05-22 20:40 | 17K | |
| Mathilde Santing - Y..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - W..> | 2026-05-22 20:40 | 81K | |
| Mathilde Santing - W..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - W..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - T..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - T..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - T..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - T..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - O..> | 2026-05-22 20:40 | 61K | |
| Mathilde Santing - O..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - I..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - I..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - I..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - I..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - I..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - C..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - B..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - B..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - B..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - B..> | 2026-05-22 20:40 | 10K | |
| Mathilde Santing - B..> | 2026-05-22 20:40 | 27K | |
| Mathilde Santing - A..> | 2026-05-22 20:40 | 27K | |
| Mathias Kellner - Ba..> | 2026-05-22 20:40 | 129K | |
| Matchbox - Midnite D..> | 2026-05-22 19:41 | 100K | |
| Matchbox - Buzz Buzz..> | 2026-05-22 19:41 | 83K | |
| Master Genius - Let'..> | 2026-05-22 19:41 | 51K | |
| Massive Attack - Unf..> | 2026-05-22 19:59 | 35K | |
| Massada - Sajang E.jpg | 2026-05-22 20:40 | 62K | |
| Massada - Latin Danc..> | 2026-05-22 19:34 | 296K | |
| Massada - Arumbai.jpg | 2026-05-22 19:34 | 43K | |
| Masquerade - Guardia..> | 2026-05-22 19:41 | 24K | |
| Masove - Mr. Saxobea..> | 2026-05-22 20:08 | 232K | |
| Masove - Believe.jpg | 2026-05-22 20:08 | 206K | |
| Mashmakhan - As The ..> | 2026-05-22 19:34 | 38K | |
| Mase - Feel So Good.jpg | 2026-05-22 19:58 | 218K | |
| Mary Wells - My Guy ..> | 2026-05-22 20:40 | 150K | |
| Mary Sarah & Ray Pri..> | 2026-05-22 20:24 | 211K | |
| Mary Mary - Shackles..> | 2026-05-22 20:08 | 33K | |
| Mary Macgregor - Tor..> | 2026-05-22 20:40 | 27K | |
| Mary Jane Girls - In..> | 2026-05-22 19:41 | 84K | |
| Mary J Blige & U2 - ..> | 2026-05-22 20:08 | 34K | |
| Mary J. Blige - No M..> | 2026-05-22 20:08 | 29K | |
| Mary J. Blige - Fami..> | 2026-05-22 20:08 | 29K | |
| Mary J. Blige - (You..> | 2026-05-22 19:58 | 209K | |
| Mary J. Blige & U2 -..> | 2026-05-22 20:08 | 35K | |
| Mary Hopkin - Those ..> | 2026-05-22 20:40 | 28K | |
| Mary Hopkin - Knock ..> | 2026-05-22 19:34 | 506K | |
| Mary Hopkin - Goodby..> | 2026-05-22 20:40 | 859K | |
| Mary Chapin Carpente..> | 2026-05-22 20:24 | 121K | |
| Mary Chapin Carpente..> | 2026-05-22 20:24 | 115K | |
| Mary Chapin Carpente..> | 2026-05-22 20:24 | 143K | |
| Mary Chapin Carpente..> | 2026-05-22 20:24 | 136K | |
| Mary Chapin Carpente..> | 2026-05-22 20:24 | 29K | |
| Mary Chapin Carpente..> | 2026-05-22 20:24 | 121K | |
| Mary Chapin Carpente..> | 2026-05-22 20:24 | 121K | |
| Mary Chapin Carpente..> | 2026-05-22 20:24 | 171K | |
| Mary Chapin Carpente..> | 2026-05-22 20:24 | 173K | |
| Mary-Chapin Carpente..> | 2026-05-22 20:24 | 320K | |
| Marvin Hamlisch - Th..> | 2026-05-22 19:34 | 22K | |
| Marvin Gaye - What's..> | 2026-05-22 20:40 | 47K | |
| Marvin Gaye - Sexual..> | 2026-05-22 19:41 | 62K | |
| Marvin Gaye - Let's ..> | 2026-05-22 19:34 | 62K | |
| Marvin Gaye - I Hear..> | 2026-05-22 20:40 | 65K | |
| Marvin Gaye - Got To..> | 2026-05-22 20:08 | 32K | |
| Marvin Gaye & Tammi ..> | 2026-05-22 19:58 | 36K | |
| Marvin Gaye & Tammi ..> | 2026-05-22 20:40 | 64K | |
| Marvin Gaye & Kim We..> | 2026-05-22 20:40 | 21K | |
| Marvin, Welch & Farr..> | 2026-05-22 19:34 | 91K | |
| Marvin, Welch & Farr..> | 2026-05-22 20:08 | 41K | |
| Marva Hodge & the Mo..> | 2026-05-22 20:40 | 123K | |
| Marusha - Over The R..> | 2026-05-22 19:58 | 30K | |
| Marty Stuart - Tempt..> | 2026-05-22 20:24 | 240K | |
| Marty Stuart - Now T..> | 2026-05-22 20:24 | 290K | |
| Marty Stuart - Burn ..> | 2026-05-22 20:24 | 184K | |
| Marty Stuart, Travis..> | 2026-05-22 20:24 | 38 | |
| Marty Stuart, Travis..> | 2026-05-22 20:24 | 196K | |
| Marty Stuart, The St..> | 2026-05-22 20:24 | 139K | |
| Marty Robbins - Toni..> | 2026-05-22 20:24 | 214K | |
| Marty Robbins - Stre..> | 2026-05-22 20:24 | 276K | |
| Marty Robbins - Sing..> | 2026-05-22 20:24 | 121K | |
| Marty Robbins - My W..> | 2026-05-22 20:24 | 216K | |
| Marty Robbins - I Wa..> | 2026-05-22 20:24 | 214K | |
| Marty Robbins - El P..> | 2026-05-22 20:24 | 171K | |
| Marty Robbins - Devi..> | 2026-05-22 20:24 | 151K | |
| Marty Robbins - Cool..> | 2026-05-22 20:24 | 171K | |
| Marty Robbins - A Wh..> | 2026-05-22 20:40 | 30K | |
| Marty Robbins - A Wh..> | 2026-05-22 20:24 | 124K | |
| Marty Haggard - You ..> | 2026-05-22 20:24 | 160K | |
| Marty - Trompet Polk..> | 2026-05-22 19:34 | 47K | |
| Marty - Op De Boerde..> | 2026-05-22 19:34 | 47K | |
| Marty - Maanserenade..> | 2026-05-22 20:40 | 128K | |
| Marty - Grootvaders ..> | 2026-05-22 19:34 | 47K | |
| Marty - Alma Mia.jpg | 2026-05-22 19:34 | 47K | |
| Martina McBride - Wr..> | 2026-05-22 20:24 | 141K | |
| Martina McBride - Wi..> | 2026-05-22 20:24 | 150K | |
| Martina McBride - Wh..> | 2026-05-22 20:24 | 141K | |
| Martina McBride - Va..> | 2026-05-22 20:24 | 20K | |
| Martina McBride - My..> | 2026-05-22 20:24 | 150K | |
| Martina McBride - Li..> | 2026-05-22 20:24 | 20K | |
| Martina McBride - In..> | 2026-05-22 20:24 | 150K | |
| Martina McBride - I ..> | 2026-05-22 20:24 | 72K | |
| Martina McBride - Ha..> | 2026-05-22 20:24 | 141K | |
| Martina McBride - A ..> | 2026-05-22 20:24 | 150K | |
| Martin Solveig Ft. D..> | 2026-05-22 20:08 | 256K | |
| Martin Solveig, Drag..> | 2026-05-22 20:08 | 53K | |
| Martin Solveig & Dra..> | 2026-05-22 20:08 | 99K | |
| Martin Garrix - High..> | 2026-05-22 20:08 | 25K | |
| Martin Garrix - High..> | 2026-05-22 20:08 | 155K | |
| Martin Garrix - Anim..> | 2026-05-22 20:08 | 291K | |
| Martin Garrix, John ..> | 2026-05-22 20:08 | 18K | |
| Martin Garrix, John ..> | 2026-05-22 20:08 | 275K | |
| Martika - Toy soldie..> | 2026-05-22 19:41 | 55K | |
| Martika - Martika's ..> | 2026-05-22 19:58 | 242K | |
| Marti Webb - Take Th..> | 2026-05-22 20:40 | 51K | |
| Martha Reeves & The ..> | 2026-05-22 19:58 | 117K | |
| Martha & The Vandell..> | 2026-05-22 20:40 | 340K | |
| Martay - Gimme All Y..> | 2026-05-22 19:58 | 105K | |
| Marshmello & Bastill..> | 2026-05-22 20:08 | 16K | |
| Marshall Hain - Danc..> | 2026-05-22 19:34 | 46K | |
| Marsha Raven - Catch..> | 2026-05-22 19:41 | 51K | |
| Marrs - Pump Up The ..> | 2026-05-22 19:41 | 33K | |
| Maroon 5 Ft. Christi..> | 2026-05-22 20:08 | 133K | |
| Maroon 5 Feat. Wiz K..> | 2026-05-22 20:08 | 125K | |
| Maroon 5 - This Love..> | 2026-05-22 20:08 | 72K | |
| Maroon 5 - Sunday Mo..> | 2026-05-22 20:08 | 72K | |
| Maroon 5 - Sugar.jpg | 2026-05-22 20:08 | 51K | |
| Maroon 5 - She Will ..> | 2026-05-22 20:08 | 72K | |
| Maroon 5 - Moves Lik..> | 2026-05-22 20:08 | 62K | |
| Maroon 5 - Misery.jpg | 2026-05-22 20:08 | 76K | |
| Maroon 5 - Memories.jpg | 2026-05-22 20:08 | 105K | |
| Maroon 5 - Makes Me ..> | 2026-05-22 20:08 | 36K | |
| Maroon 5 - Daylight.jpg | 2026-05-22 20:08 | 125K | |
| Marmalade - Reflecti..> | 2026-05-22 19:58 | 72K | |
| Marmalade - Ob-la-di..> | 2026-05-22 20:40 | 83K | |
| Marmalade - I See Th..> | 2026-05-22 20:40 | 234K | |
| Marlene Dietrich - S..> | 2026-05-22 20:40 | 54K | |
| Marlene Dietrich - L..> | 2026-05-22 20:40 | 65K | |
| Marlena Shaw - Calif..> | 2026-05-22 20:08 | 45K | |
| Marky Mark And The F..> | 2026-05-22 19:58 | 476K | |
| Mark van Dale - Wate..> | 2026-05-22 20:08 | 117K | |
| Mark Wills - Wish Yo..> | 2026-05-22 20:24 | 81K | |
| Mark Wills - She's I..> | 2026-05-22 20:24 | 203K | |
| Mark Wills - Places ..> | 2026-05-22 20:24 | 38K | |
| Mark Wills - I Do (C..> | 2026-05-22 20:24 | 203K | |
| Mark Wills - Don't L..> | 2026-05-22 20:24 | 191K | |
| Mark Wills - Back At..> | 2026-05-22 20:24 | 150K | |
| Mark Van Dale & Enri..> | 2026-05-22 19:58 | 19K | |
| Mark Van Dale & Enri..> | 2026-05-22 20:08 | 19K | |
| Mark Ronson Ft. Mile..> | 2026-05-22 20:08 | 61K | |
| Mark Ronson Feat. Br..> | 2026-05-22 20:08 | 46K | |
| Mark Ronson, Amy Win..> | 2026-05-22 20:08 | 73K | |
| Mark Morrison - Retu..> | 2026-05-22 20:40 | 43K | |
| Mark Knopfler - Goin..> | 2026-05-22 19:41 | 28K | |
| Mark Gray, Tammy Wyn..> | 2026-05-22 20:24 | 293K | |
| Mark Collie - Even T..> | 2026-05-22 20:24 | 198K | |
| Mark Collie - Born T..> | 2026-05-22 20:24 | 198K | |
| Mark Chesnutt - Your..> | 2026-05-22 20:24 | 74K | |
| Mark Chesnutt - Too ..> | 2026-05-22 20:24 | 244K | |
| Mark Chesnutt - This..> | 2026-05-22 20:24 | 105K | |
| Mark Chesnutt - Than..> | 2026-05-22 20:24 | 100K | |
| Mark Chesnutt - Old ..> | 2026-05-22 20:24 | 509K | |
| Mark Chesnutt - Ol' ..> | 2026-05-22 20:24 | 651K | |
| Mark Chesnutt - It S..> | 2026-05-22 20:24 | 651K | |
| Mark Chesnutt - It's..> | 2026-05-22 20:24 | 100K | |
| Mark Chesnutt - I Ju..> | 2026-05-22 20:24 | 278K | |
| Mark Chesnutt - I Do..> | 2026-05-22 20:24 | 482K | |
| Mark Chesnutt - I'll..> | 2026-05-22 20:24 | 651K | |
| Mark Chesnutt - Gonn..> | 2026-05-22 20:24 | 100K | |
| Mark Chesnutt - Goin..> | 2026-05-22 20:24 | 651K | |
| Mark Chesnutt - Bubb..> | 2026-05-22 20:24 | 651K | |
| Mark Chesnutt - Brok..> | 2026-05-22 20:24 | 633K | |
| Mark Chesnutt - Blam..> | 2026-05-22 20:24 | 128K | |
| Mark Chesnutt - Almo..> | 2026-05-22 20:24 | 278K | |
| Mark 'oh - Stuck On ..> | 2026-05-22 20:08 | 202K | |
| Mark & Clark Band - ..> | 2026-05-22 19:34 | 36K | |
| Mariska Veres - Lovi..> | 2026-05-22 19:41 | 31K | |
| Mario Lopez - The So..> | 2026-05-22 20:08 | 227K | |
| Mario Lopez - The So..> | 2026-05-22 20:08 | 12K | |
| Mario Lanza - Drink,..> | 2026-05-22 20:40 | 23K | |
| Mariniers Kapel (Joh..> | 2026-05-22 20:40 | 95K | |
| Marilyn Monroe - I W..> | 2026-05-22 20:40 | 51K | |
| Marilyn Monroe - Dia..> | 2026-05-22 19:41 | 302K | |
| Marilyn Martin - Mov..> | 2026-05-22 19:41 | 42K | |
| Marillion - Kayleigh..> | 2026-05-22 20:40 | 63K | |
| Marie Williams - Don..> | 2026-05-22 20:24 | 49K | |
| Marie Osmond - You'r..> | 2026-05-22 20:24 | 240K | |
| Marie Osmond - There..> | 2026-05-22 20:24 | 290K | |
| Marie Osmond - Read ..> | 2026-05-22 20:24 | 290K | |
| Marie Osmond - Paper..> | 2026-05-22 20:24 | 40K | |
| Marie Osmond - Paper..> | 2026-05-22 20:24 | 293K | |
| Marie Osmond - Paper..> | 2026-05-22 19:34 | 40K | |
| Marie Myriam - L'Ois..> | 2026-05-22 19:34 | 202K | |
| Marianne Rosenberg -..> | 2026-05-22 20:40 | 42K | |
| Marianne Faithfull -..> | 2026-05-22 20:40 | 27K | |
| Marianne Faithfull -..> | 2026-05-22 20:40 | 33K | |
| Marianne Faithfull -..> | 2026-05-22 20:40 | 52K | |
| Marianne Faithfull -..> | 2026-05-22 19:34 | 68K | |
| Marianne Faithfull -..> | 2026-05-22 20:40 | 123K | |
| Marianne Faithful - ..> | 2026-05-22 19:58 | 29K | |
| Mariah Carey Ft Trey..> | 2026-05-22 19:58 | 53K | |
| Mariah Carey - Witho..> | 2026-05-22 20:40 | 50K | |
| Mariah Carey - Visio..> | 2026-05-22 19:58 | 10M | |
| Mariah Carey - Make ..> | 2026-05-22 19:58 | 36K | |
| Mariah Carey - Honey..> | 2026-05-22 19:58 | 62K | |
| Mariah Carey - Hero.jpg | 2026-05-22 19:58 | 39K | |
| Mariah Carey - Fanta..> | 2026-05-22 19:58 | 47K | |
| Mariah Carey - Emoti..> | 2026-05-22 19:58 | 10M | |
| Mariah Carey - Dream..> | 2026-05-22 19:58 | 133K | |
| Mariah Carey - Anyti..> | 2026-05-22 19:58 | 22K | |
| Mariah Carey - All I..> | 2026-05-22 19:58 | 305K | |
| Mariah Carey - Again..> | 2026-05-22 20:40 | 28K | |
| Mariah Carey & Whitn..> | 2026-05-22 19:58 | 85K | |
| Mariah Carey & Jay-Z..> | 2026-05-22 20:08 | 49K | |
| Mariah Carey & Boyz ..> | 2026-05-22 19:58 | 166K | |
| Maria Zamora Y Sus M..> | 2026-05-22 20:08 | 118K | |
| Maria Mena - Just Ho..> | 2026-05-22 20:40 | 32K | |
| Maria Mena - All Thi..> | 2026-05-22 20:40 | 53K | |
| Maria McKee - Show m..> | 2026-05-22 20:40 | 50K | |
| Margriet Eshuys Band..> | 2026-05-22 20:40 | 44K | |
| Margriet Eshuijs Ban..> | 2026-05-22 19:41 | 90K | |
| Margie Ball - Goodby..> | 2026-05-22 20:40 | 86K | |
| Margareth Singana - ..> | 2026-05-22 20:40 | 288K | |
| Margaret Durante - U..> | 2026-05-22 20:40 | 18K | |
| Maren Morris - The B..> | 2026-05-22 20:24 | 70K | |
| Marco Borsato & Luci..> | 2026-05-22 20:08 | 13K | |
| Marcia Hines - Your ..> | 2026-05-22 19:41 | 21K | |
| Marcia Hines - Many ..> | 2026-05-22 19:41 | 21K | |
| Marcels - Blue Moon.jpg | 2026-05-22 19:58 | 40K | |
| Marc Winter Band - T..> | 2026-05-22 19:34 | 104K | |
| Marc KissThomTreeCry..> | 2026-05-22 20:08 | 48K | |
| Marc Kiss, ThomTree,..> | 2026-05-22 20:08 | 13M | |
| Marc Hamilton - Comm..> | 2026-05-22 19:41 | 90K | |
| Marc Cohn - Walking ..> | 2026-05-22 20:40 | 29K | |
| Marc Aryan - La Lett..> | 2026-05-22 19:34 | 38K | |
| Marc Anthony - You S..> | 2026-05-22 20:40 | 52K | |
| Marc Anthony - I Nee..> | 2026-05-22 19:58 | 15K | |
| Marc Almond - Tears ..> | 2026-05-22 19:41 | 23K | |
| Marc Almond & Gene P..> | 2026-05-22 20:40 | 27K | |
| Marbles - Only one w..> | 2026-05-22 20:40 | 51K | |
| Manuel & Music Of Th..> | 2026-05-22 19:41 | 44K | |
| Manu Chao - Me Gusta..> | 2026-05-22 20:08 | 104K | |
| Mantronix With Wondr..> | 2026-05-22 20:08 | 499K | |
| Mantronix - Got To H..> | 2026-05-22 19:41 | 47K | |
| Mantovani & His Orch..> | 2026-05-22 20:40 | 73K | |
| Mantovani & His Orch..> | 2026-05-22 20:40 | 49K | |
| Manic Street Preache..> | 2026-05-22 19:58 | 52K | |
| Manic Street Preache..> | 2026-05-22 19:58 | 48K | |
| Manhattans -Kiss And..> | 2026-05-22 19:34 | 79K | |
| Manhattans - Kiss An..> | 2026-05-22 19:41 | 71K | |
| Manhattan Transfer -..> | 2026-05-22 19:34 | 21K | |
| Manfred Mann - Prett..> | 2026-05-22 20:40 | 30K | |
| Manfred Mann - Might..> | 2026-05-22 20:40 | 64K | |
| Manfred Mann - Might..> | 2026-05-22 20:40 | 235K | |
| Manfred Mann - Ha ha..> | 2026-05-22 20:40 | 64K | |
| Manfred Mann - Fox o..> | 2026-05-22 20:40 | 58K | |
| Manfred Mann - Do Wa..> | 2026-05-22 20:08 | 51K | |
| Manfred Mann's Earth..> | 2026-05-22 20:40 | 44K | |
| Manfred Mann's Earth..> | 2026-05-22 20:40 | 45K | |
| Manau - La Tribu De ..> | 2026-05-22 19:58 | 22K | |
| Mamas & the Papas - ..> | 2026-05-22 20:40 | 42K | |
| Mama Cass - Dream A ..> | 2026-05-22 20:40 | 87K | |
| Mama's & The Papa's ..> | 2026-05-22 19:41 | 154K | |
| Mama's & The Papa's ..> | 2026-05-22 20:40 | 46K | |
| Mama's & The Papa's ..> | 2026-05-22 20:40 | 46K | |
| Mama's & The Papa's ..> | 2026-05-22 19:41 | 164K | |
| Mama's & The Papa's ..> | 2026-05-22 19:41 | 840K | |
| Malcolm Mclaren - Ma..> | 2026-05-22 19:41 | 21K | |
| Malcolm Mclaren & th..> | 2026-05-22 19:41 | 59K | |
| Malando - La Cumpars..> | 2026-05-22 20:40 | 125K | |
| Malando & His Tango ..> | 2026-05-22 19:34 | 134K | |
| Malando & His Orches..> | 2026-05-22 19:34 | 125K | |
| Malando & His Orches..> | 2026-05-22 19:34 | 134K | |
| Major Lazer X Dj Sna..> | 2026-05-22 20:08 | 210K | |
| Major Dundee Band Wi..> | 2026-05-22 20:24 | 45K | |
| Major Dundee Band - ..> | 2026-05-22 20:24 | 18K | |
| Majestic x Boney M. ..> | 2026-05-22 20:08 | 38K | |
| Maisonettes - Hearta..> | 2026-05-22 19:41 | 41K | |
| Mainframe - 5 Minute..> | 2026-05-22 19:41 | 29K | |
| Mailer Mackenzie Ban..> | 2026-05-22 19:34 | 161K | |
| Mai Tai - History.jpg | 2026-05-22 19:41 | 101K | |
| Mai Tai - Female Int..> | 2026-05-22 19:41 | 77K | |
| Mai Tai - Am I Losin..> | 2026-05-22 19:41 | 101K | |
| Mahna MacKay - Mah n..> | 2026-05-22 20:40 | 48K | |
| Mahalia Jackson - Do..> | 2026-05-22 19:41 | 168K | |
| Magna Carta - Airpor..> | 2026-05-22 19:34 | 43K | |
| Magic Affair - Omen ..> | 2026-05-22 19:58 | 9.6K | |
| Magic! - Rude.jpg | 2026-05-22 20:08 | 17K | |
| Maggie Reilly - Moon..> | 2026-05-22 19:41 | 21K | |
| Maggie Mcneal - When..> | 2026-05-22 19:34 | 196K | |
| Maggie Macneal - Whe..> | 2026-05-22 19:58 | 40K | |
| Madonna Vs Tone-Loc ..> | 2026-05-22 20:08 | 188K | |
| Madonna - Who's That..> | 2026-05-22 19:41 | 55K | |
| Madonna - Vogue.jpg | 2026-05-22 19:58 | 23K | |
| Madonna - True Blue.jpg | 2026-05-22 19:41 | 85K | |
| Madonna - This Used ..> | 2026-05-22 19:58 | 55K | |
| Madonna - The Power ..> | 2026-05-22 19:58 | 38K | |
| Madonna - Take A Bow..> | 2026-05-22 20:08 | 30K | |
| Madonna - Ray Of Lig..> | 2026-05-22 19:58 | 43K | |
| Madonna - Papa Don't..> | 2026-05-22 19:41 | 42K | |
| Madonna - Open Your ..> | 2026-05-22 19:41 | 42K | |
| Madonna - Nothing Re..> | 2026-05-22 20:08 | 43K | |
| Madonna - Music.jpg | 2026-05-22 20:08 | 53K | |
| Madonna - Miles Away..> | 2026-05-22 20:08 | 93K | |
| Madonna - Material G..> | 2026-05-22 19:41 | 42K | |
| Madonna - Lucky Star..> | 2026-05-22 20:08 | 36K | |
| Madonna - Live To Te..> | 2026-05-22 19:41 | 32K | |
| Madonna - Like A Vir..> | 2026-05-22 19:41 | 26K | |
| Madonna - Like A Pra..> | 2026-05-22 19:41 | 71K | |
| Madonna - La Isla Bo..> | 2026-05-22 19:41 | 85K | |
| Madonna - Justify My..> | 2026-05-22 19:58 | 25K | |
| Madonna - Jump.jpg | 2026-05-22 20:08 | 41K | |
| Madonna - Into The G..> | 2026-05-22 19:41 | 26K | |
| Madonna - Hung Up.jpg | 2026-05-22 20:08 | 41K | |
| Madonna - Holiday.jpg | 2026-05-22 19:41 | 41K | |
| Madonna - Frozen.jpg | 2026-05-22 19:58 | 394K | |
| Madonna - Express Yo..> | 2026-05-22 19:58 | 53K | |
| Madonna - Dress You ..> | 2026-05-22 19:41 | 26K | |
| Madonna - Don't Cry ..> | 2026-05-22 20:08 | 38K | |
| Madonna - Don't Cry ..> | 2026-05-22 19:58 | 18K | |
| Madonna - Die Anothe..> | 2026-05-22 20:08 | 78K | |
| Madonna - Dear Jessi..> | 2026-05-22 19:41 | 229K | |
| Madonna - Crazy For ..> | 2026-05-22 19:41 | 17K | |
| Madonna - Cherish.jpg | 2026-05-22 19:41 | 42K | |
| Madonna - Causing A ..> | 2026-05-22 19:41 | 31K | |
| Madonna - Borderline..> | 2026-05-22 19:41 | 36K | |
| Madonna - Beautiful ..> | 2026-05-22 19:58 | 75K | |
| Madonna - American P..> | 2026-05-22 20:08 | 53K | |
| Madness - Our House.jpg | 2026-05-22 19:41 | 36K | |
| Madness - One Step B..> | 2026-05-22 19:34 | 33K | |
| Madness - Night Boat..> | 2026-05-22 19:41 | 33K | |
| Madness - It Must Be..> | 2026-05-22 20:08 | 33K | |
| Madness - House Of F..> | 2026-05-22 19:41 | 64K | |
| Madness - Embarressm..> | 2026-05-22 19:41 | 37K | |
| Madness - Baggy Trou..> | 2026-05-22 19:41 | 26K | |
| Madison Avenue - Don..> | 2026-05-22 20:08 | 44K | |
| MadismJaden BojsenBi..> | 2026-05-22 20:08 | 39K | |
| Maddix; Leila K - Op..> | 2026-05-22 20:08 | 919K | |
| Madcon - Beggin.jpg | 2026-05-22 20:08 | 19K | |
| Madcon & Ray Dalton ..> | 2026-05-22 20:08 | 1.0M | |
| Mad'house - Holiday.jpg | 2026-05-22 20:08 | 60K | |
| Mad'House - Like a P..> | 2026-05-22 20:08 | 163K | |
| Mad’house - Like a..> | 2026-05-22 20:08 | 34K | |
| Mad’house - Like a..> | 2026-05-22 20:08 | 60K | |
| Macklemore & Ryan Le..> | 2026-05-22 20:08 | 86K | |
| Macklemore & Ryan Le..> | 2026-05-22 20:08 | 86K | |
| Macklemore & Ryan Le..> | 2026-05-22 20:08 | 86K | |
| Macklemore & Ryan Le..> | 2026-05-22 20:08 | 86K | |
| Mac and Katie Kissoo..> | 2026-05-22 19:34 | 195K | |
| Mac Kissoon - Surpri..> | 2026-05-22 19:34 | 272K | |
| Mac Kissoon - Lavend..> | 2026-05-22 20:40 | 52K | |
| Mac Kissoon & Family..> | 2026-05-22 19:34 | 333K | |
| Mac Davis - Texas In..> | 2026-05-22 20:24 | 134K | |
| Mac Davis - It’s H..> | 2026-05-22 20:24 | 52K | |
| Mac Davis - Hooked o..> | 2026-05-22 20:24 | 80K | |
| Mac Davis - Baby Don..> | 2026-05-22 20:24 | 158K | |
| Mac & Katie Kissoon ..> | 2026-05-22 19:34 | 144K | |
| Mac & Katie Kissoon ..> | 2026-05-22 19:33 | 195K | |
| Mac & Katie Kissoon ..> | 2026-05-22 19:33 | 195K | |
| Mac & Katie Kissoon ..> | 2026-05-22 19:33 | 312K | |
| Mac & Katie Kissoon ..> | 2026-05-22 19:33 | 195K | |
| Maarten Peters & The..> | 2026-05-22 19:41 | 42K | |
| Maître Gims -J'me T..> | 2026-05-22 20:40 | 89K | |
| MR - To France.jpg | 2026-05-22 19:59 | 102K | |
| MFSB - TSOP (The Sou..> | 2026-05-22 20:40 | 298K | |
| MFSB & The Three Deg..> | 2026-05-22 19:34 | 75K | |
| MATTNStavros Martina..> | 2026-05-22 20:08 | 32K | |
| MATTN, Stavros Marti..> | 2026-05-22 20:08 | 51K | |
| MATTN & Futuristic P..> | 2026-05-22 20:08 | 387K | |
| MATTN & Futuristic P..> | 2026-05-22 20:08 | 41K | |
| MASH- Suicide Is Pai..> | 2026-05-22 19:34 | 35K | |
| MALARKEY - Shackles ..> | 2026-05-22 20:08 | 191K | |
| M.F.S.B. & the Three..> | 2026-05-22 19:33 | 32K | |
| M.C. Hammer - Have Y..> | 2026-05-22 19:58 | 39K | |
| M.A.S.H. - Suicide I..> | 2026-05-22 20:40 | 35K | |
| M - Pop Muzik.jpg | 2026-05-22 19:33 | 20K | |
| M-People - Moving On..> | 2026-05-22 19:59 | 135K | |
| M-People - Itchycoo ..> | 2026-05-22 19:59 | 57K | |
| Münchener Freiheit ..> | 2026-05-22 19:42 | 75K | |
| Münchener Freiheit ..> | 2026-05-22 20:09 | 33K | |
| Måneskin - Beggin'.jpg | 2026-05-22 20:08 | 320K | |
| Lynyrd Skynyrd - Swe..> | 2026-05-22 20:24 | 532K | |
| Lynyrd Skynyrd - Swe..> | 2026-05-22 19:58 | 40K | |
| Lynyrd Skynyrd - Mad..> | 2026-05-22 20:24 | 47K | |
| Lynyrd Skynyrd - Fre..> | 2026-05-22 19:33 | 363K | |
| Lynsey De Paul - Sug..> | 2026-05-22 19:33 | 36K | |
| Lynn Anderson - You'..> | 2026-05-22 20:40 | 31K | |
| Lynn Anderson - You..> | 2026-05-22 20:24 | 79K | |
| Lynn Anderson - Top ..> | 2026-05-22 20:24 | 192K | |
| Lynn Anderson - Talk..> | 2026-05-22 20:24 | 128K | |
| Lynn Anderson - Stan..> | 2026-05-22 20:24 | 345K | |
| Lynn Anderson - Rose..> | 2026-05-22 20:24 | 31K | |
| Lynn Anderson - Rose..> | 2026-05-22 20:24 | 215K | |
| Lynn Anderson - It W..> | 2026-05-22 20:24 | 40K | |
| Lynn Anderson - How ..> | 2026-05-22 20:24 | 447K | |
| Lynn Anderson - Heav..> | 2026-05-22 20:24 | 48K | |
| Lynn Anderson - For ..> | 2026-05-22 20:24 | 293K | |
| Lynn Anderson - Cry.jpg | 2026-05-22 20:24 | 293K | |
| Lynn Anderson - Clos..> | 2026-05-22 20:24 | 37K | |
| Lynn Anderson - Blue..> | 2026-05-22 20:24 | 48K | |
| Lynn Anderson - (I N..> | 2026-05-22 20:24 | 49K | |
| Lyn Stanley - You Do..> | 2026-05-22 20:40 | 53K | |
| Lyn Stanley - The Th..> | 2026-05-22 20:40 | 53K | |
| Lyn Stanley - The Pa..> | 2026-05-22 20:40 | 53K | |
| Lyn Stanley - The Ma..> | 2026-05-22 20:40 | 53K | |
| Lyn Stanley - Teach ..> | 2026-05-22 20:40 | 53K | |
| Lyn Stanley - Misty.jpg | 2026-05-22 20:40 | 53K | |
| Lyn Stanley - Lullab..> | 2026-05-22 20:40 | 53K | |
| Lyn Stanley - Love P..> | 2026-05-22 20:40 | 53K | |
| Lyn Stanley - In The..> | 2026-05-22 20:40 | 53K | |
| Lyn Stanley - I'm Wa..> | 2026-05-22 20:40 | 53K | |
| Lyn Stanley - Hey Th..> | 2026-05-22 20:40 | 53K | |
| Lyn Stanley - Fly Me..> | 2026-05-22 20:40 | 53K | |
| Lyn Stanley - Cry Me..> | 2026-05-22 20:40 | 53K | |
| Lyn Stanley - After ..> | 2026-05-22 20:40 | 53K | |
| Lyn Stanley - A Summ..> | 2026-05-22 20:40 | 53K | |
| Lyn Collins - Think.jpg | 2026-05-22 19:58 | 360K | |
| Lyle Lovett - Simple..> | 2026-05-22 20:24 | 29K | |
| Lykke Li - I Follow ..> | 2026-05-22 20:40 | 33K | |
| Lydia & Her Melody S..> | 2026-05-22 19:33 | 114K | |
| Luv -U.O.Me.jpg | 2026-05-22 19:33 | 71K | |
| Luv' - You're The Gr..> | 2026-05-22 19:33 | 71K | |
| Luv' - Yes I Do.jpg | 2026-05-22 19:33 | 99K | |
| Luv' - Trojan Horse.jpg | 2026-05-22 19:33 | 71K | |
| Luv' - Megamix '93.jpg | 2026-05-22 19:58 | 45K | |
| Luv' - Eeny Meeny Mi..> | 2026-05-22 19:33 | 39K | |
| Luv' - Casanova.jpg | 2026-05-22 19:33 | 39K | |
| Lutricia Mcneal - Ai..> | 2026-05-22 19:58 | 30K | |
| Luther Vandross - Sh..> | 2026-05-22 20:08 | 42K | |
| Luther Vandross - Ne..> | 2026-05-22 20:08 | 42K | |
| Luniz - I Got 5 On I..> | 2026-05-22 19:58 | 57K | |
| Lunchmoney Lewis -Bi..> | 2026-05-22 20:08 | 23K | |
| Lumineers - Ho hey.jpg | 2026-05-22 20:08 | 8.6K | |
| Lulu And The Luvvers..> | 2026-05-22 20:40 | 219K | |
| Lulu - To Sir With L..> | 2026-05-22 20:40 | 61K | |
| Lulu - Boy meets gir..> | 2026-05-22 19:33 | 367K | |
| Lulu - Boom bang-a-b..> | 2026-05-22 20:40 | 44K | |
| Luke Combs - Hurrica..> | 2026-05-22 20:24 | 109K | |
| Luke Combs - Fast Ca..> | 2026-05-22 20:08 | 460K | |
| Lukas Graham - 7 Yea..> | 2026-05-22 20:08 | 44K | |
| Luisa Fernandez - La..> | 2026-05-22 19:33 | 20K | |
| Luisa Fernandez - Gi..> | 2026-05-22 19:33 | 10K | |
| Luis Fonsi - Despaci..> | 2026-05-22 20:08 | 30K | |
| Luis Fonsi & Demi Lo..> | 2026-05-22 20:08 | 71K | |
| Lucille Starr - Joli..> | 2026-05-22 20:40 | 50K | |
| Lucille Starr - Fren..> | 2026-05-22 20:40 | 64K | |
| Lucille Starr - Don'..> | 2026-05-22 20:40 | 2.7M | |
| Lucille Starr - Craz..> | 2026-05-22 20:40 | 19K | |
| Lucille Starr - Coli..> | 2026-05-22 20:40 | 20K | |
| Lucilectric - Mädch..> | 2026-05-22 19:58 | 28K | |
| Lucifer - House For ..> | 2026-05-22 20:40 | 78K | |
| Lucie Silvas -What Y..> | 2026-05-22 20:08 | 87K | |
| Lucie Silvas - Nothi..> | 2026-05-22 20:40 | 25K | |
| Lucie Silvas - Breat..> | 2026-05-22 20:08 | 87K | |
| Luciano Pavarotti - ..> | 2026-05-22 20:40 | 93K | |
| Luciano Pavarotti - ..> | 2026-05-22 20:40 | 17K | |
| Lucas & Steve ft. Ha..> | 2026-05-22 20:08 | 89K | |
| Lucas & Steve ft. Ha..> | 2026-05-22 20:08 | 298K | |
| Lucas & Steve - Lett..> | 2026-05-22 20:08 | 98K | |
| Lt. Pigeon - Mouldy ..> | 2026-05-22 20:40 | 183K | |
| Lp - Lost On You.jpg | 2026-05-22 20:08 | 43K | |
| Lowell George - Chee..> | 2026-05-22 19:33 | 374K | |
| Lovin' Spoonful - Su..> | 2026-05-22 20:40 | 67K | |
| Lovin' Spoonful - Si..> | 2026-05-22 20:40 | 132K | |
| Lovin' Spoonful - Ra..> | 2026-05-22 20:40 | 336K | |
| Lovin' Spoonful - Da..> | 2026-05-22 20:40 | 67K | |
| Lovin' Spoonful - Da..> | 2026-05-22 20:40 | 67K | |
| Love Unlimited Orche..> | 2026-05-22 20:40 | 36K | |
| Love Unlimited - Wal..> | 2026-05-22 19:33 | 49K | |
| Love Unlimited - It ..> | 2026-05-22 20:08 | 36K | |
| Love Unlimited - I'm..> | 2026-05-22 19:41 | 70K | |
| Love Sculpture - Sab..> | 2026-05-22 20:40 | 38K | |
| Love Affair - Everla..> | 2026-05-22 20:40 | 37K | |
| Louise Tucker - Midn..> | 2026-05-22 19:41 | 69K | |
| Louis Prima - Pennie..> | 2026-05-22 20:40 | 71K | |
| Louis Prima - Oh Mar..> | 2026-05-22 20:40 | 66K | |
| Louis Prima - Jump J..> | 2026-05-22 20:40 | 160K | |
| Louis Prima - Jump J..> | 2026-05-22 20:40 | 49K | |
| Louis Prima - Buona ..> | 2026-05-22 20:40 | 30K | |
| Louis Prima & Keely ..> | 2026-05-22 20:40 | 259K | |
| Louis Armstrong - Wh..> | 2026-05-22 20:40 | 42K | |
| Louis Armstrong - Ma..> | 2026-05-22 20:40 | 38K | |
| Louis Armstrong - La..> | 2026-05-22 20:40 | 170K | |
| Louis Armstrong - It..> | 2026-05-22 20:40 | 71K | |
| Louis Armstrong - I ..> | 2026-05-22 20:40 | 41K | |
| Louis Armstrong - He..> | 2026-05-22 20:39 | 273K | |
| Louis Armstrong - Do..> | 2026-05-22 20:39 | 43K | |
| Louis Armstrong & Hi..> | 2026-05-22 20:40 | 61K | |
| Louis Armstrong & Ga..> | 2026-05-22 20:40 | 148K | |
| Louis Armstrong & El..> | 2026-05-22 20:40 | 49K | |
| Louis Armstrong & Da..> | 2026-05-22 19:58 | 29K | |
| Lou Reed - Walk On T..> | 2026-05-22 20:39 | 45K | |
| Lou Reed - Perfect D..> | 2026-05-22 20:39 | 33K | |
| Lou Reed - Intro (Sw..> | 2026-05-22 19:33 | 45K | |
| Lou Rawls - You'll n..> | 2026-05-22 19:41 | 53K | |
| Lou Rawls - You'll N..> | 2026-05-22 19:33 | 189K | |
| Lou Rawls - You'll N..> | 2026-05-22 19:58 | 37K | |
| Lou Rawls - See you ..> | 2026-05-22 19:33 | 54K | |
| Lou Rawls - Lady Lov..> | 2026-05-22 19:33 | 70K | |
| Lou Rawls & Diana Re..> | 2026-05-22 19:41 | 20K | |
| Lou Gramm - Midnight..> | 2026-05-22 20:39 | 67K | |
| Lou Bega - Mambo Nr...> | 2026-05-22 19:58 | 88K | |
| Lou Bega - I Got A G..> | 2026-05-22 19:58 | 45K | |
| Lou & The Hollywood ..> | 2026-05-22 19:33 | 41K | |
| Lost Frequencies fea..> | 2026-05-22 20:08 | 51K | |
| Lost Frequencies - T..> | 2026-05-22 20:08 | 202K | |
| Lost Frequencies - R..> | 2026-05-22 20:08 | 171K | |
| Lost Frequencies - A..> | 2026-05-22 20:08 | 42K | |
| Lost Frequencies - A..> | 2026-05-22 20:08 | 34K | |
| Lost Frequencies, To..> | 2026-05-22 20:08 | 244K | |
| Lost Frequencies, Ja..> | 2026-05-22 20:08 | 117K | |
| Lost Frequencies & Z..> | 2026-05-22 20:08 | 251K | |
| Lost Frequencies & C..> | 2026-05-22 20:08 | 159K | |
| Los Umbrellos - No T..> | 2026-05-22 20:08 | 56K | |
| Los Umbrellos - No T..> | 2026-05-22 19:58 | 56K | |
| Los Reyes - Bamboleo..> | 2026-05-22 19:41 | 406K | |
| Los Piratos - Na Na ..> | 2026-05-22 20:39 | 122K | |
| Los Paraguayos - Mal..> | 2026-05-22 20:39 | 58K | |
| Los Mayas - Concerto..> | 2026-05-22 19:33 | 151K | |
| Los Manolos - All My..> | 2026-05-22 19:58 | 320K | |
| Los Lobos - La Bamba..> | 2026-05-22 19:41 | 18K | |
| Los Indois Tabajaras..> | 2026-05-22 20:39 | 46K | |
| Los Incas - El Condo..> | 2026-05-22 19:33 | 20K | |
| Los Del Rio - Macare..> | 2026-05-22 19:58 | 28K | |
| Los Bravos - I Don't..> | 2026-05-22 20:39 | 224K | |
| Los Bravos - Black I..> | 2026-05-22 20:39 | 189K | |
| Lorne Greene - Ringo..> | 2026-05-22 20:24 | 63K | |
| Lorne Greene - Bonan..> | 2026-05-22 20:24 | 95K | |
| Lori Spee - How Many..> | 2026-05-22 20:39 | 36K | |
| Loretta Lynn - Wine,..> | 2026-05-22 20:24 | 54K | |
| Loretta Lynn - When ..> | 2026-05-22 20:24 | 61K | |
| Loretta Lynn - Rated..> | 2026-05-22 20:24 | 18K | |
| Loretta Lynn - Love ..> | 2026-05-22 20:24 | 60K | |
| Loretta Lynn - I'm a..> | 2026-05-22 20:24 | 68K | |
| Loretta Lynn - Coal ..> | 2026-05-22 20:24 | 160K | |
| Loretta Lynn - Coal..> | 2026-05-22 20:39 | 42K | |
| Loretta Lynn, Dolly ..> | 2026-05-22 20:24 | 511K | |
| Loretta Lynn, Dolly ..> | 2026-05-22 20:24 | 511K | |
| Loretta Lynn, Dolly ..> | 2026-05-22 20:24 | 511K | |
| Loretta Lynn, Dolly ..> | 2026-05-22 20:24 | 511K | |
| Loretta Lynn, Dolly ..> | 2026-05-22 20:24 | 511K | |
| Loretta Lynn, Dolly ..> | 2026-05-22 20:24 | 511K | |
| Loretta Lynn, Dolly ..> | 2026-05-22 20:24 | 511K | |
| Loretta Lynn, Dolly ..> | 2026-05-22 20:24 | 511K | |
| Loretta Lynn, Dolly ..> | 2026-05-22 20:24 | 511K | |
| Loretta Lynn, Dolly ..> | 2026-05-22 20:24 | 511K | |
| Loretta Lynn, Dolly ..> | 2026-05-22 20:24 | 511K | |
| Loretta Lynn, Dolly ..> | 2026-05-22 20:24 | 511K | |
| Loreen - Euphoria.jpg | 2026-05-22 20:08 | 36K | |
| Lorde - Royals.jpg | 2026-05-22 20:08 | 23K | |
| Lorca - Ritmo De La ..> | 2026-05-22 19:58 | 29K | |
| Loose Ends - Hangin'..> | 2026-05-22 20:08 | 125K | |
| Loona - Hijo De La L..> | 2026-05-22 19:58 | 31K | |
| Loona - Bailando.jpg | 2026-05-22 19:58 | 31K | |
| Long Tall Ernie & th..> | 2026-05-22 19:33 | 151K | |
| Long Tall Ernie & Th..> | 2026-05-22 19:33 | 35K | |
| Lonestar - You Walke..> | 2026-05-22 20:24 | 44K | |
| Lonestar - Smile.jpg | 2026-05-22 20:24 | 30K | |
| Lonestar - Say When.jpg | 2026-05-22 20:24 | 44K | |
| Lonestar - No News.jpg | 2026-05-22 20:24 | 54K | |
| Lonestar - Everythin..> | 2026-05-22 20:24 | 50K | |
| Lonestar - Come Cryi..> | 2026-05-22 20:24 | 41K | |
| Lonestar - Amazed.jpg | 2026-05-22 20:24 | 34K | |
| Lone Tusker - Smooth..> | 2026-05-22 20:08 | 169K | |
| Londonbeat - No Woma..> | 2026-05-22 19:58 | 169K | |
| London Beat - You Br..> | 2026-05-22 19:58 | 41K | |
| London Beat - I've B..> | 2026-05-22 19:58 | 19K | |
| London Beat - Failin..> | 2026-05-22 19:41 | 60K | |
| London Beat - 9am (T..> | 2026-05-22 19:41 | 160K | |
| Lolita Jolie - Joli ..> | 2026-05-22 20:08 | 73K | |
| Lolita Jolie - Joli ..> | 2026-05-22 20:08 | 155K | |
| Loggins & Messina - ..> | 2026-05-22 20:24 | 48K | |
| Loco Loco - Mosquito..> | 2026-05-22 20:08 | 226K | |
| Lobo - The Caribbean..> | 2026-05-22 19:41 | 406K | |
| Lobo - Me And You An..> | 2026-05-22 19:33 | 20K | |
| Loïs Lane - River D..> | 2026-05-22 19:33 | 24K | |
| Loïs Lane - My Best..> | 2026-05-22 19:58 | 38K | |
| Loïs Lane - It's Th..> | 2026-05-22 19:41 | 72K | |
| Loïs Lane - Fortune..> | 2026-05-22 19:58 | 38K | |
| Lmfao -Sexy And I Kn..> | 2026-05-22 20:08 | 76K | |
| Lloyd Price - Person..> | 2026-05-22 20:39 | 177K | |
| Lloyd Price - I'm Go..> | 2026-05-22 19:58 | 48K | |
| Lloyd Cole & The Com..> | 2026-05-22 19:41 | 119K | |
| Ll Cool J - I Need L..> | 2026-05-22 20:39 | 32K | |
| Ll Cool J - I Need L..> | 2026-05-22 19:41 | 84K | |
| Lizot - Weekend.jpg | 2026-05-22 20:08 | 10K | |
| Lizot - Weekend (fea..> | 2026-05-22 20:08 | 292K | |
| Lizot - Weekend (fea..> | 2026-05-22 20:08 | 292K | |
| Lizot - This Is The ..> | 2026-05-22 20:08 | 378K | |
| Lizot & Kyanu - This..> | 2026-05-22 20:08 | 93K | |
| Living In A Box - Li..> | 2026-05-22 19:41 | 64K | |
| Living In A Box - Bl..> | 2026-05-22 20:08 | 36K | |
| Living Colour - Love..> | 2026-05-22 19:58 | 59K | |
| Liverpool Express - ..> | 2026-05-22 19:58 | 61K | |
| Live - Run To The Wa..> | 2026-05-22 20:08 | 70K | |
| Live -Run Away.jpg | 2026-05-22 20:08 | 36K | |
| Live - Overcome.jpg | 2026-05-22 20:39 | 39K | |
| Live - Lightning Cra..> | 2026-05-22 20:08 | 39K | |
| Live - I Alone.jpg | 2026-05-22 20:08 | 55K | |
| Little Texas - You a..> | 2026-05-22 20:24 | 44K | |
| Little Texas - What ..> | 2026-05-22 20:24 | 52K | |
| Little Texas - My Lo..> | 2026-05-22 20:24 | 46K | |
| Little Texas - Kick ..> | 2026-05-22 20:24 | 52K | |
| Little Texas - God B..> | 2026-05-22 20:24 | 46K | |
| Little Texas - First..> | 2026-05-22 20:24 | 44K | |
| Little Texas - Amy's..> | 2026-05-22 20:24 | 52K | |
| Little Steven & The ..> | 2026-05-22 19:58 | 498K | |
| Little Steven & Rube..> | 2026-05-22 19:58 | 35K | |
| Little River Band - ..> | 2026-05-22 20:08 | 63K | |
| Little River Band - ..> | 2026-05-22 19:33 | 56K | |
| Little River Band - ..> | 2026-05-22 19:41 | 453K | |
| Little RichardTanya ..> | 2026-05-22 20:24 | 186K | |
| Little Richard - Tut..> | 2026-05-22 20:39 | 46K | |
| Little Richard - The..> | 2026-05-22 19:33 | 131K | |
| Little Richard - Luc..> | 2026-05-22 20:39 | 46K | |
| Little Richard - Lon..> | 2026-05-22 19:41 | 251K | |
| Little Jimmy Osmond ..> | 2026-05-22 19:33 | 92K | |
| Little Jimmy Osmond ..> | 2026-05-22 20:08 | 78K | |
| Little Jimmy Osmond ..> | 2026-05-22 19:33 | 312K | |
| Little Eva - The Loc..> | 2026-05-22 20:39 | 132K | |
| Little Eva - Loco-Mo..> | 2026-05-22 19:58 | 62K | |
| Little Big Town - Po..> | 2026-05-22 20:24 | 70K | |
| Little Big Town - Gi..> | 2026-05-22 20:24 | 30K | |
| Little Angels - Firs..> | 2026-05-22 20:39 | 41K | |
| Lisa Stansfield - Th..> | 2026-05-22 19:58 | 150K | |
| Lisa Stansfield - Li..> | 2026-05-22 19:58 | 48K | |
| Lisa Stansfield - Ch..> | 2026-05-22 19:41 | 139K | |
| Lisa Stansfield - Al..> | 2026-05-22 19:41 | 20K | |
| Lisa Marie - Hallelu..> | 2026-05-22 20:08 | 152K | |
| Lisa Lois - Halleluj..> | 2026-05-22 20:08 | 49K | |
| Lisa Lisa And Cult J..> | 2026-05-22 19:41 | 39K | |
| Lisa Brokop - Wildfl..> | 2026-05-22 20:24 | 78K | |
| Lisa - Hallelujah.jpg | 2026-05-22 20:08 | 269K | |
| Liquido - Narcotic.jpg | 2026-05-22 19:58 | 53K | |
| Liquid Gold - Dance ..> | 2026-05-22 20:08 | 308K | |
| Liquid & Silvy - Tur..> | 2026-05-22 20:08 | 38K | |
| Lipstick - I'm A Rav..> | 2026-05-22 19:58 | 13K | |
| Lipps Inc. - How Lon..> | 2026-05-22 19:41 | 63K | |
| Lipps Inc. - Funkyto..> | 2026-05-22 19:33 | 59K | |
| Lipps Inc. - Funky T..> | 2026-05-22 19:41 | 40K | |
| Lionel Richie With S..> | 2026-05-22 20:24 | 43K | |
| Lionel Richie - You ..> | 2026-05-22 19:41 | 13K | |
| Lionel Richie - Stuc..> | 2026-05-22 19:41 | 50K | |
| Lionel Richie - Sela..> | 2026-05-22 19:58 | 36K | |
| Lionel Richie - Se L..> | 2026-05-22 19:33 | 124K | |
| Lionel Richie - Say ..> | 2026-05-22 19:41 | 154K | |
| Lionel Richie - Runn..> | 2026-05-22 19:41 | 64K | |
| Lionel Richie - Penn..> | 2026-05-22 19:41 | 50K | |
| Lionel Richie - My D..> | 2026-05-22 19:58 | 75K | |
| Lionel Richie - Love..> | 2026-05-22 19:41 | 36K | |
| Lionel Richie - Hell..> | 2026-05-22 20:39 | 39K | |
| Lionel Richie - Do I..> | 2026-05-22 19:58 | 55K | |
| Lionel Richie - Danc..> | 2026-05-22 19:41 | 64K | |
| Lionel Richie - Ball..> | 2026-05-22 19:41 | 36K | |
| Lionel Richie - All ..> | 2026-05-22 19:41 | 64K | |
| Lionel Richie & Trij..> | 2026-05-22 20:08 | 28K | |
| Lionel Richie & Dian..> | 2026-05-22 19:41 | 1.2M | |
| Lionel Cartwright - ..> | 2026-05-22 20:24 | 47K | |
| Lionel Cartwright - ..> | 2026-05-22 20:24 | 64K | |
| Lionel Cartwright - ..> | 2026-05-22 20:24 | 47K | |
| Lionel Cartwright - ..> | 2026-05-22 20:24 | 36K | |
| Lio - Amoureux Solit..> | 2026-05-22 19:41 | 29K | |
| Linsey De Paul - Won..> | 2026-05-22 19:33 | 20K | |
| Linkin' Park - In Th..> | 2026-05-22 20:08 | 57K | |
| Lindisfarne - Run Fo..> | 2026-05-22 19:58 | 73K | |
| Lindisfarne - Lady E..> | 2026-05-22 19:33 | 656K | |
| Linda Ronstadt Featu..> | 2026-05-22 20:24 | 346K | |
| Linda Ronstadt Featu..> | 2026-05-22 20:24 | 346K | |
| Linda Ronstadt Featu..> | 2026-05-22 20:24 | 164K | |
| Linda Ronstadt Featu..> | 2026-05-22 20:24 | 57K | |
| Linda Ronstadt Feat...> | 2026-05-22 20:24 | 196K | |
| Linda Ronstadt Feat...> | 2026-05-22 20:24 | 164K | |
| Linda Ronstadt Feat...> | 2026-05-22 20:24 | 47K | |
| Linda Ronstadt - You..> | 2026-05-22 20:39 | 20K | |
| Linda Ronstadt - You..> | 2026-05-22 20:24 | 88K | |
| Linda Ronstadt - Whe..> | 2026-05-22 20:24 | 20K | |
| Linda Ronstadt - Whe..> | 2026-05-22 20:39 | 47K | |
| Linda Ronstadt - Tro..> | 2026-05-22 20:24 | 164K | |
| Linda Ronstadt - Tra..> | 2026-05-22 20:24 | 159K | |
| Linda Ronstadt - Tha..> | 2026-05-22 20:24 | 327K | |
| Linda Ronstadt - Tel..> | 2026-05-22 20:24 | 161K | |
| Linda Ronstadt - Sti..> | 2026-05-22 20:24 | 164K | |
| Linda Ronstadt - Som..> | 2026-05-22 19:41 | 66K | |
| Linda Ronstadt - So ..> | 2026-05-22 20:39 | 47K | |
| Linda Ronstadt - Sha..> | 2026-05-22 20:39 | 16K | |
| Linda Ronstadt - Lov..> | 2026-05-22 20:24 | 159K | |
| Linda Ronstadt - Lov..> | 2026-05-22 20:24 | 17K | |
| Linda Ronstadt - It(..> | 2026-05-22 20:24 | 332K | |
| Linda Ronstadt - It'..> | 2026-05-22 20:39 | 62K | |
| Linda Ronstadt - It..> | 2026-05-22 20:24 | 59K | |
| Linda Ronstadt - I W..> | 2026-05-22 20:24 | 22K | |
| Linda Ronstadt - I N..> | 2026-05-22 20:39 | 47K | |
| Linda Ronstadt - I K..> | 2026-05-22 20:24 | 164K | |
| Linda Ronstadt - Goo..> | 2026-05-22 20:24 | 164K | |
| Linda Ronstadt - Don..> | 2026-05-22 20:39 | 47K | |
| Linda Ronstadt - Des..> | 2026-05-22 20:24 | 41K | |
| Linda Ronstadt - Cry..> | 2026-05-22 20:24 | 164K | |
| Linda Ronstadt - Cra..> | 2026-05-22 20:24 | 24K | |
| Linda Ronstadt - Blu..> | 2026-05-22 20:24 | 332K | |
| Linda Ronstadt - All..> | 2026-05-22 20:39 | 47K | |
| Linda Ronstadt - All..> | 2026-05-22 20:39 | 35K | |
| Linda Ronstadt - Adi..> | 2026-05-22 20:24 | 164K | |
| Linda Ronstadt, Doll..> | 2026-05-22 20:24 | 199K | |
| Linda Ronstadt, Aaro..> | 2026-05-22 19:41 | 164K | |
| Linda Rondstadt - Lo..> | 2026-05-22 20:39 | 23K | |
| Linda Martin - Why M..> | 2026-05-22 19:58 | 208K | |
| Linda De Suza - Une ..> | 2026-05-22 19:41 | 60K | |
| Linda De Suza - Un P..> | 2026-05-22 19:33 | 79K | |
| Linda - No Goodbyes.jpg | 2026-05-22 20:08 | 36K | |
| Limp Bizkit - Behind..> | 2026-05-22 20:08 | 14K | |
| Lime - Your Love.jpg | 2026-05-22 19:41 | 47K | |
| Lime - Babe We're Go..> | 2026-05-22 19:41 | 59K | |
| Limahl - Neverending..> | 2026-05-22 19:41 | 20K | |
| Lily Allen - Smile.jpg | 2026-05-22 20:08 | 77K | |
| Lily Allen - Not Fai..> | 2026-05-22 20:08 | 20K | |
| Lily Allen - Fuck Yo..> | 2026-05-22 20:08 | 7.2K | |
| Lily Allen - 22.jpg | 2026-05-22 20:08 | 26K | |
| Lilly Wood, The Pric..> | 2026-05-22 20:08 | 52K | |
| Lilly Wood & The Pri..> | 2026-05-22 20:08 | 1.5M | |
| Lilly Wood & The Pri..> | 2026-05-22 20:08 | 60K | |
| Lila Mccann - I Wann..> | 2026-05-22 20:24 | 33K | |
| Lila Mccann - Down C..> | 2026-05-22 20:24 | 33K | |
| Lil Louis - French K..> | 2026-05-22 19:41 | 47K | |
| Lil Kim ft. Phil Col..> | 2026-05-22 20:08 | 52K | |
| Lighthouse Family - ..> | 2026-05-22 20:39 | 47K | |
| Liesbeth List - Brus..> | 2026-05-22 20:39 | 4.0K | |
| Liberation Of Man - ..> | 2026-05-22 19:33 | 54K | |
| Liam Payne & Rita Or..> | 2026-05-22 20:08 | 86K | |
| Lewis Capaldi - Some..> | 2026-05-22 20:08 | 21K | |
| Lewis Capaldi - Flap..> | 2026-05-22 20:08 | 6.7K | |
| Lewis Capaldi - Flap..> | 2026-05-22 20:08 | 6.7K | |
| Lewis Capaldi - Befo..> | 2026-05-22 20:08 | 43K | |
| Level 42 - To Be Wit..> | 2026-05-22 19:58 | 112K | |
| Level 42 - Running I..> | 2026-05-22 19:41 | 40K | |
| Level 42 - Love Game..> | 2026-05-22 19:58 | 90K | |
| Level 42 - Love Game..> | 2026-05-22 19:41 | 33K | |
| Level 42 - Lessons I..> | 2026-05-22 19:41 | 33K | |
| Level 42 - Leaving M..> | 2026-05-22 20:08 | 38K | |
| Level 42 - Its Over.jpg | 2026-05-22 20:08 | 28K | |
| Level 42 - It's Over..> | 2026-05-22 19:41 | 18K | |
| Level 42 - Hot Water..> | 2026-05-22 19:41 | 47K | |
| Level 42 - Heaven In..> | 2026-05-22 20:08 | 40K | |
| Level 42 - Children ..> | 2026-05-22 19:58 | 33K | |
| Level 42 - Children ..> | 2026-05-22 19:41 | 33K | |
| Lester Flatt & Earl ..> | 2026-05-22 20:24 | 66K | |
| Lesley Gore - It's M..> | 2026-05-22 20:39 | 15K | |
| Lesley Gore - Here Y..> | 2026-05-22 20:24 | 129K | |
| Lesiem - Roma.jpg | 2026-05-22 20:39 | 68K | |
| Lesiem - Poeta.jpg | 2026-05-22 20:39 | 68K | |
| Lesiem - Pater Patri..> | 2026-05-22 20:39 | 68K | |
| Lesiem - Paradisus.jpg | 2026-05-22 20:39 | 68K | |
| Lesiem - Navigator.jpg | 2026-05-22 20:39 | 68K | |
| Lesiem - La Rose.jpg | 2026-05-22 20:39 | 68K | |
| Lesiem - Diva.jpg | 2026-05-22 20:39 | 68K | |
| Lesiem - Coloris.jpg | 2026-05-22 20:39 | 68K | |
| Lesiem - Britannia.jpg | 2026-05-22 20:39 | 68K | |
| Lesiem - Aureus.jpg | 2026-05-22 20:39 | 68K | |
| Lesiem - Agnus Dei.jpg | 2026-05-22 20:39 | 68K | |
| Lesiem - Africa.jpg | 2026-05-22 20:39 | 68K | |
| Les Reeds Orchestra ..> | 2026-05-22 20:39 | 265K | |
| Les Reed Sound - The..> | 2026-05-22 20:39 | 120K | |
| Les Reed Sound - Str..> | 2026-05-22 20:39 | 41K | |
| Les Reed Sound - Sou..> | 2026-05-22 20:39 | 41K | |
| Les Reed Sound - Nic..> | 2026-05-22 20:39 | 41K | |
| Les Reed Sound - Cal..> | 2026-05-22 20:39 | 41K | |
| Les Reed Sound - Aut..> | 2026-05-22 20:39 | 41K | |
| Les Reed Orchestra -..> | 2026-05-22 20:39 | 40K | |
| Les Reed Orchestra -..> | 2026-05-22 20:39 | 29K | |
| Les Reed Orchestra -..> | 2026-05-22 20:39 | 56K | |
| Les Reed Orchestra -..> | 2026-05-22 20:39 | 33K | |
| Les Poppys - Non Non..> | 2026-05-22 20:39 | 45K | |
| Les Poppys - Isabell..> | 2026-05-22 19:33 | 183K | |
| Les Paul & Mary Ford..> | 2026-05-22 20:39 | 70K | |
| Les Paul & Mary Ford..> | 2026-05-22 19:58 | 64K | |
| Les Paul & Mary Ford..> | 2026-05-22 19:41 | 77K | |
| Les Paul & Mary Ford..> | 2026-05-22 19:58 | 46K | |
| Les Paul & Mary Ford..> | 2026-05-22 19:58 | 34K | |
| Les Humphties Singer..> | 2026-05-22 19:33 | 371K | |
| Les Humphries Singer..> | 2026-05-22 19:33 | 432K | |
| Les Humphries Singer..> | 2026-05-22 20:39 | 41K | |
| Les Humphries Singer..> | 2026-05-22 19:41 | 29K | |
| Les Dimitris - Casat..> | 2026-05-22 20:39 | 70K | |
| Les Compagnons De La..> | 2026-05-22 20:08 | 53K | |
| Les Compagnons De La..> | 2026-05-22 19:41 | 270K | |
| Les Baxter & His Orc..> | 2026-05-22 20:39 | 29K | |
| Leroy Anderson - The..> | 2026-05-22 20:39 | 177K | |
| Leonard Cohen - Suza..> | 2026-05-22 20:39 | 48K | |
| Leonard Cohen - So L..> | 2026-05-22 20:39 | 30K | |
| Leonard Bernstein, L..> | 2026-05-22 19:58 | 196K | |
| Leona Lewis - Bleedi..> | 2026-05-22 20:08 | 38K | |
| Leona Lewis - Bleedi..> | 2026-05-22 20:08 | 78K | |
| Leona Lewis - Better..> | 2026-05-22 20:08 | 84K | |
| Leon Payne - I Love ..> | 2026-05-22 20:24 | 36K | |
| Leon Everette - Hurr..> | 2026-05-22 20:24 | 33K | |
| Leon De Graaff - Pit..> | 2026-05-22 19:33 | 128K | |
| Leon Copeland - The ..> | 2026-05-22 20:24 | 42K | |
| Leon Copeland - Okie..> | 2026-05-22 20:24 | 373K | |
| Leon Copeland - My W..> | 2026-05-22 20:24 | 42K | |
| Leon Copeland - It's..> | 2026-05-22 20:24 | 42K | |
| Leo Sayer - You Make..> | 2026-05-22 19:33 | 32K | |
| Leo Sayer - When I N..> | 2026-05-22 20:39 | 30K | |
| Leo Sayer - Unchaine..> | 2026-05-22 19:41 | 47K | |
| Leo Sayer - Thunder ..> | 2026-05-22 20:39 | 39K | |
| Leo Sayer - Orchard ..> | 2026-05-22 20:39 | 45K | |
| Leo Sayer - More Tha..> | 2026-05-22 19:41 | 44K | |
| Leo Sayer - Long Tal..> | 2026-05-22 19:33 | 206K | |
| Leo Sayer - Long Tal..> | 2026-05-22 20:39 | 43K | |
| Lenny Pearce - Macar..> | 2026-05-22 20:08 | 270K | |
| Lenny Kuhr - Les Enf..> | 2026-05-22 19:33 | 28K | |
| Lenny Kravitz - Let ..> | 2026-05-22 19:41 | 46K | |
| Lenny Kravitz - It A..> | 2026-05-22 19:58 | 78K | |
| Lenny Kravitz - I Be..> | 2026-05-22 20:08 | 28K | |
| Lenny Kravitz - I'll..> | 2026-05-22 20:08 | 52K | |
| Lenny Kravitz - Beli..> | 2026-05-22 20:08 | 49K | |
| Lenny Kravitz - Are ..> | 2026-05-22 19:58 | 39K | |
| Lenny Kravitz - Amer..> | 2026-05-22 19:58 | 24K | |
| Lenny Kravitz - Alwa..> | 2026-05-22 19:58 | 2.3M | |
| Lene Marlin - Sittin..> | 2026-05-22 20:08 | 35K | |
| Lene Lovich - Lucky ..> | 2026-05-22 19:33 | 47K | |
| Lena Horne - It's A ..> | 2026-05-22 20:39 | 29K | |
| Len Barry - 1-2-3 (S..> | 2026-05-22 20:39 | 63K | |
| Lemon Pipers - Green..> | 2026-05-22 20:39 | 63K | |
| Lemming - Father Joh..> | 2026-05-22 19:33 | 250K | |
| Leila K - Open Sesam..> | 2026-05-22 19:58 | 58K | |
| Leila K - Ca Plane P..> | 2026-05-22 19:58 | 37K | |
| Leif Garrett - I Was..> | 2026-05-22 19:33 | 40K | |
| Left Side - Confusio..> | 2026-05-22 20:39 | 209K | |
| Lee Towers - You'll ..> | 2026-05-22 19:33 | 60K | |
| Lee Towers - Love Po..> | 2026-05-22 19:41 | 59K | |
| Lee Towers - I Can S..> | 2026-05-22 19:58 | 39K | |
| Lee Towers - Frankie..> | 2026-05-22 19:33 | 249K | |
| Lee Roy Parnell - Wh..> | 2026-05-22 20:39 | 29K | |
| Lee Roy Parnell - Wh..> | 2026-05-22 20:24 | 33K | |
| Lee Roy Parnell - Te..> | 2026-05-22 20:24 | 50K | |
| Lee Roy Parnell - On..> | 2026-05-22 20:24 | 45K | |
| Lee Roy Parnell - I'..> | 2026-05-22 20:24 | 45K | |
| Lee Marvin - Wand'ri..> | 2026-05-22 20:24 | 43K | |
| Lee Lynch - Stay Awh..> | 2026-05-22 20:39 | 211K | |
| Lee Greenwood - Touc..> | 2026-05-22 20:24 | 52K | |
| Lee Greenwood - The ..> | 2026-05-22 20:23 | 83K | |
| Lee Greenwood - Some..> | 2026-05-22 20:23 | 27K | |
| Lee Greenwood - Some..> | 2026-05-22 20:23 | 29K | |
| Lee Greenwood - Ring..> | 2026-05-22 20:23 | 120K | |
| Lee Greenwood - Morn..> | 2026-05-22 20:23 | 67K | |
| Lee Greenwood - I Do..> | 2026-05-22 20:23 | 108K | |
| Lee Greenwood - I.O...> | 2026-05-22 20:23 | 59K | |
| Lee Greenwood - Hold..> | 2026-05-22 20:23 | 59K | |
| Lee Greenwood - Hear..> | 2026-05-22 20:23 | 29K | |
| Lee Greenwood - Goin..> | 2026-05-22 20:23 | 29K | |
| Lee Greenwood - God ..> | 2026-05-22 20:23 | 120K | |
| Lee Greenwood - Fool..> | 2026-05-22 20:23 | 29K | |
| Lee Greenwood - Don'..> | 2026-05-22 20:23 | 46K | |
| Lee Greenwood - Dixi..> | 2026-05-22 20:23 | 61K | |
| Lee Greenwood - Ain'..> | 2026-05-22 20:23 | 29K | |
| Lee Dorsey - Working..> | 2026-05-22 20:39 | 197K | |
| Lee Ann Womack - You..> | 2026-05-22 20:23 | 8.7M | |
| Lee Ann Womack - The..> | 2026-05-22 20:23 | 55K | |
| Lee Ann Womack - Nev..> | 2026-05-22 20:23 | 41K | |
| Lee Ann Womack - I H..> | 2026-05-22 20:23 | 63K | |
| Lee Ann Womack - I'l..> | 2026-05-22 20:23 | 63K | |
| Lee Ann Womack - Buc..> | 2026-05-22 20:23 | 55K | |
| Lee Ann Womack - A L..> | 2026-05-22 20:23 | 219K | |
| Lee Ann Womack - (No..> | 2026-05-22 20:23 | 63K | |
| Lee‐Cabrera & Kevi..> | 2026-05-22 20:08 | 22K | |
| Led Zeppelin - Whole..> | 2026-05-22 20:39 | 58K | |
| Led Zeppelin - Stair..> | 2026-05-22 19:33 | 146K | |
| Led Zeppelin - Over ..> | 2026-05-22 19:33 | 54K | |
| Leann Rimes - Unchai..> | 2026-05-22 20:39 | 63K | |
| Leann Rimes - The Li..> | 2026-05-22 20:23 | 64K | |
| Leann Rimes - Put A ..> | 2026-05-22 20:23 | 74K | |
| Leann Rimes - One Wa..> | 2026-05-22 20:23 | 49K | |
| Leann Rimes - On The..> | 2026-05-22 20:23 | 44K | |
| Leann Rimes - Lookin..> | 2026-05-22 20:23 | 4.1M | |
| Leann Rimes -How Do ..> | 2026-05-22 20:39 | 30K | |
| Leann Rimes - Commit..> | 2026-05-22 20:23 | 63K | |
| Leann Rimes - Can't ..> | 2026-05-22 20:39 | 55K | |
| Leann Rimes - Blue.jpg | 2026-05-22 20:23 | 64K | |
| Leann Rimes - Big De..> | 2026-05-22 20:23 | 63K | |
| Leaf - Wonder Woman.jpg | 2026-05-22 20:08 | 26K | |
| Lcd -Zorba's Dance.jpg | 2026-05-22 20:39 | 34K | |
| Lauryn Hill & Bob Ma..> | 2026-05-22 19:58 | 16K | |
| Laurie Steele Combo ..> | 2026-05-22 20:39 | 26K | |
| Laurie Steele & Chor..> | 2026-05-22 20:39 | 26K | |
| Laurie Anderson - O ..> | 2026-05-22 19:41 | 828K | |
| Lauren Daigle - You ..> | 2026-05-22 20:08 | 40K | |
| Laura Pausini - Stra..> | 2026-05-22 20:39 | 70K | |
| Laura Pausini - La S..> | 2026-05-22 20:39 | 66K | |
| Laura Jansen -Wicked..> | 2026-05-22 20:39 | 16K | |
| Laura Jansen -Use So..> | 2026-05-22 20:39 | 16K | |
| Laura Fygi - Willow ..> | 2026-05-22 20:39 | 23K | |
| Laura Fygi - Stuck o..> | 2026-05-22 20:39 | 23K | |
| Laura Fygi - Out of ..> | 2026-05-22 20:39 | 23K | |
| Laura Fygi - My Fool..> | 2026-05-22 20:39 | 23K | |
| Laura Fygi - Let's G..> | 2026-05-22 20:39 | 23K | |
| Laura Fygi - Just On..> | 2026-05-22 20:39 | 23K | |
| Laura Fygi - Impossi..> | 2026-05-22 20:39 | 23K | |
| Laura Fygi - I've Gr..> | 2026-05-22 20:39 | 23K | |
| Laura Fygi - Guess W..> | 2026-05-22 20:39 | 23K | |
| Laura Fygi - Good Mo..> | 2026-05-22 20:39 | 23K | |
| Laura Fygi - Go Away..> | 2026-05-22 20:39 | 23K | |
| Laura Fygi - Girl Ta..> | 2026-05-22 20:39 | 23K | |
| Laura Fygi - Dream a..> | 2026-05-22 20:39 | 23K | |
| Laura Fygi - Don't I..> | 2026-05-22 20:23 | 158K | |
| Laura Fygi - Can It ..> | 2026-05-22 20:39 | 23K | |
| Laura Branigan - Sel..> | 2026-05-22 19:41 | 48K | |
| Laura Branigan - Glo..> | 2026-05-22 19:41 | 266K | |
| Lasgo - Something.jpg | 2026-05-22 20:08 | 47K | |
| Lasgo -Out Of My Min..> | 2026-05-22 20:08 | 33K | |
| Lasgo - Lost.jpg | 2026-05-22 20:08 | 33K | |
| Lasgo - Lost (Radio ..> | 2026-05-22 20:08 | 160K | |
| Lasgo - Alone.jpg | 2026-05-22 20:08 | 45K | |
| Lasgo -All Night Lon..> | 2026-05-22 20:08 | 21K | |
| Las Ketchup - The Ke..> | 2026-05-22 20:08 | 27K | |
| Larry Gatlin & The G..> | 2026-05-22 20:23 | 48K | |
| Larry Gatlin & The G..> | 2026-05-22 20:23 | 16K | |
| Larry Gatlin & The G..> | 2026-05-22 20:23 | 19K | |
| Larry Gatlin & The G..> | 2026-05-22 20:23 | 23K | |
| Larry Gatlin & The G..> | 2026-05-22 20:23 | 12K | |
| Larry Gatlin & The G..> | 2026-05-22 20:23 | 48K | |
| Larry Gatlin & The G..> | 2026-05-22 20:23 | 16K | |
| Larry Gatlin & The G..> | 2026-05-22 20:23 | 53K | |
| Larry Gatlin & The G..> | 2026-05-22 20:23 | 78K | |
| Larry Gatlin & The G..> | 2026-05-22 20:23 | 48K | |
| Larry Gatlin & The G..> | 2026-05-22 20:23 | 48K | |
| Larry Gatlin & The G..> | 2026-05-22 20:23 | 48K | |
| Lari White - That's ..> | 2026-05-22 20:23 | 39K | |
| Lana Del Rey - Video..> | 2026-05-22 20:39 | 210K | |
| Lally Stott - Chirpy..> | 2026-05-22 19:33 | 24K | |
| Lakeside - Fantastic..> | 2026-05-22 19:58 | 35K | |
| Laid Back - White Ho..> | 2026-05-22 19:41 | 76K | |
| Laid Back - Sunshine..> | 2026-05-22 20:08 | 63K | |
| Laid Back - Sunshine..> | 2026-05-22 19:41 | 76K | |
| Lafleur - Boogie Nig..> | 2026-05-22 19:41 | 47K | |
| Lady Lay-Pierre Gros..> | 2026-05-22 19:33 | 28K | |
| Lady Gaga With Arian..> | 2026-05-22 20:08 | 67K | |
| Lady Gaga Ft. Bradle..> | 2026-05-22 20:08 | 47K | |
| Lady Gaga Feat. Colb..> | 2026-05-22 20:08 | 50K | |
| Lady Gaga - Poker Fa..> | 2026-05-22 20:08 | 55K | |
| Lady Gaga - Paparazz..> | 2026-05-22 20:08 | 50K | |
| Lady Gaga - Just Dan..> | 2026-05-22 20:08 | 138K | |
| Lady Gaga - Born Thi..> | 2026-05-22 20:08 | 49K | |
| Lady Gaga - Bad Roma..> | 2026-05-22 20:08 | 76K | |
| Lady Gaga - Always R..> | 2026-05-22 20:08 | 47K | |
| Lady Gaga -Alejandro..> | 2026-05-22 20:08 | 50K | |
| Lady Gaga & Beyoncé..> | 2026-05-22 20:08 | 53K | |
| Lady Gaga & Ariana G..> | 2026-05-22 20:08 | 435K | |
| Lady GaGa - Poker Fa..> | 2026-05-22 20:08 | 60K | |
| Lady GaGa & Colby O'..> | 2026-05-22 20:08 | 122K | |
| Lady Antebellum - Ne..> | 2026-05-22 20:23 | 51K | |
| Lady Antebellum - Go..> | 2026-05-22 20:23 | 74K | |
| Lacy J. Dalton - Tak..> | 2026-05-22 20:23 | 41K | |
| Lacy J. Dalton - Har..> | 2026-05-22 20:23 | 33K | |
| Lace - I'm A Gambler..> | 2026-05-22 20:39 | 366K | |
| Labi Siffre - It Mus..> | 2026-05-22 19:33 | 99K | |
| Labi Siffre - (Somet..> | 2026-05-22 19:41 | 91K | |
| Labelle - Voulez Vou..> | 2026-05-22 19:33 | 23K | |
| Labelle - Voulez Vou..> | 2026-05-22 19:58 | 436K | |
| LaRoxx ProjectSandro..> | 2026-05-22 20:08 | 35K | |
| LaRoxx ProjectSandro..> | 2026-05-22 20:08 | 35K | |
| La Bouche - Be My Lo..> | 2026-05-22 19:58 | 24K | |
| La Bionda -One For Y..> | 2026-05-22 19:33 | 11K | |
| LUM!X, Jordan Rys - ..> | 2026-05-22 20:08 | 365K | |
| LSRCITY, Gareth Emer..> | 2026-05-22 20:08 | 31K | |
| LMFAO Feat. Lauren B..> | 2026-05-22 20:08 | 27K | |
| LMFAO Feat. Lauren B..> | 2026-05-22 20:08 | 234K | |
| LIZOTKYANU - This Is..> | 2026-05-22 20:08 | 41K | |
| L.T.D. - Shine On.jpg | 2026-05-22 19:41 | 65K | |
| L.T.D. - Back in Lov..> | 2026-05-22 19:41 | 48K | |
| Kyu Sakamoto - Sukiy..> | 2026-05-22 19:58 | 66K | |
| Kylie Minogue - The ..> | 2026-05-22 19:41 | 48K | |
| Kylie Minogue - Tear..> | 2026-05-22 19:58 | 71K | |
| Kylie Minogue - Step..> | 2026-05-22 19:58 | 56K | |
| Kylie Minogue - Spin..> | 2026-05-22 20:08 | 38K | |
| Kylie Minogue - Love..> | 2026-05-22 20:08 | 19K | |
| Kylie Minogue - Loco..> | 2026-05-22 19:41 | 153K | |
| Kylie Minogue - In Y..> | 2026-05-22 20:08 | 61K | |
| Kylie Minogue - I Sh..> | 2026-05-22 19:41 | 48K | |
| Kylie Minogue - Danc..> | 2026-05-22 20:23 | 102K | |
| Kylie Minogue - Can..> | 2026-05-22 20:08 | 19K | |
| Kylie Minogue - Bett..> | 2026-05-22 19:58 | 14K | |
| Kylie Minogue & Nick..> | 2026-05-22 19:58 | 286K | |
| Kylie Minogue & Jaso..> | 2026-05-22 19:41 | 20K | |
| Kygo x Tina Turner -..> | 2026-05-22 20:07 | 277K | |
| Kygo with Avicii & S..> | 2026-05-22 20:07 | 62K | |
| KygoWhitney Houston ..> | 2026-05-22 20:08 | 12K | |
| Kygo Ft. Parson Jame..> | 2026-05-22 20:07 | 51K | |
| Kygo Ft. Conrad - Fi..> | 2026-05-22 20:07 | 11K | |
| Kygo Feat. Maty Noye..> | 2026-05-22 20:07 | 9.8K | |
| Kygo - Firestone.jpg | 2026-05-22 20:07 | 11K | |
| Kygo, Avicii, Sandro..> | 2026-05-22 20:08 | 2.7M | |
| Kygo & Whitney Houst..> | 2026-05-22 20:07 | 35K | |
| Kygo & Onerepublic -..> | 2026-05-22 20:07 | 345K | |
| Kurt Nilsen - She's ..> | 2026-05-22 20:07 | 37K | |
| Kungs & Cookin' On 3..> | 2026-05-22 20:07 | 640K | |
| Kt Tunstall - Sudden..> | 2026-05-22 20:07 | 53K | |
| Kristine W. - Land O..> | 2026-05-22 19:58 | 195K | |
| Kristine W. - Feel W..> | 2026-05-22 20:07 | 29K | |
| Kris Kross Amsterdam..> | 2026-05-22 20:07 | 53K | |
| Kris Kross Amsterdam..> | 2026-05-22 20:07 | 490K | |
| Kris Kross Amsterdam..> | 2026-05-22 20:07 | 35K | |
| Kris Kross Amsterdam..> | 2026-05-22 20:07 | 1.3M | |
| Kris Kross Amsterdam..> | 2026-05-22 20:07 | 149K | |
| Kris Kross Amsterdam..> | 2026-05-22 20:07 | 434K | |
| Kris Kross - Jump.jpg | 2026-05-22 19:58 | 69K | |
| Kris Kristofferson -..> | 2026-05-22 19:33 | 60K | |
| Kris Kristofferson -..> | 2026-05-22 20:23 | 78K | |
| Kris Kristofferson -..> | 2026-05-22 20:23 | 78K | |
| Kris Kristofferson -..> | 2026-05-22 20:23 | 78K | |
| Kris Kristofferson &..> | 2026-05-22 20:23 | 65K | |
| Krezip - Sweet Goodb..> | 2026-05-22 20:39 | 47K | |
| Krezip - Lost With..> | 2026-05-22 20:07 | 27K | |
| Krezip - I Would Sta..> | 2026-05-22 20:07 | 28K | |
| Krezip - All My Life..> | 2026-05-22 20:07 | 72K | |
| Kraftwerk - The Mode..> | 2026-05-22 19:33 | 42K | |
| Kraftwerk - Das Mode..> | 2026-05-22 19:41 | 78K | |
| Kraftwerk - Autobahn..> | 2026-05-22 19:33 | 78K | |
| Kosmonova - Danse Av..> | 2026-05-22 20:07 | 205K | |
| Kosheen - Hide U.jpg | 2026-05-22 20:07 | 57K | |
| Korgis - Rover's Ret..> | 2026-05-22 19:41 | 80K | |
| Korgis - Everybodys ..> | 2026-05-22 20:39 | 30K | |
| Kool Moe Dee - Go Se..> | 2026-05-22 19:41 | 199K | |
| Kool And The Gang - ..> | 2026-05-22 19:58 | 102K | |
| Kool And The Gang - ..> | 2026-05-22 19:58 | 656K | |
| Kool And The Gang - ..> | 2026-05-22 19:33 | 271K | |
| Kool And The Gang - ..> | 2026-05-22 20:07 | 55K | |
| Kool And The Gang - ..> | 2026-05-22 19:58 | 62K | |
| Kool And The Gang - ..> | 2026-05-22 19:41 | 282K | |
| Kool & The Gang - Fr..> | 2026-05-22 19:41 | 63K | |
| Kool & The Gang - Ch..> | 2026-05-22 19:41 | 63K | |
| Kool & The Gang - Ce..> | 2026-05-22 19:58 | 50K | |
| Kon Kan - I Beg Your..> | 2026-05-22 19:41 | 67K | |
| Kokomo - A Little Bi..> | 2026-05-22 19:41 | 60K | |
| Knack - My Sharona.jpg | 2026-05-22 19:33 | 225K | |
| Klymaxx - I Miss You..> | 2026-05-22 19:41 | 71K | |
| Klubbingman - Revolu..> | 2026-05-22 20:07 | 236K | |
| Klubbingman - Revolu..> | 2026-05-22 20:07 | 50K | |
| Klubbheads - Turn Up..> | 2026-05-22 20:07 | 21K | |
| Klf - Last Train To ..> | 2026-05-22 19:58 | 181K | |
| Klf - 3 A.M. Eternal..> | 2026-05-22 19:58 | 25K | |
| Klf & Tammy Wynette ..> | 2026-05-22 19:58 | 30K | |
| Klangkarussell - Son..> | 2026-05-22 20:07 | 234K | |
| Klaatu - Calling Occ..> | 2026-05-22 19:33 | 146K | |
| Klaas Meets Haddaway..> | 2026-05-22 20:07 | 28K | |
| Klaas - Ok Without Y..> | 2026-05-22 20:07 | 129K | |
| Kitty Wells - Whose ..> | 2026-05-22 20:23 | 87K | |
| Kitty Wells - Mommy ..> | 2026-05-22 20:23 | 87K | |
| Kitty Wells - Makin..> | 2026-05-22 20:23 | 85K | |
| Kitty Wells - Left t..> | 2026-05-22 20:23 | 30K | |
| Kitty Wells - Jealou..> | 2026-05-22 20:23 | 64K | |
| Kitty Wells - It Was..> | 2026-05-22 20:23 | 208K | |
| Kitty Wells - It Was..> | 2026-05-22 20:23 | 65K | |
| Kitty Wells - I Can'..> | 2026-05-22 20:23 | 43K | |
| Kitty Wells - Heartb..> | 2026-05-22 20:23 | 110K | |
| Kitty Wells - He's L..> | 2026-05-22 20:23 | 415K | |
| Kitty Grant - Glad T..> | 2026-05-22 19:41 | 292K | |
| Kiss -Sure Know Some..> | 2026-05-22 19:33 | 79K | |
| Kiss - Sure Know Som..> | 2026-05-22 19:58 | 43K | |
| Kiss - I Was Made Fo..> | 2026-05-22 19:33 | 52K | |
| Kinks - Waterloo sun..> | 2026-05-22 20:39 | 56K | |
| Kinks - Sunny aftern..> | 2026-05-22 20:39 | 52K | |
| Kinks - Mr. Pleasant..> | 2026-05-22 20:39 | 56K | |
| Kinks - Mister Pleas..> | 2026-05-22 20:39 | 96K | |
| Kinks - Lola.jpg | 2026-05-22 19:58 | 41K | |
| Kinks - Lola (live).jpg | 2026-05-22 19:41 | 349K | |
| Kinks - Dead End Str..> | 2026-05-22 20:39 | 65K | |
| Kinks - Dandy.jpg | 2026-05-22 20:39 | 52K | |
| Kinks - A Well Respe..> | 2026-05-22 20:39 | 48K | |
| Kinks, The - Lola.jpg | 2026-05-22 19:33 | 56K | |
| Kingston Trio - Tom ..> | 2026-05-22 19:41 | 220K | |
| Kings Of Leon - Use ..> | 2026-05-22 20:39 | 46K | |
| Kings Of Leon - Sex ..> | 2026-05-22 20:07 | 25K | |
| King Curtis & The Ki..> | 2026-05-22 20:39 | 44K | |
| King Bee - Back By D..> | 2026-05-22 20:07 | 45K | |
| King Africa - La Bom..> | 2026-05-22 20:07 | 79K | |
| King - Love And Prid..> | 2026-05-22 19:41 | 197K | |
| King - Love & Pride.jpg | 2026-05-22 19:41 | 197K | |
| Kincade - Dreams Are..> | 2026-05-22 19:33 | 243K | |
| Kim Wilde - You Keep..> | 2026-05-22 19:58 | 42K | |
| Kim Wilde - You Came..> | 2026-05-22 20:07 | 63K | |
| Kim Wilde - View Fro..> | 2026-05-22 19:41 | 28K | |
| Kim Wilde - Never Tr..> | 2026-05-22 19:41 | 222K | |
| Kim Wilde - Love Blo..> | 2026-05-22 19:41 | 189K | |
| Kim Wilde - Kids In ..> | 2026-05-22 19:41 | 30K | |
| Kim Wilde - If I Can..> | 2026-05-22 19:58 | 30K | |
| Kim Wilde - Four Let..> | 2026-05-22 19:58 | 176K | |
| Kim Wilde - Chequere..> | 2026-05-22 19:41 | 28K | |
| Kim Wilde - Cambodia..> | 2026-05-22 19:41 | 176K | |
| Kim Lukas - All I Re..> | 2026-05-22 20:07 | 77K | |
| Kim Lucas - All I Re..> | 2026-05-22 19:58 | 77K | |
| Kim Carnes - The Uni..> | 2026-05-22 19:41 | 323K | |
| Kim Carnes - Bette D..> | 2026-05-22 20:39 | 82K | |
| Kim Appleby - Don't ..> | 2026-05-22 19:58 | 31K | |
| Killing Joke - Love ..> | 2026-05-22 19:41 | 355K | |
| Killer Queen - Don't..> | 2026-05-22 20:07 | 58K | |
| Kilima Hawaiians - O..> | 2026-05-22 19:58 | 33K | |
| Kiki Dee - I've Got ..> | 2026-05-22 19:58 | 77K | |
| Kiki Dee - I've Got ..> | 2026-05-22 19:33 | 173K | |
| Kiki & Pearly - Patr..> | 2026-05-22 19:33 | 432K | |
| Kids From Fame - Sta..> | 2026-05-22 19:41 | 420K | |
| Kids From Fame - Hi-..> | 2026-05-22 19:41 | 420K | |
| Kid Rock - All Summe..> | 2026-05-22 20:39 | 13K | |
| Kid Cudi Vs. Crooker..> | 2026-05-22 20:07 | 39K | |
| Kid Cudi - Day ’n..> | 2026-05-22 20:07 | 136K | |
| Kid Creole & The Coc..> | 2026-05-22 19:41 | 362K | |
| Kid Creole & The Coc..> | 2026-05-22 19:41 | 224K | |
| Kid Creole & The Coc..> | 2026-05-22 19:58 | 53K | |
| Khaled - Aïcha.jpg | 2026-05-22 19:58 | 25K | |
| Kevin Sharp - She's ..> | 2026-05-22 20:23 | 25K | |
| Kevin Sharp - Nobody..> | 2026-05-22 20:23 | 25K | |
| Kevin Sharp - If You..> | 2026-05-22 20:23 | 25K | |
| Kevin Rowland & Dexy..> | 2026-05-22 19:41 | 99K | |
| Kevin Johnson - Rock..> | 2026-05-22 19:33 | 236K | |
| Kernkraft 400 - Zomb..> | 2026-05-22 20:07 | 43K | |
| Kentucky Headhunters..> | 2026-05-22 20:39 | 74K | |
| Kent Blazy and Garth..> | 2026-05-22 20:23 | 435K | |
| Kensington - War.jpg | 2026-05-22 20:07 | 19K | |
| Kensington - Unchart..> | 2026-05-22 20:07 | 88K | |
| Kensington - Streets..> | 2026-05-22 20:07 | 19K | |
| Kensington - Sorry.jpg | 2026-05-22 20:07 | 30K | |
| Kensington - Riddles..> | 2026-05-22 20:07 | 19K | |
| Kensington - Do I Ev..> | 2026-05-22 20:07 | 30K | |
| Kenny Rogers the Fir..> | 2026-05-22 20:23 | 104K | |
| Kenny Rogers - You D..> | 2026-05-22 20:39 | 38K | |
| Kenny Rogers - What ..> | 2026-05-22 20:23 | 38K | |
| Kenny Rogers - We've..> | 2026-05-22 20:39 | 56K | |
| Kenny Rogers - We’..> | 2026-05-22 20:39 | 38K | |
| Kenny Rogers - Twent..> | 2026-05-22 20:23 | 47K | |
| Kenny Rogers - Tomb ..> | 2026-05-22 20:23 | 34K | |
| Kenny Rogers - Throu..> | 2026-05-22 20:23 | 38K | |
| Kenny Rogers - The V..> | 2026-05-22 20:23 | 139K | |
| Kenny Rogers - The G..> | 2026-05-22 20:23 | 41K | |
| Kenny Rogers - The G..> | 2026-05-22 20:23 | 436K | |
| Kenny Rogers - That ..> | 2026-05-22 20:23 | 44K | |
| Kenny Rogers - She B..> | 2026-05-22 20:23 | 200K | |
| Kenny Rogers - Scarl..> | 2026-05-22 20:23 | 42K | |
| Kenny Rogers - Reube..> | 2026-05-22 20:23 | 331K | |
| Kenny Rogers - Morni..> | 2026-05-22 20:23 | 38K | |
| Kenny Rogers - Me an..> | 2026-05-22 20:23 | 11K | |
| Kenny Rogers - Lucil..> | 2026-05-22 20:23 | 200K | |
| Kenny Rogers - Love ..> | 2026-05-22 20:23 | 38K | |
| Kenny Rogers - Love ..> | 2026-05-22 20:39 | 38K | |
| Kenny Rogers - Love ..> | 2026-05-22 20:23 | 38K | |
| Kenny Rogers - Long ..> | 2026-05-22 20:39 | 52K | |
| Kenny Rogers - Lonel..> | 2026-05-22 20:23 | 21K | |
| Kenny Rogers - Lady.jpg | 2026-05-22 20:39 | 38K | |
| Kenny Rogers - Jole ..> | 2026-05-22 20:23 | 62K | |
| Kenny Rogers - I Pre..> | 2026-05-22 20:23 | 55K | |
| Kenny Rogers - I Don..> | 2026-05-22 20:23 | 38K | |
| Kenny Rogers - For t..> | 2026-05-22 20:23 | 11K | |
| Kenny Rogers - For Y..> | 2026-05-22 20:23 | 63K | |
| Kenny Rogers - Every..> | 2026-05-22 20:39 | 42K | |
| Kenny Rogers - Don't..> | 2026-05-22 20:39 | 38K | |
| Kenny Rogers - Dayti..> | 2026-05-22 20:23 | 38K | |
| Kenny Rogers - Crazy..> | 2026-05-22 20:23 | 38K | |
| Kenny Rogers - Cowar..> | 2026-05-22 20:23 | 251K | |
| Kenny Rogers - Burie..> | 2026-05-22 20:23 | 40K | |
| Kenny Rogers - Anyon..> | 2026-05-22 20:23 | 79K | |
| Kenny Rogers - All M..> | 2026-05-22 20:39 | 59K | |
| Kenny Rogers - A Lov..> | 2026-05-22 20:23 | 79K | |
| Kenny Rogers & the F..> | 2026-05-22 20:23 | 61K | |
| Kenny Rogers & The F..> | 2026-05-22 20:39 | 65K | |
| Kenny Rogers & Sheen..> | 2026-05-22 19:58 | 109K | |
| Kenny Rogers & Dolly..> | 2026-05-22 20:39 | 14K | |
| Kenny Rogers & Dolly..> | 2026-05-22 20:23 | 234K | |
| Kenny Loggins - This..> | 2026-05-22 19:58 | 108K | |
| Kenny Loggins - Foot..> | 2026-05-22 19:58 | 136K | |
| Kenny Loggins & Stev..> | 2026-05-22 19:58 | 48K | |
| Kenny G - Songbird.jpg | 2026-05-22 20:39 | 46K | |
| Kenny G - Songbird (..> | 2026-05-22 19:41 | 52K | |
| Kenny Chesney - The ..> | 2026-05-22 20:23 | 41K | |
| Kenny Chesney - That..> | 2026-05-22 20:23 | 44K | |
| Kenny Chesney - She ..> | 2026-05-22 20:23 | 33K | |
| Kenny Chesney - She'..> | 2026-05-22 20:23 | 41K | |
| Kenny Chesney - How ..> | 2026-05-22 20:23 | 33K | |
| Kenny Chesney - Fall..> | 2026-05-22 20:23 | 41K | |
| Kenny Chesney - A Ch..> | 2026-05-22 20:23 | 44K | |
| Ken Boothe - Everyth..> | 2026-05-22 19:33 | 153K | |
| Kelly Marie - Run to..> | 2026-05-22 19:33 | 251K | |
| Kelly Marie - Feels ..> | 2026-05-22 19:40 | 194K | |
| Kelly Family - The C..> | 2026-05-22 19:58 | 87K | |
| Kelly Family - I Can..> | 2026-05-22 19:58 | 74K | |
| Kelly Family - Fell ..> | 2026-05-22 19:58 | 74K | |
| Kelly Family - David..> | 2026-05-22 20:39 | 34K | |
| Kelly Clarkson - Sin..> | 2026-05-22 20:07 | 66K | |
| Kelly Clarkson - My ..> | 2026-05-22 20:07 | 48K | |
| Kelly Clarkson - Mis..> | 2026-05-22 20:07 | 45K | |
| Kelly Clarkson - Bre..> | 2026-05-22 20:07 | 41K | |
| Kelly Clarkson - Bec..> | 2026-05-22 20:07 | 41K | |
| Keith Whitley and Al..> | 2026-05-22 20:39 | 43K | |
| Keith Whitley - When..> | 2026-05-22 20:23 | 31K | |
| Keith Whitley - It A..> | 2026-05-22 20:23 | 32K | |
| Keith Whitley - I Wo..> | 2026-05-22 20:23 | 45K | |
| Keith Whitley - I'm ..> | 2026-05-22 20:23 | 48K | |
| Keith Whitley - I'm ..> | 2026-05-22 20:23 | 48K | |
| Keith Whitley - Don'..> | 2026-05-22 20:23 | 48K | |
| Keith West - Excerpt..> | 2026-05-22 20:39 | 11K | |
| Keith Urban - Somebo..> | 2026-05-22 20:23 | 52K | |
| Keith Marshall - Onl..> | 2026-05-22 19:40 | 142K | |
| Keep it locked - Rob..> | 2026-05-22 19:29 | 3.1K | |
| Keanu Silva, Toby Ro..> | 2026-05-22 20:07 | 32K | |
| Keanu Silva, Toby Ro..> | 2026-05-22 20:07 | 194K | |
| Keanu Silva & Don Di..> | 2026-05-22 20:07 | 156K | |
| Keanu Silva & Don Di..> | 2026-05-22 20:07 | 365K | |
| Keane - This Is The ..> | 2026-05-22 20:07 | 84K | |
| Keane - Sovereign Li..> | 2026-05-22 20:07 | 64K | |
| Keane - Somewhere On..> | 2026-05-22 20:07 | 31K | |
| Keane - Everybody's ..> | 2026-05-22 20:07 | 84K | |
| Keane - Crystal Ball..> | 2026-05-22 20:07 | 84K | |
| Keane - Bend And Bre..> | 2026-05-22 20:07 | 56K | |
| Keane - Bedshaped.jpg | 2026-05-22 20:07 | 84K | |
| Ke$ha -Tik Tok.jpg | 2026-05-22 20:07 | 108K | |
| Kc And The Sunshine ..> | 2026-05-22 19:58 | 45K | |
| Kc & The Sunshine Ba..> | 2026-05-22 19:33 | 157K | |
| Kc & The Sunshine Ba..> | 2026-05-22 19:33 | 324K | |
| Kc & The Sunshine Ba..> | 2026-05-22 19:33 | 96K | |
| Kc & The Sunshine Ba..> | 2026-05-22 19:33 | 37K | |
| Kc & The Sunshine Ba..> | 2026-05-22 19:58 | 19K | |
| Kayak - Ruthless Que..> | 2026-05-22 20:39 | 16K | |
| Kay Starr - Wheel Of..> | 2026-05-22 19:33 | 33K | |
| Kay Starr - The Rock..> | 2026-05-22 20:39 | 63K | |
| Katy Perry Ft. Skip ..> | 2026-05-22 20:07 | 27K | |
| Katy Perry Feat. Sno..> | 2026-05-22 20:07 | 244K | |
| Katy Perry Feat. Jui..> | 2026-05-22 20:07 | 51K | |
| Katy Perry -This Is ..> | 2026-05-22 20:07 | 48K | |
| Katy Perry - Roar.jpg | 2026-05-22 20:07 | 38K | |
| Katy Perry - Last Fr..> | 2026-05-22 20:07 | 50K | |
| Katy Perry - I Kisse..> | 2026-05-22 20:07 | 60K | |
| Katy Perry - Hot N C..> | 2026-05-22 20:07 | 39K | |
| Katy Perry -Firework..> | 2026-05-22 20:07 | 39K | |
| Katy Perry - Dark Ho..> | 2026-05-22 20:07 | 160K | |
| Katy Perry - Dark Ho..> | 2026-05-22 20:07 | 51K | |
| Katy Perry -Californ..> | 2026-05-22 20:07 | 39K | |
| Katrina & The Waves ..> | 2026-05-22 19:40 | 46K | |
| Katrina & The Waves ..> | 2026-05-22 19:58 | 14K | |
| Katie Melua - What A..> | 2026-05-22 20:39 | 41K | |
| Katie Melua - The Cl..> | 2026-05-22 20:39 | 11K | |
| Katie Melua - Thank ..> | 2026-05-22 20:39 | 41K | |
| Katie Melua - Spider..> | 2026-05-22 20:39 | 28K | |
| Katie Melua - Piece ..> | 2026-05-22 20:39 | 28K | |
| Katie Melua - On The..> | 2026-05-22 20:39 | 41K | |
| Katie Melua - Nine M..> | 2026-05-22 20:39 | 38K | |
| Katie Melua - My Aph..> | 2026-05-22 20:39 | 6.0K | |
| Katie Melua - Mockin..> | 2026-05-22 20:39 | 6.0K | |
| Katie Melua - Lilac ..> | 2026-05-22 20:39 | 6.0K | |
| Katie Melua - I Crie..> | 2026-05-22 20:39 | 538K | |
| Katie Melua - Call o..> | 2026-05-22 20:39 | 6.0K | |
| Kathy Mattea - You'r..> | 2026-05-22 20:23 | 28K | |
| Kathy Mattea - Where..> | 2026-05-22 20:23 | 69K | |
| Kathy Mattea - Walki..> | 2026-05-22 20:23 | 64K | |
| Kathy Mattea - Train..> | 2026-05-22 20:23 | 28K | |
| Kathy Mattea - She C..> | 2026-05-22 20:23 | 54K | |
| Kathy Mattea - Love ..> | 2026-05-22 20:23 | 92K | |
| Kathy Mattea - Life ..> | 2026-05-22 20:23 | 63K | |
| Kathy Mattea - Goin'..> | 2026-05-22 20:23 | 63K | |
| Kathy Mattea - Eight..> | 2026-05-22 20:23 | 92K | |
| Kathy Mattea - Come ..> | 2026-05-22 20:23 | 69K | |
| Kathy Mattea - Burni..> | 2026-05-22 20:23 | 54K | |
| Kathy Mattea - 455 R..> | 2026-05-22 20:23 | 83K | |
| Kate Ryan - Voyage V..> | 2026-05-22 20:07 | 39K | |
| Kate Ryan - Ella Ell..> | 2026-05-22 20:07 | 36K | |
| Kate Ryan - Désenc..> | 2026-05-22 20:07 | 29K | |
| Kate Bush - Wutherin..> | 2026-05-22 20:39 | 17K | |
| Kate Bush - Them Hea..> | 2026-05-22 19:33 | 574K | |
| Kate Bush - The Man ..> | 2026-05-22 20:39 | 62K | |
| Kate Bush - The Man ..> | 2026-05-22 19:33 | 15K | |
| Kate Bush - Running ..> | 2026-05-22 20:39 | 24K | |
| Kate Bush - Running ..> | 2026-05-22 19:40 | 96K | |
| Kate Bush - Hounds o..> | 2026-05-22 20:39 | 16K | |
| Kate Bush - Cloudbus..> | 2026-05-22 19:40 | 16K | |
| Kate Bush - Babooshk..> | 2026-05-22 19:40 | 67K | |
| Kate Bush - Army Dre..> | 2026-05-22 19:40 | 557K | |
| Kate Bush & Peter Ga..> | 2026-05-22 19:40 | 38K | |
| Kate & Anna Mcgarrig..> | 2026-05-22 20:07 | 49K | |
| Karla Bonoff feat. P..> | 2026-05-22 20:39 | 17K | |
| Karla Bonoff feat. P..> | 2026-05-22 20:39 | 17K | |
| Karla Bonoff feat. P..> | 2026-05-22 20:39 | 17K | |
| Karla Bonoff feat. D..> | 2026-05-22 20:39 | 17K | |
| Karla Bonoff feat. D..> | 2026-05-22 20:39 | 17K | |
| Karla Bonoff - Wild ..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - When ..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - Troub..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - The W..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - The L..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - The B..> | 2026-05-22 20:39 | 17K | |
| Karla Bonoff - Stand..> | 2026-05-22 20:39 | 17K | |
| Karla Bonoff - Someo..> | 2026-05-22 20:39 | 57K | |
| Karla Bonoff - Rose ..> | 2026-05-22 20:39 | 57K | |
| Karla Bonoff - Pleas..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - Only ..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - Oh Ma..> | 2026-05-22 20:39 | 17K | |
| Karla Bonoff - Never..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - Lovin..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - Lose ..> | 2026-05-22 20:39 | 57K | |
| Karla Bonoff - Just ..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - It Ju..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - Isn't..> | 2026-05-22 20:39 | 57K | |
| Karla Bonoff - If He..> | 2026-05-22 20:39 | 57K | |
| Karla Bonoff - I Don..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - I Can..> | 2026-05-22 20:39 | 57K | |
| Karla Bonoff - How L..> | 2026-05-22 20:23 | 195K | |
| Karla Bonoff - Home.jpg | 2026-05-22 20:39 | 57K | |
| Karla Bonoff - Goodb..> | 2026-05-22 20:23 | 193K | |
| Karla Bonoff - Gonna..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - Flyin..> | 2026-05-22 20:39 | 57K | |
| Karla Bonoff - Faces..> | 2026-05-22 20:39 | 57K | |
| Karla Bonoff - Even ..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - Dream..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - Baby ..> | 2026-05-22 20:39 | 63K | |
| Karla Bonoff - All W..> | 2026-05-22 20:39 | 17K | |
| Karla Bonoff - All M..> | 2026-05-22 20:23 | 193K | |
| Karen Young - Hot sh..> | 2026-05-22 19:33 | 29K | |
| Karen Brooks & Johnn..> | 2026-05-22 20:39 | 340K | |
| Kaoma - Lambada.jpg | 2026-05-22 19:58 | 43K | |
| Kansas - Dust In The..> | 2026-05-22 20:39 | 46K | |
| Kane - Where Do I Go..> | 2026-05-22 20:07 | 38K | |
| Kane - So Glad You M..> | 2026-05-22 20:07 | 109K | |
| Kane - Shot Of A Gun..> | 2026-05-22 20:07 | 66K | |
| Kane - Rain Down On ..> | 2026-05-22 20:07 | 30K | |
| Kane - No Surrender.jpg | 2026-05-22 20:07 | 94K | |
| Kane - Damn Those Ey..> | 2026-05-22 19:58 | 27K | |
| Kane & Carice van Ho..> | 2026-05-22 20:07 | 33K | |
| Kandidaten X-Factor..> | 2026-05-22 20:07 | 280K | |
| Kamahl - The Elephan..> | 2026-05-22 19:33 | 24K | |
| Kamahl - Chanson d'a..> | 2026-05-22 19:33 | 24K | |
| Kalin Twins - When.jpg | 2026-05-22 20:39 | 273K | |
| Kajagoogoo - Too Shy..> | 2026-05-22 19:40 | 46K | |
| Kajagoogoo - Big App..> | 2026-05-22 19:40 | 82K | |
| Kaiser Chiefs - Ruby..> | 2026-05-22 20:07 | 206K | |
| Kai Tracid - Liquid ..> | 2026-05-22 20:07 | 350K | |
| Kadoc - The Nighttra..> | 2026-05-22 19:58 | 53K | |
| Kacey Musgraves - Ra..> | 2026-05-22 20:23 | 48K | |
| KSHMR - Take Me Home..> | 2026-05-22 20:07 | 456K | |
| KLF - Justified & An..> | 2026-05-22 19:58 | 37K | |
| KC And The Sunshine ..> | 2026-05-22 19:33 | 197K | |
| K.T. Oslin - I'll Al..> | 2026-05-22 20:23 | 36K | |
| K.T. Oslin - Hold Me..> | 2026-05-22 20:23 | 32K | |
| K.T. Oslin - Do Ya'.jpg | 2026-05-22 20:23 | 49K | |
| K.T. Oslin - Come Ne..> | 2026-05-22 20:23 | 45K | |
| K.T. Oslin - 80's La..> | 2026-05-22 20:23 | 36K | |
| K.C. & The Sunshine ..> | 2026-05-22 20:07 | 41K | |
| K.C. & The Sunshine ..> | 2026-05-22 20:07 | 25K | |
| K-Ci & Jojo - All My..> | 2026-05-22 19:58 | 28K | |
| K's Choice - Not An ..> | 2026-05-22 20:07 | 52K | |
| K'naan Ft. Nelly Fur..> | 2026-05-22 20:07 | 33K | |
| K'naan -Wavin' Flag.jpg | 2026-05-22 20:07 | 48K | |
| Justin Timberlake - ..> | 2026-05-22 20:07 | 58K | |
| Justin Timberlake - ..> | 2026-05-22 20:07 | 32K | |
| Justin Timberlake - ..> | 2026-05-22 20:07 | 32K | |
| Justin Timberlake - ..> | 2026-05-22 20:07 | 32K | |
| Justin Hayward with ..> | 2026-05-22 20:39 | 26K | |
| Justin Hayward with ..> | 2026-05-22 20:39 | 26K | |
| Justin Hayward with ..> | 2026-05-22 20:39 | 26K | |
| Justin Hayward with ..> | 2026-05-22 20:39 | 26K | |
| Justin Hayward with ..> | 2026-05-22 20:39 | 26K | |
| Justin Hayward with ..> | 2026-05-22 20:39 | 26K | |
| Justin Hayward with ..> | 2026-05-22 20:39 | 26K | |
| Justin Hayward with ..> | 2026-05-22 20:39 | 26K | |
| Justin Hayward with ..> | 2026-05-22 20:39 | 26K | |
| Justin Hayward with ..> | 2026-05-22 20:39 | 26K | |
| Justin Hayward with ..> | 2026-05-22 20:39 | 26K | |
| Justin Hayward with ..> | 2026-05-22 20:39 | 26K | |
| Justin Hayward with ..> | 2026-05-22 20:39 | 26K | |
| Justin Hayward - For..> | 2026-05-22 19:33 | 183K | |
| June Lodge - Someone..> | 2026-05-22 19:40 | 95K | |
| June Lodge - More Th..> | 2026-05-22 19:40 | 95K | |
| June Lodge & Prince ..> | 2026-05-22 19:58 | 176K | |
| Jumping Jewels - Whe..> | 2026-05-22 19:58 | 79K | |
| Jumping Jewels - Iri..> | 2026-05-22 19:58 | 11K | |
| Jumping Jewels - Afr..> | 2026-05-22 20:39 | 12K | |
| Julio Iglesias - Un ..> | 2026-05-22 19:33 | 29K | |
| Julio Iglesias - Qui..> | 2026-05-22 19:40 | 284K | |
| Julio Iglesias - Qui..> | 2026-05-22 19:33 | 19K | |
| Julio Iglesias - Por..> | 2026-05-22 19:33 | 59K | |
| Julio Iglesias & Wil..> | 2026-05-22 19:58 | 38K | |
| Julien Clerc - This ..> | 2026-05-22 20:39 | 31K | |
| Julien Clerc - Si On..> | 2026-05-22 20:38 | 77K | |
| Julien Clerc - Hél..> | 2026-05-22 20:38 | 78K | |
| Julie Rogers - The W..> | 2026-05-22 20:07 | 31K | |
| Julie London - My He..> | 2026-05-22 20:38 | 49K | |
| Julie London - Mad a..> | 2026-05-22 20:38 | 53K | |
| Julie London - Cry M..> | 2026-05-22 20:38 | 71K | |
| Julie Covington - Do..> | 2026-05-22 20:38 | 70K | |
| Julie Andrews - The ..> | 2026-05-22 20:38 | 211K | |
| Julie Andrews - My F..> | 2026-05-22 20:38 | 46K | |
| Julie Andrews - Do-R..> | 2026-05-22 20:38 | 46K | |
| Juliane Werding - St..> | 2026-05-22 19:40 | 148K | |
| Juliane Werding - Ge..> | 2026-05-22 19:40 | 103K | |
| Juliane Werding, Mag..> | 2026-05-22 19:58 | 278K | |
| Julian Lennon - Too ..> | 2026-05-22 19:58 | 100K | |
| Julee Cruise - Falli..> | 2026-05-22 20:38 | 12K | |
| Juice Newton - You M..> | 2026-05-22 20:23 | 89K | |
| Juice Newton - This ..> | 2026-05-22 20:23 | 33K | |
| Juice Newton - The S..> | 2026-05-22 20:23 | 28K | |
| Juice Newton - Queen..> | 2026-05-22 20:23 | 629K | |
| Juice Newton - Love..> | 2026-05-22 20:23 | 82K | |
| Juice Newton - Hurt.jpg | 2026-05-22 20:23 | 36K | |
| Juice Newton - Heart..> | 2026-05-22 20:23 | 273K | |
| Juice Newton - Break..> | 2026-05-22 20:23 | 23K | |
| Juice Newton - Angel..> | 2026-05-22 20:38 | 98K | |
| Juice Newton & Eddie..> | 2026-05-22 20:23 | 49K | |
| Juergen von der Lipp..> | 2026-05-22 19:40 | 204K | |
| Judy Collins - Send ..> | 2026-05-22 19:33 | 68K | |
| Judy Collins - Amazi..> | 2026-05-22 19:33 | 33K | |
| Judy Boucher - Can't..> | 2026-05-22 19:40 | 292K | |
| Judith Ansems - If Y..> | 2026-05-22 19:58 | 189K | |
| Judds - Why Not Me.jpg | 2026-05-22 19:58 | 42K | |
| Jubël - Dancing In..> | 2026-05-22 20:07 | 23K | |
| Jubël; NEIMY - Danc..> | 2026-05-22 20:07 | 23K | |
| Juanes - La Camisa N..> | 2026-05-22 20:07 | 30K | |
| Juanes - A Dios Le P..> | 2026-05-22 20:07 | 32K | |
| Juan Luis Guerra - B..> | 2026-05-22 19:58 | 35K | |
| Juan Bastos - Loop D..> | 2026-05-22 19:33 | 355K | |
| Jr. Walker & The All..> | 2026-05-22 20:38 | 174K | |
| Joyce Sims - Come In..> | 2026-05-22 20:07 | 45K | |
| Joy Division - Love ..> | 2026-05-22 19:40 | 85K | |
| Jovanotti - Libera L..> | 2026-05-22 19:58 | 21K | |
| Journey - Opens Arms..> | 2026-05-22 20:07 | 544K | |
| Journey - Don't Stop..> | 2026-05-22 20:07 | 61K | |
| Joss Stone - You Had..> | 2026-05-22 20:07 | 29K | |
| Joshua Kadison - Jes..> | 2026-05-22 20:38 | 37K | |
| Jose Pirata Orchestr..> | 2026-05-22 20:38 | 62K | |
| Jose Pirata Orchestr..> | 2026-05-22 20:38 | 62K | |
| Jose Carreras - Plac..> | 2026-05-22 20:38 | 38K | |
| Jose Carreras - Plac..> | 2026-05-22 20:38 | 38K | |
| Jose & Ron Brandsted..> | 2026-05-22 19:40 | 499K | |
| José Pirata Orchest..> | 2026-05-22 20:38 | 62K | |
| José Feliciano - Li..> | 2026-05-22 20:38 | 49K | |
| José Feliciano - Fe..> | 2026-05-22 20:38 | 48K | |
| José Feliciano - Ch..> | 2026-05-22 20:38 | 44K | |
| José Carreras & Sar..> | 2026-05-22 20:38 | 50K | |
| José - Secret Love.jpg | 2026-05-22 19:40 | 265K | |
| José - I Will Follo..> | 2026-05-22 19:40 | 256K | |
| Jorja Smith - Little..> | 2026-05-22 20:07 | 98K | |
| Jorja Smith - Little..> | 2026-05-22 20:07 | 135K | |
| Jordy - Dur Dur D'ê..> | 2026-05-22 19:58 | 36K | |
| Jordin Sparks With C..> | 2026-05-22 20:07 | 73K | |
| Jordin Sparks - Batt..> | 2026-05-22 20:07 | 249K | |
| Jordan Hill - Rememb..> | 2026-05-22 19:58 | 45K | |
| Joost - Europapa.jpg | 2026-05-22 20:07 | 129K | |
| Joni Mitchell -Both ..> | 2026-05-22 20:38 | 92K | |
| Joni Mitchell - Big ..> | 2026-05-22 19:33 | 45K | |
| Jonathan Richman & t..> | 2026-05-22 19:33 | 206K | |
| Jonathan King - Hook..> | 2026-05-22 20:38 | 39K | |
| Jonathan King - Ever..> | 2026-05-22 20:38 | 89K | |
| Jonathan Jeremiah - ..> | 2026-05-22 20:07 | 37K | |
| Jonas Brothers Feat...> | 2026-05-22 20:07 | 548K | |
| Jonas Brothers - Wha..> | 2026-05-22 20:07 | 86K | |
| Jonas Brothers - Onl..> | 2026-05-22 20:07 | 45K | |
| Jonas Blue feat. Dak..> | 2026-05-22 20:07 | 55K | |
| Jona Lewie - Stop Th..> | 2026-05-22 19:40 | 232K | |
| Jon Secada - Just An..> | 2026-05-22 19:58 | 66K | |
| Jon Secada - Angel (..> | 2026-05-22 19:58 | 67K | |
| Jon Bon Jovi - Blaze..> | 2026-05-22 19:58 | 66K | |
| Jon Bon Jovi - Blaze..> | 2026-05-22 19:58 | 29K | |
| Jon Anderson - Surre..> | 2026-05-22 19:58 | 22K | |
| Jon Anderson - Hold ..> | 2026-05-22 20:07 | 68K | |
| Jon & Vangelis - I H..> | 2026-05-22 20:38 | 84K | |
| Jon & Vangelis - I H..> | 2026-05-22 19:40 | 13K | |
| Jon & Vangelis - I'l..> | 2026-05-22 19:40 | 216K | |
| Johnny Wakelin - In ..> | 2026-05-22 19:33 | 29K | |
| Johnny Tillotson - P..> | 2026-05-22 20:38 | 42K | |
| Johnny Tillotson - H..> | 2026-05-22 20:23 | 479K | |
| Johnny Preston - Run..> | 2026-05-22 20:23 | 80K | |
| Johnny Pearson - Sle..> | 2026-05-22 20:38 | 73K | |
| Johnny Paycheck - He..> | 2026-05-22 20:23 | 252K | |
| Johnny Otis Show & M..> | 2026-05-22 19:58 | 678K | |
| Johnny Nash - Tears ..> | 2026-05-22 19:33 | 40K | |
| Johnny Nash - Rock m..> | 2026-05-22 19:40 | 140K | |
| Johnny Nash - I Can ..> | 2026-05-22 19:33 | 555K | |
| Johnny Nash - Hold M..> | 2026-05-22 20:38 | 211K | |
| Johnny Nash - Cupid.jpg | 2026-05-22 20:38 | 48K | |
| Johnny Mathis - Star..> | 2026-05-22 20:38 | 56K | |
| Johnny Mathis - I'm ..> | 2026-05-22 20:07 | 55K | |
| Johnny Mathis & Deni..> | 2026-05-22 19:33 | 20K | |
| Johnny Mathis & Deni..> | 2026-05-22 19:33 | 76K | |
| Johnny Logan - What'..> | 2026-05-22 20:38 | 44K | |
| Johnny Logan - Hold ..> | 2026-05-22 20:38 | 74K | |
| Johnny Lee - You Cou..> | 2026-05-22 20:23 | 61K | |
| Johnny Lee - Yellow ..> | 2026-05-22 20:23 | 174K | |
| Johnny Lee - Save th..> | 2026-05-22 20:23 | 73K | |
| Johnny Lee - Pickin'..> | 2026-05-22 20:23 | 47K | |
| Johnny Lee - One In ..> | 2026-05-22 20:23 | 52K | |
| Johnny Lee - Lookin'..> | 2026-05-22 20:23 | 47K | |
| Johnny Lee - Hey Bar..> | 2026-05-22 20:23 | 44K | |
| Johnny Lee - Bet You..> | 2026-05-22 20:23 | 38K | |
| Johnny Kendall and t..> | 2026-05-22 20:38 | 48K | |
| Johnny Kendall & the..> | 2026-05-22 20:38 | 48K | |
| Johnny Howard Orches..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Orches..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Orches..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Orches..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Orches..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Orches..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Orches..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Orches..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Orches..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Orches..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Orches..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Orches..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Orches..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Orches..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Ochest..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Ochest..> | 2026-05-22 20:38 | 150K | |
| Johnny Howard Ochest..> | 2026-05-22 20:38 | 150K | |
| Johnny Hates Jazz - ..> | 2026-05-22 19:40 | 129K | |
| Johnny Hates Jazz - ..> | 2026-05-22 20:07 | 27K | |
| Johnny Hates Jazz - ..> | 2026-05-22 19:40 | 371K | |
| Johnny Hartman - Nat..> | 2026-05-22 20:38 | 424K | |
| Johnny Hallyday - Te..> | 2026-05-22 20:07 | 34K | |
| Johnny Hallyday - Po..> | 2026-05-22 20:38 | 237K | |
| Johnny Hallyday - Po..> | 2026-05-22 19:58 | 66K | |
| Johnny Guitar Watson..> | 2026-05-22 19:33 | 490K | |
| Johnny Duncan - Come..> | 2026-05-22 20:38 | 47K | |
| Johnny Doe - Ring of..> | 2026-05-22 20:23 | 373K | |
| Johnny Doe - I Walk ..> | 2026-05-22 20:23 | 167K | |
| Johnny Doe - A Boy N..> | 2026-05-22 20:23 | 145K | |
| Johnny Cash Feat. Sn..> | 2026-05-22 20:23 | 74K | |
| Johnny Cash - You're..> | 2026-05-22 20:23 | 36K | |
| Johnny Cash - Wreck ..> | 2026-05-22 20:23 | 72K | |
| Johnny Cash - What..> | 2026-05-22 20:38 | 80K | |
| Johnny Cash - What..> | 2026-05-22 20:38 | 583K | |
| Johnny Cash - Train ..> | 2026-05-22 20:23 | 36K | |
| Johnny Cash - Thunde..> | 2026-05-22 20:38 | 59K | |
| Johnny Cash - There ..> | 2026-05-22 20:23 | 68K | |
| Johnny Cash - The Wa..> | 2026-05-22 20:23 | 36K | |
| Johnny Cash - The Ma..> | 2026-05-22 20:38 | 51K | |
| Johnny Cash - The Lo..> | 2026-05-22 20:38 | 80K | |
| Johnny Cash - The Ch..> | 2026-05-22 20:23 | 56K | |
| Johnny Cash - Thanks..> | 2026-05-22 20:23 | 42K | |
| Johnny Cash - Sunday..> | 2026-05-22 20:23 | 37K | |
| Johnny Cash - Straig..> | 2026-05-22 20:23 | 44K | |
| Johnny Cash - So Dog..> | 2026-05-22 20:23 | 36K | |
| Johnny Cash - Smilin..> | 2026-05-22 20:23 | 75K | |
| Johnny Cash - Second..> | 2026-05-22 20:23 | 68K | |
| Johnny Cash - Season..> | 2026-05-22 20:23 | 72K | |
| Johnny Cash - San Qu..> | 2026-05-22 20:23 | 248K | |
| Johnny Cash - San Qu..> | 2026-05-22 20:23 | 60K | |
| Johnny Cash - Rock I..> | 2026-05-22 20:23 | 36K | |
| Johnny Cash - Ring o..> | 2026-05-22 20:23 | 154K | |
| Johnny Cash - Ring O..> | 2026-05-22 19:40 | 487K | |
| Johnny Cash - Riders..> | 2026-05-22 19:33 | 50K | |
| Johnny Cash - Orange..> | 2026-05-22 20:23 | 282K | |
| Johnny Cash - Next i..> | 2026-05-22 20:23 | 36K | |
| Johnny Cash - Mean E..> | 2026-05-22 20:23 | 30K | |
| Johnny Cash - Man in..> | 2026-05-22 20:23 | 109K | |
| Johnny Cash - Luther..> | 2026-05-22 20:23 | 27K | |
| Johnny Cash - Long-L..> | 2026-05-22 20:23 | 370K | |
| Johnny Cash - Katy T..> | 2026-05-22 20:23 | 44K | |
| Johnny Cash - Kate.jpg | 2026-05-22 20:23 | 38K | |
| Johnny Cash - Jackso..> | 2026-05-22 20:38 | 71K | |
| Johnny Cash - It's J..> | 2026-05-22 20:23 | 36K | |
| Johnny Cash - If I W..> | 2026-05-22 20:23 | 282K | |
| Johnny Cash - I Want..> | 2026-05-22 20:23 | 71K | |
| Johnny Cash - I Walk..> | 2026-05-22 20:23 | 237K | |
| Johnny Cash - I Love..> | 2026-05-22 20:23 | 111K | |
| Johnny Cash - I Got ..> | 2026-05-22 20:23 | 28K | |
| Johnny Cash - I've G..> | 2026-05-22 20:23 | 199K | |
| Johnny Cash - I’ve..> | 2026-05-22 20:38 | 36K | |
| Johnny Cash - Hurt.jpg | 2026-05-22 20:23 | 94K | |
| Johnny Cash - Home o..> | 2026-05-22 20:23 | 35K | |
| Johnny Cash - Hey Po..> | 2026-05-22 20:23 | 36K | |
| Johnny Cash - Guess ..> | 2026-05-22 20:23 | 68K | |
| Johnny Cash - Goodby..> | 2026-05-22 20:23 | 44K | |
| Johnny Cash - Give M..> | 2026-05-22 20:23 | 43K | |
| Johnny Cash - Get Rh..> | 2026-05-22 20:23 | 36K | |
| Johnny Cash - Franki..> | 2026-05-22 20:23 | 48K | |
| Johnny Cash - Folsom..> | 2026-05-22 20:23 | 166K | |
| Johnny Cash - Folsom..> | 2026-05-22 20:23 | 128K | |
| Johnny Cash - Five F..> | 2026-05-22 20:23 | 46K | |
| Johnny Cash - Don't ..> | 2026-05-22 20:23 | 28K | |
| Johnny Cash - Don't ..> | 2026-05-22 20:23 | 52K | |
| Johnny Cash - Doin' ..> | 2026-05-22 20:23 | 42K | |
| Johnny Cash - Cry, C..> | 2026-05-22 20:23 | 36K | |
| Johnny Cash - Countr..> | 2026-05-22 20:23 | 97K | |
| Johnny Cash - Come i..> | 2026-05-22 20:23 | 64K | |
| Johnny Cash - Chicke..> | 2026-05-22 20:38 | 75K | |
| Johnny Cash - Big Ri..> | 2026-05-22 20:23 | 36K | |
| Johnny Cash - Ballad..> | 2026-05-22 20:23 | 33K | |
| Johnny Cash - A Thin..> | 2026-05-22 20:23 | 38K | |
| Johnny Cash - A Thin..> | 2026-05-22 20:23 | 124K | |
| Johnny Cash - A Boy ..> | 2026-05-22 20:23 | 11K | |
| Johnny Cash - A Boy ..> | 2026-05-22 19:33 | 15K | |
| Johnny Cash - (Ghost..> | 2026-05-22 20:23 | 114K | |
| Johnny Cash & June C..> | 2026-05-22 20:23 | 322K | |
| Johnny Cash & June C..> | 2026-05-22 20:38 | 36K | |
| Johnny Bristol - Han..> | 2026-05-22 19:33 | 43K | |
| Johnny And Orquestra..> | 2026-05-22 19:33 | 378K | |
| Johnny 'guitar' Wats..> | 2026-05-22 19:58 | 95K | |
| Johnny & The Hurrica..> | 2026-05-22 20:38 | 40K | |
| Johnny & Rijk - De B..> | 2026-05-22 20:38 | 22K | |
| Johnny & Orquestra R..> | 2026-05-22 19:33 | 111K | |
| Johnny & Orquesta Ro..> | 2026-05-22 19:33 | 55K | |
| Johnny & His Cellar ..> | 2026-05-22 20:38 | 170K | |
| Johnnie Ray - Yes To..> | 2026-05-22 19:58 | 69K | |
| Johnnie Ray - Jus Wa..> | 2026-05-22 20:38 | 252K | |
| John Woodhouse - The..> | 2026-05-22 20:38 | 211K | |
| John Woodhouse - Non..> | 2026-05-22 20:38 | 136K | |
| John Woodhouse - Mel..> | 2026-05-22 20:38 | 78K | |
| John Waite - Missing..> | 2026-05-22 19:58 | 189K | |
| John Travolta - Summ..> | 2026-05-22 19:33 | 303K | |
| John Travolta - Sand..> | 2026-05-22 19:33 | 30K | |
| John Travolta - Grea..> | 2026-05-22 19:33 | 32K | |
| John Travolta & Oliv..> | 2026-05-22 19:33 | 21K | |
| John Travolta & Oliv..> | 2026-05-22 20:38 | 17K | |
| John Travolta & Oliv..> | 2026-05-22 19:58 | 39K | |
| John Travolta & Oliv..> | 2026-05-22 19:58 | 54K | |
| John Sebastian - Wel..> | 2026-05-22 19:33 | 48K | |
| John Schneider - You..> | 2026-05-22 20:23 | 46K | |
| John Schneider - I'v..> | 2026-05-22 20:23 | 45K | |
| John Schneider - Cou..> | 2026-05-22 20:23 | 45K | |
| John Schneider - At ..> | 2026-05-22 20:23 | 45K | |
| John Rowles - If I o..> | 2026-05-22 20:38 | 68K | |
| John Rowles - Hush N..> | 2026-05-22 20:38 | 334K | |
| John Phillips - Miss..> | 2026-05-22 20:23 | 43K | |
| John Paul Young - St..> | 2026-05-22 19:33 | 13K | |
| John Paul Young - Lo..> | 2026-05-22 19:33 | 43K | |
| John Parr - St. Elmo..> | 2026-05-22 19:58 | 81K | |
| John Parr - St. Elmo..> | 2026-05-22 19:40 | 172K | |
| John Newman - Love M..> | 2026-05-22 20:07 | 54K | |
| John Miles - Music.jpg | 2026-05-22 20:38 | 82K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 42K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 77K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 77K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 37K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 77K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 77K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 77K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 34K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 40K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 40K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 44K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 33K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 48K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 195K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 301K | |
| John Michael Montgom..> | 2026-05-22 20:22 | 301K | |
| John Mayer Ft. Taylo..> | 2026-05-22 20:07 | 319K | |
| John Mayer - Waiting..> | 2026-05-22 20:07 | 7.0K | |
| John Mayer - Queen O..> | 2026-05-22 20:38 | 469K | |
| John Mayer - New Lig..> | 2026-05-22 20:07 | 37K | |
| John Mayer - Love On..> | 2026-05-22 20:07 | 30K | |
| John Mayer - In The ..> | 2026-05-22 20:07 | 23K | |
| John Mayer - Heartbr..> | 2026-05-22 20:38 | 145K | |
| John Mayer - Gravity..> | 2026-05-22 20:07 | 7.0K | |
| John Mayer - Daughte..> | 2026-05-22 20:07 | 28K | |
| John Mayer - Clarity..> | 2026-05-22 20:07 | 37K | |
| John Mayall - Room T..> | 2026-05-22 19:33 | 273K | |
| John Mayall - Don`t ..> | 2026-05-22 20:38 | 274K | |
| John Leyton - Johnny..> | 2026-05-22 20:22 | 169K | |
| John Lennon - Woman.jpg | 2026-05-22 20:07 | 171K | |
| John Lennon - Jealou..> | 2026-05-22 19:33 | 4.6K | |
| John Lennon - Imagin..> | 2026-05-22 20:38 | 4.6K | |
| John Lennon - (Just ..> | 2026-05-22 19:40 | 188K | |
| John Lennon & Yoko O..> | 2026-05-22 19:58 | 39K | |
| John Lennon & Plasti..> | 2026-05-22 19:33 | 34K | |
| John Lennon & Plasti..> | 2026-05-22 19:33 | 40K | |
| John Lennon & Plasti..> | 2026-05-22 20:38 | 79K | |
| John Legend - Save R..> | 2026-05-22 20:38 | 88K | |
| John Legend - P.D.A...> | 2026-05-22 20:07 | 290K | |
| John Legend - P.D.A...> | 2026-05-22 20:38 | 59K | |
| John Legend - P.D.A...> | 2026-05-22 20:07 | 290K | |
| John Legend - Ordina..> | 2026-05-22 20:38 | 39K | |
| John Legend - All Of..> | 2026-05-22 20:38 | 18K | |
| John Lee Hooker Feat..> | 2026-05-22 19:58 | 82K | |
| John Lee Hooker & Ca..> | 2026-05-22 20:07 | 53K | |
| John Lee Hooker & Bo..> | 2026-05-22 19:58 | 82K | |
| John Hiatt - Have A ..> | 2026-05-22 19:58 | 44K | |
| John Fred & His Play..> | 2026-05-22 20:38 | 71K | |
| John Fogerty - Jamba..> | 2026-05-22 20:22 | 189K | |
| John Farnham - You'r..> | 2026-05-22 19:40 | 42K | |
| John Farnham - That'..> | 2026-05-22 19:58 | 123K | |
| John Farnham - Age O..> | 2026-05-22 20:07 | 42K | |
| John Denver - Wild M..> | 2026-05-22 20:22 | 172K | |
| John Denver - Thank ..> | 2026-05-22 20:22 | 197K | |
| John Denver - Thank ..> | 2026-05-22 20:38 | 37K | |
| John Denver - Thank ..> | 2026-05-22 20:22 | 41K | |
| John Denver - Thank ..> | 2026-05-22 20:22 | 35K | |
| John Denver - Take M..> | 2026-05-22 20:22 | 182K | |
| John Denver - Sunshi..> | 2026-05-22 19:58 | 38K | |
| John Denver - Rocky ..> | 2026-05-22 19:58 | 69K | |
| John Denver - Leavin..> | 2026-05-22 20:22 | 261K | |
| John Denver - Leavin..> | 2026-05-22 20:22 | 73K | |
| John Denver - I'm So..> | 2026-05-22 20:22 | 344K | |
| John Denver - Dreaml..> | 2026-05-22 20:22 | 200K | |
| John Denver - Calyps..> | 2026-05-22 20:22 | 78K | |
| John Denver - Calyps..> | 2026-05-22 20:22 | 53K | |
| John Denver - Annie'..> | 2026-05-22 20:22 | 218K | |
| John Denver - Annie..> | 2026-05-22 20:38 | 37K | |
| John Denver & The Fa..> | 2026-05-22 19:33 | 18K | |
| John Denver & Placid..> | 2026-05-22 20:38 | 37K | |
| John D. Loudermilk -..> | 2026-05-22 20:22 | 179K | |
| John Cougar Mellenca..> | 2026-05-22 20:07 | 43K | |
| John Cougar Mellenca..> | 2026-05-22 20:07 | 199K | |
| John Conlee - Years ..> | 2026-05-22 20:22 | 271K | |
| John Conlee - Workin..> | 2026-05-22 20:22 | 297K | |
| John Conlee - Way Ba..> | 2026-05-22 20:22 | 271K | |
| John Conlee - The Ca..> | 2026-05-22 20:22 | 297K | |
| John Conlee - She Ca..> | 2026-05-22 20:22 | 89K | |
| John Conlee - Rose C..> | 2026-05-22 20:22 | 144K | |
| John Conlee - Old Sc..> | 2026-05-22 20:22 | 271K | |
| John Conlee - Mama's..> | 2026-05-22 20:22 | 229K | |
| John Conlee - Lady L..> | 2026-05-22 20:22 | 271K | |
| John Conlee - In My ..> | 2026-05-22 20:22 | 271K | |
| John Conlee - I Don'..> | 2026-05-22 20:22 | 271K | |
| John Conlee - I'm On..> | 2026-05-22 20:22 | 144K | |
| John Conlee - Friday..> | 2026-05-22 20:22 | 144K | |
| John Conlee - Domest..> | 2026-05-22 20:22 | 164K | |
| John Conlee - Common..> | 2026-05-22 20:22 | 271K | |
| John Conlee - Backsi..> | 2026-05-22 20:22 | 144K | |
| John Berry - She's T..> | 2026-05-22 20:22 | 113K | |
| John Berry - Change ..> | 2026-05-22 20:22 | 184K | |
| John Barry - Goldfin..> | 2026-05-22 20:38 | 195K | |
| John Anderson - Woul..> | 2026-05-22 20:22 | 157K | |
| John Anderson - When..> | 2026-05-22 20:22 | 114K | |
| John Anderson - Swin..> | 2026-05-22 20:22 | 157K | |
| John Anderson - Stra..> | 2026-05-22 20:22 | 119K | |
| John Anderson - She ..> | 2026-05-22 20:22 | 136K | |
| John Anderson - Semi..> | 2026-05-22 20:22 | 119K | |
| John Anderson - I'm ..> | 2026-05-22 20:22 | 200K | |
| John Anderson - Blac..> | 2026-05-22 20:22 | 46K | |
| John Anderson - 1959..> | 2026-05-22 20:22 | 136K | |
| John & Ann Ryder - C..> | 2026-05-22 19:33 | 40K | |
| Joey Dyser - 100 Yea..> | 2026-05-22 20:38 | 16K | |
| Joel Dayde - Mamy Bl..> | 2026-05-22 19:33 | 36K | |
| Joel Corry X David G..> | 2026-05-22 20:07 | 25K | |
| Joel Corry; MNEK - H..> | 2026-05-22 20:07 | 162K | |
| Joel Corry, RAYE & D..> | 2026-05-22 20:07 | 76K | |
| Joel Corry & Jax Jon..> | 2026-05-22 20:07 | 85K | |
| Joel Corry & Jax Jon..> | 2026-05-22 20:07 | 351K | |
| Joe Walsh - Life's B..> | 2026-05-22 19:33 | 223K | |
| Joe Turner - Corrina..> | 2026-05-22 20:07 | 25K | |
| Joe Tex - Loose Cabo..> | 2026-05-22 19:33 | 82K | |
| Joe Tex - Ain't Gonn..> | 2026-05-22 19:33 | 125K | |
| Joe South - Walk a M..> | 2026-05-22 20:22 | 63K | |
| Joe South - Games pe..> | 2026-05-22 20:38 | 21K | |
| Joe Smooth - Promise..> | 2026-05-22 20:07 | 51K | |
| Joe Jackson - Steppi..> | 2026-05-22 20:07 | 24K | |
| Joe Jackson - Real M..> | 2026-05-22 20:38 | 19K | |
| Joe Jackson - Is She..> | 2026-05-22 20:38 | 40K | |
| Joe Jackson - Is Se ..> | 2026-05-22 19:40 | 464K | |
| Joe Jackson - Be My ..> | 2026-05-22 20:07 | 18K | |
| Joe Jackson & Elaine..> | 2026-05-22 20:07 | 18K | |
| Joe Esposito - Lady ..> | 2026-05-22 19:40 | 193K | |
| Joe Dolce - Shaddup ..> | 2026-05-22 19:40 | 250K | |
| Joe Dolan - Make me ..> | 2026-05-22 20:38 | 32K | |
| Joe Diffie - Third R..> | 2026-05-22 20:38 | 37K | |
| Joe Diffie - So Help..> | 2026-05-22 20:22 | 131K | |
| Joe Diffie - Ships T..> | 2026-05-22 20:22 | 131K | |
| Joe Diffie - Prop Me..> | 2026-05-22 20:22 | 131K | |
| Joe Diffie - Pickup ..> | 2026-05-22 20:22 | 153K | |
| Joe Diffie - New Way..> | 2026-05-22 20:22 | 137K | |
| Joe Diffie - John De..> | 2026-05-22 20:22 | 153K | |
| Joe Diffie - Is It C..> | 2026-05-22 20:22 | 132K | |
| Joe Diffie - If the ..> | 2026-05-22 20:22 | 132K | |
| Joe Diffie - If You ..> | 2026-05-22 20:22 | 132K | |
| Joe Diffie - Honky T..> | 2026-05-22 20:22 | 137K | |
| Joe Diffie - Home.jpg | 2026-05-22 20:22 | 132K | |
| Joe Diffie - C-O-U-N..> | 2026-05-22 20:22 | 168K | |
| Joe Diffie - Bigger ..> | 2026-05-22 20:22 | 137K | |
| Joe Diffie - Behind ..> | 2026-05-22 20:22 | 174K | |
| Joe Diffie - A Night..> | 2026-05-22 20:22 | 132K | |
| Joe Dassin - Les Cha..> | 2026-05-22 20:38 | 34K | |
| Joe Dassin - L'été..> | 2026-05-22 19:33 | 93K | |
| Joe Dassin - Ca Va P..> | 2026-05-22 19:33 | 145K | |
| Joe Cocker - You Can..> | 2026-05-22 20:38 | 31K | |
| Joe Cocker - You Are..> | 2026-05-22 20:38 | 19K | |
| Joe Cocker - With a ..> | 2026-05-22 20:38 | 11K | |
| Joe Cocker - Unchain..> | 2026-05-22 19:40 | 188K | |
| Joe Cocker - Unchain..> | 2026-05-22 19:58 | 37K | |
| Joe Cocker - The Let..> | 2026-05-22 19:33 | 36K | |
| Joe Cocker - N'oubli..> | 2026-05-22 19:58 | 41K | |
| Joe Cocker - High Ti..> | 2026-05-22 19:33 | 56K | |
| Joe Cocker - Don't L..> | 2026-05-22 19:58 | 74K | |
| Joe Cocker - Delta L..> | 2026-05-22 20:38 | 23K | |
| Joe Cocker - Cry Me ..> | 2026-05-22 19:33 | 36K | |
| Joe Cocker & Jennife..> | 2026-05-22 20:38 | 19K | |
| Joe Buck - The Way Y..> | 2026-05-22 20:07 | 51K | |
| Joe Bourne - To Know..> | 2026-05-22 19:33 | 193K | |
| Jody Watley - Lookin..> | 2026-05-22 19:40 | 502K | |
| Jodi Bernal - Que Si..> | 2026-05-22 20:07 | 20K | |
| Jocelyn Brown - Some..> | 2026-05-22 19:58 | 34K | |
| Joan Osborne - One O..> | 2026-05-22 20:38 | 95K | |
| Joan Jett & The Blac..> | 2026-05-22 20:07 | 32K | |
| Joan Jett & The Blac..> | 2026-05-22 19:40 | 215K | |
| Joan Franka -You And..> | 2026-05-22 20:07 | 50K | |
| Joan Baez - The Nigh..> | 2026-05-22 20:22 | 133K | |
| Joan Baez - Blowin' ..> | 2026-05-22 19:40 | 46K | |
| Joan Armatrading - R..> | 2026-05-22 20:07 | 38K | |
| Jo Stafford - The Be..> | 2026-05-22 20:38 | 71K | |
| Jo Stafford - Thank ..> | 2026-05-22 20:38 | 100K | |
| Jo Stafford - Allent..> | 2026-05-22 20:38 | 267K | |
| Jo Stafford & Paul W..> | 2026-05-22 20:38 | 41K | |
| Jo Dee Messina - Sta..> | 2026-05-22 20:22 | 193K | |
| Jo Dee Messina - Les..> | 2026-05-22 20:22 | 263K | |
| Jo Dee Messina - I'm..> | 2026-05-22 20:22 | 177K | |
| Jo Dee Messina - Hea..> | 2026-05-22 20:22 | 193K | |
| Jo Dee Messina - Bye..> | 2026-05-22 20:22 | 243K | |
| Jive Jones - Me, Mys..> | 2026-05-22 20:07 | 68K | |
| Jive Bunny And The M..> | 2026-05-22 19:40 | 419K | |
| Jive Bunny & The Mas..> | 2026-05-22 19:58 | 36K | |
| Jimmy Work - Making ..> | 2026-05-22 20:22 | 236K | |
| Jimmy Soul - If You ..> | 2026-05-22 19:58 | 29K | |
| Jimmy Sommerville - ..> | 2026-05-22 19:58 | 18K | |
| Jimmy Sommerville - ..> | 2026-05-22 19:58 | 33K | |
| Jimmy Somerville & B..> | 2026-05-22 19:58 | 36K | |
| Jimmy Ruffin - What ..> | 2026-05-22 20:38 | 74K | |
| Jimmy Nail - Love do..> | 2026-05-22 19:40 | 350K | |
| Jimmy Nail - Ain't N..> | 2026-05-22 20:07 | 39K | |
| Jimmy James & Vagabo..> | 2026-05-22 20:38 | 56K | |
| Jimmy James & The Va..> | 2026-05-22 19:33 | 16K | |
| Jimmy James & The Va..> | 2026-05-22 19:33 | 463K | |
| Jimmy Helms - Gonna ..> | 2026-05-22 19:33 | 42K | |
| Jimmy Edwards - Love..> | 2026-05-22 20:22 | 123K | |
| Jimmy Dean - Big Bad..> | 2026-05-22 20:38 | 48K | |
| Jimmy Cliff - Wonder..> | 2026-05-22 20:38 | 25K | |
| Jimmy Cliff - Wild W..> | 2026-05-22 19:33 | 16K | |
| Jimmy Cliff - Sunshi..> | 2026-05-22 19:40 | 196K | |
| Jimmy Cliff - Reggae..> | 2026-05-22 19:40 | 196K | |
| Jimmy Cliff - Many R..> | 2026-05-22 19:33 | 19K | |
| Jimmy Cliff & Lebo M..> | 2026-05-22 20:38 | 51K | |
| Jimmy C. Newman - Yo..> | 2026-05-22 20:22 | 13K | |
| Jimmy C. Newman - Da..> | 2026-05-22 20:22 | 134K | |
| Jimmy C. Newman - Bl..> | 2026-05-22 20:22 | 91K | |
| Jimmy C. Newman - A ..> | 2026-05-22 20:38 | 31K | |
| Jimmy C. Newman - A ..> | 2026-05-22 20:22 | 159K | |
| Jimmy Buffett - Marg..> | 2026-05-22 20:22 | 262K | |
| Jimmy Bo Horne - Spa..> | 2026-05-22 19:33 | 80K | |
| Jimmy 'bo' Horne - D..> | 2026-05-22 19:58 | 50K | |
| Jimmy 'Bo' Horne - D..> | 2026-05-22 19:58 | 67K | |
| Jimmie Rodgers - Hon..> | 2026-05-22 20:38 | 87K | |
| Jimmie Rodgers - Eng..> | 2026-05-22 20:07 | 14K | |
| Jimi Hendrix Experie..> | 2026-05-22 20:38 | 78K | |
| Jimi Hendrix Experie..> | 2026-05-22 20:38 | 45K | |
| Jimi Hendrix Experie..> | 2026-05-22 20:38 | 1.8M | |
| Jimi Hendrix Experie..> | 2026-05-22 20:38 | 259K | |
| Jimi Hendrix - The W..> | 2026-05-22 19:58 | 78K | |
| Jimi Hendrix - Hey J..> | 2026-05-22 19:58 | 27K | |
| Jimi Hendrix - All A..> | 2026-05-22 19:58 | 84K | |
| Jimi Hendrix - All..> | 2026-05-22 19:40 | 110K | |
| Jim Reeves Feat. Pat..> | 2026-05-22 20:22 | 234K | |
| Jim Reeves Feat. Dor..> | 2026-05-22 20:22 | 38K | |
| Jim Reeves - Young H..> | 2026-05-22 20:22 | 222K | |
| Jim Reeves - Yonder ..> | 2026-05-22 20:22 | 201K | |
| Jim Reeves - Welcome..> | 2026-05-22 20:22 | 58K | |
| Jim Reeves - Waltzin..> | 2026-05-22 20:22 | 161K | |
| Jim Reeves - Waiting..> | 2026-05-22 20:22 | 148K | |
| Jim Reeves - Waitin(..> | 2026-05-22 20:22 | 58K | |
| Jim Reeves - Two Sha..> | 2026-05-22 20:22 | 157K | |
| Jim Reeves - Tweedle..> | 2026-05-22 20:22 | 131K | |
| Jim Reeves - There's..> | 2026-05-22 20:38 | 15K | |
| Jim Reeves - There..> | 2026-05-22 20:22 | 42K | |
| Jim Reeves - Then I'..> | 2026-05-22 20:22 | 157K | |
| Jim Reeves - The Wre..> | 2026-05-22 20:22 | 41K | |
| Jim Reeves - The Str..> | 2026-05-22 20:22 | 58K | |
| Jim Reeves - Tahiti.jpg | 2026-05-22 20:22 | 224K | |
| Jim Reeves - Streets..> | 2026-05-22 20:38 | 54K | |
| Jim Reeves - Someday..> | 2026-05-22 20:22 | 101K | |
| Jim Reeves - Roly Po..> | 2026-05-22 20:22 | 239K | |
| Jim Reeves - Red Eye..> | 2026-05-22 20:22 | 96K | |
| Jim Reeves - Penny C..> | 2026-05-22 20:22 | 239K | |
| Jim Reeves - Partner..> | 2026-05-22 20:22 | 239K | |
| Jim Reeves - Overnig..> | 2026-05-22 20:22 | 157K | |
| Jim Reeves - My Lips..> | 2026-05-22 20:22 | 274K | |
| Jim Reeves - My Happ..> | 2026-05-22 20:22 | 406K | |
| Jim Reeves - Missing..> | 2026-05-22 20:22 | 58K | |
| Jim Reeves - Mexican..> | 2026-05-22 20:22 | 58K | |
| Jim Reeves - Just Wa..> | 2026-05-22 20:22 | 41K | |
| Jim Reeves - Just Wa..> | 2026-05-22 20:38 | 80K | |
| Jim Reeves - I won't..> | 2026-05-22 20:38 | 28K | |
| Jim Reeves - I Wont ..> | 2026-05-22 20:38 | 54K | |
| Jim Reeves - I Won()..> | 2026-05-22 20:22 | 58K | |
| Jim Reeves - I Won't..> | 2026-05-22 20:22 | 146K | |
| Jim Reeves - I Won..> | 2026-05-22 20:22 | 28K | |
| Jim Reeves - I Misse..> | 2026-05-22 20:22 | 239K | |
| Jim Reeves - I Love ..> | 2026-05-22 20:22 | 58K | |
| Jim Reeves - I Know ..> | 2026-05-22 20:22 | 131K | |
| Jim Reeves - I Can()..> | 2026-05-22 20:22 | 54K | |
| Jim Reeves - I Can't..> | 2026-05-22 20:38 | 48K | |
| Jim Reeves - I()m Hu..> | 2026-05-22 20:22 | 88K | |
| Jim Reeves - I'm Get..> | 2026-05-22 20:22 | 239K | |
| Jim Reeves - I'm Beg..> | 2026-05-22 20:22 | 239K | |
| Jim Reeves - I'd Lik..> | 2026-05-22 20:22 | 239K | |
| Jim Reeves - Home.jpg | 2026-05-22 20:22 | 239K | |
| Jim Reeves - Hillbil..> | 2026-05-22 20:22 | 560K | |
| Jim Reeves - He'll H..> | 2026-05-22 20:22 | 180K | |
| Jim Reeves - Have I ..> | 2026-05-22 20:22 | 63K | |
| Jim Reeves - Give Me..> | 2026-05-22 20:22 | 282K | |
| Jim Reeves - Four Wa..> | 2026-05-22 19:58 | 29K | |
| Jim Reeves - Final A..> | 2026-05-22 20:22 | 156K | |
| Jim Reeves - Drinkin..> | 2026-05-22 20:22 | 280K | |
| Jim Reeves - Distant..> | 2026-05-22 20:22 | 32K | |
| Jim Reeves - Distant..> | 2026-05-22 20:22 | 17K | |
| Jim Reeves - Danny B..> | 2026-05-22 20:22 | 58K | |
| Jim Reeves - But You..> | 2026-05-22 20:38 | 21K | |
| Jim Reeves - Blue Si..> | 2026-05-22 20:38 | 54K | |
| Jim Reeves - Blue Bo..> | 2026-05-22 19:58 | 29K | |
| Jim Reeves - Bimbo.jpg | 2026-05-22 20:22 | 58K | |
| Jim Reeves - Billy B..> | 2026-05-22 20:22 | 146K | |
| Jim Reeves - Auf Wie..> | 2026-05-22 20:22 | 41K | |
| Jim Reeves - Anna Ma..> | 2026-05-22 20:22 | 239K | |
| Jim Reeves - Am I Lo..> | 2026-05-22 20:38 | 351K | |
| Jim Reeves - Adios A..> | 2026-05-22 20:22 | 146K | |
| Jim Reeves - Accordi..> | 2026-05-22 20:22 | 69K | |
| Jim Reeves - A Lette..> | 2026-05-22 20:22 | 58K | |
| Jim Reeves - (There'..> | 2026-05-22 20:38 | 54K | |
| Jim Reeves & Patsy C..> | 2026-05-22 20:38 | 122K | |
| Jim Glaser - You're ..> | 2026-05-22 20:22 | 139K | |
| Jim Gilstrap - Swing..> | 2026-05-22 19:33 | 23K | |
| Jim Ed Brown - Pop a..> | 2026-05-22 20:22 | 166K | |
| Jim Ed Brown - Morni..> | 2026-05-22 20:22 | 245K | |
| Jim Diamond - I Shou..> | 2026-05-22 19:40 | 76K | |
| Jim Croce - Time In ..> | 2026-05-22 20:38 | 45K | |
| Jim Croce - Operator..> | 2026-05-22 20:22 | 138K | |
| Jim Croce - I'll Hav..> | 2026-05-22 20:38 | 45K | |
| Jim Croce - Bad Bad ..> | 2026-05-22 20:38 | 25K | |
| Jewel Akens - The bi..> | 2026-05-22 20:38 | 9.8K | |
| Jewel -Foolish Games..> | 2026-05-22 20:38 | 24K | |
| Jeugd Van Tegenwoord..> | 2026-05-22 20:07 | 96K | |
| Jets - Pied piper.jpg | 2026-05-22 20:38 | 86K | |
| Jethro Tull - Locomo..> | 2026-05-22 19:33 | 333K | |
| Jethro Tull - Bouré..> | 2026-05-22 20:38 | 77K | |
| Jesus Loves You - Ge..> | 2026-05-22 20:07 | 12K | |
| Jessie J -Price Tag.jpg | 2026-05-22 20:07 | 60K | |
| Jessie J -Domino.jpg | 2026-05-22 20:07 | 72K | |
| Jessie J, Ariana Gra..> | 2026-05-22 20:07 | 46K | |
| Jessica Simpson -The..> | 2026-05-22 20:38 | 49K | |
| Jessica - How will i..> | 2026-05-22 20:38 | 21K | |
| Jessica -How Will I ..> | 2026-05-22 20:07 | 21K | |
| Jesse Green - Nice A..> | 2026-05-22 19:33 | 12K | |
| Jesse Green - Flip.jpg | 2026-05-22 19:33 | 246K | |
| Jerry Shook - Slowly..> | 2026-05-22 20:22 | 117K | |
| Jerry Shook - In the..> | 2026-05-22 20:22 | 117K | |
| Jerry Reed - When Yo..> | 2026-05-22 20:22 | 292K | |
| Jerry Reed - She Got..> | 2026-05-22 20:22 | 133K | |
| Jerry Reed - Guitar ..> | 2026-05-22 20:22 | 28K | |
| Jerry Reed - East Bo..> | 2026-05-22 20:22 | 133K | |
| Jerry Lee Lewis - Wh..> | 2026-05-22 20:38 | 31K | |
| Jerry Lee Lewis - Sa..> | 2026-05-22 20:38 | 78K | |
| Jerry Lee Lewis - Gr..> | 2026-05-22 20:38 | 65K | |
| Jerry Lee Lewis - Gr..> | 2026-05-22 19:40 | 33K | |
| Jerry Lee Lewis - Ch..> | 2026-05-22 20:38 | 41K | |
| Jermaine Stewart - W..> | 2026-05-22 20:07 | 37K | |
| Jermaine Jackson - D..> | 2026-05-22 19:40 | 115K | |
| Jermaine Jackson - D..> | 2026-05-22 19:33 | 215K | |
| Jermaine Jackson & P..> | 2026-05-22 19:40 | 143K | |
| Jenny Burton - Bad H..> | 2026-05-22 20:07 | 39K | |
| Jenny Bee - Wanna Ge..> | 2026-05-22 19:58 | 21K | |
| Jennifer Warnes - Ri..> | 2026-05-22 20:22 | 134K | |
| Jennifer Warnes - I ..> | 2026-05-22 20:22 | 427K | |
| Jennifer Rush - The ..> | 2026-05-22 19:58 | 40K | |
| Jennifer Paige - Cru..> | 2026-05-22 19:58 | 66K | |
| Jennifer Lopez Feat...> | 2026-05-22 20:07 | 26K | |
| Jennifer Lopez - Wai..> | 2026-05-22 20:07 | 28K | |
| Jennifer Lopez - The..> | 2026-05-22 20:38 | 38K | |
| Jennifer Lopez - Let..> | 2026-05-22 20:07 | 30K | |
| Jennifer Lopez - If ..> | 2026-05-22 20:07 | 31K | |
| Jennifer Lopez - Ain..> | 2026-05-22 20:07 | 61K | |
| Jennifer Lopez & Jad..> | 2026-05-22 20:07 | 50K | |
| Jennifer Ewbank - Im..> | 2026-05-22 20:38 | 129K | |
| Jen Payne - Because ..> | 2026-05-22 20:07 | 15K | |
| Jefferson Airplane -..> | 2026-05-22 20:38 | 235K | |
| Jefferson Airplane -..> | 2026-05-22 20:38 | 208K | |
| Jeff Wayne - Thunder..> | 2026-05-22 20:38 | 11K | |
| Jeff Wayne - The Spi..> | 2026-05-22 20:38 | 11K | |
| Jeff Wayne - The Red..> | 2026-05-22 20:38 | 11K | |
| Jeff Wayne - The Red..> | 2026-05-22 20:38 | 11K | |
| Jeff Wayne - The Eve..> | 2026-05-22 19:33 | 36K | |
| Jeff Wayne - The Art..> | 2026-05-22 20:38 | 11K | |
| Jeff Wayne - The Art..> | 2026-05-22 20:38 | 11K | |
| Jeff Wayne - Horsell..> | 2026-05-22 20:38 | 11K | |
| Jeff Wayne - Epilogu..> | 2026-05-22 20:38 | 11K | |
| Jeff Wayne - Epilogu..> | 2026-05-22 20:38 | 11K | |
| Jeff Wayne - Dead Lo..> | 2026-05-22 20:38 | 11K | |
| Jeff Wayne - Brave N..> | 2026-05-22 20:38 | 11K | |
| Jeff Wayne & Justin ..> | 2026-05-22 20:38 | 56K | |
| Jeff Moore - She's O..> | 2026-05-22 20:22 | 70K | |
| Jeff Carson - The Ca..> | 2026-05-22 20:22 | 139K | |
| Jeff Carson - Not On..> | 2026-05-22 20:22 | 139K | |
| Jeff Buckley - Halle..> | 2026-05-22 20:38 | 52K | |
| Jeff Beck Group - Hi..> | 2026-05-22 20:38 | 15K | |
| Jeff Beck - Hi-ho si..> | 2026-05-22 20:38 | 15K | |
| Jeckyll & Hyde - Fro..> | 2026-05-22 20:07 | 36K | |
| Jeckyll & Hyde -Free..> | 2026-05-22 20:07 | 36K | |
| Jeannie C. Riley - H..> | 2026-05-22 20:22 | 59K | |
| Jeanne Black - He´l..> | 2026-05-22 20:22 | 340K | |
| Jean Shepard - A Dea..> | 2026-05-22 20:22 | 265K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 129K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 129K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 41K | |
| Jean Michel Jarre - ..> | 2026-05-22 19:33 | 12K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 44K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 174K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 174K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 174K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 174K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 26K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 524K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 524K | |
| Jean Michel Jarre - ..> | 2026-05-22 20:38 | 384K | |
| Jean Michel Jarre - ..> | 2026-05-22 19:33 | 340K | |
| Jean Knight - Mr. Bi..> | 2026-05-22 20:07 | 49K | |
| Jean Ferrat - La Mon..> | 2026-05-22 20:38 | 49K | |
| Jean-Michel Jarre - ..> | 2026-05-22 19:33 | 278K | |
| Jean-Michel Jarre - ..> | 2026-05-22 20:38 | 25K | |
| Jay Z - Hard Knock L..> | 2026-05-22 19:58 | 21K | |
| Jay-Z Ft. Beyonce - ..> | 2026-05-22 20:07 | 86K | |
| Jay-Z Ft. Alicia Key..> | 2026-05-22 20:07 | 320K | |
| Jay & the Americans ..> | 2026-05-22 20:38 | 40K | |
| Jay & the Americans ..> | 2026-05-22 20:38 | 18K | |
| Jasper Forks - River..> | 2026-05-22 20:07 | 55K | |
| Jasper Forks - River..> | 2026-05-22 20:07 | 121K | |
| Jason Mraz - I Won't..> | 2026-05-22 20:07 | 12K | |
| Jason Mraz - I'm You..> | 2026-05-22 20:38 | 29K | |
| Jason Mraz (Feat. Co..> | 2026-05-22 20:38 | 20K | |
| Jason Mraz & Colbie ..> | 2026-05-22 20:07 | 76K | |
| Jason Donovan - Too ..> | 2026-05-22 19:40 | 201K | |
| Jason Donovan - Seal..> | 2026-05-22 19:40 | 207K | |
| Jason Donovan - Any ..> | 2026-05-22 19:58 | 72K | |
| Jason Derulo - Want ..> | 2026-05-22 20:07 | 29K | |
| Janis Joplin -Merced..> | 2026-05-22 20:38 | 21K | |
| Janis Joplin - Merce..> | 2026-05-22 20:38 | 265K | |
| Janis Joplin - Me An..> | 2026-05-22 20:38 | 46K | |
| Janis Joplin & The F..> | 2026-05-22 19:33 | 31K | |
| Janis Ian - The Othe..> | 2026-05-22 19:40 | 234K | |
| Janis Ian - Fly Too ..> | 2026-05-22 20:38 | 200K | |
| Janis Ian - Fly Too ..> | 2026-05-22 19:33 | 16K | |
| Janis Ian - At Seven..> | 2026-05-22 20:38 | 35K | |
| Janie Fricke - Your ..> | 2026-05-22 20:22 | 180K | |
| Janie Fricke - Tell ..> | 2026-05-22 20:22 | 175K | |
| Janie Fricke - Someb..> | 2026-05-22 20:22 | 225K | |
| Janie Fricke - She's..> | 2026-05-22 20:22 | 186K | |
| Janie Fricke - Let's..> | 2026-05-22 20:22 | 175K | |
| Janie Fricke - It Ai..> | 2026-05-22 20:22 | 117K | |
| Janie Fricke - If th..> | 2026-05-22 20:22 | 166K | |
| Janie Fricke - I'll ..> | 2026-05-22 20:22 | 158K | |
| Janie Fricke - He's ..> | 2026-05-22 20:22 | 95K | |
| Janie Fricke - Easy ..> | 2026-05-22 20:22 | 261K | |
| Janie Fricke - Down ..> | 2026-05-22 20:22 | 261K | |
| Janie Fricke - Don't..> | 2026-05-22 20:22 | 186K | |
| Janie Fricke - Alway..> | 2026-05-22 20:22 | 211K | |
| Janet Jackson - When..> | 2026-05-22 19:58 | 24K | |
| Janet Jackson - What..> | 2026-05-22 20:07 | 26K | |
| Janet Jackson - Toge..> | 2026-05-22 19:58 | 9.6K | |
| Janet Jackson - That..> | 2026-05-22 19:58 | 81K | |
| Janet Jackson - Runa..> | 2026-05-22 19:57 | 41K | |
| Janet Jackson - Nast..> | 2026-05-22 19:40 | 346K | |
| Janet Jackson - Miss..> | 2026-05-22 19:40 | 188K | |
| Janet Jackson - Let'..> | 2026-05-22 19:40 | 251K | |
| Janet Jackson - Esca..> | 2026-05-22 20:07 | 31K | |
| Janet Jackson - All ..> | 2026-05-22 20:07 | 36K | |
| Janet Jackson & Herb..> | 2026-05-22 19:58 | 63K | |
| Jane Birkin & Serge ..> | 2026-05-22 19:33 | 83K | |
| Jan Wayne -Only You.jpg | 2026-05-22 20:07 | 27K | |
| Jan Wayne - More Tha..> | 2026-05-22 20:07 | 27K | |
| Jan Wayne - Because ..> | 2026-05-22 20:07 | 170K | |
| Jan Hammer - Miami ..> | 2026-05-22 19:57 | 43K | |
| Jan Hammer - Crocket..> | 2026-05-22 19:40 | 92K | |
| Jan Akkerman - House..> | 2026-05-22 19:33 | 329K | |
| Jan & Kjeld - Banjo ..> | 2026-05-22 20:07 | 46K | |
| Jan & Dean - Surf Ci..> | 2026-05-22 19:33 | 12K | |
| Jan & Dean - Dead Ma..> | 2026-05-22 19:33 | 393K | |
| Jamiroquai - Virtual..> | 2026-05-22 19:57 | 121K | |
| Jamiroquai - Cosmic ..> | 2026-05-22 20:07 | 32K | |
| Jamiroquai - Canned ..> | 2026-05-22 20:07 | 47K | |
| Jamie Lidell - Anoth..> | 2026-05-22 20:07 | 40K | |
| Jamie Cullum - Everl..> | 2026-05-22 20:37 | 37K | |
| Jamie Cullum -Don't ..> | 2026-05-22 20:38 | 77K | |
| James Taylor - You'v..> | 2026-05-22 20:22 | 288K | |
| James Taylor - How S..> | 2026-05-22 20:37 | 13K | |
| James Taylor - Fire ..> | 2026-05-22 20:22 | 57K | |
| James Morrison - You..> | 2026-05-22 20:07 | 29K | |
| James Morrison - Won..> | 2026-05-22 20:37 | 34K | |
| James Morrison - Not..> | 2026-05-22 20:07 | 60K | |
| James Morrison -Brok..> | 2026-05-22 20:07 | 75K | |
| James Morrison & Nel..> | 2026-05-22 20:37 | 60K | |
| James Lloyd - Keep O..> | 2026-05-22 19:33 | 246K | |
| James Last - Träume..> | 2026-05-22 20:37 | 75K | |
| James Last - Theme F..> | 2026-05-22 20:37 | 75K | |
| James Last - Rodrigo..> | 2026-05-22 20:37 | 75K | |
| James Last - Prelude..> | 2026-05-22 20:37 | 36K | |
| James Last - Prelude..> | 2026-05-22 20:37 | 36K | |
| James Last - Prelude..> | 2026-05-22 20:37 | 36K | |
| James Last - Prelude..> | 2026-05-22 20:37 | 36K | |
| James Last - Prelude..> | 2026-05-22 20:37 | 36K | |
| James Last - Prelude..> | 2026-05-22 20:37 | 36K | |
| James Last - Overtur..> | 2026-05-22 20:37 | 75K | |
| James Last - Liebest..> | 2026-05-22 20:37 | 75K | |
| James Last - Interme..> | 2026-05-22 20:37 | 75K | |
| James Last - In The ..> | 2026-05-22 20:37 | 75K | |
| James Last - Hungari..> | 2026-05-22 20:37 | 54K | |
| James Last - Fugue X..> | 2026-05-22 20:37 | 36K | |
| James Last - Fugue X..> | 2026-05-22 20:37 | 36K | |
| James Last - Fugue V..> | 2026-05-22 20:37 | 36K | |
| James Last - Fugue V..> | 2026-05-22 20:37 | 36K | |
| James Last - Fugue I..> | 2026-05-22 20:37 | 36K | |
| James Last - Fugue I..> | 2026-05-22 20:37 | 36K | |
| James Last - Elvira ..> | 2026-05-22 19:33 | 39K | |
| James Last - Eine Kl..> | 2026-05-22 20:37 | 75K | |
| James Last - Chanson..> | 2026-05-22 20:37 | 75K | |
| James Last - Bolero.jpg | 2026-05-22 20:37 | 75K | |
| James Last - Biscaya..> | 2026-05-22 20:37 | 47K | |
| James Last - Barcaro..> | 2026-05-22 20:37 | 188K | |
| James Last - Ballet ..> | 2026-05-22 20:37 | 75K | |
| James Last - Amboss-..> | 2026-05-22 19:33 | 106K | |
| James Last - Adagio ..> | 2026-05-22 20:37 | 75K | |
| James Last & His Orc..> | 2026-05-22 19:33 | 100K | |
| James Last & His Orc..> | 2026-05-22 19:33 | 100K | |
| James Last & His Orc..> | 2026-05-22 19:33 | 41K | |
| James Last & His Orc..> | 2026-05-22 19:40 | 121K | |
| James Last & His Orc..> | 2026-05-22 20:37 | 247K | |
| James Last & Gheorgh..> | 2026-05-22 19:33 | 48K | |
| James Iotti & Jan Va..> | 2026-05-22 19:33 | 224K | |
| James Ingram & Micha..> | 2026-05-22 19:40 | 39K | |
| James Brown - Woman.jpg | 2026-05-22 20:07 | 63K | |
| James Brown - Living..> | 2026-05-22 19:57 | 49K | |
| James Brown - Its A ..> | 2026-05-22 19:57 | 81K | |
| James Brown - It's a..> | 2026-05-22 20:37 | 97K | |
| James Brown - I Got ..> | 2026-05-22 20:07 | 51K | |
| James Blunt - You're..> | 2026-05-22 20:37 | 56K | |
| James Blunt - Wiseme..> | 2026-05-22 20:07 | 56K | |
| James Blunt - Stay T..> | 2026-05-22 20:07 | 33K | |
| James Blunt - Goodby..> | 2026-05-22 20:37 | 56K | |
| James Blunt - 1973.jpg | 2026-05-22 20:37 | 142K | |
| James Bay - Let It G..> | 2026-05-22 20:37 | 51K | |
| James Bay - Hold Bac..> | 2026-05-22 20:07 | 51K | |
| James Bay - Best Fak..> | 2026-05-22 20:07 | 33K | |
| James Arthur Ft. Ann..> | 2026-05-22 20:07 | 52K | |
| James Arthur - Say Y..> | 2026-05-22 20:07 | 21K | |
| James & Bobby Purify..> | 2026-05-22 19:33 | 245K | |
| Jamelia - Superstar.jpg | 2026-05-22 20:07 | 41K | |
| Jamai - Step Right U..> | 2026-05-22 20:07 | 39K | |
| JamBeats - One Day.jpg | 2026-05-22 20:07 | 81K | |
| Jaki Graham - Step R..> | 2026-05-22 19:40 | 261K | |
| Jaki Graham - Set Me..> | 2026-05-22 20:07 | 36K | |
| Jaki Graham - Breaki..> | 2026-05-22 19:57 | 32K | |
| Jade - Don't Walk Aw..> | 2026-05-22 19:57 | 19K | |
| Jacques Dutronc - Le..> | 2026-05-22 20:37 | 288K | |
| Jacques Dutronc - Il..> | 2026-05-22 20:37 | 45K | |
| Jacques Brel - Voir ..> | 2026-05-22 19:33 | 8.5M | |
| Jacques Brel - Ne Me..> | 2026-05-22 20:37 | 44K | |
| Jacques Brel - Le Mo..> | 2026-05-22 19:57 | 56K | |
| Jacques Brel - La Ch..> | 2026-05-22 20:37 | 48K | |
| Jacques Brel - Amste..> | 2026-05-22 20:37 | 31K | |
| Jacksons - Shake You..> | 2026-05-22 19:33 | 57K | |
| Jacksons - Lovely On..> | 2026-05-22 20:07 | 33K | |
| Jacksons - Can You F..> | 2026-05-22 19:33 | 29K | |
| Jacksons - Blame It ..> | 2026-05-22 19:33 | 146K | |
| Jacksons, The - Love..> | 2026-05-22 20:07 | 33K | |
| Jacksons & Mick Jagg..> | 2026-05-22 19:57 | 64K | |
| Jackson Five - I Wan..> | 2026-05-22 19:33 | 86K | |
| Jackson Five - I'll ..> | 2026-05-22 19:33 | 61K | |
| Jackson Five - Abc.jpg | 2026-05-22 19:57 | 50K | |
| Jackson Browne - The..> | 2026-05-22 20:07 | 47K | |
| Jackson Browne - Run..> | 2026-05-22 19:33 | 164K | |
| Jackson 5 - ABC.jpg | 2026-05-22 20:37 | 215K | |
| Jackpot - One And On..> | 2026-05-22 19:33 | 29K | |
| Jackpot - Is Everybo..> | 2026-05-22 19:33 | 41K | |
| Jackie Wilson - Reet..> | 2026-05-22 20:37 | 53K | |
| Jackie Wilson - I Ge..> | 2026-05-22 19:40 | 247K | |
| Jackie Wilson - I Ge..> | 2026-05-22 20:37 | 348K | |
| Jackie Wilson - (You..> | 2026-05-22 19:57 | 32K | |
| Jackie Deshannon - W..> | 2026-05-22 19:33 | 76K | |
| Jack Johnson - Upsid..> | 2026-05-22 20:07 | 69K | |
| Jack Jersey - Sri La..> | 2026-05-22 19:40 | 26K | |
| Jack Jersey - Papa W..> | 2026-05-22 19:33 | 18K | |
| Jack Jersey - Me And..> | 2026-05-22 19:33 | 71K | |
| Jack Jersey - In The..> | 2026-05-22 19:33 | 101K | |
| Jack Ingram - Flutte..> | 2026-05-22 20:22 | 178K | |
| Jack Greene - You Ar..> | 2026-05-22 20:22 | 335K | |
| Jack Greene - There ..> | 2026-05-22 20:22 | 225K | |
| Jack Greene - Statue..> | 2026-05-22 20:22 | 298K | |
| Jack Greene - All th..> | 2026-05-22 20:22 | 329K | |
| Jaap Dekker Boogie S..> | 2026-05-22 19:33 | 75K | |
| Jaap Dekker Boogie S..> | 2026-05-22 19:33 | 68K | |
| J.j. Cale - Cocaine.jpg | 2026-05-22 19:33 | 207K | |
| J.j. Cale - Cajun Mo..> | 2026-05-22 19:33 | 261K | |
| J. Vincent Edwards -..> | 2026-05-22 20:37 | 16K | |
| J.J Cale - After Mid..> | 2026-05-22 19:57 | 53K | |
| J.J. Cale - After Mi..> | 2026-05-22 19:33 | 32K | |
| J. Geils Band - Free..> | 2026-05-22 20:07 | 65K | |
| J.Geils Band - Cente..> | 2026-05-22 20:07 | 45K | |
| J.D. Souther - You..> | 2026-05-22 20:22 | 31K | |
| Jürgen Marcus - Ein..> | 2026-05-22 20:07 | 50K | |
| Izabella - Shame Sha..> | 2026-05-22 19:57 | 104K | |
| Ivy League - Tossing..> | 2026-05-22 20:37 | 34K | |
| Ivor Raymonde Orches..> | 2026-05-22 20:37 | 4.3K | |
| Ivor Raymonde Orches..> | 2026-05-22 20:37 | 4.3K | |
| Ivor Raymonde Orches..> | 2026-05-22 20:37 | 4.3K | |
| Ivor Raymonde Orches..> | 2026-05-22 20:37 | 4.3K | |
| Ivor Raymonde Orches..> | 2026-05-22 20:37 | 4.3K | |
| Ivor Raymonde Orches..> | 2026-05-22 20:37 | 4.3K | |
| Ivor Raymonde Orches..> | 2026-05-22 20:37 | 4.3K | |
| Ivor Raimonde Orches..> | 2026-05-22 20:37 | 4.3K | |
| Ivor Raimonde Orches..> | 2026-05-22 20:37 | 4.3K | |
| Iveys - Maybe tomorr..> | 2026-05-22 20:37 | 35K | |
| Its time to crank it..> | 2026-05-22 19:29 | 3.1K | |
| Issey Cross - Bitter..> | 2026-05-22 20:07 | 358K | |
| Israel Kamakawiwo'ol..> | 2026-05-22 19:40 | 42K | |
| Israel Kamakawiwo'ol..> | 2026-05-22 20:37 | 65K | |
| Isley Jasper Isley -..> | 2026-05-22 20:37 | 44K | |
| Isley Brothers - Sum..> | 2026-05-22 19:33 | 60K | |
| Isley Brothers - Beh..> | 2026-05-22 20:37 | 36K | |
| Isaac Hayes - Theme ..> | 2026-05-22 19:33 | 316K | |
| Iron Maiden - Can I ..> | 2026-05-22 20:07 | 48K | |
| Iron Butterfly - In ..> | 2026-05-22 19:33 | 299K | |
| Iris Kroes - Foolish..> | 2026-05-22 20:07 | 89K | |
| Irene Moors & De Smu..> | 2026-05-22 19:57 | 21K | |
| Irene Cara - Flashda..> | 2026-05-22 19:40 | 37K | |
| Irene Cara - Fame.jpg | 2026-05-22 19:40 | 135K | |
| Inxs - Suicide Blond..> | 2026-05-22 19:57 | 36K | |
| Inxs - Original Sin.jpg | 2026-05-22 19:40 | 26K | |
| Inxs - New Sensation..> | 2026-05-22 19:40 | 55K | |
| Inxs - Never Tear Us..> | 2026-05-22 19:40 | 194K | |
| Inxs - Need You Toni..> | 2026-05-22 19:40 | 55K | |
| Inxs - Disappear.jpg | 2026-05-22 20:07 | 26K | |
| In the Mix (Helen).jpg | 2026-05-22 19:29 | 3.1K | |
| Internationals - You..> | 2026-05-22 19:33 | 286K | |
| Inner City - Good Li..> | 2026-05-22 19:57 | 31K | |
| Inner City - Good Li..> | 2026-05-22 19:57 | 72K | |
| Inner City - Big Fun..> | 2026-05-22 19:40 | 128K | |
| Inner Circle - Sweat..> | 2026-05-22 19:57 | 71K | |
| Inna Ft. Bob Taylor ..> | 2026-05-22 20:07 | 92K | |
| Inna Feat. Bob Taylo..> | 2026-05-22 20:07 | 49K | |
| Inna - Sun Is Up.jpg | 2026-05-22 20:06 | 20K | |
| Inna - Sun Is Up (Pl..> | 2026-05-22 20:06 | 65K | |
| Inna - Hot.jpg | 2026-05-22 20:06 | 59K | |
| Inna - Hot (Radio Ve..> | 2026-05-22 20:06 | 62K | |
| Ini Kamoze - Here Co..> | 2026-05-22 20:06 | 71K | |
| Ingrid Michaelson - ..> | 2026-05-22 20:06 | 182K | |
| Ingrid Michaelson - ..> | 2026-05-22 20:06 | 182K | |
| Ingrid - Stolen Danc..> | 2026-05-22 20:06 | 16K | |
| Indeep - Last Night ..> | 2026-05-22 19:40 | 30K | |
| Incredible Bongo Ban..> | 2026-05-22 19:33 | 144K | |
| Incognito Ft.. Jocel..> | 2026-05-22 19:57 | 55K | |
| Incognito - Don't Yo..> | 2026-05-22 19:57 | 104K | |
| In Tua Nua - Seven i..> | 2026-05-22 19:40 | 121K | |
| In-Grid - Tu Es Fout..> | 2026-05-22 20:06 | 37K | |
| Imanbek & BYOR - Bel..> | 2026-05-22 20:06 | 337K | |
| Imagine Dragons - Wh..> | 2026-05-22 20:06 | 26K | |
| Imagine Dragons - On..> | 2026-05-22 20:06 | 30K | |
| Imagine Dragons - De..> | 2026-05-22 20:06 | 30K | |
| Imagination - Music ..> | 2026-05-22 20:06 | 36K | |
| Imagination - Just A..> | 2026-05-22 20:06 | 74K | |
| Imagination - Body T..> | 2026-05-22 20:06 | 35K | |
| Imaani - Where Are Y..> | 2026-05-22 20:37 | 10K | |
| Ilse Delange - World..> | 2026-05-22 20:22 | 91K | |
| Ilse Delange -Winter..> | 2026-05-22 20:37 | 33K | |
| Ilse Delange - The L..> | 2026-05-22 20:06 | 74K | |
| Ilse Delange - The G..> | 2026-05-22 20:37 | 31K | |
| Ilse Delange - So In..> | 2026-05-22 20:37 | 31K | |
| Ilse Delange - Puzzl..> | 2026-05-22 20:06 | 55K | |
| Ilse Delange - Next ..> | 2026-05-22 20:06 | 31K | |
| Ilse Delange - Mirac..> | 2026-05-22 20:37 | 40K | |
| Ilse Delange - I Sti..> | 2026-05-22 20:06 | 31K | |
| Ilse Delange - I()m ..> | 2026-05-22 20:22 | 43K | |
| Ilse Delange - I()d ..> | 2026-05-22 20:22 | 43K | |
| Ilse Delange - I'm N..> | 2026-05-22 20:37 | 19K | |
| Ilse Delange - I'd B..> | 2026-05-22 19:57 | 43K | |
| Ilse Delange - Chang..> | 2026-05-22 20:37 | 56K | |
| Ilse DeLange - Hurri..> | 2026-05-22 20:37 | 33K | |
| Ilse DeLange - Blue ..> | 2026-05-22 20:37 | 35K | |
| Il Divo - You Raise ..> | 2026-05-22 20:37 | 31K | |
| Il Divo - Without Yo..> | 2026-05-22 20:37 | 31K | |
| Il Divo - Unbreak My..> | 2026-05-22 20:37 | 48K | |
| Il Divo - Time to Sa..> | 2026-05-22 20:37 | 37K | |
| Il Divo - The Power ..> | 2026-05-22 20:37 | 62K | |
| Il Divo - The Imposs..> | 2026-05-22 20:37 | 93K | |
| Il Divo - Somewhere.jpg | 2026-05-22 20:37 | 31K | |
| Il Divo - She.jpg | 2026-05-22 20:37 | 62K | |
| Il Divo - Pour que t..> | 2026-05-22 20:37 | 46K | |
| Il Divo - Passera.jpg | 2026-05-22 20:37 | 48K | |
| Il Divo - O Holy Nig..> | 2026-05-22 20:37 | 46K | |
| Il Divo - Nights in ..> | 2026-05-22 20:37 | 31K | |
| Il Divo - Nella Fant..> | 2026-05-22 20:37 | 48K | |
| Il Divo - My Way (A ..> | 2026-05-22 20:37 | 48K | |
| Il Divo - My Heart W..> | 2026-05-22 20:37 | 69K | |
| Il Divo - Mama.jpg | 2026-05-22 20:37 | 48K | |
| Il Divo - La vida si..> | 2026-05-22 20:37 | 31K | |
| Il Divo - I Will Alw..> | 2026-05-22 20:37 | 69K | |
| Il Divo - Heroe.jpg | 2026-05-22 20:37 | 46K | |
| Il Divo - Hallelujah..> | 2026-05-22 20:37 | 62K | |
| Il Divo - Everytime ..> | 2026-05-22 20:37 | 48K | |
| Il Divo - Don't Cry ..> | 2026-05-22 20:37 | 37K | |
| Il Divo - Crying (Ll..> | 2026-05-22 20:37 | 37K | |
| Il Divo - Caruso.jpg | 2026-05-22 20:37 | 20K | |
| Il Divo - Can't Help..> | 2026-05-22 20:37 | 69K | |
| Il Divo - Ave Maria.jpg | 2026-05-22 20:37 | 46K | |
| Il Divo - Amazing Gr..> | 2026-05-22 20:37 | 62K | |
| Il Divo - Alone (Sol..> | 2026-05-22 20:37 | 69K | |
| Il Divo - All by Mys..> | 2026-05-22 20:37 | 46K | |
| Il Divo - Adagio.jpg | 2026-05-22 20:37 | 62K | |
| Ike & Tina Turner - ..> | 2026-05-22 20:37 | 78K | |
| Ike & Tina Turner - ..> | 2026-05-22 19:33 | 54K | |
| Ike & Tina Turner - ..> | 2026-05-22 19:33 | 54K | |
| Iggy Pop - Real Wild..> | 2026-05-22 19:40 | 120K | |
| Iggy Pop - Lust For ..> | 2026-05-22 19:33 | 37K | |
| Iggy Pop & Kate Pier..> | 2026-05-22 19:57 | 182K | |
| Idols 2004 -I've Got..> | 2026-05-22 20:06 | 53K | |
| Icona pop - I love i..> | 2026-05-22 20:06 | 89K | |
| Icehouse - Hey Littl..> | 2026-05-22 19:40 | 44K | |
| Icehouse - Crazy.jpg | 2026-05-22 20:06 | 34K | |
| Ian Van Dahl - Castl..> | 2026-05-22 20:06 | 14K | |
| Ian Dury & the Block..> | 2026-05-22 19:33 | 51K | |
| Ian Dury & The Block..> | 2026-05-22 19:33 | 80K | |
| Ian Dury & The Block..> | 2026-05-22 19:33 | 20K | |
| Ian Carey Project -G..> | 2026-05-22 20:06 | 39K | |
| I'll Go Where The Mu..> | 2026-05-22 19:33 | 554K | |
| Hypaton; David Guett..> | 2026-05-22 20:06 | 49K | |
| Hypaton; David Guett..> | 2026-05-22 20:06 | 375K | |
| Hurricane Smith - Oh..> | 2026-05-22 19:33 | 119K | |
| Hunters - Russian sp..> | 2026-05-22 20:37 | 22K | |
| Hunters - Mr. Tambou..> | 2026-05-22 20:37 | 49K | |
| Human League - The L..> | 2026-05-22 19:40 | 21K | |
| Human League - Human..> | 2026-05-22 19:40 | 38K | |
| Human League - Don't..> | 2026-05-22 19:40 | 22K | |
| Hugues Aufray - Adie..> | 2026-05-22 20:37 | 43K | |
| Hugo Strasser - Letk..> | 2026-05-22 20:37 | 15K | |
| Hugo Montenegro and ..> | 2026-05-22 20:22 | 83K | |
| Hugo Montenegro - Th..> | 2026-05-22 20:37 | 83K | |
| Hugh Barrett - Deser..> | 2026-05-22 20:22 | 128K | |
| Huey Lewis And The N..> | 2026-05-22 19:40 | 95K | |
| Huey Lewis & The New..> | 2026-05-22 19:40 | 95K | |
| Huey Lewis & The New..> | 2026-05-22 19:40 | 95K | |
| Huey Lewis & The New..> | 2026-05-22 19:40 | 12K | |
| Hues Corporation - R..> | 2026-05-22 19:33 | 168K | |
| Hues Corporation - L..> | 2026-05-22 19:33 | 156K | |
| Hu & Hilltops - Cry ..> | 2026-05-22 20:37 | 28K | |
| Hozier - Take Me to ..> | 2026-05-22 20:06 | 69K | |
| Howard Jones - What ..> | 2026-05-22 20:37 | 35K | |
| Howard Jones - Life ..> | 2026-05-22 19:40 | 33K | |
| Howard Jones - Hide ..> | 2026-05-22 19:40 | 29K | |
| Housemartins - Happy..> | 2026-05-22 20:06 | 31K | |
| Houseband - Don't Lo..> | 2026-05-22 19:33 | 423K | |
| Houseband - Dancing ..> | 2026-05-22 19:33 | 423K | |
| House Rockerz - Herz..> | 2026-05-22 20:06 | 112K | |
| House Rockerz - Herz..> | 2026-05-22 20:06 | 51K | |
| House Of Pain - Jump..> | 2026-05-22 19:57 | 35K | |
| Hotcha Trio - The Ga..> | 2026-05-22 19:57 | 63K | |
| Hot Chocolate - You ..> | 2026-05-22 19:33 | 86K | |
| Hot Chocolate - So Y..> | 2026-05-22 19:33 | 42K | |
| Hot Chocolate - It S..> | 2026-05-22 19:40 | 23K | |
| Hot Chocolate - I'll..> | 2026-05-22 19:40 | 1.4M | |
| Hot Chocolate - Girl..> | 2026-05-22 19:40 | 23K | |
| Hot Chocolate - Ever..> | 2026-05-22 19:33 | 257K | |
| Hot Chocolate - Emma..> | 2026-05-22 19:33 | 149K | |
| Hot Butter - Popcorn..> | 2026-05-22 19:33 | 32K | |
| Horst Jankowski & Hi..> | 2026-05-22 19:57 | 82K | |
| Hootie & The Blowfis..> | 2026-05-22 19:57 | 49K | |
| Hooters - Satellite.jpg | 2026-05-22 19:40 | 106K | |
| Hoobastank - The Rea..> | 2026-05-22 20:06 | 33K | |
| Honeycombs - That's ..> | 2026-05-22 20:37 | 382K | |
| Honeybus - I can't l..> | 2026-05-22 20:37 | 52K | |
| Hollywood Beyond - W..> | 2026-05-22 19:40 | 65K | |
| Holly Johnson - Amer..> | 2026-05-22 19:40 | 55K | |
| Holly Dunn - You Rea..> | 2026-05-22 20:22 | 353K | |
| Holly Dunn - There G..> | 2026-05-22 20:22 | 177K | |
| Holly Dunn - Strange..> | 2026-05-22 20:22 | 363K | |
| Holly Dunn - Love So..> | 2026-05-22 20:22 | 186K | |
| Holly Dunn - Daddy's..> | 2026-05-22 20:22 | 302K | |
| Holly Dunn - Are You..> | 2026-05-22 20:22 | 162K | |
| Hollis P Monroe - I'..> | 2026-05-22 19:57 | 70K | |
| Hollies - The Day Th..> | 2026-05-22 20:37 | 39K | |
| Hollies - The Baby.jpg | 2026-05-22 19:33 | 140K | |
| Hollies - The Air Th..> | 2026-05-22 20:37 | 44K | |
| Hollies - Stop, Stop..> | 2026-05-22 20:37 | 56K | |
| Hollies - Sorry suza..> | 2026-05-22 20:37 | 92K | |
| Hollies - Sandy (4th..> | 2026-05-22 19:33 | 242K | |
| Hollies - On a carou..> | 2026-05-22 20:37 | 32K | |
| Hollies - Long Cool ..> | 2026-05-22 19:33 | 380K | |
| Hollies - Jennifer E..> | 2026-05-22 20:37 | 75K | |
| Hollies - I'm alive.jpg | 2026-05-22 20:37 | 95K | |
| Hollies - He ain't h..> | 2026-05-22 20:37 | 92K | |
| Hollies - Carrie Ann..> | 2026-05-22 20:37 | 239K | |
| Hollies - Bus Stop.jpg | 2026-05-22 20:37 | 39K | |
| Holland - Hans Brink..> | 2026-05-22 19:33 | 348K | |
| Hobbyhorse - Summert..> | 2026-05-22 19:33 | 47K | |
| Hithouse - Move Your..> | 2026-05-22 19:40 | 43K | |
| Hit Intro Montage - ..> | 2026-05-22 19:29 | 3.1K | |
| Hillside SIngers - I..> | 2026-05-22 19:33 | 12K | |
| Highwaymen - Michael..> | 2026-05-22 20:37 | 65K | |
| Highway 101 - Who's ..> | 2026-05-22 20:22 | 241K | |
| Highway 101 - Whiske..> | 2026-05-22 20:22 | 130K | |
| Highway 101 - Walkin..> | 2026-05-22 20:22 | 241K | |
| Highway 101 - The Be..> | 2026-05-22 20:22 | 130K | |
| Highway 101 - Somewh..> | 2026-05-22 20:22 | 94K | |
| Highway 101 - Honkey..> | 2026-05-22 20:22 | 232K | |
| Highway 101 - Cry, C..> | 2026-05-22 20:22 | 130K | |
| Highway 101 - Bing B..> | 2026-05-22 20:22 | 223K | |
| Highway 101 - All th..> | 2026-05-22 20:22 | 232K | |
| Highway 101 - (Do Yo..> | 2026-05-22 20:22 | 232K | |
| Highlight - One One ..> | 2026-05-22 19:33 | 101K | |
| Hervé Vilard - Capr..> | 2026-05-22 20:37 | 78K | |
| Herrey's - Diggi Loo..> | 2026-05-22 19:40 | 48K | |
| Hermes House Band In..> | 2026-05-22 20:06 | 78K | |
| Hermes House Band - ..> | 2026-05-22 19:57 | 38K | |
| Herman Brood - My Wa..> | 2026-05-22 20:06 | 16K | |
| Herman Brood & Wild ..> | 2026-05-22 19:57 | 46K | |
| Herman Brood & His W..> | 2026-05-22 19:33 | 225K | |
| Herman Brood & His W..> | 2026-05-22 19:33 | 22K | |
| Herman's Hermits - T..> | 2026-05-22 20:37 | 12K | |
| Herman's Hermits - N..> | 2026-05-22 20:37 | 75K | |
| Herman's Hermits - M..> | 2026-05-22 20:37 | 42K | |
| Herman's Hermits - I..> | 2026-05-22 20:37 | 350K | |
| Herman's Hermits - I..> | 2026-05-22 20:37 | 345K | |
| Herman's Hermits - D..> | 2026-05-22 20:37 | 29K | |
| Herd - From the unde..> | 2026-05-22 20:37 | 47K | |
| Herbie Hancock - Roc..> | 2026-05-22 19:40 | 76K | |
| Herbert Grönemeyer ..> | 2026-05-22 19:57 | 19K | |
| Herb Alpert & the Ti..> | 2026-05-22 20:37 | 66K | |
| Herb Alpert & the Ti..> | 2026-05-22 20:37 | 66K | |
| Herb Alpert & the Ti..> | 2026-05-22 20:37 | 36K | |
| Herb Alpert & The Ti..> | 2026-05-22 20:37 | 73K | |
| Herb Alpert & The Ti..> | 2026-05-22 20:37 | 45K | |
| Herb Alpert & The Ti..> | 2026-05-22 20:37 | 38K | |
| Herb Alpert & The Ti..> | 2026-05-22 20:37 | 38K | |
| Herb Alpert & Janet ..> | 2026-05-22 19:57 | 85K | |
| Hep Stars - The Musi..> | 2026-05-22 20:37 | 1.1M | |
| Hep Stars - Sunny Gi..> | 2026-05-22 19:57 | 48K | |
| Henson Cargill - Ski..> | 2026-05-22 20:22 | 351K | |
| Henson Cargill - Lov..> | 2026-05-22 20:22 | 127K | |
| Henson Cargill - Alw..> | 2026-05-22 20:22 | 248K | |
| Henry Thomas - Old C..> | 2026-05-22 20:22 | 244K | |
| Henry Mancini - The ..> | 2026-05-22 19:57 | 111K | |
| Henry Mancini - Moon..> | 2026-05-22 20:37 | 60K | |
| Henny Huisman En Sou..> | 2026-05-22 19:40 | 106K | |
| Helmut Lotti - Wonde..> | 2026-05-22 20:37 | 36K | |
| Helmut Lotti - What ..> | 2026-05-22 20:37 | 36K | |
| Helmut Lotti - So Yo..> | 2026-05-22 20:37 | 36K | |
| Helmut Lotti - Purpl..> | 2026-05-22 20:37 | 36K | |
| Helmut Lotti - No Mo..> | 2026-05-22 20:37 | 36K | |
| Helmut Lotti - My Gi..> | 2026-05-22 20:37 | 72K | |
| Helmut Lotti - If Yo..> | 2026-05-22 20:37 | 36K | |
| Helmut Lotti - If I ..> | 2026-05-22 20:37 | 72K | |
| Helmut Lotti - I Hea..> | 2026-05-22 20:37 | 72K | |
| Helmut Lotti - I´d ..> | 2026-05-22 20:37 | 72K | |
| Helmut Lotti - Halle..> | 2026-05-22 20:37 | 72K | |
| Helmut Lotti - Funic..> | 2026-05-22 20:37 | 195K | |
| Helmut Lotti - Easy.jpg | 2026-05-22 20:37 | 72K | |
| Helmut Lotti - Down ..> | 2026-05-22 20:37 | 36K | |
| Helmut Lotti - Bring..> | 2026-05-22 20:37 | 36K | |
| Helmut Lotti - A Bea..> | 2026-05-22 20:37 | 72K | |
| Helen Shapiro - You ..> | 2026-05-22 20:37 | 303K | |
| Helen Shapiro - Walk..> | 2026-05-22 20:37 | 41K | |
| Helen Shapiro - Walk..> | 2026-05-22 20:37 | 100K | |
| Helen Shapiro - Quee..> | 2026-05-22 20:37 | 41K | |
| Helen Reddy - I Don'..> | 2026-05-22 19:33 | 89K | |
| Helène Fischer - At..> | 2026-05-22 20:06 | 27K | |
| Heinz Schachtner - I..> | 2026-05-22 20:37 | 18K | |
| Heino - La Montanara..> | 2026-05-22 19:40 | 470K | |
| Heavy D & The Boyz -..> | 2026-05-22 19:57 | 54K | |
| Heaven 17 - Temptati..> | 2026-05-22 20:06 | 48K | |
| Heaven 17 - Temptati..> | 2026-05-22 19:40 | 96K | |
| Heaven 17 - Temptati..> | 2026-05-22 19:57 | 46K | |
| Heatwave - Boogie ni..> | 2026-05-22 19:33 | 127K | |
| Heart - These Dreams..> | 2026-05-22 20:37 | 18K | |
| Heart - Magic Man.jpg | 2026-05-22 19:33 | 202K | |
| Heart - Crazy On You..> | 2026-05-22 19:33 | 209K | |
| Heart - Alone.jpg | 2026-05-22 19:40 | 14K | |
| Heart - All I Wanna ..> | 2026-05-22 19:40 | 29K | |
| Hear This.jpg | 2026-05-22 19:29 | 3.1K | |
| Hayseed Dixie - Stra..> | 2026-05-22 20:22 | 95K | |
| Hayseed Dixie - Duel..> | 2026-05-22 20:22 | 19K | |
| Hawkwind - Silver Ma..> | 2026-05-22 19:33 | 892K | |
| Hawaiians - Music to..> | 2026-05-22 20:37 | 518K | |
| Hawaiians - Caravan.jpg | 2026-05-22 20:37 | 518K | |
| Hawaiians - A Walk i..> | 2026-05-22 20:37 | 518K | |
| Hatfield's End - Voi..> | 2026-05-22 20:37 | 32K | |
| Hatfield's End - The..> | 2026-05-22 20:37 | 32K | |
| Hatfield's End - The..> | 2026-05-22 20:37 | 32K | |
| Hatfield's End - Sun..> | 2026-05-22 20:37 | 32K | |
| Hatfield's End - Sho..> | 2026-05-22 20:37 | 32K | |
| Hatfield's End - Rui..> | 2026-05-22 20:37 | 32K | |
| Hatfield's End - Mid..> | 2026-05-22 20:37 | 32K | |
| Hatfield's End - Mid..> | 2026-05-22 20:37 | 32K | |
| Hatfield's End - Los..> | 2026-05-22 20:37 | 32K | |
| Hatfield's End - Lon..> | 2026-05-22 20:37 | 32K | |
| Hatfield's End - Ent..> | 2026-05-22 20:37 | 32K | |
| Harry Thumann - Unde..> | 2026-05-22 19:40 | 56K | |
| Harry Styles - Water..> | 2026-05-22 20:06 | 25K | |
| Harry Styles - Sign ..> | 2026-05-22 20:06 | 31K | |
| Harry Styles - Golde..> | 2026-05-22 20:06 | 25K | |
| Harry Styles - Adore..> | 2026-05-22 20:06 | 25K | |
| Harry Secombe - This..> | 2026-05-22 20:37 | 6.7K | |
| Harry Nilsson - With..> | 2026-05-22 19:33 | 223K | |
| Harry Nilsson - Ever..> | 2026-05-22 20:37 | 74K | |
| Harry Chapin - W.O.L..> | 2026-05-22 19:33 | 44K | |
| Harry Chapin - Cat's..> | 2026-05-22 19:33 | 234K | |
| Harry Belfonte & Ode..> | 2026-05-22 20:37 | 42K | |
| Harry Belafonte - Tr..> | 2026-05-22 20:37 | 49K | |
| Harry Belafonte - Ma..> | 2026-05-22 19:57 | 25K | |
| Harry Belafonte - Ja..> | 2026-05-22 20:37 | 33K | |
| Harry Belafonte - Is..> | 2026-05-22 19:57 | 25K | |
| Harry Belafonte - Co..> | 2026-05-22 19:57 | 35K | |
| Harry Belafonte - Ba..> | 2026-05-22 20:37 | 60K | |
| Harry Belafonte & Je..> | 2026-05-22 19:40 | 28K | |
| Harris & Ford - 99 L..> | 2026-05-22 20:06 | 361K | |
| Harpo - Moviestar.jpg | 2026-05-22 19:33 | 31K | |
| Harold Melvin & the ..> | 2026-05-22 19:33 | 23K | |
| Harold Melvin & The ..> | 2026-05-22 19:57 | 22K | |
| Harold Melvin & The ..> | 2026-05-22 19:33 | 689K | |
| Harold Faltermeyer -..> | 2026-05-22 19:40 | 70K | |
| HardwellMetallica - ..> | 2026-05-22 20:06 | 15K | |
| Hardwell Ft. Metalli..> | 2026-05-22 20:06 | 46K | |
| Hardwell - Cobra.jpg | 2026-05-22 20:06 | 266K | |
| Happy Groover - When..> | 2026-05-22 19:57 | 48K | |
| Hanson - Mmmbop.jpg | 2026-05-22 19:57 | 192K | |
| Hansi Hinterseer - H..> | 2026-05-22 20:06 | 111K | |
| Hannah Laing & RoRo ..> | 2026-05-22 20:06 | 279K | |
| Hank the Knife & the..> | 2026-05-22 19:33 | 417K | |
| Hank the Knife & the..> | 2026-05-22 20:21 | 46K | |
| Hank Williams Jr. - ..> | 2026-05-22 20:21 | 184K | |
| Hank Williams - Jamb..> | 2026-05-22 20:21 | 205K | |
| Hank Williams - Jamb..> | 2026-05-22 20:37 | 29K | |
| Hank Williams - I He..> | 2026-05-22 20:06 | 50K | |
| Hank Williams - Hey ..> | 2026-05-22 20:21 | 204K | |
| Hank Williams - Hey,..> | 2026-05-22 20:21 | 245K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:22 | 431K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 260K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 201K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 253K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 261K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 260K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 253K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 217K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 106K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 201K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 289K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 260K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 260K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 260K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 484K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 260K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 106K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 261K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 485K | |
| Hank Williams, Jr. -..> | 2026-05-22 20:21 | 261K | |
| Hank The Knife And T..> | 2026-05-22 20:21 | 294K | |
| Hank The Knife & The..> | 2026-05-22 20:21 | 1.0M | |
| Hank The Knife & The..> | 2026-05-22 19:32 | 128K | |
| Hank The Knife & Cra..> | 2026-05-22 19:40 | 37K | |
| Hank Snow - Miller()..> | 2026-05-22 20:21 | 421K | |
| Hank Snow - Doggone ..> | 2026-05-22 20:21 | 164K | |
| Hank Snow - Chasin()..> | 2026-05-22 20:21 | 13K | |
| Hank Snow - A Fool S..> | 2026-05-22 20:21 | 108K | |
| Hank Mizell - Jungle..> | 2026-05-22 19:32 | 295K | |
| Hank Marvin - When Y..> | 2026-05-22 20:21 | 293K | |
| Hank Locklin - Send ..> | 2026-05-22 20:21 | 42K | |
| Hank Locklin - Pleas..> | 2026-05-22 20:37 | 57K | |
| Hank Locklin - Pleas..> | 2026-05-22 20:21 | 51K | |
| Hank Locklin - Pleas..> | 2026-05-22 20:21 | 405K | |
| Hank Locklin - Let M..> | 2026-05-22 20:21 | 93K | |
| Handsome Poets - Sky..> | 2026-05-22 20:06 | 41K | |
| Hancock Herbie - Roc..> | 2026-05-22 19:40 | 8.3K | |
| Hammond & West - Giv..> | 2026-05-22 19:40 | 80K | |
| Hamilton Bohannon - ..> | 2026-05-22 19:32 | 154K | |
| Hamilton Bohannon - ..> | 2026-05-22 19:32 | 33K | |
| Hall And Oates - Out..> | 2026-05-22 19:40 | 78K | |
| Hall And Oates - Adu..> | 2026-05-22 19:40 | 17K | |
| Hall & Oats - Rich G..> | 2026-05-22 19:32 | 250K | |
| Hall & Oates - Manea..> | 2026-05-22 19:40 | 77K | |
| Hall & Oates - Kiss ..> | 2026-05-22 19:40 | 48K | |
| Hall & Oates - I Can..> | 2026-05-22 19:40 | 32K | |
| Hal Ketchum - Sure L..> | 2026-05-22 20:21 | 210K | |
| Hal Ketchum - Small ..> | 2026-05-22 20:21 | 207K | |
| Hal Ketchum - Past T..> | 2026-05-22 20:21 | 207K | |
| Hal Ketchum - Hearts..> | 2026-05-22 20:21 | 210K | |
| Hal Ketchum - Five O..> | 2026-05-22 20:21 | 207K | |
| Haiducii - Dragostea..> | 2026-05-22 20:06 | 80K | |
| Haddaway - What Is L..> | 2026-05-22 19:57 | 85K | |
| Haddaway - Life.jpg | 2026-05-22 19:57 | 85K | |
| Haddaway - I miss yo..> | 2026-05-22 20:37 | 85K | |
| Haddaway - I Miss Yo..> | 2026-05-22 19:57 | 85K | |
| Gwen Stefani Ft. Ako..> | 2026-05-22 20:06 | 43K | |
| Gwen Stefani Feat. E..> | 2026-05-22 20:06 | 71K | |
| Gwen Stefani - Baby ..> | 2026-05-22 20:06 | 75K | |
| Gwen Mccrae - Keep T..> | 2026-05-22 19:57 | 59K | |
| Gwen Mccrae - Keep T..> | 2026-05-22 19:40 | 69K | |
| Gwen Guthrie - Ain't..> | 2026-05-22 19:40 | 35K | |
| Guys 'n Dolls - You ..> | 2026-05-22 19:32 | 30K | |
| Guys 'n' Dolls - How..> | 2026-05-22 19:32 | 67K | |
| Guys 'n' Dolls - Ang..> | 2026-05-22 19:32 | 298K | |
| Guys 'N Dolls - You'..> | 2026-05-22 19:32 | 30K | |
| Guys 'N Dolls - Ther..> | 2026-05-22 19:32 | 30K | |
| Guys 'N Dolls - Some..> | 2026-05-22 19:32 | 30K | |
| Guys 'N' Dolls - Our..> | 2026-05-22 19:40 | 45K | |
| Guy Sebastian - Be..> | 2026-05-22 20:06 | 34K | |
| Guy Mitchell - Singi..> | 2026-05-22 19:57 | 58K | |
| Guy Mitchell - Pitts..> | 2026-05-22 19:57 | 54K | |
| Guy Mitchell - My Tr..> | 2026-05-22 19:40 | 174K | |
| Guy Mitchell - Heart..> | 2026-05-22 20:21 | 277K | |
| Guy Mitchell & Ray C..> | 2026-05-22 20:21 | 203K | |
| Guy Fletcher - Mary ..> | 2026-05-22 19:32 | 122K | |
| Gusttavo Lima - Bala..> | 2026-05-22 20:06 | 57K | |
| Guru Josh Project - ..> | 2026-05-22 20:06 | 100K | |
| Guru Josh Project, T..> | 2026-05-22 20:06 | 31K | |
| Guru Josh - Infinity..> | 2026-05-22 19:40 | 67K | |
| Guns N' Roses - Swee..> | 2026-05-22 19:40 | 23K | |
| Guns N' Roses - Swee..> | 2026-05-22 19:57 | 60K | |
| Guns N' Roses - Pati..> | 2026-05-22 19:40 | 60K | |
| Guns N' Roses - Nove..> | 2026-05-22 19:57 | 58K | |
| Guns N' Roses - Live..> | 2026-05-22 19:57 | 58K | |
| Guns 'N Roses - Para..> | 2026-05-22 19:40 | 60K | |
| Guns 'N Roses - Knoc..> | 2026-05-22 19:57 | 48K | |
| Guilliano, Anita Mey..> | 2026-05-22 20:06 | 123K | |
| Guess Who - Dancin' ..> | 2026-05-22 19:32 | 348K | |
| Guess Who -Clap For ..> | 2026-05-22 19:32 | 18K | |
| Guess Who, The - Ame..> | 2026-05-22 19:32 | 94K | |
| Guesch Patti - Etien..> | 2026-05-22 19:40 | 58K | |
| Gudrun Jankis - Let ..> | 2026-05-22 19:40 | 17K | |
| Gruppo Sportivo - He..> | 2026-05-22 19:57 | 46K | |
| Gruppo Sportivo - Di..> | 2026-05-22 19:32 | 244K | |
| Grover Washington Ju..> | 2026-05-22 19:40 | 39K | |
| Grover Washington Jr..> | 2026-05-22 20:37 | 90K | |
| Groove Coverage - Go..> | 2026-05-22 20:06 | 37K | |
| Groove Armada - My F..> | 2026-05-22 20:06 | 17K | |
| Greyhound - Black & ..> | 2026-05-22 19:32 | 19K | |
| Gretchen Wilson - Re..> | 2026-05-22 20:21 | 47K | |
| Gregory Abbott - Sha..> | 2026-05-22 19:40 | 37K | |
| Gregorian - Wonderwa..> | 2026-05-22 20:37 | 76K | |
| Gregorian - With Or ..> | 2026-05-22 20:37 | 54K | |
| Gregorian - Wicked G..> | 2026-05-22 20:37 | 38K | |
| Gregorian - Who Want..> | 2026-05-22 20:37 | 56K | |
| Gregorian - When A M..> | 2026-05-22 20:37 | 54K | |
| Gregorian - Voyage V..> | 2026-05-22 20:37 | 54K | |
| Gregorian - Vienna.jpg | 2026-05-22 20:37 | 54K | |
| Gregorian - The Soun..> | 2026-05-22 20:37 | 54K | |
| Gregorian - The Rose..> | 2026-05-22 20:37 | 56K | |
| Gregorian - The Firs..> | 2026-05-22 20:37 | 54K | |
| Gregorian - Tears In..> | 2026-05-22 20:37 | 54K | |
| Gregorian - Sweet Ch..> | 2026-05-22 20:37 | 41K | |
| Gregorian - Streets ..> | 2026-05-22 20:37 | 76K | |
| Gregorian - Stairway..> | 2026-05-22 20:37 | 54K | |
| Gregorian - Send Me ..> | 2026-05-22 20:37 | 42K | |
| Gregorian - Sebastia..> | 2026-05-22 20:37 | 54K | |
| Gregorian - Scarboro..> | 2026-05-22 20:37 | 54K | |
| Gregorian - Save A P..> | 2026-05-22 20:37 | 44K | |
| Gregorian - Sacrific..> | 2026-05-22 20:37 | 54K | |
| Gregorian - Running ..> | 2026-05-22 20:37 | 41K | |
| Gregorian - Pride (I..> | 2026-05-22 20:37 | 76K | |
| Gregorian - Only You..> | 2026-05-22 20:37 | 38K | |
| Gregorian - One Of U..> | 2026-05-22 20:37 | 41K | |
| Gregorian - Nothing ..> | 2026-05-22 20:37 | 54K | |
| Gregorian - My Immor..> | 2026-05-22 20:37 | 35K | |
| Gregorian - Maid Of ..> | 2026-05-22 20:37 | 54K | |
| Gregorian - Mad Worl..> | 2026-05-22 20:37 | 41K | |
| Gregorian - Losing M..> | 2026-05-22 20:37 | 54K | |
| Gregorian - Lady D'A..> | 2026-05-22 20:36 | 54K | |
| Gregorian - Imagine.jpg | 2026-05-22 20:36 | 32K | |
| Gregorian - I Still ..> | 2026-05-22 20:36 | 54K | |
| Gregorian - I'll Fin..> | 2026-05-22 20:36 | 54K | |
| Gregorian - Hurt.jpg | 2026-05-22 20:36 | 35K | |
| Gregorian - Hide And..> | 2026-05-22 20:36 | 54K | |
| Gregorian - Heaven.jpg | 2026-05-22 20:36 | 76K | |
| Gregorian - Greensle..> | 2026-05-22 20:36 | 41K | |
| Gregorian - Fields O..> | 2026-05-22 20:36 | 54K | |
| Gregorian - Fade To ..> | 2026-05-22 20:36 | 54K | |
| Gregorian - Everythi..> | 2026-05-22 20:36 | 76K | |
| Gregorian - Everybod..> | 2026-05-22 20:36 | 54K | |
| Gregorian - Enjoy Th..> | 2026-05-22 20:36 | 41K | |
| Gregorian - Engel.jpg | 2026-05-22 20:36 | 35K | |
| Gregorian - Don't Gi..> | 2026-05-22 20:36 | 54K | |
| Gregorian - Clocks.jpg | 2026-05-22 20:36 | 54K | |
| Gregorian - Child in..> | 2026-05-22 20:36 | 54K | |
| Gregorian - Chasing ..> | 2026-05-22 20:36 | 41K | |
| Gregorian - Brothers..> | 2026-05-22 20:36 | 54K | |
| Gregorian - Bridge O..> | 2026-05-22 20:36 | 54K | |
| Gregorian - Boulevar..> | 2026-05-22 20:36 | 42K | |
| Gregorian - Blue Mon..> | 2026-05-22 20:36 | 54K | |
| Gregorian - Believe ..> | 2026-05-22 20:36 | 41K | |
| Gregorian - Be.jpg | 2026-05-22 20:36 | 54K | |
| Gregorian - A Whiter..> | 2026-05-22 20:36 | 41K | |
| Gregor Salto & Kaoma..> | 2026-05-22 20:06 | 50K | |
| Gregor Salto & Kaoma..> | 2026-05-22 20:06 | 38K | |
| Greg Kihn Band - Jeo..> | 2026-05-22 19:40 | 14K | |
| Greenfield & Cook - ..> | 2026-05-22 20:36 | 40K | |
| Greenfield & Cook - ..> | 2026-05-22 19:32 | 19K | |
| Green Day - Wake Me ..> | 2026-05-22 20:06 | 33K | |
| Green Day - Boulevar..> | 2026-05-22 20:06 | 72K | |
| Green Day - Basket C..> | 2026-05-22 20:06 | 91K | |
| Great Big Sea - It..> | 2026-05-22 20:21 | 117K | |
| Grease Soundtrack - ..> | 2026-05-22 19:32 | 6.2K | |
| Grapefruit - Deep Wa..> | 2026-05-22 20:36 | 240K | |
| Grant & Forsyth - Yo..> | 2026-05-22 19:40 | 372K | |
| Grant & Forsyth - Yo..> | 2026-05-22 20:21 | 372K | |
| Grant & Forsyth - Tu..> | 2026-05-22 20:21 | 91K | |
| Grant & Forsyth - To..> | 2026-05-22 20:21 | 45K | |
| Grant & Forsyth - To..> | 2026-05-22 19:57 | 45K | |
| Grant & Forsyth - Th..> | 2026-05-22 19:40 | 372K | |
| Grant & Forsyth - Th..> | 2026-05-22 20:21 | 372K | |
| Grant & Forsyth - So..> | 2026-05-22 19:57 | 45K | |
| Grant & Forsyth - La..> | 2026-05-22 19:57 | 19K | |
| Grant & Forsyth - Dr..> | 2026-05-22 19:57 | 372K | |
| Grant & Forsyth - An..> | 2026-05-22 20:36 | 136K | |
| Grandmaster Flash -T..> | 2026-05-22 19:40 | 48K | |
| Grandmaster Flash & ..> | 2026-05-22 19:57 | 41K | |
| Grandmaster Flash & ..> | 2026-05-22 19:40 | 62K | |
| Grandmaster Chicken ..> | 2026-05-22 19:40 | 298K | |
| Grand Funk Railroad ..> | 2026-05-22 19:32 | 209K | |
| Grace Jones - Victor..> | 2026-05-22 19:40 | 87K | |
| Grace Jones - Slave ..> | 2026-05-22 19:40 | 29K | |
| Grace Jones - Pull U..> | 2026-05-22 19:40 | 32K | |
| Grace Jones - Nipple..> | 2026-05-22 19:40 | 18K | |
| Grace Jones - La Vie..> | 2026-05-22 19:32 | 144K | |
| Grace Jones - I've S..> | 2026-05-22 19:40 | 45K | |
| Gotye Ft. Kimbra - S..> | 2026-05-22 20:36 | 35K | |
| Gotye; FISHER; Chris..> | 2026-05-22 20:06 | 36K | |
| Gotye; FISHER; Chris..> | 2026-05-22 20:06 | 319K | |
| Gotye - Somebody Tha..> | 2026-05-22 20:06 | 203K | |
| Gottlieb Wendehals -..> | 2026-05-22 19:40 | 54K | |
| Gordon McRae - I've ..> | 2026-05-22 20:36 | 52K | |
| Gordon Lightfoot - I..> | 2026-05-22 20:36 | 32K | |
| Gordon Franks Orches..> | 2026-05-22 20:36 | 33K | |
| Gordon Franks Orches..> | 2026-05-22 20:36 | 33K | |
| Gordon Franks Orches..> | 2026-05-22 20:36 | 33K | |
| Gordon Franks Orches..> | 2026-05-22 20:36 | 33K | |
| Gordon Franks Orches..> | 2026-05-22 20:36 | 33K | |
| Gordon Franks Orches..> | 2026-05-22 20:36 | 33K | |
| Gordon Franks Orches..> | 2026-05-22 20:36 | 33K | |
| Gordon Franks Orches..> | 2026-05-22 20:36 | 33K | |
| Gordon Franks Orches..> | 2026-05-22 20:36 | 33K | |
| Gordon Franks & his ..> | 2026-05-22 20:36 | 33K | |
| Gordon Franks & his ..> | 2026-05-22 20:36 | 33K | |
| Gordon Franks & his ..> | 2026-05-22 20:36 | 33K | |
| Goombay Dance Band -..> | 2026-05-22 19:32 | 25K | |
| Goombay Dance Band -..> | 2026-05-22 19:40 | 479K | |
| Goombay Dance Band, ..> | 2026-05-22 19:40 | 50K | |
| Good music needs to ..> | 2026-05-22 19:29 | 3.1K | |
| Good Brothers - Fox ..> | 2026-05-22 20:36 | 43K | |
| Goo Goo Dolls - Iris..> | 2026-05-22 19:57 | 32K | |
| Gompie - Alice, Who ..> | 2026-05-22 19:57 | 48K | |
| Goldfrapp - Rocket (..> | 2026-05-22 20:06 | 34K | |
| Golden Earrings - Pl..> | 2026-05-22 20:36 | 52K | |
| Golden Earrings - Da..> | 2026-05-22 20:36 | 47K | |
| Golden Earring - Whe..> | 2026-05-22 19:40 | 65K | |
| Golden Earring - Wee..> | 2026-05-22 19:32 | 39K | |
| Golden Earring - Twi..> | 2026-05-22 19:40 | 37K | |
| Golden Earring - Tha..> | 2026-05-22 20:36 | 43K | |
| Golden Earring - Sou..> | 2026-05-22 20:36 | 61K | |
| Golden Earring - Rad..> | 2026-05-22 19:32 | 35K | |
| Golden Earring -Rada..> | 2026-05-22 19:32 | 35K | |
| Golden Earring - Rad..> | 2026-05-22 19:57 | 35K | |
| Golden Earring - Jus..> | 2026-05-22 20:36 | 43K | |
| Golden Earring - I C..> | 2026-05-22 19:57 | 39K | |
| Golden Earring - Goi..> | 2026-05-22 19:57 | 48K | |
| Golden Earring - Don..> | 2026-05-22 20:36 | 54K | |
| Golden Earring - Bom..> | 2026-05-22 19:32 | 31K | |
| Golden Earring - Bac..> | 2026-05-22 19:57 | 80K | |
| Golden Earring - Ano..> | 2026-05-22 20:36 | 58K | |
| Godley & Creme - Cry..> | 2026-05-22 19:40 | 54K | |
| Godley & Creme - An ..> | 2026-05-22 19:40 | 106K | |
| Godley & Creme - A L..> | 2026-05-22 19:40 | 122K | |
| Go West - We Close O..> | 2026-05-22 19:40 | 64K | |
| Gnarls Barkley - Cra..> | 2026-05-22 20:36 | 63K | |
| Gloria Gaynor - Walk..> | 2026-05-22 19:32 | 28K | |
| Gloria Gaynor - Reac..> | 2026-05-22 19:32 | 113K | |
| Gloria Gaynor - Neve..> | 2026-05-22 19:32 | 28K | |
| Gloria Gaynor - I Wi..> | 2026-05-22 19:32 | 17K | |
| Gloria Gaynor - I Am..> | 2026-05-22 19:40 | 63K | |
| Gloria Estefan - Her..> | 2026-05-22 19:57 | 61K | |
| Gloria Estefan - Get..> | 2026-05-22 19:57 | 61K | |
| Gloria Estefan - Cut..> | 2026-05-22 20:36 | 61K | |
| Gloria Estefan & The..> | 2026-05-22 19:40 | 43K | |
| Gloria Estefan & The..> | 2026-05-22 19:40 | 43K | |
| Gloria Estefan & The..> | 2026-05-22 19:40 | 43K | |
| Gloria Estefan & The..> | 2026-05-22 19:40 | 43K | |
| Gloria Estefan & Mia..> | 2026-05-22 19:40 | 32K | |
| Gloria Estefan & Mia..> | 2026-05-22 19:40 | 36K | |
| Gloria Estefan & Mia..> | 2026-05-22 19:40 | 61K | |
| Gloria Estefan & Mia..> | 2026-05-22 19:40 | 32K | |
| Gloria Estefan & Mia..> | 2026-05-22 19:40 | 32K | |
| Gloria Estefan & Mia..> | 2026-05-22 19:57 | 55K | |
| Gloria - The last se..> | 2026-05-22 20:36 | 108K | |
| Global RockerzMichae..> | 2026-05-22 20:06 | 34K | |
| Global Rockerz, Mich..> | 2026-05-22 20:06 | 935K | |
| Global Deejays - Wha..> | 2026-05-22 20:06 | 1.8M | |
| Glenn Miller - In th..> | 2026-05-22 19:32 | 34K | |
| Glenn Miller & His O..> | 2026-05-22 19:57 | 500K | |
| Glenn Miller & His O..> | 2026-05-22 20:36 | 95K | |
| Glenn Miller & His O..> | 2026-05-22 20:36 | 53K | |
| Glenn Medeiros - Not..> | 2026-05-22 19:40 | 40K | |
| Glenn Medeiros - Not..> | 2026-05-22 20:36 | 40K | |
| Glenn Medeiros - Lon..> | 2026-05-22 19:40 | 44K | |
| Glenn Frey - You Bel..> | 2026-05-22 19:40 | 10K | |
| Glenn Frey - The Hea..> | 2026-05-22 19:40 | 10K | |
| Glenn Frey - Heat Is..> | 2026-05-22 19:40 | 71K | |
| Glenn Campbell - Gal..> | 2026-05-22 20:36 | 36K | |
| Glenda Peters - Sinc..> | 2026-05-22 19:40 | 77K | |
| Glen Campbell - Wich..> | 2026-05-22 20:21 | 80K | |
| Glen Campbell - Try ..> | 2026-05-22 20:21 | 127K | |
| Glen Campbell - The ..> | 2026-05-22 20:21 | 237K | |
| Glen Campbell - Suns..> | 2026-05-22 20:21 | 157K | |
| Glen Campbell - Sout..> | 2026-05-22 20:21 | 302K | |
| Glen Campbell - She'..> | 2026-05-22 20:21 | 204K | |
| Glen Campbell - Rhin..> | 2026-05-22 20:21 | 126K | |
| Glen Campbell - Hone..> | 2026-05-22 20:21 | 50K | |
| Glen Campbell - Galv..> | 2026-05-22 20:21 | 255K | |
| Glen Campbell - Drea..> | 2026-05-22 20:21 | 253K | |
| Glen Campbell - Coun..> | 2026-05-22 20:21 | 95K | |
| Glen Campbell - By T..> | 2026-05-22 20:21 | 188K | |
| Glen Campbell - A La..> | 2026-05-22 20:21 | 121K | |
| Glass Tiger - Don't ..> | 2026-05-22 19:57 | 89K | |
| Gladys Knight - Lice..> | 2026-05-22 19:40 | 37K | |
| Gladys Knight & the ..> | 2026-05-22 19:32 | 63K | |
| Gladys Knight & The ..> | 2026-05-22 20:36 | 58K | |
| Gladys Knight & The ..> | 2026-05-22 19:32 | 247K | |
| Gladys Knight & The ..> | 2026-05-22 19:32 | 56K | |
| Gladys Knight & The ..> | 2026-05-22 19:32 | 205K | |
| Gladys Knight & The ..> | 2026-05-22 20:06 | 58K | |
| Gipsy Kings - Volare..> | 2026-05-22 20:36 | 157K | |
| Gipsy Kings - Djobi ..> | 2026-05-22 19:57 | 39K | |
| Gipsy Kings - Bambol..> | 2026-05-22 19:40 | 39K | |
| Gipsy Kings - Baila ..> | 2026-05-22 19:57 | 61K | |
| Giorgio - Son Of My ..> | 2026-05-22 19:32 | 48K | |
| Ginuwine - When Dove..> | 2026-05-22 19:57 | 138K | |
| Ginuwine - Pony.jpg | 2026-05-22 19:57 | 56K | |
| Gino Vannelli - Wild..> | 2026-05-22 19:40 | 27K | |
| Gino Vannelli - Peop..> | 2026-05-22 19:57 | 27K | |
| Gino Vannelli - Hurt..> | 2026-05-22 19:40 | 27K | |
| Ginger Ninja - Sunsh..> | 2026-05-22 20:06 | 15K | |
| Ginger Ale - The Flo..> | 2026-05-22 19:57 | 174K | |
| Ginger - Blind Date.jpg | 2026-05-22 19:40 | 48K | |
| Gilla - We Gotta Get..> | 2026-05-22 19:32 | 68K | |
| Gilla - Bend Me Shap..> | 2026-05-22 19:32 | 22K | |
| Gilbert O'sullivan -..> | 2026-05-22 20:06 | 25K | |
| Gilbert O'sullivan -..> | 2026-05-22 20:36 | 18K | |
| Gilbert O'sullivan -..> | 2026-05-22 20:36 | 17K | |
| Gilbert O'sullivan -..> | 2026-05-22 20:36 | 39K | |
| Gilbert O'sullivan -..> | 2026-05-22 20:36 | 36K | |
| Gilbert O'Sullivan -..> | 2026-05-22 19:32 | 97K | |
| Gilbert Bécaud - Na..> | 2026-05-22 19:57 | 23K | |
| Gilbert Bécaud - Na..> | 2026-05-22 20:36 | 241K | |
| Gilbert Bécaud - L'..> | 2026-05-22 20:36 | 31K | |
| Gilbert Bécaud - Et..> | 2026-05-22 19:40 | 112K | |
| Gilbert Bécaud - A ..> | 2026-05-22 19:32 | 432K | |
| Gigliola Cinquetti -..> | 2026-05-22 19:40 | 230K | |
| Gigi D'agostino - Th..> | 2026-05-22 19:40 | 23K | |
| Gigi D'agostino - La..> | 2026-05-22 19:40 | 45K | |
| Gigi D'agostino - L'..> | 2026-05-22 19:40 | 30K | |
| Gigi D'agostino - Bl..> | 2026-05-22 20:06 | 27K | |
| Gigantjes - Yaki Tak..> | 2026-05-22 19:40 | 269K | |
| Gibson Brothers - Qu..> | 2026-05-22 19:40 | 79K | |
| Gibson Brothers - No..> | 2026-05-22 19:32 | 114K | |
| Gibson Brothers - Cu..> | 2026-05-22 20:36 | 84K | |
| Gheorghe Zamfir - Li..> | 2026-05-22 19:32 | 71K | |
| Gheorghe Zamfir - Ei..> | 2026-05-22 20:36 | 48K | |
| Gheorge Zamfir & Jam..> | 2026-05-22 20:36 | 133K | |
| Get ready to mashup ..> | 2026-05-22 19:29 | 3.1K | |
| Gert & Hermien Timme..> | 2026-05-22 19:57 | 138K | |
| Gerry Rafferty - Cit..> | 2026-05-22 19:32 | 367K | |
| Gerry Rafferty - Cit..> | 2026-05-22 19:32 | 202K | |
| Gerry Rafferty - Bak..> | 2026-05-22 20:36 | 47K | |
| Gerry Rafferty - Bak..> | 2026-05-22 19:32 | 202K | |
| Gerry & The Pacemake..> | 2026-05-22 20:36 | 47K | |
| Gerry & The Pacemake..> | 2026-05-22 20:36 | 342K | |
| Gerry & The Pacemake..> | 2026-05-22 19:57 | 40K | |
| Geri Halliwell - Mi ..> | 2026-05-22 19:57 | 24K | |
| Geri Halliwell - It'..> | 2026-05-22 20:06 | 50K | |
| Gerhard Wendland - T..> | 2026-05-22 19:57 | 62K | |
| Gerard Joling - Tick..> | 2026-05-22 19:40 | 37K | |
| Gerard Joling - Shan..> | 2026-05-22 19:40 | 65K | |
| Gerard Joling - Reac..> | 2026-05-22 19:40 | 293K | |
| Gerard Joling - No M..> | 2026-05-22 19:40 | 33K | |
| Gerard Joling - Love..> | 2026-05-22 19:40 | 18K | |
| Gerard Joling & Tatj..> | 2026-05-22 19:57 | 115K | |
| Gerard Joling & Jan ..> | 2026-05-22 20:06 | 27K | |
| Georgie Fame And Ala..> | 2026-05-22 19:32 | 37K | |
| Georgie Fame - Yeh y..> | 2026-05-22 20:36 | 21K | |
| Georgie Fame - The B..> | 2026-05-22 20:36 | 14K | |
| Georgie Fame - Sunny..> | 2026-05-22 20:36 | 237K | |
| Georgie Davis - Blac..> | 2026-05-22 19:40 | 166K | |
| Georgia Gibbs - Seve..> | 2026-05-22 19:57 | 51K | |
| Georges Moustaki - L..> | 2026-05-22 20:36 | 58K | |
| George Strait feat. ..> | 2026-05-22 20:36 | 17K | |
| George Strait - You ..> | 2026-05-22 20:21 | 171K | |
| George Strait - You ..> | 2026-05-22 20:21 | 162K | |
| George Strait - You ..> | 2026-05-22 20:21 | 70K | |
| George Strait - You ..> | 2026-05-22 20:21 | 171K | |
| George Strait - You'..> | 2026-05-22 20:21 | 362K | |
| George Strait - Writ..> | 2026-05-22 20:21 | 171K | |
| George Strait - Why ..> | 2026-05-22 20:21 | 65K | |
| George Strait - Wher..> | 2026-05-22 20:21 | 86K | |
| George Strait - What..> | 2026-05-22 20:21 | 206K | |
| George Strait - What..> | 2026-05-22 20:21 | 249K | |
| George Strait - We R..> | 2026-05-22 20:21 | 183K | |
| George Strait - Unwo..> | 2026-05-22 20:21 | 396K | |
| George Strait - True..> | 2026-05-22 20:21 | 183K | |
| George Strait - Trai..> | 2026-05-22 20:21 | 324K | |
| George Strait - Toda..> | 2026-05-22 20:21 | 236K | |
| George Strait - The ..> | 2026-05-22 20:21 | 236K | |
| George Strait - The ..> | 2026-05-22 20:21 | 86K | |
| George Strait - The ..> | 2026-05-22 20:21 | 264K | |
| George Strait - The ..> | 2026-05-22 20:21 | 264K | |
| George Strait - The ..> | 2026-05-22 20:21 | 162K | |
| George Strait - The ..> | 2026-05-22 20:21 | 171K | |
| George Strait - The ..> | 2026-05-22 20:21 | 199K | |
| George Strait - So M..> | 2026-05-22 20:21 | 324K | |
| George Strait - Six ..> | 2026-05-22 20:21 | 308K | |
| George Strait - Roun..> | 2026-05-22 20:21 | 171K | |
| George Strait - Righ..> | 2026-05-22 20:21 | 223K | |
| George Strait - Over..> | 2026-05-22 20:21 | 249K | |
| George Strait - Over..> | 2026-05-22 20:21 | 86K | |
| George Strait - One ..> | 2026-05-22 20:21 | 236K | |
| George Strait - Ocea..> | 2026-05-22 20:21 | 250K | |
| George Strait - Nobo..> | 2026-05-22 20:21 | 171K | |
| George Strait - Milk..> | 2026-05-22 20:21 | 223K | |
| George Strait - Merr..> | 2026-05-22 20:21 | 299K | |
| George Strait - Mean..> | 2026-05-22 20:21 | 206K | |
| George Strait - Mari..> | 2026-05-22 20:21 | 213K | |
| George Strait - Love..> | 2026-05-22 20:21 | 162K | |
| George Strait - Love..> | 2026-05-22 20:21 | 86K | |
| George Strait - Let'..> | 2026-05-22 20:21 | 171K | |
| George Strait - Lead..> | 2026-05-22 20:21 | 630K | |
| George Strait - King..> | 2026-05-22 20:21 | 67K | |
| George Strait - It A..> | 2026-05-22 20:21 | 331K | |
| George Strait - If Y..> | 2026-05-22 20:21 | 363K | |
| George Strait - If Y..> | 2026-05-22 20:21 | 396K | |
| George Strait - If I..> | 2026-05-22 20:21 | 171K | |
| George Strait - I Ju..> | 2026-05-22 20:21 | 115K | |
| George Strait - I Ge..> | 2026-05-22 20:21 | 18K | |
| George Strait - I Cr..> | 2026-05-22 20:21 | 128K | |
| George Strait - I Ca..> | 2026-05-22 20:21 | 505K | |
| George Strait - I Ca..> | 2026-05-22 20:21 | 213K | |
| George Strait - I've..> | 2026-05-22 20:21 | 171K | |
| George Strait - I'd ..> | 2026-05-22 20:21 | 302K | |
| George Strait - Holl..> | 2026-05-22 20:21 | 308K | |
| George Strait - Hear..> | 2026-05-22 20:21 | 86K | |
| George Strait - Gone..> | 2026-05-22 20:21 | 324K | |
| George Strait - Fool..> | 2026-05-22 20:21 | 213K | |
| George Strait - Easy..> | 2026-05-22 20:21 | 302K | |
| George Strait - Drin..> | 2026-05-22 20:21 | 266K | |
| George Strait - Does..> | 2026-05-22 20:21 | 264K | |
| George Strait - Chec..> | 2026-05-22 20:21 | 171K | |
| George Strait - Blue..> | 2026-05-22 20:21 | 123K | |
| George Strait - Blam..> | 2026-05-22 20:21 | 223K | |
| George Strait - Baby..> | 2026-05-22 20:21 | 70K | |
| George Strait - Baby..> | 2026-05-22 20:21 | 171K | |
| George Strait - Any ..> | 2026-05-22 20:21 | 308K | |
| George Strait - Amar..> | 2026-05-22 20:21 | 213K | |
| George Strait - Am I..> | 2026-05-22 20:21 | 250K | |
| George Strait - All ..> | 2026-05-22 20:21 | 171K | |
| George Strait - Adal..> | 2026-05-22 20:21 | 198K | |
| George Strait - Ace ..> | 2026-05-22 20:21 | 249K | |
| George Strait - A Fi..> | 2026-05-22 20:21 | 171K | |
| George Strait - 80 P..> | 2026-05-22 20:21 | 467K | |
| George Morgan - You..> | 2026-05-22 20:21 | 78K | |
| George Morgan - Room..> | 2026-05-22 20:21 | 42K | |
| George Morgan - I()m..> | 2026-05-22 20:21 | 317K | |
| George Morgan - Almo..> | 2026-05-22 20:21 | 93K | |
| George Michael - You..> | 2026-05-22 19:57 | 25K | |
| George Michael - Wai..> | 2026-05-22 19:57 | 83K | |
| George Michael - Too..> | 2026-05-22 19:57 | 38K | |
| George Michael - Pra..> | 2026-05-22 19:57 | 29K | |
| George Michael - Out..> | 2026-05-22 19:57 | 43K | |
| George Michael - Kis..> | 2026-05-22 19:40 | 63K | |
| George Michael - Kil..> | 2026-05-22 19:57 | 27K | |
| George Michael - Jes..> | 2026-05-22 19:57 | 16K | |
| George Michael - I W..> | 2026-05-22 19:57 | 25K | |
| George Michael - I W..> | 2026-05-22 19:40 | 44K | |
| George Michael - I C..> | 2026-05-22 19:57 | 10K | |
| George Michael - Hea..> | 2026-05-22 19:57 | 83K | |
| George Michael - Fre..> | 2026-05-22 19:57 | 41K | |
| George Michael - Fat..> | 2026-05-22 19:40 | 63K | |
| George Michael - Fai..> | 2026-05-22 19:40 | 63K | |
| George Michael - Cow..> | 2026-05-22 19:57 | 56K | |
| George Michael - Car..> | 2026-05-22 19:40 | 29K | |
| George Michael - A D..> | 2026-05-22 19:40 | 16K | |
| George Michael & Que..> | 2026-05-22 19:57 | 39K | |
| George Michael & Mar..> | 2026-05-22 19:57 | 195K | |
| George Michael & Elt..> | 2026-05-22 19:57 | 83K | |
| George Mccrae - Rock..> | 2026-05-22 19:32 | 30K | |
| George Mccormick - L..> | 2026-05-22 20:21 | 145K | |
| George Mccormick - J..> | 2026-05-22 20:21 | 328K | |
| George Jones - You G..> | 2026-05-22 20:21 | 298K | |
| George Jones - You'v..> | 2026-05-22 20:21 | 120K | |
| George Jones - Wine ..> | 2026-05-22 20:21 | 222K | |
| George Jones - Why B..> | 2026-05-22 20:21 | 160K | |
| George Jones - Who S..> | 2026-05-22 20:21 | 190K | |
| George Jones - Who's..> | 2026-05-22 20:21 | 146K | |
| George Jones - White..> | 2026-05-22 20:21 | 415K | |
| George Jones - What ..> | 2026-05-22 20:21 | 171K | |
| George Jones - We()r..> | 2026-05-22 20:21 | 92K | |
| George Jones - Two S..> | 2026-05-22 20:21 | 175K | |
| George Jones - Treas..> | 2026-05-22 20:21 | 165K | |
| George Jones - Too M..> | 2026-05-22 20:21 | 280K | |
| George Jones - There..> | 2026-05-22 20:21 | 261K | |
| George Jones - The W..> | 2026-05-22 20:21 | 316K | |
| George Jones - The O..> | 2026-05-22 20:21 | 286K | |
| George Jones - The G..> | 2026-05-22 20:21 | 146K | |
| George Jones - The D..> | 2026-05-22 20:21 | 147K | |
| George Jones - Tenne..> | 2026-05-22 20:21 | 231K | |
| George Jones - Tende..> | 2026-05-22 20:21 | 165K | |
| George Jones - Still..> | 2026-05-22 20:21 | 222K | |
| George Jones - Shine..> | 2026-05-22 20:21 | 184K | |
| George Jones - She's..> | 2026-05-22 20:21 | 286K | |
| George Jones - Same ..> | 2026-05-22 20:21 | 144K | |
| George Jones - Rock ..> | 2026-05-22 20:21 | 298K | |
| George Jones - Prett..> | 2026-05-22 20:21 | 178K | |
| George Jones - No Mo..> | 2026-05-22 20:21 | 193K | |
| George Jones - Near ..> | 2026-05-22 20:21 | 175K | |
| George Jones - Just ..> | 2026-05-22 20:21 | 317K | |
| George Jones - If Dr..> | 2026-05-22 20:21 | 147K | |
| George Jones - I Don..> | 2026-05-22 20:21 | 138K | |
| George Jones - I'm a..> | 2026-05-22 20:21 | 126K | |
| George Jones - I'm N..> | 2026-05-22 20:21 | 222K | |
| George Jones - Hold ..> | 2026-05-22 20:21 | 223K | |
| George Jones - He St..> | 2026-05-22 20:21 | 147K | |
| George Jones - Good ..> | 2026-05-22 20:36 | 64K | |
| George Jones - Gonna..> | 2026-05-22 20:21 | 200K | |
| George Jones - Golde..> | 2026-05-22 20:21 | 154K | |
| George Jones - Don()..> | 2026-05-22 20:21 | 209K | |
| George Jones - Colou..> | 2026-05-22 20:21 | 188K | |
| George Jones - Choic..> | 2026-05-22 20:21 | 153K | |
| George Jones - Big H..> | 2026-05-22 20:21 | 164K | |
| George Jones - (We'r..> | 2026-05-22 20:21 | 210K | |
| George Jones, Tammy ..> | 2026-05-22 20:21 | 143K | |
| George Jones, B.B. K..> | 2026-05-22 20:21 | 439K | |
| George Jones & Tammy..> | 2026-05-22 20:21 | 209K | |
| George Jones & Tammy..> | 2026-05-22 20:21 | 65K | |
| George Jones & Tammy..> | 2026-05-22 20:21 | 42K | |
| George Harrison - My..> | 2026-05-22 20:36 | 71K | |
| George Harrison - My..> | 2026-05-22 19:32 | 296K | |
| George Harrison - Go..> | 2026-05-22 20:36 | 51K | |
| George Hamilton IV -..> | 2026-05-22 20:21 | 171K | |
| George Hamilton IV -..> | 2026-05-22 20:21 | 186K | |
| George Ezra - Shot..> | 2026-05-22 20:06 | 39K | |
| George Ezra - Budape..> | 2026-05-22 20:06 | 92K | |
| George Cash - Nighti..> | 2026-05-22 20:36 | 336K | |
| George Benson - On B..> | 2026-05-22 20:36 | 18K | |
| George Benson - On B..> | 2026-05-22 19:40 | 107K | |
| George Benson - Give..> | 2026-05-22 19:40 | 41K | |
| George Baker Selecti..> | 2026-05-22 20:36 | 43K | |
| George Baker Selecti..> | 2026-05-22 19:32 | 49K | |
| George Baker Selecti..> | 2026-05-22 19:32 | 54K | |
| George Baker Selecti..> | 2026-05-22 19:40 | 50K | |
| George Baker Selecti..> | 2026-05-22 19:32 | 52K | |
| George Baker Selecti..> | 2026-05-22 19:32 | 36K | |
| George Baker Selecti..> | 2026-05-22 20:36 | 46K | |
| George Baker Selecti..> | 2026-05-22 19:32 | 56K | |
| George Baker Selecti..> | 2026-05-22 19:32 | 51K | |
| George Baker Selecti..> | 2026-05-22 19:40 | 237K | |
| George Baker Selecti..> | 2026-05-22 19:57 | 93K | |
| George Baker - Una P..> | 2026-05-22 20:06 | 56K | |
| George Baker - Sing ..> | 2026-05-22 19:32 | 174K | |
| Genesis - That's All..> | 2026-05-22 20:06 | 110K | |
| Genesis - Tell Me Wh..> | 2026-05-22 19:57 | 26K | |
| Genesis - No Son Of ..> | 2026-05-22 19:57 | 26K | |
| Genesis - Mama.jpg | 2026-05-22 19:40 | 14K | |
| Genesis - Land Of Co..> | 2026-05-22 19:40 | 41K | |
| Genesis - Jesus He K..> | 2026-05-22 19:57 | 26K | |
| Genesis - Invisible ..> | 2026-05-22 19:40 | 41K | |
| Genesis - I Can't Da..> | 2026-05-22 19:57 | 26K | |
| Genesis - Hold On My..> | 2026-05-22 20:36 | 73K | |
| Genesis - Follow You..> | 2026-05-22 19:32 | 75K | |
| Genesis - Follow You..> | 2026-05-22 19:57 | 37K | |
| Gene Vincent & His B..> | 2026-05-22 19:32 | 2.3M | |
| Gene Pitney - Yours ..> | 2026-05-22 19:32 | 19K | |
| Gene Pitney - Yester..> | 2026-05-22 19:32 | 32K | |
| Gene Pitney - Won't ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Who Ne..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - Walk.jpg | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Twenty..> | 2026-05-22 20:36 | 172K | |
| Gene Pitney - True L..> | 2026-05-22 19:32 | 59K | |
| Gene Pitney - Train ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Town W..> | 2026-05-22 19:32 | 59K | |
| Gene Pitney - Tower ..> | 2026-05-22 19:32 | 59K | |
| Gene Pitney - Today'..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Time A..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Those ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - There'..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - The Sh..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - The Mo..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - The La..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - The Fo..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - The Bo..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - The Ba..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - The An..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - That G..> | 2026-05-22 19:32 | 24K | |
| Gene Pitney - Tell T..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Teardr..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Take M..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Take I..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Sure F..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Song O..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Somewh..> | 2026-05-22 19:32 | 19K | |
| Gene Pitney - Someth..> | 2026-05-22 20:36 | 17K | |
| Gene Pitney - Small ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - She St..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - She Le..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - She's ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - She's ..> | 2026-05-22 19:32 | 59K | |
| Gene Pitney - Shady ..> | 2026-05-22 19:32 | 59K | |
| Gene Pitney - Save Y..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Saro F..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - Run, R..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Rising..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Prince..> | 2026-05-22 19:32 | 59K | |
| Gene Pitney - Please..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Peanut..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Only L..> | 2026-05-22 19:40 | 204K | |
| Gene Pitney - Only L..> | 2026-05-22 19:32 | 36K | |
| Gene Pitney - One Da..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Oh, An..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Not Re..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Nobody..> | 2026-05-22 19:32 | 15K | |
| Gene Pitney - Nobody..> | 2026-05-22 20:36 | 15K | |
| Gene Pitney - Nessun..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - My Sul..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - My Hea..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Mr. Mo..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Meliss..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Mecca.jpg | 2026-05-22 19:32 | 59K | |
| Gene Pitney - Maybe ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Marian..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - Maria ..> | 2026-05-22 19:32 | 59K | |
| Gene Pitney - Make B..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Lyda S..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Love G..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Lookin..> | 2026-05-22 20:36 | 79K | |
| Gene Pitney - Lonely..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Lonely..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Little..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Little..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Lips A..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - Life T..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Laying..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - Laurie..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Last C..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - Keep T..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Just O..> | 2026-05-22 19:32 | 59K | |
| Gene Pitney - June I..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - It Hur..> | 2026-05-22 20:36 | 56K | |
| Gene Pitney - It's N..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Innamo..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - If Mar..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - If I W..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - If I O..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - If I N..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - If I D..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - If I D..> | 2026-05-22 19:32 | 322K | |
| Gene Pitney - I Shou..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - I Must..> | 2026-05-22 19:32 | 19K | |
| Gene Pitney - I Love..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - I Lost..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - I Laug..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - I Can'..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - I Can'..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - I'm Up..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - I'm Go..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - I'm Go..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - I'm Go..> | 2026-05-22 20:36 | 56K | |
| Gene Pitney - I'm Go..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - I'll F..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - I'll B..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - I'd Li..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - House ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Hey, P..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Hello ..> | 2026-05-22 19:32 | 16K | |
| Gene Pitney - Heaven..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Hawaii..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - Hate.jpg | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Harmon..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Half T..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Half H..> | 2026-05-22 19:32 | 59K | |
| Gene Pitney - Going ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Garden..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - For Me..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Follow..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Every ..> | 2026-05-22 19:32 | 59K | |
| Gene Pitney - E Se D..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Drinki..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Dream ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Down I..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Donna ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Don't ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Don't ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Don't ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Darlin..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Cry Yo..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Cradle..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Cornfl..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - Con Te..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - Citta ..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - Carrie..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Brandy..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Blue G..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Bleibe..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Billy ..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - Baton ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Backst..> | 2026-05-22 19:32 | 42K | |
| Gene Pitney - Baby, ..> | 2026-05-22 19:32 | 41K | |
| Gene Pitney - Autumn..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Answer..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - Animal..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - Aladdi..> | 2026-05-22 19:32 | 18K | |
| Gene Pitney - Air-Ma..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - A Thou..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - A Stre..> | 2026-05-22 19:32 | 59K | |
| Gene Pitney - A Porc..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney - A Grea..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - A Chan..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - 24 Syc..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney - 24 Hou..> | 2026-05-22 20:35 | 47K | |
| Gene Pitney - 22 Day..> | 2026-05-22 20:35 | 389K | |
| Gene Pitney - (You'v..> | 2026-05-22 19:32 | 41K | |
| Gene Pitney - (The M..> | 2026-05-22 19:32 | 59K | |
| Gene Pitney - (In Th..> | 2026-05-22 20:35 | 34K | |
| Gene Pitney - (I Wan..> | 2026-05-22 19:32 | 59K | |
| Gene Pitney - (1-2-3..> | 2026-05-22 20:35 | 389K | |
| Gene Pitney & Melba ..> | 2026-05-22 20:21 | 84K | |
| Gene Pitney & Melba ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney & Melba ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney & Melba ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney & Melba ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney & Melba ..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney & Melba ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney & Melba ..> | 2026-05-22 20:36 | 389K | |
| Gene Pitney & Melba ..> | 2026-05-22 20:36 | 34K | |
| Gene Pitney & George..> | 2026-05-22 20:21 | 52K | |
| Gene Pitney & George..> | 2026-05-22 20:21 | 52K | |
| Gene Pitney & George..> | 2026-05-22 20:21 | 39K | |
| Gene Parson - Wreck ..> | 2026-05-22 20:21 | 823K | |
| Gene Kelly - Singin'..> | 2026-05-22 19:32 | 905K | |
| Gene Kelly - I Got R..> | 2026-05-22 20:35 | 78K | |
| Gene Kelly & Donald ..> | 2026-05-22 19:57 | 35K | |
| Gene Chandler - Duke..> | 2026-05-22 19:57 | 45K | |
| Gene Autry - You Are..> | 2026-05-22 20:21 | 182K | |
| Gene Autry - Blueber..> | 2026-05-22 20:21 | 348K | |
| Geier Sturzflug - Br..> | 2026-05-22 19:40 | 183K | |
| Geebros - Henry The ..> | 2026-05-22 20:35 | 82K | |
| Gazebo -I Like Chopi..> | 2026-05-22 19:40 | 44K | |
| Gavin Degraw - Not O..> | 2026-05-22 20:06 | 40K | |
| Gavin Degraw - I Don..> | 2026-05-22 20:06 | 32K | |
| Gavin Degraw - Follo..> | 2026-05-22 20:06 | 32K | |
| Gavin Degraw - Chari..> | 2026-05-22 20:06 | 32K | |
| Gary jules - Mad Wor..> | 2026-05-22 20:35 | 69K | |
| Gary Stewart - She's..> | 2026-05-22 20:21 | 135K | |
| Gary Stewart - Out o..> | 2026-05-22 20:21 | 135K | |
| Gary Stewart - Drink..> | 2026-05-22 20:21 | 135K | |
| Gary Puckett & the U..> | 2026-05-22 20:35 | 52K | |
| Gary Puckett & The U..> | 2026-05-22 20:35 | 79K | |
| Gary Numan - Cars.jpg | 2026-05-22 19:32 | 23K | |
| Gary Morris - Wind B..> | 2026-05-22 20:21 | 96 | |
| Gary Morris - Why La..> | 2026-05-22 20:21 | 165K | |
| Gary Morris - The wi..> | 2026-05-22 20:35 | 45K | |
| Gary Morris - The Lo..> | 2026-05-22 20:21 | 209K | |
| Gary Morris - Leave ..> | 2026-05-22 20:21 | 156K | |
| Gary Morris - I'll N..> | 2026-05-22 20:21 | 342K | |
| Gary Morris - 100% C..> | 2026-05-22 20:20 | 23K | |
| Gary Moore - Still G..> | 2026-05-22 20:35 | 52K | |
| Gary Moore - Over Th..> | 2026-05-22 19:40 | 33K | |
| Gary Moore - Oh Pret..> | 2026-05-22 19:57 | 70K | |
| Gary Moore - Empty R..> | 2026-05-22 19:57 | 47K | |
| Gary Moore & Phil Ly..> | 2026-05-22 19:40 | 55K | |
| Gary Low - La Colleg..> | 2026-05-22 19:40 | 49K | |
| Gary Fane - Aquarius..> | 2026-05-22 19:40 | 16K | |
| Gary Brooker - No Mo..> | 2026-05-22 20:35 | 59K | |
| Gary Allan - Her Man..> | 2026-05-22 20:20 | 142K | |
| Garth Brooks as Chri..> | 2026-05-22 20:20 | 50K | |
| Garth Brooks Tribute..> | 2026-05-22 20:20 | 38K | |
| Garth Brooks - You M..> | 2026-05-22 20:20 | 1.0M | |
| Garth Brooks - We Sh..> | 2026-05-22 20:20 | 50K | |
| Garth Brooks - Uptow..> | 2026-05-22 20:20 | 98K | |
| Garth Brooks - Unans..> | 2026-05-22 20:20 | 50K | |
| Garth Brooks - Two O..> | 2026-05-22 20:20 | 214K | |
| Garth Brooks - The T..> | 2026-05-22 20:20 | 181K | |
| Garth Brooks - The R..> | 2026-05-22 20:20 | 63K | |
| Garth Brooks - The D..> | 2026-05-22 20:20 | 129K | |
| Garth Brooks - The C..> | 2026-05-22 20:20 | 98K | |
| Garth Brooks - The B..> | 2026-05-22 20:20 | 181K | |
| Garth Brooks - That ..> | 2026-05-22 20:20 | 50K | |
| Garth Brooks - Somew..> | 2026-05-22 20:20 | 50K | |
| Garth Brooks - She()..> | 2026-05-22 20:20 | 1.0M | |
| Garth Brooks - Rodeo..> | 2026-05-22 20:20 | 115K | |
| Garth Brooks - Papa ..> | 2026-05-22 20:20 | 192K | |
| Garth Brooks - Not C..> | 2026-05-22 20:20 | 192K | |
| Garth Brooks - Much ..> | 2026-05-22 20:20 | 192K | |
| Garth Brooks - Learn..> | 2026-05-22 20:20 | 50K | |
| Garth Brooks - It Do..> | 2026-05-22 20:20 | 50K | |
| Garth Brooks - Frien..> | 2026-05-22 20:20 | 115K | |
| Garth Brooks - Calli..> | 2026-05-22 20:20 | 45K | |
| Garth Brooks - Belle..> | 2026-05-22 20:20 | 1.0M | |
| Garth Brooks - Ain..> | 2026-05-22 20:20 | 50K | |
| Garth Brooks, Trisha..> | 2026-05-22 20:20 | 12K | |
| Garth Brooks, Steve ..> | 2026-05-22 20:20 | 50K | |
| Garnets - Indian Upr..> | 2026-05-22 19:32 | 216K | |
| Garland Jeffries - M..> | 2026-05-22 19:40 | 18K | |
| Garland Jeffreys - M..> | 2026-05-22 19:57 | 18K | |
| Garland Jeffreys - H..> | 2026-05-22 19:57 | 327K | |
| Gareth Gates - Uncha..> | 2026-05-22 20:35 | 31K | |
| Gareth Gates - Spiri..> | 2026-05-22 20:06 | 70K | |
| Gareth Gates - Anyon..> | 2026-05-22 20:06 | 73K | |
| Gareth Gates, The Ku..> | 2026-05-22 20:06 | 70K | |
| Gap Band - Oops Up S..> | 2026-05-22 19:57 | 36K | |
| Gap Band - Oops Up S..> | 2026-05-22 19:32 | 292K | |
| Gap Band, The - Oops..> | 2026-05-22 19:40 | 33K | |
| Gallagher & Lyle - I..> | 2026-05-22 19:32 | 87K | |
| Galantis - Runaway (..> | 2026-05-22 20:06 | 64K | |
| Gala - Freed From De..> | 2026-05-22 19:57 | 68K | |
| Gala - Come Into My ..> | 2026-05-22 20:06 | 271K | |
| Gabry Ponte x R3HAB ..> | 2026-05-22 20:06 | 2.3M | |
| Gabry PonteLUM!XPrez..> | 2026-05-22 20:06 | 69K | |
| Gabry PonteHOSANNA -..> | 2026-05-22 20:06 | 64K | |
| Gabry PonteDon Diabl..> | 2026-05-22 20:06 | 117K | |
| Gabry Ponte; Marnik;..> | 2026-05-22 20:06 | 190K | |
| Gabry Ponte - We Cou..> | 2026-05-22 20:06 | 427K | |
| Gabry Ponte - Thunde..> | 2026-05-22 20:06 | 201K | |
| Gabry Ponte - Crusad..> | 2026-05-22 20:06 | 259K | |
| Gabry Ponte, LUM!X, ..> | 2026-05-22 20:06 | 427K | |
| Gabrielle - Out Of R..> | 2026-05-22 20:06 | 56K | |
| Gabrielle - Dreams.jpg | 2026-05-22 19:57 | 15K | |
| Gabriella Cilmi - Sw..> | 2026-05-22 20:35 | 34K | |
| GIMS - J'me tire Cop..> | 2026-05-22 20:06 | 89K | |
| GENX - voornieuws.jpg | 2026-05-22 19:27 | 3.1K | |
| GENE WATSON - Memori..> | 2026-05-22 20:21 | 292K | |
| GEN-X HOUR - hrs23_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs22_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs21_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs20_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs19_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs18_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs17_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs16_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs15_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs14_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs13_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs12_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs11_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs10_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs09_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs08_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs07_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs06_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs05_0..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs04_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs03_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs02_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs01_o..> | 2026-05-22 19:27 | 3.1K | |
| GEN-X HOUR - hrs00_o..> | 2026-05-22 19:27 | 3.1K | |
| GAMPER & DADONI - Cr..> | 2026-05-22 20:06 | 269K | |
| G'Race -Manhattan.jpg | 2026-05-22 19:40 | 84K | |
| G&G - Endless.jpg | 2026-05-22 20:06 | 164K | |
| Gérard Lenorman - V..> | 2026-05-22 19:32 | 278K | |
| Gérard Lenorman - S..> | 2026-05-22 20:36 | 40K | |
| Gérard Lenorman - L..> | 2026-05-22 20:36 | 48K | |
| Future World Orchest..> | 2026-05-22 19:40 | 48K | |
| Future World Orchest..> | 2026-05-22 19:40 | 18K | |
| Future World Orchest..> | 2026-05-22 19:40 | 30K | |
| Future Breeze - Why ..> | 2026-05-22 19:57 | 49K | |
| Funky BeatzKate Ryan..> | 2026-05-22 20:06 | 4.0M | |
| Fun Fun - Hit Mix.jpg | 2026-05-22 19:40 | 36K | |
| Fun Fun - Happy Stat..> | 2026-05-22 19:40 | 43K | |
| Fun Fun - Colour My ..> | 2026-05-22 19:40 | 43K | |
| Fun Fun - Baila Bole..> | 2026-05-22 19:40 | 36K | |
| Fun Ft. Janelle Mona..> | 2026-05-22 20:06 | 25K | |
| Fun Boy Three with B..> | 2026-05-22 19:40 | 64K | |
| Fun. - We Are Young ..> | 2026-05-22 20:06 | 109K | |
| Full House - Standin..> | 2026-05-22 19:32 | 21K | |
| Full Force - Alice (..> | 2026-05-22 19:40 | 49K | |
| Full Force - Alice! ..> | 2026-05-22 19:57 | 42K | |
| Fugees - Ready Or No..> | 2026-05-22 19:57 | 28K | |
| Fugees - Killing Me ..> | 2026-05-22 20:35 | 72K | |
| Fruitcake - My Feet ..> | 2026-05-22 19:40 | 56K | |
| Frizzle Sizzle - Tal..> | 2026-05-22 19:40 | 188K | |
| Frijid Pink - House ..> | 2026-05-22 19:32 | 17K | |
| Frida Boccara - Un J..> | 2026-05-22 19:32 | 45K | |
| Frida Boccara - Cent..> | 2026-05-22 20:35 | 45K | |
| Frida - To Turn The ..> | 2026-05-22 19:40 | 32K | |
| Frida - I Know There..> | 2026-05-22 20:06 | 41K | |
| Frida - I Know There..> | 2026-05-22 19:40 | 21K | |
| Freiheit - Play It C..> | 2026-05-22 19:40 | 38K | |
| Freiheit - Keeping T..> | 2026-05-22 19:40 | 10K | |
| Freestylers - Ruffne..> | 2026-05-22 20:06 | 67K | |
| Freemasons Feat. Bai..> | 2026-05-22 20:35 | 27K | |
| Freemasons Feat. Bai..> | 2026-05-22 20:06 | 130K | |
| Freeez - I.O.U..jpg | 2026-05-22 19:40 | 33K | |
| Free - Allright Now.jpg | 2026-05-22 19:57 | 37K | |
| Free - All Right Now..> | 2026-05-22 19:32 | 37K | |
| Freddy Weller - The ..> | 2026-05-22 20:20 | 87K | |
| Freddy Weller - On t..> | 2026-05-22 20:20 | 187K | |
| Freddy Quinn - La Pa..> | 2026-05-22 19:32 | 70K | |
| Freddy Quinn - Junge..> | 2026-05-22 20:35 | 316K | |
| Freddy Quinn - Hunde..> | 2026-05-22 20:35 | 45K | |
| Freddy Quinn - Heimw..> | 2026-05-22 19:32 | 60K | |
| Freddy Quinn - Die G..> | 2026-05-22 20:35 | 229K | |
| Freddy Quinn & Bert ..> | 2026-05-22 19:32 | 234K | |
| Freddy Fender - Wast..> | 2026-05-22 20:20 | 225K | |
| Freddy Fender - Vaya..> | 2026-05-22 20:20 | 178K | |
| Freddy Fender - Tell..> | 2026-05-22 20:20 | 190K | |
| Freddy Fender - Befo..> | 2026-05-22 20:20 | 44K | |
| Freddy Fender - Befo..> | 2026-05-22 20:20 | 174K | |
| Freddy Breck - Rote ..> | 2026-05-22 19:32 | 15K | |
| Freddy Breck - Rosam..> | 2026-05-22 19:32 | 40K | |
| Freddy Breck - Bianc..> | 2026-05-22 19:32 | 201K | |
| Freddie MercuryMonts..> | 2026-05-22 19:40 | 8.5K | |
| Freddie Mercury - Th..> | 2026-05-22 20:35 | 37K | |
| Freddie Mercury - Lo..> | 2026-05-22 19:40 | 61K | |
| Freddie Mercury - Lo..> | 2026-05-22 20:35 | 103K | |
| Freddie Mercury - Li..> | 2026-05-22 19:57 | 66K | |
| Freddie Mercury & Mo..> | 2026-05-22 20:35 | 121K | |
| Freddie James - Get ..> | 2026-05-22 19:32 | 86K | |
| Freddie Hart - Easy ..> | 2026-05-22 20:35 | 291K | |
| Freddie Aguilar - An..> | 2026-05-22 20:35 | 35K | |
| Freddie & The Dreame..> | 2026-05-22 20:35 | 176K | |
| Freda Payne - Band O..> | 2026-05-22 20:35 | 55K | |
| Fred Jasper - Delila..> | 2026-05-22 20:35 | 156K | |
| Fred Astaire - Cheek..> | 2026-05-22 20:35 | 37K | |
| Frantique - Strut Yo..> | 2026-05-22 19:32 | 49K | |
| Frans Krassenburg - ..> | 2026-05-22 20:35 | 355K | |
| Frankie Valli - Grea..> | 2026-05-22 19:32 | 22K | |
| Frankie Valli - Can'..> | 2026-05-22 20:35 | 182K | |
| Frankie Valli & The ..> | 2026-05-22 19:32 | 22K | |
| Frankie Valli & The ..> | 2026-05-22 20:35 | 182K | |
| Frankie Valli & Four..> | 2026-05-22 19:39 | 41K | |
| Frankie Miller - Lov..> | 2026-05-22 19:32 | 44K | |
| Frankie Miller - Dar..> | 2026-05-22 20:20 | 76K | |
| Frankie Lymon & The ..> | 2026-05-22 20:35 | 20K | |
| Frankie Laine - Rawh..> | 2026-05-22 20:20 | 296K | |
| Frankie Laine - Moon..> | 2026-05-22 19:57 | 61K | |
| Frankie Laine - Jeze..> | 2026-05-22 20:20 | 238K | |
| Frankie Laine - I Be..> | 2026-05-22 20:35 | 44K | |
| Frankie Laine - High..> | 2026-05-22 20:20 | 296K | |
| Frankie Laine - Answ..> | 2026-05-22 20:20 | 22K | |
| Frankie Laine - Answ..> | 2026-05-22 20:35 | 35K | |
| Frankie Laine - A Wo..> | 2026-05-22 20:35 | 35K | |
| Frankie Goes To Holl..> | 2026-05-22 20:06 | 30K | |
| Frankie Goes To Holl..> | 2026-05-22 19:39 | 66K | |
| Frankie Goes To Holl..> | 2026-05-22 19:39 | 66K | |
| Frankie Goes To Holl..> | 2026-05-22 19:39 | 66K | |
| Frankie Goes To Holl..> | 2026-05-22 19:39 | 66K | |
| Frankie Goes To Holl..> | 2026-05-22 19:39 | 40K | |
| Frankie Avalon - Why..> | 2026-05-22 20:35 | 239K | |
| Frankie Avalon - Ven..> | 2026-05-22 20:35 | 245K | |
| Frankie Avalon - Ven..> | 2026-05-22 19:32 | 74K | |
| Frank Zappa - Dancin..> | 2026-05-22 19:32 | 380K | |
| Frank Stallone - Far..> | 2026-05-22 19:39 | 34K | |
| Frank Sinatra with T..> | 2026-05-22 20:35 | 17K | |
| Frank Sinatra - Them..> | 2026-05-22 20:35 | 23K | |
| Frank Sinatra - The ..> | 2026-05-22 20:35 | 164K | |
| Frank Sinatra - That..> | 2026-05-22 20:35 | 66K | |
| Frank Sinatra - Stra..> | 2026-05-22 20:35 | 36K | |
| Frank Sinatra - My W..> | 2026-05-22 20:35 | 113K | |
| Frank Sinatra - My W..> | 2026-05-22 20:35 | 54K | |
| Frank Sinatra - My K..> | 2026-05-22 20:35 | 15K | |
| Frank Sinatra - My F..> | 2026-05-22 20:35 | 53K | |
| Frank Sinatra - Moon..> | 2026-05-22 20:35 | 42K | |
| Frank Sinatra - Me A..> | 2026-05-22 20:35 | 24K | |
| Frank Sinatra - Love..> | 2026-05-22 20:35 | 44K | |
| Frank Sinatra - Love..> | 2026-05-22 20:35 | 26K | |
| Frank Sinatra - Let ..> | 2026-05-22 20:35 | 55K | |
| Frank Sinatra - It W..> | 2026-05-22 20:35 | 64K | |
| Frank Sinatra - I Ge..> | 2026-05-22 20:35 | 44K | |
| Frank Sinatra - I Be..> | 2026-05-22 19:32 | 5.3K | |
| Frank Sinatra - I've..> | 2026-05-22 20:35 | 62K | |
| Frank Sinatra - For ..> | 2026-05-22 20:35 | 16K | |
| Frank Sinatra - For ..> | 2026-05-22 20:35 | 48K | |
| Frank Sinatra - Fly ..> | 2026-05-22 20:20 | 57K | |
| Frank Sinatra - Come..> | 2026-05-22 19:39 | 143K | |
| Frank Sinatra - Chee..> | 2026-05-22 20:35 | 44K | |
| Frank Sinatra - Blue..> | 2026-05-22 19:39 | 472K | |
| Frank Sinatra - Bad,..> | 2026-05-22 19:32 | 249K | |
| Frank Mills - Music ..> | 2026-05-22 20:35 | 64K | |
| Frank Mills - Music ..> | 2026-05-22 19:32 | 64K | |
| Frank Ifield - I Rem..> | 2026-05-22 20:06 | 30K | |
| Frank Ferrari - Monz..> | 2026-05-22 19:32 | 349K | |
| Frank Duval - Angel ..> | 2026-05-22 20:35 | 85K | |
| Frank Ashton - I Sti..> | 2026-05-22 19:39 | 22K | |
| Frank Ashton & Maris..> | 2026-05-22 19:39 | 69K | |
| Frank & Nancy Sinatr..> | 2026-05-22 20:35 | 34K | |
| Franck Pourcel - Je ..> | 2026-05-22 20:35 | 66K | |
| Francis Lai - Theme ..> | 2026-05-22 19:32 | 48K | |
| Francis Goya - Nosta..> | 2026-05-22 20:35 | 18K | |
| Francis Goya - Conce..> | 2026-05-22 20:35 | 34K | |
| Francis Goya & Damia..> | 2026-05-22 19:32 | 47K | |
| Francesco Napoli - B..> | 2026-05-22 19:39 | 67K | |
| France Gall - Poupé..> | 2026-05-22 20:35 | 25K | |
| France Gall - Il Jou..> | 2026-05-22 19:39 | 43K | |
| France Gall - Ella E..> | 2026-05-22 20:35 | 249K | |
| Françoise Hardy - T..> | 2026-05-22 20:35 | 55K | |
| Françoise Hardy - O..> | 2026-05-22 20:35 | 21K | |
| Françoise Hardy - L..> | 2026-05-22 20:35 | 48K | |
| Fra Lippo Lippi - Sh..> | 2026-05-22 19:39 | 64K | |
| Foxy - Get Off.jpg | 2026-05-22 19:32 | 15K | |
| Fox The Fox - Precio..> | 2026-05-22 19:39 | 32K | |
| Fox Stevenson - Swee..> | 2026-05-22 20:06 | 35K | |
| Four Tops - What Is ..> | 2026-05-22 20:35 | 257K | |
| Four Tops - Walk awa..> | 2026-05-22 20:35 | 86K | |
| Four Tops - Standing..> | 2026-05-22 20:35 | 86K | |
| Four Tops - Reach ou..> | 2026-05-22 20:35 | 86K | |
| Four Tops - Loco In ..> | 2026-05-22 20:35 | 75K | |
| Four Tops - It's The..> | 2026-05-22 20:35 | 44K | |
| Four Tops - If I Wer..> | 2026-05-22 20:35 | 186K | |
| Four Tops - Don't Wa..> | 2026-05-22 19:39 | 51K | |
| Four Tops - Baby I N..> | 2026-05-22 20:35 | 61K | |
| Four Tops, The - Ind..> | 2026-05-22 19:39 | 142K | |
| Four Seasons & Frank..> | 2026-05-22 20:06 | 562K | |
| Four Knights - Oh Ba..> | 2026-05-22 19:57 | 69K | |
| Four Aces - Tell Me ..> | 2026-05-22 19:57 | 47K | |
| Four Aces - Love Is ..> | 2026-05-22 19:57 | 43K | |
| Foundations - Build ..> | 2026-05-22 20:35 | 16K | |
| Foundations - Back O..> | 2026-05-22 20:35 | 297K | |
| Foundations - Baby, ..> | 2026-05-22 20:35 | 82K | |
| Foster And Lloyd - W..> | 2026-05-22 20:20 | 124K | |
| Foster And Lloyd - S..> | 2026-05-22 20:20 | 124K | |
| Foster And Lloyd - F..> | 2026-05-22 20:20 | 41K | |
| Foster And Lloyd - C..> | 2026-05-22 20:20 | 124K | |
| Fortunes - You've Go..> | 2026-05-22 20:35 | 59K | |
| Fortunes - This Gold..> | 2026-05-22 20:35 | 8.8K | |
| Fortunes - Seasons I..> | 2026-05-22 20:35 | 72K | |
| Fortunes - Here it c..> | 2026-05-22 20:35 | 88K | |
| Fortunes - Here Come..> | 2026-05-22 20:35 | 50K | |
| Fortunes - Freedom C..> | 2026-05-22 19:32 | 314K | |
| Fortunes - Caroline.jpg | 2026-05-22 19:57 | 61K | |
| Fortuna Feat.Satenig..> | 2026-05-22 19:57 | 8.2K | |
| For the love of musi..> | 2026-05-22 19:29 | 3.1K | |
| Forrest - Feel The N..> | 2026-05-22 19:39 | 39K | |
| Forest -Rock The Boa..> | 2026-05-22 19:39 | 50K | |
| Foreigner - Waiting ..> | 2026-05-22 19:39 | 25K | |
| Foreigner - That Was..> | 2026-05-22 19:39 | 37K | |
| Foreigner - Say You ..> | 2026-05-22 19:39 | 35K | |
| Foreigner - I Want t..> | 2026-05-22 20:35 | 43K | |
| Foreigner - I Don't ..> | 2026-05-22 19:39 | 35K | |
| Foreigner - Cold as ..> | 2026-05-22 19:32 | 22K | |
| Forecast - Happy day..> | 2026-05-22 19:39 | 36K | |
| Fool's Garden - Lemo..> | 2026-05-22 20:35 | 56K | |
| Foo Fighters - Learn..> | 2026-05-22 20:06 | 42K | |
| Fonzerelli - Moonlig..> | 2026-05-22 20:06 | 44K | |
| Fontella Bass - Resc..> | 2026-05-22 19:57 | 57K | |
| Focus - Tommy (Erupt..> | 2026-05-22 19:32 | 126K | |
| Focus - Sylvia.jpg | 2026-05-22 19:32 | 20K | |
| Focus - House Of The..> | 2026-05-22 19:32 | 76K | |
| Focus - Hocus Pocus.jpg | 2026-05-22 19:32 | 126K | |
| Focus - Harem Scarem..> | 2026-05-22 19:32 | 124K | |
| Flying Pickets - Onl..> | 2026-05-22 20:35 | 34K | |
| Floyd Cramer - Last ..> | 2026-05-22 20:20 | 156K | |
| Floy Joy - Weak In T..> | 2026-05-22 19:39 | 39K | |
| Flowerpot Men - Let'..> | 2026-05-22 20:35 | 63K | |
| Flowerpot Men - Let'..> | 2026-05-22 20:35 | 271K | |
| Florida Inc - Fuck I..> | 2026-05-22 20:06 | 96K | |
| Floaters - Float On.jpg | 2026-05-22 19:32 | 224K | |
| Flo Rida feat. Sia -..> | 2026-05-22 20:06 | 29K | |
| Flo Rida Ft. Wynter ..> | 2026-05-22 20:06 | 224K | |
| Flo Rida - Whistle.jpg | 2026-05-22 20:06 | 29K | |
| Flo Rida & Ke$ha - R..> | 2026-05-22 20:06 | 244K | |
| Flo-Rida (Feat. Kesh..> | 2026-05-22 20:06 | 49K | |
| Flirtations - Nothin..> | 2026-05-22 19:57 | 42K | |
| Flim Flam - The Best..> | 2026-05-22 19:39 | 57K | |
| Flim & the BB's - St..> | 2026-05-22 20:35 | 32K | |
| Flim & the BB's - Re..> | 2026-05-22 20:35 | 32K | |
| Flim & the BB's - Ne..> | 2026-05-22 20:35 | 32K | |
| Flim & the BB's - In..> | 2026-05-22 20:35 | 32K | |
| Flim & the BB's - He..> | 2026-05-22 20:35 | 32K | |
| Flim & the BB's - Fu..> | 2026-05-22 20:35 | 32K | |
| Flim & the BB's - Bo..> | 2026-05-22 20:35 | 32K | |
| Flim & the BB's - Bo..> | 2026-05-22 20:35 | 32K | |
| Flim & the BB's - Be..> | 2026-05-22 20:35 | 32K | |
| Flim & the BB's - At..> | 2026-05-22 20:35 | 32K | |
| Flim & the BB's - At..> | 2026-05-22 20:35 | 32K | |
| Fleetwood Mac - Tusk..> | 2026-05-22 19:32 | 32K | |
| Fleetwood Mac - The ..> | 2026-05-22 19:32 | 29K | |
| Fleetwood Mac - Song..> | 2026-05-22 19:32 | 292K | |
| Fleetwood Mac - Seve..> | 2026-05-22 20:35 | 62K | |
| Fleetwood Mac - Sara..> | 2026-05-22 19:32 | 184K | |
| Fleetwood Mac - Rhia..> | 2026-05-22 19:32 | 36K | |
| Fleetwood Mac - Rhia..> | 2026-05-22 19:32 | 184K | |
| Fleetwood Mac - Oh W..> | 2026-05-22 20:35 | 46K | |
| Fleetwood Mac - Need..> | 2026-05-22 20:35 | 192K | |
| Fleetwood Mac - Man ..> | 2026-05-22 20:35 | 25K | |
| Fleetwood Mac - Litt..> | 2026-05-22 20:35 | 28K | |
| Fleetwood Mac - Gyps..> | 2026-05-22 19:39 | 47K | |
| Fleetwood Mac - Go Y..> | 2026-05-22 19:32 | 29K | |
| Fleetwood Mac - Ever..> | 2026-05-22 20:35 | 51K | |
| Fleetwood Mac - Drea..> | 2026-05-22 19:32 | 29K | |
| Fleetwood Mac - Dr..> | 2026-05-22 19:57 | 29K | |
| Fleetwood Mac - Drea..> | 2026-05-22 20:06 | 35K | |
| Fleetwood Mac - Don'..> | 2026-05-22 19:32 | 29K | |
| Fleetwood Mac - Big ..> | 2026-05-22 20:35 | 51K | |
| Fleetwood Mac - As L..> | 2026-05-22 20:35 | 28K | |
| Fleetwood Mac - Alba..> | 2026-05-22 20:35 | 38K | |
| Flavium - Nightlife.jpg | 2026-05-22 19:39 | 33K | |
| Flash And The Pan - ..> | 2026-05-22 19:39 | 57K | |
| Flash & The Pan - Wa..> | 2026-05-22 19:39 | 117K | |
| Flash & The Pan - Mi..> | 2026-05-22 19:57 | 27K | |
| Flash & The Pan - He..> | 2026-05-22 19:32 | 26K | |
| Flash & The Pan - He..> | 2026-05-22 19:57 | 27K | |
| Five Star - Rain Or ..> | 2026-05-22 19:39 | 44K | |
| Five Star - Love Tak..> | 2026-05-22 19:39 | 141K | |
| Five Star - All Fall..> | 2026-05-22 19:39 | 46K | |
| Five Americans - Wes..> | 2026-05-22 20:35 | 214K | |
| Five - everybody get..> | 2026-05-22 20:06 | 244K | |
| Five - Keep On Movin..> | 2026-05-22 20:06 | 45K | |
| Five - Got The Feeli..> | 2026-05-22 19:57 | 214K | |
| Five & Queen - We Wi..> | 2026-05-22 20:06 | 29K | |
| Fisher - Losing It.jpg | 2026-05-22 20:06 | 448K | |
| Fish - A Gentleman's..> | 2026-05-22 20:06 | 49K | |
| Fischer Z - The Work..> | 2026-05-22 19:32 | 15K | |
| Fischer Z - So Long.jpg | 2026-05-22 20:06 | 56K | |
| Fischer Z - So Long ..> | 2026-05-22 19:39 | 27K | |
| Fischer Chöre - La ..> | 2026-05-22 19:32 | 48K | |
| Fischer Cöre - La P..> | 2026-05-22 20:06 | 117K | |
| Fischer-Z - Marliese..> | 2026-05-22 19:39 | 250K | |
| First Class - Beach ..> | 2026-05-22 19:32 | 215K | |
| First Choice - Let N..> | 2026-05-22 19:39 | 50K | |
| First Choice - Dr. L..> | 2026-05-22 19:32 | 85K | |
| First Choice - Docto..> | 2026-05-22 19:39 | 55K | |
| First Aid Kit - My S..> | 2026-05-22 20:35 | 55K | |
| Firm - Star Trekkin'..> | 2026-05-22 19:39 | 146K | |
| Finger And Kadel - M..> | 2026-05-22 20:06 | 74K | |
| Fine Young Cannibals..> | 2026-05-22 19:39 | 47K | |
| Fine Young Cannibals..> | 2026-05-22 19:39 | 47K | |
| Fine Young Cannibals..> | 2026-05-22 19:39 | 37K | |
| Fine Young Cannibals..> | 2026-05-22 19:39 | 47K | |
| Fifth Dimension - Aq..> | 2026-05-22 20:35 | 52K | |
| Fiction Factory - (F..> | 2026-05-22 19:39 | 61K | |
| Fess Parker - Ballad..> | 2026-05-22 20:20 | 111K | |
| Ferry Corsten - The ..> | 2026-05-22 20:06 | 23K | |
| Ferry Corsten - Feel..> | 2026-05-22 20:06 | 60K | |
| Ferry Aid - Let It B..> | 2026-05-22 19:39 | 42K | |
| Ferre Grignard - Yam..> | 2026-05-22 20:35 | 130K | |
| Ferre Grignard - Rin..> | 2026-05-22 20:35 | 35K | |
| Ferre Grignard - Dru..> | 2026-05-22 20:35 | 43K | |
| Ferrari - Sweet Love..> | 2026-05-22 19:32 | 83K | |
| Fern Kinney - Togeth..> | 2026-05-22 19:39 | 47K | |
| Ferlin Husky - Wings..> | 2026-05-22 20:20 | 390K | |
| Ferlin Husky - Littl..> | 2026-05-22 20:20 | 379K | |
| Ferlin Husky - Gone.jpg | 2026-05-22 20:20 | 275K | |
| Ferlin Husky - Giddy..> | 2026-05-22 20:20 | 25K | |
| Fergie - Big Girls D..> | 2026-05-22 20:06 | 28K | |
| Felix Jaehn feat. Sa..> | 2026-05-22 20:06 | 198K | |
| Felix Jaehn Ft. Jasm..> | 2026-05-22 20:06 | 77K | |
| Felix Jaehn & VIZE F..> | 2026-05-22 20:06 | 228K | |
| Felix HarrerJerome -..> | 2026-05-22 20:06 | 25K | |
| Felix - It Will Make..> | 2026-05-22 19:57 | 73K | |
| Felix - Don't You Wa..> | 2026-05-22 19:57 | 16K | |
| Feel the power - Mik..> | 2026-05-22 19:29 | 3.1K | |
| Feel good hits - Ann..> | 2026-05-22 19:29 | 3.1K | |
| Feder Ft. Lyse - Goo..> | 2026-05-22 20:06 | 13K | |
| Fedde Le Grand - Put..> | 2026-05-22 20:06 | 45K | |
| Feb - Don't Stop the..> | 2026-05-22 20:06 | 321K | |
| Feargal Sharkey - A ..> | 2026-05-22 19:39 | 7.1K | |
| Faye Tucker - I Real..> | 2026-05-22 20:20 | 145K | |
| Faye Tucker - I Fall..> | 2026-05-22 20:20 | 457K | |
| Faye Tucker - Crazy.jpg | 2026-05-22 20:20 | 196K | |
| Fay Lovsky - Don't F..> | 2026-05-22 19:39 | 27K | |
| Fay Lovsky - Christm..> | 2026-05-22 19:39 | 27K | |
| Faul & Wad Ad vs. Pn..> | 2026-05-22 20:06 | 62K | |
| Fats Domino - When I..> | 2026-05-22 19:57 | 51K | |
| Fats Domino - Walkin..> | 2026-05-22 20:35 | 40K | |
| Fats Domino - There ..> | 2026-05-22 20:35 | 52K | |
| Fats Domino - Red Sa..> | 2026-05-22 20:35 | 92K | |
| Fats Domino - My Gir..> | 2026-05-22 20:35 | 40K | |
| Fats Domino - Lovely..> | 2026-05-22 20:35 | 422K | |
| Fats Domino - Jambal..> | 2026-05-22 20:35 | 40K | |
| Fats Domino - I'm Wa..> | 2026-05-22 20:35 | 43K | |
| Fats Domino - I'm Re..> | 2026-05-22 19:57 | 40K | |
| Fats Domino - Bluebe..> | 2026-05-22 20:35 | 40K | |
| Fats Domino - Blue M..> | 2026-05-22 19:39 | 1.6M | |
| Fats Domino - Be My ..> | 2026-05-22 19:32 | 18K | |
| Fatboy Slim - Praise..> | 2026-05-22 20:06 | 50K | |
| Fat Tony - Gimme Gim..> | 2026-05-22 20:06 | 282K | |
| Fat Larry's Band - Z..> | 2026-05-22 19:39 | 50K | |
| Farm - All Together ..> | 2026-05-22 19:57 | 34K | |
| Farley Jackmaster Fu..> | 2026-05-22 19:39 | 263K | |
| Far Corporation - St..> | 2026-05-22 19:39 | 53K | |
| Fantastique - Mama T..> | 2026-05-22 19:39 | 39K | |
| Fancy - Bolero (Hol..> | 2026-05-22 19:39 | 80K | |
| Family Of The Year -..> | 2026-05-22 20:06 | 175K | |
| Family Dogg - A way ..> | 2026-05-22 20:35 | 46K | |
| Familee - The Story ..> | 2026-05-22 19:32 | 44K | |
| Falco - Rock Me Amad..> | 2026-05-22 19:39 | 42K | |
| Falco - Jeanny.jpg | 2026-05-22 20:35 | 48K | |
| Falco - Jeanny (Part..> | 2026-05-22 19:39 | 65K | |
| Falco - Der kommissa..> | 2026-05-22 19:39 | 65K | |
| Falco - Coming Home ..> | 2026-05-22 19:39 | 15K | |
| FaithlessDavid Guett..> | 2026-05-22 20:06 | 80K | |
| Faithless - We Come ..> | 2026-05-22 20:06 | 17K | |
| Faithless - Insomnia..> | 2026-05-22 19:57 | 22K | |
| Faithless - Insomnia..> | 2026-05-22 20:06 | 87K | |
| Faithless - God Is A..> | 2026-05-22 20:06 | 17K | |
| Faithless - God Is A..> | 2026-05-22 19:57 | 17K | |
| Faith No More - Easy..> | 2026-05-22 19:57 | 38K | |
| Faith Hill - You Giv..> | 2026-05-22 20:20 | 114K | |
| Faith Hill - Wild On..> | 2026-05-22 20:20 | 140K | |
| Faith Hill - This Ki..> | 2026-05-22 20:20 | 164K | |
| Faith Hill - The Way..> | 2026-05-22 20:20 | 202K | |
| Faith Hill - Take Me..> | 2026-05-22 20:20 | 140K | |
| Faith Hill - Someone..> | 2026-05-22 20:20 | 208K | |
| Faith Hill - Piece o..> | 2026-05-22 20:20 | 240K | |
| Faith Hill - Me.jpg | 2026-05-22 20:20 | 114K | |
| Faith Hill - Love Ai..> | 2026-05-22 20:20 | 114K | |
| Faith Hill - Let Me ..> | 2026-05-22 20:20 | 114K | |
| Faith Hill - Let's G..> | 2026-05-22 20:20 | 208K | |
| Faith Hill - It Matt..> | 2026-05-22 20:20 | 208K | |
| Faith Hill - Breathe..> | 2026-05-22 20:20 | 202K | |
| Faith Hill - (Everyt..> | 2026-05-22 20:35 | 224K | |
| Faith Hill, Tim McGr..> | 2026-05-22 20:20 | 197K | |
| Faith Evans - Mesmer..> | 2026-05-22 20:06 | 44K | |
| Fairground Attractio..> | 2026-05-22 20:35 | 54K | |
| Fairground Attractio..> | 2026-05-22 19:39 | 11K | |
| Fab & Mc Parker - Th..> | 2026-05-22 19:57 | 482K | |
| F.R. David - Words.jpg | 2026-05-22 19:39 | 37K | |
| F.P.I. Project Feat...> | 2026-05-22 19:57 | 50K | |
| Eydie Gormé Y Los P..> | 2026-05-22 19:57 | 42K | |
| Eydie Gormé Y Los P..> | 2026-05-22 19:39 | 213K | |
| Eydie Gormé - Blame..> | 2026-05-22 20:35 | 22K | |
| Extreme - More Than ..> | 2026-05-22 20:35 | 49K | |
| Extreme - Hole-Heart..> | 2026-05-22 20:06 | 71K | |
| Expose - When I Look..> | 2026-05-22 19:39 | 96K | |
| Exile - Yet.jpg | 2026-05-22 20:20 | 60K | |
| Exile - Woke Up in L..> | 2026-05-22 20:20 | 271K | |
| Exile - She's a Mira..> | 2026-05-22 20:20 | 271K | |
| Exile - She's Too Go..> | 2026-05-22 20:20 | 271K | |
| Exile - Nobody's Tal..> | 2026-05-22 20:20 | 143K | |
| Exile - Kiss You All..> | 2026-05-22 19:32 | 78K | |
| Exile - It'll Be Me ..> | 2026-05-22 20:20 | 260K | |
| Exile - I Don't Want..> | 2026-05-22 20:20 | 312K | |
| Exile - I Could Get ..> | 2026-05-22 20:20 | 155K | |
| Exile - I Can't Get ..> | 2026-05-22 20:20 | 271K | |
| Exile - Hang On to Y..> | 2026-05-22 20:20 | 271K | |
| Exile - Give Me One ..> | 2026-05-22 20:20 | 186K | |
| Exile - Crazy for Yo..> | 2026-05-22 20:20 | 271K | |
| Everything But The G..> | 2026-05-22 19:57 | 174K | |
| Everything But The G..> | 2026-05-22 19:39 | 44K | |
| Everly Brothers - Wh..> | 2026-05-22 19:57 | 69K | |
| Everly Brothers - Wa..> | 2026-05-22 20:35 | 48K | |
| Everly Brothers - Ti..> | 2026-05-22 19:39 | 403K | |
| Everly Brothers - Th..> | 2026-05-22 19:39 | 203K | |
| Everly Brothers - Te..> | 2026-05-22 20:06 | 40K | |
| Everly Brothers - Lu..> | 2026-05-22 20:35 | 48K | |
| Everly Brothers - Lo..> | 2026-05-22 20:35 | 40K | |
| Everly Brothers - Lo..> | 2026-05-22 20:35 | 48K | |
| Everly Brothers - Le..> | 2026-05-22 19:57 | 68K | |
| Everly Brothers - Cr..> | 2026-05-22 19:57 | 51K | |
| Everly Brothers - Ca..> | 2026-05-22 20:35 | 47K | |
| Everly Brothers - By..> | 2026-05-22 20:35 | 59K | |
| Everly Brothers - Bi..> | 2026-05-22 19:39 | 282K | |
| Everly Brothers, The..> | 2026-05-22 19:39 | 49K | |
| Evelyn Thomas - High..> | 2026-05-22 19:39 | 55K | |
| Evelyn 'champagne' K..> | 2026-05-22 19:32 | 37K | |
| Evanescence - My Imm..> | 2026-05-22 20:06 | 53K | |
| Eva Olmerová - Geor..> | 2026-05-22 20:20 | 38K | |
| Eva Cassidy - Tennes..> | 2026-05-22 20:20 | 44K | |
| Eva Cassidy - Songbi..> | 2026-05-22 19:57 | 14K | |
| Eva Cassidy - Fields..> | 2026-05-22 19:57 | 14K | |
| Euson - Life Is On M..> | 2026-05-22 19:32 | 20K | |
| Euson - Leon.jpg | 2026-05-22 19:32 | 83K | |
| Euson - I Use The So..> | 2026-05-22 19:32 | 101K | |
| Euson - Both Sides N..> | 2026-05-22 19:32 | 84K | |
| Eurythmics - Would I..> | 2026-05-22 19:39 | 28K | |
| Eurythmics - Who's T..> | 2026-05-22 19:39 | 32K | |
| Eurythmics - When To..> | 2026-05-22 19:39 | 28K | |
| Eurythmics - There M..> | 2026-05-22 19:39 | 24K | |
| Eurythmics - Sweet D..> | 2026-05-22 19:39 | 42K | |
| Eurythmics - Sexcrim..> | 2026-05-22 19:39 | 49K | |
| Eurythmics - Right B..> | 2026-05-22 19:39 | 29K | |
| Eurythmics - Miracle..> | 2026-05-22 19:39 | 28K | |
| Eurythmics - Love Is..> | 2026-05-22 19:39 | 31K | |
| Eurythmics - It's Al..> | 2026-05-22 19:39 | 28K | |
| Eurythmics - Here Co..> | 2026-05-22 19:39 | 31K | |
| Eurythmics & Aretha ..> | 2026-05-22 19:39 | 42K | |
| Europe - The Final C..> | 2026-05-22 19:39 | 46K | |
| Europe - Carrie.jpg | 2026-05-22 19:39 | 52K | |
| Eumir Deodato - Also..> | 2026-05-22 19:32 | 116K | |
| Etta James - I Just ..> | 2026-05-22 19:32 | 43K | |
| Etta James - I Just ..> | 2026-05-22 20:35 | 186K | |
| Eternal - Angel of m..> | 2026-05-22 20:35 | 34K | |
| Eternal & Bebe Winan..> | 2026-05-22 19:57 | 41K | |
| Esther Phillips - Wh..> | 2026-05-22 19:32 | 223K | |
| Esther & Abi Ofarim ..> | 2026-05-22 20:35 | 112K | |
| Esther & Abi Ofarim ..> | 2026-05-22 20:35 | 14K | |
| Estelle Feat. Kanye ..> | 2026-05-22 20:06 | 42K | |
| Estelle - American B..> | 2026-05-22 20:06 | 42K | |
| Espen Lind - When Su..> | 2026-05-22 20:35 | 25K | |
| Esmée Denters - Out..> | 2026-05-22 20:06 | 54K | |
| Eruption - One Way T..> | 2026-05-22 19:32 | 37K | |
| Eruption - I Can't S..> | 2026-05-22 19:32 | 356K | |
| Erste Allgemeine Ver..> | 2026-05-22 19:39 | 49K | |
| Eros Ramazzotti - Un..> | 2026-05-22 20:06 | 48K | |
| Eros Ramazzotti - Te..> | 2026-05-22 19:39 | 70K | |
| Eros Ramazzotti - Se..> | 2026-05-22 19:57 | 25K | |
| Eros Ramazzotti - Pi..> | 2026-05-22 19:57 | 25K | |
| Eros Ramazzotti - Mu..> | 2026-05-22 19:57 | 25K | |
| Eros Ramazzotti - Ma..> | 2026-05-22 19:39 | 57K | |
| Eros Ramazzotti - Co..> | 2026-05-22 19:57 | 25K | |
| Eros Ramazzotti & Ti..> | 2026-05-22 19:57 | 45K | |
| Eros Ramazzotti & Ic..> | 2026-05-22 19:57 | 2.0M | |
| Eros Ramazzotti & An..> | 2026-05-22 20:06 | 39K | |
| Eros Ramazotti - Mus..> | 2026-05-22 19:39 | 55K | |
| Erma Franklin - Piec..> | 2026-05-22 20:06 | 33K | |
| Erik Mesie - Zonder ..> | 2026-05-22 19:57 | 323K | |
| Eric Weissberg and S..> | 2026-05-22 20:20 | 72K | |
| Eric Weissberg & Ste..> | 2026-05-22 20:35 | 49K | |
| Eric Prydz Vs. Pink ..> | 2026-05-22 20:06 | 37K | |
| Eric Clapton - Worri..> | 2026-05-22 20:35 | 63K | |
| Eric Clapton - Wonde..> | 2026-05-22 20:35 | 50K | |
| Eric Clapton - Walki..> | 2026-05-22 20:35 | 63K | |
| Eric Clapton - Tears..> | 2026-05-22 20:35 | 80K | |
| Eric Clapton - Tears..> | 2026-05-22 19:57 | 54K | |
| Eric Clapton - Signe..> | 2026-05-22 20:35 | 63K | |
| Eric Clapton - San F..> | 2026-05-22 20:35 | 63K | |
| Eric Clapton - Runni..> | 2026-05-22 20:35 | 23K | |
| Eric Clapton - Rolli..> | 2026-05-22 20:35 | 63K | |
| Eric Clapton - Nobod..> | 2026-05-22 20:35 | 23K | |
| Eric Clapton - My Fa..> | 2026-05-22 20:35 | 63K | |
| Eric Clapton - Malte..> | 2026-05-22 20:35 | 63K | |
| Eric Clapton - Lonel..> | 2026-05-22 20:35 | 42K | |
| Eric Clapton - Layla..> | 2026-05-22 20:35 | 42K | |
| Eric Clapton - Lay D..> | 2026-05-22 19:32 | 541K | |
| Eric Clapton - Knock..> | 2026-05-22 19:32 | 25K | |
| Eric Clapton - I Sho..> | 2026-05-22 19:32 | 85K | |
| Eric Clapton - Hey H..> | 2026-05-22 20:35 | 42K | |
| Eric Clapton - Forev..> | 2026-05-22 19:39 | 23K | |
| Eric Clapton - Cocai..> | 2026-05-22 19:32 | 152K | |
| Eric Clapton - Circu..> | 2026-05-22 20:35 | 39K | |
| Eric Clapton - Chang..> | 2026-05-22 19:57 | 40K | |
| Eric Clapton - Befor..> | 2026-05-22 20:35 | 42K | |
| Eric Clapton - Alber..> | 2026-05-22 20:35 | 42K | |
| Eric Clapton - After..> | 2026-05-22 19:32 | 254K | |
| Eric Clapton & Sting..> | 2026-05-22 19:57 | 32K | |
| Eric Church - Spring..> | 2026-05-22 20:20 | 51K | |
| Eric Carmen - Hungry..> | 2026-05-22 19:39 | 33K | |
| Eric Carmen - All by..> | 2026-05-22 19:32 | 289K | |
| Eric Burdon - Paint ..> | 2026-05-22 19:32 | 70K | |
| Eric Burdon & The An..> | 2026-05-22 20:35 | 144K | |
| Eric Burdon & The An..> | 2026-05-22 20:35 | 281K | |
| Eric Burdon & The An..> | 2026-05-22 20:35 | 22K | |
| Eric B & Rakim - Fol..> | 2026-05-22 19:39 | 36K | |
| Eric & The Good Good..> | 2026-05-22 19:39 | 33K | |
| Erasure - Take A Cha..> | 2026-05-22 19:57 | 51K | |
| Erasure - Sometimes.jpg | 2026-05-22 19:39 | 46K | |
| Erasure - It Doesn't..> | 2026-05-22 19:39 | 46K | |
| Erasure - Abba Esque..> | 2026-05-22 19:57 | 51K | |
| Era - Winds Of Hope.jpg | 2026-05-22 20:35 | 299K | |
| Era - Voxifera.jpg | 2026-05-22 20:35 | 67K | |
| Era - Voxifera (rock..> | 2026-05-22 20:35 | 67K | |
| Era - Vivaldi & Wind..> | 2026-05-22 20:35 | 69K | |
| Era - Vivaldi & Suns..> | 2026-05-22 20:35 | 69K | |
| Era - Verdi & The Ch..> | 2026-05-22 20:35 | 69K | |
| Era - Verdi & Arisin..> | 2026-05-22 20:35 | 69K | |
| Era - Thunder Flash.jpg | 2026-05-22 20:35 | 62K | |
| Era - The Mass.jpg | 2026-05-22 20:35 | 85K | |
| Era - The Mas Remix ..> | 2026-05-22 20:35 | 85K | |
| Era - The Chosen Pat..> | 2026-05-22 20:35 | 299K | |
| Era - The Champions.jpg | 2026-05-22 20:35 | 85K | |
| Era - Sunset Drive.jpg | 2026-05-22 20:35 | 299K | |
| Era - Something Exci..> | 2026-05-22 20:35 | 35K | |
| Era - Sombre Day.jpg | 2026-05-22 20:35 | 85K | |
| Era - Sinfoni Deo.jpg | 2026-05-22 20:35 | 59K | |
| Era - Sentence.jpg | 2026-05-22 20:35 | 55K | |
| Era - Sempire d'Amor..> | 2026-05-22 20:35 | 55K | |
| Era - Ritus Pacis.jpg | 2026-05-22 20:35 | 299K | |
| Era - Redemption.jpg | 2026-05-22 20:35 | 299K | |
| Era - Reborn.jpg | 2026-05-22 20:35 | 59K | |
| Era - Prelude.jpg | 2026-05-22 20:35 | 62K | |
| Era - Prayers.jpg | 2026-05-22 20:35 | 1.4M | |
| Era - Prayer.jpg | 2026-05-22 20:35 | 59K | |
| Era - Outro Madeus.jpg | 2026-05-22 20:35 | 62K | |
| Era - Omen Sore.jpg | 2026-05-22 20:35 | 55K | |
| Era - Not This Time.jpg | 2026-05-22 20:35 | 7.0K | |
| Era - Nomen Adore.jpg | 2026-05-22 20:35 | 67K | |
| Era - Mother.jpg | 2026-05-22 20:35 | 55K | |
| Era - Misere Mani.jpg | 2026-05-22 20:35 | 55K | |
| Era - Mirror.jpg | 2026-05-22 20:35 | 55K | |
| Era - Malher & Adagi..> | 2026-05-22 20:35 | 69K | |
| Era - Madona.jpg | 2026-05-22 20:35 | 55K | |
| Era - Madeus.jpg | 2026-05-22 20:35 | 62K | |
| Era - Looking for So..> | 2026-05-22 20:35 | 85K | |
| Era - Looking For So..> | 2026-05-22 20:35 | 85K | |
| Era - Levi & Sombre ..> | 2026-05-22 20:35 | 69K | |
| Era - Last Song.jpg | 2026-05-22 20:35 | 59K | |
| Era - Kilimandjaro.jpg | 2026-05-22 20:35 | 59K | |
| Era - Kilimandiaro (..> | 2026-05-22 20:35 | 67K | |
| Era - Journey.jpg | 2026-05-22 20:35 | 62K | |
| Era - Infanati.jpg | 2026-05-22 20:35 | 55K | |
| Era - In Fine.jpg | 2026-05-22 20:34 | 55K | |
| Era - Impera.jpg | 2026-05-22 20:34 | 55K | |
| Era - If You Shout.jpg | 2026-05-22 20:34 | 85K | |
| Era - I Fall for You..> | 2026-05-22 20:34 | 67K | |
| Era - I'm No Angel.jpg | 2026-05-22 20:34 | 62K | |
| Era - Hymne.jpg | 2026-05-22 20:34 | 55K | |
| Era - Hurricane.jpg | 2026-05-22 20:34 | 67K | |
| Era - Haendel & Dark..> | 2026-05-22 20:34 | 69K | |
| Era - Freedom.jpg | 2026-05-22 20:34 | 7.0K | |
| Era - Era.jpg | 2026-05-22 20:34 | 55K | |
| Era - Enae Volare me..> | 2026-05-22 20:34 | 55K | |
| Era - Enae Volare.jpg | 2026-05-22 20:34 | 85K | |
| Era - Don't You Forg..> | 2026-05-22 20:34 | 85K | |
| Era - Don't U.jpg | 2026-05-22 20:34 | 55K | |
| Era - Don't Go Away.jpg | 2026-05-22 20:34 | 85K | |
| Era - Divano.jpg | 2026-05-22 20:34 | 55K | |
| Era - Devore Amante.jpg | 2026-05-22 20:34 | 55K | |
| Era - Dark Wonders.jpg | 2026-05-22 20:34 | 299K | |
| Era - Dark Voices.jpg | 2026-05-22 20:34 | 59K | |
| Era - Come Into My W..> | 2026-05-22 20:34 | 59K | |
| Era - Come Into My W..> | 2026-05-22 20:34 | 59K | |
| Era - Cathar Rhythm.jpg | 2026-05-22 20:34 | 55K | |
| Era - Caccinni & Red..> | 2026-05-22 20:34 | 69K | |
| Era - Barber & Adagi..> | 2026-05-22 20:34 | 69K | |
| Era - Bach & Ritus P..> | 2026-05-22 20:34 | 69K | |
| Era - Avemano Orches..> | 2026-05-22 20:34 | 85K | |
| Era - Avemano.jpg | 2026-05-22 20:34 | 55K | |
| Era - Ave Paternum D..> | 2026-05-22 20:34 | 62K | |
| Era - Arising Force.jpg | 2026-05-22 20:34 | 299K | |
| Era - Ameno Metal.jpg | 2026-05-22 20:34 | 7.0K | |
| Era - Ameno.jpg | 2026-05-22 20:34 | 55K | |
| Era - Ameno (remix).jpg | 2026-05-22 20:34 | 55K | |
| Era - Ameno (The Cit..> | 2026-05-22 20:34 | 67K | |
| Era - Agnus Deorem.jpg | 2026-05-22 20:34 | 35K | |
| Era - After Thousand..> | 2026-05-22 20:34 | 1.4M | |
| Era - Adagietto.jpg | 2026-05-22 20:34 | 299K | |
| Era - Abbey Road Blu..> | 2026-05-22 20:34 | 62K | |
| Era - A Brand New Da..> | 2026-05-22 20:34 | 62K | |
| Era - 7 Seconds.jpg | 2026-05-22 20:34 | 67K | |
| Era & Arielle Dombas..> | 2026-05-22 20:35 | 53K | |
| Era & Arielle Dombas..> | 2026-05-22 20:35 | 53K | |
| Equals - Baby come b..> | 2026-05-22 20:34 | 25K | |
| Enya - Triad St. Pat..> | 2026-05-22 20:34 | 49K | |
| Enya - To Go Beyond ..> | 2026-05-22 20:34 | 49K | |
| Enya - To Go Beyond ..> | 2026-05-22 20:34 | 49K | |
| Enya - The Sun in th..> | 2026-05-22 20:34 | 49K | |
| Enya - The Celts.jpg | 2026-05-22 20:34 | 49K | |
| Enya - Smaointe....jpg | 2026-05-22 20:34 | 37K | |
| Enya - Shepherd Moon..> | 2026-05-22 20:34 | 37K | |
| Enya - Portrait.jpg | 2026-05-22 20:34 | 49K | |
| Enya - Orinoco Flow ..> | 2026-05-22 20:34 | 21K | |
| Enya - Only Time.jpg | 2026-05-22 20:34 | 47K | |
| Enya - No Holly for ..> | 2026-05-22 20:34 | 37K | |
| Enya - March of the ..> | 2026-05-22 20:34 | 49K | |
| Enya - Marble Halls.jpg | 2026-05-22 20:34 | 37K | |
| Enya - Lothlórien.jpg | 2026-05-22 20:34 | 101K | |
| Enya - I Want Tomorr..> | 2026-05-22 20:34 | 49K | |
| Enya - How Can I Kee..> | 2026-05-22 20:34 | 37K | |
| Enya - Fairytale.jpg | 2026-05-22 20:34 | 49K | |
| Enya - Evacuee.jpg | 2026-05-22 20:34 | 37K | |
| Enya - Epona.jpg | 2026-05-22 20:34 | 49K | |
| Enya - Ebudae.jpg | 2026-05-22 20:34 | 37K | |
| Enya - Deireadh an T..> | 2026-05-22 20:34 | 49K | |
| Enya - Dan Y Dŵr.jpg | 2026-05-22 20:34 | 49K | |
| Enya - Caribbean Blu..> | 2026-05-22 20:34 | 37K | |
| Enya - Book of Days ..> | 2026-05-22 20:34 | 37K | |
| Enya - Boadicea.jpg | 2026-05-22 20:34 | 49K | |
| Enya - Bard Dance.jpg | 2026-05-22 20:34 | 49K | |
| Enya - Angeles.jpg | 2026-05-22 20:34 | 37K | |
| Enya - Aldebaran (De..> | 2026-05-22 20:34 | 49K | |
| Enya - Afer Ventus.jpg | 2026-05-22 20:34 | 37K | |
| Enrique Iglesias Fea..> | 2026-05-22 20:06 | 28K | |
| Enrique Iglesias - T..> | 2026-05-22 20:06 | 33K | |
| Enrique Iglesias - R..> | 2026-05-22 20:06 | 32K | |
| Enrique Iglesias - H..> | 2026-05-22 20:06 | 39K | |
| Enrique Iglesias - E..> | 2026-05-22 20:06 | 40K | |
| Enrique Iglesias - D..> | 2026-05-22 20:06 | 40K | |
| Enrique Iglesias - B..> | 2026-05-22 19:57 | 56K | |
| Enrique Iglesias & W..> | 2026-05-22 20:06 | 33K | |
| Ennio Morricone - On..> | 2026-05-22 20:34 | 20K | |
| Ennio Morricone - Il..> | 2026-05-22 19:32 | 50K | |
| Ennio Maricone - Il ..> | 2026-05-22 20:20 | 42K | |
| Enio Moriccone - ''F..> | 2026-05-22 20:34 | 43K | |
| Enigma - The Voice o..> | 2026-05-22 20:34 | 181K | |
| Enigma - The Voice &..> | 2026-05-22 20:34 | 181K | |
| Enigma - The Eyes Of..> | 2026-05-22 19:57 | 63K | |
| Enigma - Sadeness Pa..> | 2026-05-22 20:34 | 61K | |
| Enigma - Sadeness Pa..> | 2026-05-22 19:57 | 232K | |
| Enigma - Sadeness.jpg | 2026-05-22 20:34 | 181K | |
| Enigma - Return to i..> | 2026-05-22 20:34 | 37K | |
| Enigma - Principles ..> | 2026-05-22 20:34 | 181K | |
| Enigma - Mea Culpa P..> | 2026-05-22 19:57 | 16K | |
| Enigma - Mea Culpa P..> | 2026-05-22 19:57 | 250K | |
| Enigma - Mea Culpa.jpg | 2026-05-22 20:34 | 181K | |
| Enigma - Knocking on..> | 2026-05-22 20:34 | 181K | |
| Enigma - Callas Went..> | 2026-05-22 20:34 | 181K | |
| Enigma - Back To The..> | 2026-05-22 20:34 | 181K | |
| Enigma - Age of Lone..> | 2026-05-22 19:57 | 56K | |
| England Dan & John F..> | 2026-05-22 19:32 | 30K | |
| Engelbert Humperdinc..> | 2026-05-22 20:34 | 80K | |
| Engelbert Humperdinc..> | 2026-05-22 20:34 | 55K | |
| Engelbert Humperdinc..> | 2026-05-22 20:34 | 122K | |
| Engelbert Humperdinc..> | 2026-05-22 20:34 | 29K | |
| Engelbert Humperdinc..> | 2026-05-22 20:06 | 35K | |
| Engelbert Humperdinc..> | 2026-05-22 20:34 | 35K | |
| Engelbert Humperdinc..> | 2026-05-22 20:34 | 71K | |
| Engelbert Humperdinc..> | 2026-05-22 20:34 | 197K | |
| Ending 2.jpg | 2026-05-22 19:29 | 3.1K | |
| Ending 1.jpg | 2026-05-22 19:29 | 3.1K | |
| En Vogue - My Lovin'..> | 2026-05-22 19:57 | 40K | |
| En Vogue - Hold On (..> | 2026-05-22 19:57 | 51K | |
| En Vogue - Free Your..> | 2026-05-22 19:57 | 40K | |
| En Vogue - Don't Let..> | 2026-05-22 19:57 | 40K | |
| Emotions - I Should ..> | 2026-05-22 19:32 | 79K | |
| Emotions - Best Of M..> | 2026-05-22 19:32 | 299K | |
| Emmylou Harris - You..> | 2026-05-22 19:32 | 193K | |
| Emmylou Harris - You..> | 2026-05-22 20:34 | 39K | |
| Emmylou Harris - Two..> | 2026-05-22 20:20 | 204K | |
| Emmylou Harris - Tog..> | 2026-05-22 20:20 | 254K | |
| Emmylou Harris - Swe..> | 2026-05-22 20:20 | 205K | |
| Emmylou Harris - Sav..> | 2026-05-22 20:20 | 180K | |
| Emmylou Harris - Sav..> | 2026-05-22 20:34 | 35K | |
| Emmylou Harris - One..> | 2026-05-22 20:20 | 254K | |
| Emmylou Harris - Mis..> | 2026-05-22 20:20 | 24K | |
| Emmylou Harris - I R..> | 2026-05-22 19:32 | 88K | |
| Emmylou Harris - Fee..> | 2026-05-22 20:20 | 102K | |
| Emmylou Harris - Bor..> | 2026-05-22 20:20 | 181K | |
| Emmylou Harris - (Yo..> | 2026-05-22 20:20 | 194K | |
| Emmylou, Dolly, Lind..> | 2026-05-22 20:34 | 376K | |
| Emmylou, Dolly, Lind..> | 2026-05-22 20:34 | 51K | |
| Emmylou, Dolly, Lind..> | 2026-05-22 20:34 | 51K | |
| Emmylou, Dolly, Lind..> | 2026-05-22 20:34 | 51K | |
| Emmelie de Forest - ..> | 2026-05-22 20:06 | 46K | |
| Eminem ft. Rihanna -..> | 2026-05-22 20:06 | 53K | |
| Eminem - The Real Sl..> | 2026-05-22 20:06 | 277K | |
| Eminem - Lose Yourse..> | 2026-05-22 20:06 | 65K | |
| Eminem & Dido - Stan..> | 2026-05-22 20:34 | 65K | |
| Emilio Navaira - It'..> | 2026-05-22 20:20 | 240K | |
| Emilia - Big big wor..> | 2026-05-22 20:34 | 26K | |
| Emile Ford & The Che..> | 2026-05-22 19:57 | 47K | |
| Emf - Unbelievable.jpg | 2026-05-22 19:57 | 62K | |
| Emerson, Lake & Palm..> | 2026-05-22 19:32 | 187K | |
| Emerson, Lake & Palm..> | 2026-05-22 19:39 | 29K | |
| Emerson, Lake & Palm..> | 2026-05-22 19:32 | 78K | |
| Emerson, Lake & Palm..> | 2026-05-22 19:32 | 232K | |
| Emeli Sandé - Read ..> | 2026-05-22 20:06 | 36K | |
| Emeli Sandé - Next ..> | 2026-05-22 20:06 | 36K | |
| Emeli Sandé - Clown..> | 2026-05-22 20:06 | 26K | |
| Elvis Presley Vs. Jx..> | 2026-05-22 19:57 | 47K | |
| Elvis Presley - You ..> | 2026-05-22 19:32 | 35K | |
| Elvis Presley - Wood..> | 2026-05-22 19:32 | 26K | |
| Elvis Presley - Wood..> | 2026-05-22 19:57 | 163K | |
| Elvis Presley - Way ..> | 2026-05-22 20:20 | 68K | |
| Elvis Presley - Viva..> | 2026-05-22 19:32 | 43K | |
| Elvis Presley - That..> | 2026-05-22 19:39 | 193K | |
| Elvis Presley - Susp..> | 2026-05-22 20:34 | 68K | |
| Elvis Presley - Susp..> | 2026-05-22 19:39 | 6.5K | |
| Elvis Presley - Such..> | 2026-05-22 20:34 | 148K | |
| Elvis Presley - She ..> | 2026-05-22 19:57 | 28K | |
| Elvis Presley - Retu..> | 2026-05-22 20:34 | 12K | |
| Elvis Presley - One ..> | 2026-05-22 20:34 | 12K | |
| Elvis Presley - My w..> | 2026-05-22 19:32 | 22K | |
| Elvis Presley - My W..> | 2026-05-22 20:20 | 276K | |
| Elvis Presley - My B..> | 2026-05-22 19:32 | 35K | |
| Elvis Presley - Mood..> | 2026-05-22 20:34 | 18K | |
| Elvis Presley - Love..> | 2026-05-22 20:34 | 12K | |
| Elvis Presley - Love..> | 2026-05-22 20:34 | 153K | |
| Elvis Presley - Litt..> | 2026-05-22 19:32 | 38K | |
| Elvis Presley - Kiss..> | 2026-05-22 19:39 | 34K | |
| Elvis Presley - Kent..> | 2026-05-22 20:20 | 73K | |
| Elvis Presley - Jail..> | 2026-05-22 19:32 | 52K | |
| Elvis Presley - Its ..> | 2026-05-22 20:34 | 38K | |
| Elvis Presley - In T..> | 2026-05-22 20:34 | 38K | |
| Elvis Presley - I Ju..> | 2026-05-22 19:32 | 26K | |
| Elvis Presley - Houn..> | 2026-05-22 20:34 | 27K | |
| Elvis Presley - Hear..> | 2026-05-22 20:34 | 12K | |
| Elvis Presley - Guit..> | 2026-05-22 19:39 | 33K | |
| Elvis Presley - Good..> | 2026-05-22 19:32 | 12K | |
| Elvis Presley - Gent..> | 2026-05-22 20:20 | 88K | |
| Elvis Presley - For ..> | 2026-05-22 20:34 | 229K | |
| Elvis Presley - Foll..> | 2026-05-22 20:20 | 276K | |
| Elvis Presley - Don'..> | 2026-05-22 20:34 | 38K | |
| Elvis Presley - Don'..> | 2026-05-22 19:32 | 21K | |
| Elvis Presley - Don..> | 2026-05-22 20:34 | 12K | |
| Elvis Presley - Cryi..> | 2026-05-22 20:34 | 36K | |
| Elvis Presley - Can'..> | 2026-05-22 20:34 | 55K | |
| Elvis Presley - Burn..> | 2026-05-22 19:32 | 229K | |
| Elvis Presley - Boss..> | 2026-05-22 19:32 | 37K | |
| Elvis Presley - Blue..> | 2026-05-22 20:34 | 36K | |
| Elvis Presley - Are ..> | 2026-05-22 20:34 | 30K | |
| Elvis Presley - Are ..> | 2026-05-22 20:34 | 40K | |
| Elvis Presley - Alwa..> | 2026-05-22 19:32 | 70K | |
| Elvis Presley - All ..> | 2026-05-22 20:34 | 36K | |
| Elvis Presley - A Li..> | 2026-05-22 19:57 | 46K | |
| Elvis Presley - (You..> | 2026-05-22 19:57 | 38K | |
| Elvis Presley - (Now..> | 2026-05-22 19:32 | 12K | |
| Elvis Presley - (Mar..> | 2026-05-22 19:32 | 12K | |
| Elvis Presley - (Let..> | 2026-05-22 20:34 | 33K | |
| Elvis Presley & The ..> | 2026-05-22 19:32 | 179K | |
| Elvis Presley & The ..> | 2026-05-22 19:39 | 37K | |
| Elvis Crespo - Suave..> | 2026-05-22 19:57 | 44K | |
| Elvis Costello - Wat..> | 2026-05-22 19:32 | 374K | |
| Elvis Costello - Oli..> | 2026-05-22 19:32 | 148K | |
| Elvis Costello - I W..> | 2026-05-22 20:34 | 45K | |
| Elvis Costello - Goo..> | 2026-05-22 20:34 | 49K | |
| Elvis Costello & The..> | 2026-05-22 19:39 | 148K | |
| Elvis & Jxl - A Litt..> | 2026-05-22 20:06 | 47K | |
| Elvis & Jxl - A Litt..> | 2026-05-22 20:06 | 47K | |
| Elvin Bishop - Foole..> | 2026-05-22 19:57 | 49K | |
| Elvin Bishop - Foole..> | 2026-05-22 19:32 | 275K | |
| Elton John - Your So..> | 2026-05-22 20:34 | 29K | |
| Elton John - Tiny Da..> | 2026-05-22 19:32 | 133K | |
| Elton John - The Bit..> | 2026-05-22 19:32 | 207K | |
| Elton John - Sorry s..> | 2026-05-22 19:32 | 23K | |
| Elton John - Song fo..> | 2026-05-22 20:34 | 47K | |
| Elton John - Sad Son..> | 2026-05-22 19:39 | 94K | |
| Elton John - Sacrifi..> | 2026-05-22 19:57 | 74K | |
| Elton John - Rocket ..> | 2026-05-22 19:32 | 27K | |
| Elton John - Rocket..> | 2026-05-22 19:57 | 47K | |
| Elton John - Nikita.jpg | 2026-05-22 19:39 | 45K | |
| Elton John - I Guess..> | 2026-05-22 19:39 | 8.1K | |
| Elton John - I'm Sti..> | 2026-05-22 19:39 | 8.1K | |
| Elton John - Goodbye..> | 2026-05-22 19:32 | 133K | |
| Elton John - Don't L..> | 2026-05-22 19:32 | 43K | |
| Elton John - Don't G..> | 2026-05-22 19:32 | 45K | |
| Elton John - Daniel.jpg | 2026-05-22 19:32 | 34K | |
| Elton John - Crocodi..> | 2026-05-22 19:32 | 34K | |
| Elton John - Circle ..> | 2026-05-22 20:34 | 52K | |
| Elton John - Candle ..> | 2026-05-22 20:34 | 74K | |
| Elton John - Candle ..> | 2026-05-22 20:34 | 41K | |
| Elton John - Can You..> | 2026-05-22 19:57 | 31K | |
| Elton John - Blue Ey..> | 2026-05-22 19:39 | 76K | |
| Elton John & Rupaul ..> | 2026-05-22 19:57 | 37K | |
| Elton John & Kiki De..> | 2026-05-22 19:57 | 74K | |
| Elton John & Kiki De..> | 2026-05-22 20:34 | 63K | |
| Elton John & Dua Lip..> | 2026-05-22 20:06 | 177K | |
| Elton Britt - Someda..> | 2026-05-22 20:34 | 51K | |
| Elo - Roll Over Beet..> | 2026-05-22 19:32 | 36K | |
| Elo - Hold On Tight.jpg | 2026-05-22 19:39 | 33K | |
| Ellie Goulding - Lov..> | 2026-05-22 20:06 | 41K | |
| Ellie Goulding - Bur..> | 2026-05-22 20:06 | 46K | |
| Ellen Foley - What's..> | 2026-05-22 19:32 | 227K | |
| Ellen Foley - We Bel..> | 2026-05-22 19:32 | 164K | |
| Ellen Foley & Jimmy ..> | 2026-05-22 19:39 | 46K | |
| Ella Fitzgerald - Mr..> | 2026-05-22 19:57 | 34K | |
| Ella Fitzgerald - Mi..> | 2026-05-22 20:34 | 32K | |
| Ella Fitzgerald - I'..> | 2026-05-22 20:34 | 75K | |
| Ella Fitzgerald - Ev..> | 2026-05-22 20:34 | 209K | |
| Ella Fitzgerald - Do..> | 2026-05-22 20:34 | 148K | |
| Ella Fitzgerald - Ch..> | 2026-05-22 20:34 | 43K | |
| Ella Fitzgerald - Ca..> | 2026-05-22 20:34 | 51K | |
| Ella Fitzgerald - Ba..> | 2026-05-22 20:34 | 52K | |
| Ella Fitzgerald & Lo..> | 2026-05-22 20:34 | 139K | |
| Elkie Brooks - You'r..> | 2026-05-22 20:34 | 33K | |
| Elkie Brooks - Three..> | 2026-05-22 20:34 | 33K | |
| Elkie Brooks - Pearl..> | 2026-05-22 20:34 | 65K | |
| Elkie Brooks - Lilac..> | 2026-05-22 19:32 | 326K | |
| Elkie Brooks - Is th..> | 2026-05-22 20:34 | 33K | |
| Elkie Brooks - I'll ..> | 2026-05-22 20:34 | 33K | |
| Elkie Brooks - Hard ..> | 2026-05-22 20:34 | 33K | |
| Eliza Doolittle - Pa..> | 2026-05-22 20:06 | 46K | |
| EliZe - Hot Stuff (R..> | 2026-05-22 20:06 | 79K | |
| Elena - Disco Romanc..> | 2026-05-22 20:06 | 56K | |
| Electronica - Der En..> | 2026-05-22 19:39 | 235K | |
| Electric Theatre - B..> | 2026-05-22 19:39 | 32K | |
| Electric Light Orche..> | 2026-05-22 19:32 | 235K | |
| Electric Light Orche..> | 2026-05-22 19:32 | 168K | |
| Electric Light Orche..> | 2026-05-22 19:32 | 36K | |
| Electric Light Orche..> | 2026-05-22 19:57 | 40K | |
| Electric Light Orche..> | 2026-05-22 19:39 | 168K | |
| Electric Light Orche..> | 2026-05-22 19:32 | 41K | |
| Electric Light Orche..> | 2026-05-22 19:32 | 247K | |
| Electric Light Orche..> | 2026-05-22 19:39 | 171K | |
| Electric Light Orche..> | 2026-05-22 19:32 | 39K | |
| Electric Light Orche..> | 2026-05-22 19:32 | 72K | |
| Electric Light Orche..> | 2026-05-22 19:32 | 33K | |
| Electric Light Orche..> | 2026-05-22 19:39 | 325K | |
| Elbow Bones & The Ra..> | 2026-05-22 19:39 | 51K | |
| Elbow - One Day Like..> | 2026-05-22 20:06 | 74K | |
| Elaine Paige & Barba..> | 2026-05-22 19:39 | 35K | |
| El Debarge - Who's J..> | 2026-05-22 19:39 | 7.0K | |
| Ekseption - The 5th.jpg | 2026-05-22 20:34 | 95K | |
| Ekseption - Rhapsody..> | 2026-05-22 20:34 | 95K | |
| Ekseption - Peace Pl..> | 2026-05-22 19:32 | 27K | |
| Ekseption - Italian ..> | 2026-05-22 19:32 | 184K | |
| Ekseption - De Fiets..> | 2026-05-22 19:32 | 320K | |
| Ekseption - Ave Mari..> | 2026-05-22 19:32 | 38K | |
| Ekseption - Air.jpg | 2026-05-22 20:34 | 95K | |
| Ekseption - Adagio.jpg | 2026-05-22 19:32 | 422K | |
| Ekseption - A La Tur..> | 2026-05-22 19:32 | 9.0K | |
| Eiffel 65 - Blue (Da..> | 2026-05-22 19:56 | 49K | |
| Eg Daily - Say It Sa..> | 2026-05-22 19:39 | 92K | |
| Edwyn Collins - A Gi..> | 2026-05-22 19:56 | 27K | |
| Edwin Starr - War.jpg | 2026-05-22 19:32 | 166K | |
| Edwin Hawkins Singer..> | 2026-05-22 19:32 | 107K | |
| Edwin Hawkins Singer..> | 2026-05-22 20:34 | 32K | |
| Edwin Hawkins Singer..> | 2026-05-22 20:34 | 130K | |
| Edward Sharpe & Magn..> | 2026-05-22 20:06 | 236K | |
| Edward Maya Feat. Vi..> | 2026-05-22 20:06 | 61K | |
| Edward Maya Feat. Vi..> | 2026-05-22 20:06 | 165K | |
| Edward Maya Feat. Vi..> | 2026-05-22 20:06 | 51K | |
| Edward Maya - This I..> | 2026-05-22 20:06 | 88K | |
| Edmundo Ross - Londo..> | 2026-05-22 20:06 | 77K | |
| Edmundo Ross & His O..> | 2026-05-22 20:34 | 92K | |
| Edith Piaf - Non, Je..> | 2026-05-22 20:34 | 30K | |
| Edith Piaf - Milord.jpg | 2026-05-22 19:39 | 73K | |
| Edith Piaf - La Vie ..> | 2026-05-22 20:34 | 34K | |
| Edith Piaf - Hymne A..> | 2026-05-22 20:34 | 30K | |
| Edison Lighthouse - ..> | 2026-05-22 19:32 | 297K | |
| Edie Brickell & New ..> | 2026-05-22 19:39 | 27K | |
| Edelweiss - Bring Me..> | 2026-05-22 19:39 | 56K | |
| Eddysons - Ups And D..> | 2026-05-22 20:34 | 355K | |
| Eddy Wally - Cherie ..> | 2026-05-22 19:56 | 64K | |
| Eddy Huntington - U...> | 2026-05-22 19:39 | 217K | |
| Eddy Grant - I Don't..> | 2026-05-22 19:39 | 49K | |
| Eddy Grant - Gimme H..> | 2026-05-22 19:39 | 33K | |
| Eddy Grant - Electri..> | 2026-05-22 19:39 | 49K | |
| Eddy Grant - Electri..> | 2026-05-22 20:06 | 31K | |
| Eddy Arnold - Make t..> | 2026-05-22 20:20 | 39K | |
| Eddy & The Soulband ..> | 2026-05-22 19:39 | 48K | |
| Eddie Rabbitt - You ..> | 2026-05-22 20:20 | 134K | |
| Eddie Rabbitt - You ..> | 2026-05-22 20:20 | 257K | |
| Eddie Rabbitt - We M..> | 2026-05-22 20:20 | 169K | |
| Eddie Rabbitt - Two ..> | 2026-05-22 20:20 | 289K | |
| Eddie Rabbitt - The ..> | 2026-05-22 20:20 | 49K | |
| Eddie Rabbitt - The ..> | 2026-05-22 20:20 | 150K | |
| Eddie Rabbitt - Susp..> | 2026-05-22 20:20 | 457K | |
| Eddie Rabbitt - Step..> | 2026-05-22 20:20 | 150K | |
| Eddie Rabbitt - Some..> | 2026-05-22 20:20 | 195K | |
| Eddie Rabbitt - Rock..> | 2026-05-22 20:20 | 157K | |
| Eddie Rabbitt - Repe..> | 2026-05-22 20:20 | 157K | |
| Eddie Rabbitt - On S..> | 2026-05-22 20:20 | 373K | |
| Eddie Rabbitt - My L..> | 2026-05-22 20:20 | 14K | |
| Eddie Rabbitt - I Lo..> | 2026-05-22 20:34 | 66K | |
| Eddie Rabbitt - I Ju..> | 2026-05-22 20:20 | 110K | |
| Eddie Rabbitt - I Ca..> | 2026-05-22 20:20 | 135K | |
| Eddie Rabbitt - Hear..> | 2026-05-22 20:20 | 110K | |
| Eddie Rabbitt - Gone..> | 2026-05-22 20:20 | 110K | |
| Eddie Rabbitt - Ever..> | 2026-05-22 20:20 | 110K | |
| Eddie Rabbitt - Driv..> | 2026-05-22 20:20 | 361K | |
| Eddie Rabbitt - Driv..> | 2026-05-22 20:34 | 66K | |
| Eddie Murphy - Party..> | 2026-05-22 19:39 | 316K | |
| Eddie Money - Take M..> | 2026-05-22 19:56 | 38K | |
| Eddie Hodges - I'm G..> | 2026-05-22 19:56 | 77K | |
| Eddie Floyd - Knock ..> | 2026-05-22 20:34 | 53K | |
| Eddie Cochran - Thre..> | 2026-05-22 19:39 | 334K | |
| Eddie Cochran - Summ..> | 2026-05-22 20:06 | 46K | |
| Eddie Cochran - C'mo..> | 2026-05-22 19:56 | 91K | |
| Eddie Calvert - Oh M..> | 2026-05-22 20:06 | 34K | |
| Ed Starink - Once Up..> | 2026-05-22 20:20 | 50K | |
| Ed Sheeran ft. Beyon..> | 2026-05-22 20:06 | 107K | |
| Ed Sheeran Ft. Beyon..> | 2026-05-22 20:06 | 5.4M | |
| Ed Sheeran - Thinkin..> | 2026-05-22 20:06 | 36K | |
| Ed Sheeran - The a T..> | 2026-05-22 20:06 | 67K | |
| Ed Sheeran - Shape O..> | 2026-05-22 20:06 | 25K | |
| Ed Sheeran - Lego Ho..> | 2026-05-22 20:34 | 67K | |
| Ed Sheeran - I See F..> | 2026-05-22 20:06 | 76K | |
| Ed Sheeran - Happier..> | 2026-05-22 20:06 | 56K | |
| Ed Sheeran - Galway ..> | 2026-05-22 20:06 | 56K | |
| Ed Sheeran - Castle ..> | 2026-05-22 20:06 | 56K | |
| Ed Bruce - You Turn ..> | 2026-05-22 20:20 | 344K | |
| Ed Bruce - The Last ..> | 2026-05-22 20:20 | 344K | |
| Ed Bruce - My First ..> | 2026-05-22 20:20 | 344K | |
| Echosmith - Cool Kid..> | 2026-05-22 20:06 | 30K | |
| Easybeats - Hello Ho..> | 2026-05-22 20:34 | 21K | |
| Easybeats - Friday o..> | 2026-05-22 20:34 | 47K | |
| East Side Beat - Rid..> | 2026-05-22 19:56 | 48K | |
| East Side Beat - Ali..> | 2026-05-22 19:56 | 48K | |
| East 17 - Stay Anoth..> | 2026-05-22 19:56 | 70K | |
| East 17 - It S Alrig..> | 2026-05-22 19:56 | 127K | |
| Eartha Kitt - Where ..> | 2026-05-22 19:39 | 37K | |
| Eartha Kitt - The Gi..> | 2026-05-22 20:34 | 19K | |
| Eartha Kitt - C'est ..> | 2026-05-22 19:39 | 130K | |
| Earth Wind And Fire ..> | 2026-05-22 19:56 | 46K | |
| Earth Wind & Fire - ..> | 2026-05-22 19:56 | 58K | |
| Earth Wind & Fire - ..> | 2026-05-22 19:32 | 72K | |
| Earth Wind & Fire - ..> | 2026-05-22 19:39 | 195K | |
| Earth Wind & Fire - ..> | 2026-05-22 19:32 | 36K | |
| Earth Wind & Fire - ..> | 2026-05-22 19:32 | 72K | |
| Earth Wind & Fire - ..> | 2026-05-22 19:32 | 216K | |
| Earth And Fire - Wee..> | 2026-05-22 19:32 | 31K | |
| Earth And Fire - Mem..> | 2026-05-22 19:32 | 32K | |
| Earth, Wind & Fire -..> | 2026-05-22 19:32 | 696K | |
| Earth, Wind & Fire -..> | 2026-05-22 19:32 | 60K | |
| Earth, Wind & Fire -..> | 2026-05-22 20:06 | 45K | |
| Earth, Wind & Fire -..> | 2026-05-22 19:56 | 152K | |
| Earth, Wind & Fire -..> | 2026-05-22 19:39 | 90K | |
| Earth, Wind & Fire -..> | 2026-05-22 19:56 | 44K | |
| Earth, Wind & Fire -..> | 2026-05-22 19:39 | 486K | |
| Earth, Wind & Fire -..> | 2026-05-22 19:39 | 325K | |
| Earth & Fire - Weeke..> | 2026-05-22 19:39 | 31K | |
| Earth & Fire - Storm..> | 2026-05-22 19:32 | 1.1M | |
| Earth & Fire - Maybe..> | 2026-05-22 19:32 | 23K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 109K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 130K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 109K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 127K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 130K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 172K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 164K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 164K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 130K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 130K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 130K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 163K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 109K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 164K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 195K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 164K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 366K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 109K | |
| Earl Thomas Conley -..> | 2026-05-22 20:20 | 109K | |
| Earl Thomas Conley -..> | 2026-05-22 20:34 | 35K | |
| Earl Cupit - Abilene..> | 2026-05-22 20:20 | 200K | |
| Earl Bostic - Flamin..> | 2026-05-22 20:34 | 37K | |
| Eamon - Fuck It (I D..> | 2026-05-22 20:06 | 40K | |
| Eagles - Witchy Woma..> | 2026-05-22 19:32 | 101K | |
| Eagles - The Long Ru..> | 2026-05-22 20:34 | 720K | |
| Eagles - The Last Re..> | 2026-05-22 19:56 | 45K | |
| Eagles - The Last Re..> | 2026-05-22 19:32 | 393K | |
| Eagles - Tequila Sun..> | 2026-05-22 20:34 | 25K | |
| Eagles - Tequila Sun..> | 2026-05-22 20:20 | 178K | |
| Eagles - Take It To ..> | 2026-05-22 19:32 | 15K | |
| Eagles - Take It Eas..> | 2026-05-22 19:32 | 101K | |
| Eagles - Please come..> | 2026-05-22 19:31 | 41K | |
| Eagles - One of Thes..> | 2026-05-22 19:31 | 393K | |
| Eagles - New kid in ..> | 2026-05-22 19:31 | 271K | |
| Eagles - New Kid in ..> | 2026-05-22 20:34 | 40K | |
| Eagles - Lyin’ Eye..> | 2026-05-22 20:34 | 58K | |
| Eagles - Life in the..> | 2026-05-22 19:31 | 393K | |
| Eagles - I Can't Tel..> | 2026-05-22 19:39 | 58K | |
| Eagles - Hotel Calif..> | 2026-05-22 20:34 | 25K | |
| Eagles - Hotel Calif..> | 2026-05-22 19:39 | 48K | |
| Eagles - Hotel Calif..> | 2026-05-22 19:31 | 101K | |
| Eagles - Heartache T..> | 2026-05-22 19:31 | 101K | |
| Eagles - Desperado.jpg | 2026-05-22 20:34 | 59K | |
| Eagles - Desperado (..> | 2026-05-22 19:31 | 101K | |
| Eagles - Best of My ..> | 2026-05-22 20:34 | 25K | |
| Eagle-Eye Cherry - S..> | 2026-05-22 19:56 | 40K | |
| ERA feat. Racha Rizk..> | 2026-05-22 20:35 | 219K | |
| ERAJesse Bloch - The..> | 2026-05-22 20:06 | 88K | |
| ERA - Mother [Remix]..> | 2026-05-22 20:35 | 302K | |
| ELO - Rock 'N' Roll ..> | 2026-05-22 19:39 | 44K | |
| ELO - I'm Alive.jpg | 2026-05-22 19:39 | 30K | |
| EDDY RAVEN - Sometim..> | 2026-05-22 20:20 | 356K | |
| EDDY RAVEN - Shine, ..> | 2026-05-22 20:20 | 146K | |
| EDDY RAVEN - In A Le..> | 2026-05-22 20:20 | 117K | |
| EDDY RAVEN - I Got M..> | 2026-05-22 20:20 | 272K | |
| EDDY RAVEN - I'm Gon..> | 2026-05-22 20:20 | 247K | |
| EDDY RAVEN - Bayou B..> | 2026-05-22 20:20 | 117K | |
| E.G Daily - Say It, ..> | 2026-05-22 19:56 | 45K | |
| E-Type - Campione 20..> | 2026-05-22 20:06 | 57K | |
| E-Rotic - Max, Don't..> | 2026-05-22 19:57 | 327K | |
| Dynoro & Gigi D'Agos..> | 2026-05-22 20:06 | 81K | |
| Dwight Yoakam - You'..> | 2026-05-22 20:20 | 54K | |
| Dwight Yoakam - Turn..> | 2026-05-22 20:20 | 198K | |
| Dwight Yoakam - Susp..> | 2026-05-22 20:34 | 51K | |
| Dwight Yoakam - Susp..> | 2026-05-22 20:20 | 268K | |
| Dwight Yoakam - Plea..> | 2026-05-22 20:20 | 305K | |
| Dwight Yoakam - Litt..> | 2026-05-22 20:20 | 62K | |
| Dwight Yoakam - Litt..> | 2026-05-22 20:20 | 215K | |
| Dwight Yoakam - I Sa..> | 2026-05-22 20:20 | 174K | |
| Dwight Yoakam - I Go..> | 2026-05-22 20:20 | 166K | |
| Dwight Yoakam - Honk..> | 2026-05-22 20:20 | 174K | |
| Dwight Yoakam - Guit..> | 2026-05-22 20:20 | 305K | |
| Dwight Yoakam - Fast..> | 2026-05-22 20:20 | 197K | |
| Dwight Yoakam - Craz..> | 2026-05-22 20:20 | 368K | |
| Dwight Yoakam - Ain'..> | 2026-05-22 20:20 | 197K | |
| Dutch X-Factor 2010 ..> | 2026-05-22 20:06 | 87K | |
| Dutch Swing College ..> | 2026-05-22 20:34 | 89K | |
| Dutch Swing College ..> | 2026-05-22 20:34 | 56K | |
| Dutch Swing College ..> | 2026-05-22 20:34 | 142K | |
| Dutch Swing College ..> | 2026-05-22 20:06 | 51K | |
| Dutch Rhythm Steal &..> | 2026-05-22 19:31 | 24K | |
| Dutch - This Is Welf..> | 2026-05-22 19:56 | 54K | |
| Dusty Springfield - ..> | 2026-05-22 20:34 | 43K | |
| Dusty Springfield - ..> | 2026-05-22 19:56 | 47K | |
| Dusty Springfield - ..> | 2026-05-22 20:34 | 31K | |
| Dusty Springfield - ..> | 2026-05-22 20:34 | 36K | |
| Dusty Springfield - ..> | 2026-05-22 20:34 | 47K | |
| Dusty Springfield - ..> | 2026-05-22 19:56 | 57K | |
| Dusty Springfield - ..> | 2026-05-22 20:34 | 49K | |
| Dusty Springfield - ..> | 2026-05-22 20:34 | 52K | |
| Dusty Springfield - ..> | 2026-05-22 20:34 | 52K | |
| Dusty Springfield - ..> | 2026-05-22 20:34 | 52K | |
| Dusty Springfield - ..> | 2026-05-22 19:39 | 78K | |
| Dusty Springfield & ..> | 2026-05-22 20:06 | 50K | |
| Duran Duran - Wild B..> | 2026-05-22 19:39 | 67K | |
| Duran Duran - Union ..> | 2026-05-22 19:39 | 133K | |
| Duran Duran - The Wi..> | 2026-05-22 19:56 | 20K | |
| Duran Duran - The Re..> | 2026-05-22 19:39 | 18K | |
| Duran Duran - Skin T..> | 2026-05-22 19:39 | 29K | |
| Duran Duran - Save A..> | 2026-05-22 19:39 | 75K | |
| Duran Duran - Rio.jpg | 2026-05-22 19:39 | 40K | |
| Duran Duran - Notori..> | 2026-05-22 19:39 | 29K | |
| Duran Duran - New Mo..> | 2026-05-22 19:39 | 20K | |
| Duran Duran - Is The..> | 2026-05-22 19:39 | 36K | |
| Duran Duran - Hungry..> | 2026-05-22 20:06 | 59K | |
| Duran Duran - Girls ..> | 2026-05-22 19:56 | 20K | |
| Duran Duran - A View..> | 2026-05-22 19:39 | 29K | |
| Duo Acropolis - La D..> | 2026-05-22 20:34 | 38K | |
| Dune - Who Wants To ..> | 2026-05-22 19:56 | 50K | |
| Dune - Rainbow To Th..> | 2026-05-22 19:56 | 42K | |
| Dune - Hardcore Vibe..> | 2026-05-22 19:56 | 294K | |
| Dune - Hand In Hand.jpg | 2026-05-22 19:56 | 132K | |
| Dune - Can't Stop Ra..> | 2026-05-22 19:56 | 197K | |
| Dune - Are You Ready..> | 2026-05-22 19:56 | 42K | |
| Duncan Laurence - So..> | 2026-05-22 20:06 | 210K | |
| Duncan Laurence - Ar..> | 2026-05-22 20:06 | 18K | |
| Duncan Browne - The ..> | 2026-05-22 19:31 | 358K | |
| Dukes - Friday on my..> | 2026-05-22 20:34 | 40K | |
| Duke - So In Love Wi..> | 2026-05-22 19:56 | 48K | |
| Duffy - Warwick Aven..> | 2026-05-22 20:06 | 38K | |
| Duffy - Mercy.jpg | 2026-05-22 20:06 | 41K | |
| Duck Sauce - Barbra ..> | 2026-05-22 20:06 | 52K | |
| Dubrovacki Trubaduri..> | 2026-05-22 20:34 | 368K | |
| Dubliners - The Wild..> | 2026-05-22 19:39 | 76K | |
| Dubliners - Seven dr..> | 2026-05-22 20:34 | 48K | |
| Dubble Trubble - Ele..> | 2026-05-22 19:39 | 8.5K | |
| Duane Eddy - Play Me..> | 2026-05-22 19:31 | 231K | |
| Duane Eddy - Because..> | 2026-05-22 19:31 | 371K | |
| Duane Eddy - Because..> | 2026-05-22 19:39 | 31K | |
| Dua Lipa - We're Goo..> | 2026-05-22 20:06 | 230K | |
| Dua Lipa - Homesick.jpg | 2026-05-22 20:05 | 48K | |
| Dua Lipa - Be The On..> | 2026-05-22 20:05 | 62K | |
| Dschinghis Khan - Mo..> | 2026-05-22 19:31 | 398K | |
| Dschinghis Khan - Ka..> | 2026-05-22 19:39 | 50K | |
| Drunkenmunky - E.jpg | 2026-05-22 20:05 | 128K | |
| Drum Theatre - Eldor..> | 2026-05-22 19:39 | 53K | |
| Dru Hill Ft. Redman ..> | 2026-05-22 20:05 | 835K | |
| Drifters - You're Mo..> | 2026-05-22 19:31 | 35K | |
| Drifters - Save The ..> | 2026-05-22 19:56 | 67K | |
| Drifters - Saturday ..> | 2026-05-22 20:34 | 188K | |
| Drifters - Kissin' I..> | 2026-05-22 20:34 | 40K | |
| Drifters, The - Kiss..> | 2026-05-22 19:31 | 124K | |
| Drenchill Feat. Indi..> | 2026-05-22 20:05 | 131K | |
| Dream Academy - Life..> | 2026-05-22 19:56 | 29K | |
| Drafi Deutscher - Ma..> | 2026-05-22 20:34 | 354K | |
| Drafi - United.(Te D..> | 2026-05-22 19:31 | 37K | |
| Dr Alban - It's My L..> | 2026-05-22 19:56 | 39K | |
| Dr. Hook - When You'..> | 2026-05-22 20:34 | 33K | |
| Dr. Hook - The Cover..> | 2026-05-22 20:20 | 58K | |
| Dr. Hook - Sylvia's ..> | 2026-05-22 19:31 | 95K | |
| Dr. Hook - Sylvia’..> | 2026-05-22 20:20 | 95K | |
| Dr. Hook - Sharing T..> | 2026-05-22 20:34 | 33K | |
| Dr. Hook - Sexy Eyes..> | 2026-05-22 19:39 | 311K | |
| Dr.Hook - Roland The..> | 2026-05-22 19:31 | 479K | |
| Dr.Hook - Cover Of T..> | 2026-05-22 19:31 | 142K | |
| Dr.Hook - Baby Makes..> | 2026-05-22 19:39 | 87K | |
| Dr. Hook - Baby Make..> | 2026-05-22 19:31 | 33K | |
| Dr. Hook - A Little ..> | 2026-05-22 20:20 | 29K | |
| Dr. Buzzard's Origin..> | 2026-05-22 19:56 | 84K | |
| Dr. Buzzard's Origin..> | 2026-05-22 19:31 | 84K | |
| Dr. Alban - Sing Hal..> | 2026-05-22 19:56 | 39K | |
| Dr. Alban - Look Who..> | 2026-05-22 19:56 | 51K | |
| Douwe Bob - Slow Dow..> | 2026-05-22 20:05 | 60K | |
| Douwe Bob - Shine.jpg | 2026-05-22 20:05 | 45K | |
| Douwe Bob & Jacqueli..> | 2026-05-22 20:05 | 45K | |
| Doug Supernaw - Reno..> | 2026-05-22 20:20 | 628K | |
| Doug Supernaw - Not ..> | 2026-05-22 20:20 | 244K | |
| Doug Supernaw - I Do..> | 2026-05-22 20:20 | 628K | |
| Doug Stone - Why Did..> | 2026-05-22 20:20 | 128K | |
| Doug Stone - Warning..> | 2026-05-22 20:20 | 225K | |
| Doug Stone - Too Bus..> | 2026-05-22 20:20 | 111K | |
| Doug Stone - These L..> | 2026-05-22 20:20 | 111K | |
| Doug Stone - Made fo..> | 2026-05-22 20:20 | 162K | |
| Doug Stone - Little ..> | 2026-05-22 20:20 | 138K | |
| Doug Stone - In a Di..> | 2026-05-22 20:20 | 138K | |
| Doug Stone - I Thoug..> | 2026-05-22 20:20 | 256K | |
| Doug Stone - I Never..> | 2026-05-22 20:20 | 111K | |
| Doug Stone - I'd Be ..> | 2026-05-22 20:20 | 176K | |
| Doug Stone - Come in..> | 2026-05-22 20:20 | 111K | |
| Doug Ashdown - Winte..> | 2026-05-22 20:34 | 77K | |
| Double You - Run To ..> | 2026-05-22 19:56 | 39K | |
| Double You - Please ..> | 2026-05-22 19:56 | 39K | |
| Double Trouble & Reb..> | 2026-05-22 19:39 | 39K | |
| Double Trouble & Reb..> | 2026-05-22 19:39 | 13K | |
| Double - The Captain..> | 2026-05-22 19:39 | 236K | |
| Dottie West - A Less..> | 2026-05-22 20:20 | 295K | |
| Dotan - This Town.jpg | 2026-05-22 20:05 | 57K | |
| Dotan - Hungry.jpg | 2026-05-22 20:05 | 58K | |
| Dotan - Home.jpg | 2026-05-22 20:05 | 58K | |
| Doris Day - Whatever..> | 2026-05-22 20:34 | 239K | |
| Doris Day - Tea For ..> | 2026-05-22 20:34 | 88K | |
| Doris Day - Singin' ..> | 2026-05-22 20:34 | 50K | |
| Doris Day - Secret L..> | 2026-05-22 20:34 | 75K | |
| Doris Day - Que Sera..> | 2026-05-22 20:34 | 28K | |
| Doris Day - Pillow T..> | 2026-05-22 19:56 | 38K | |
| Doris Day - Move Ove..> | 2026-05-22 19:56 | 38K | |
| Doris Day - Everybod..> | 2026-05-22 20:34 | 39K | |
| Doris Day - A Guy Is..> | 2026-05-22 20:34 | 38K | |
| Doris Day & Axel Sto..> | 2026-05-22 20:34 | 88K | |
| Doris D. & The Pins ..> | 2026-05-22 19:39 | 44K | |
| Doris D & The Pins -..> | 2026-05-22 19:39 | 44K | |
| Doors - Riders on th..> | 2026-05-22 19:31 | 69K | |
| Doors - Light my fir..> | 2026-05-22 20:34 | 31K | |
| Doors - Light My Fir..> | 2026-05-22 19:56 | 24K | |
| Doors - Hello, I Lov..> | 2026-05-22 19:56 | 58K | |
| Doop - Doop.jpg | 2026-05-22 19:56 | 144K | |
| Doobie Brothers - Wh..> | 2026-05-22 20:34 | 67K | |
| Doobie Brothers - Th..> | 2026-05-22 19:56 | 38K | |
| Doobie Brothers - Lo..> | 2026-05-22 19:56 | 46K | |
| Doobie Brothers - Lo..> | 2026-05-22 19:31 | 312K | |
| Doobie Brothers - Li..> | 2026-05-22 19:31 | 58K | |
| Doobie Brothers - Je..> | 2026-05-22 19:31 | 49K | |
| Donovan - Universal ..> | 2026-05-22 19:56 | 42K | |
| Donovan - Sunshine S..> | 2026-05-22 20:34 | 52K | |
| Donovan - Mellow Yel..> | 2026-05-22 20:34 | 42K | |
| Donovan - Jennifer J..> | 2026-05-22 20:34 | 200K | |
| Donovan - Colours.jpg | 2026-05-22 19:56 | 74K | |
| Donovan - Atlantis.jpg | 2026-05-22 20:34 | 74K | |
| Donny Osmond - Young..> | 2026-05-22 19:31 | 58K | |
| Donny Osmond - When ..> | 2026-05-22 19:31 | 130K | |
| Donny Osmond - The T..> | 2026-05-22 19:31 | 58K | |
| Donny Osmond - Puppy..> | 2026-05-22 20:34 | 27K | |
| Donny & Marie Osmond..> | 2026-05-22 19:31 | 406K | |
| Donna Summer - This ..> | 2026-05-22 19:39 | 75K | |
| Donna Summer - The H..> | 2026-05-22 19:31 | 29K | |
| Donna Summer - State..> | 2026-05-22 19:39 | 48K | |
| Donna Summer - She W..> | 2026-05-22 19:39 | 38K | |
| Donna Summer - On Th..> | 2026-05-22 19:31 | 50K | |
| Donna Summer - Macar..> | 2026-05-22 20:05 | 51K | |
| Donna Summer - MacAr..> | 2026-05-22 19:31 | 263K | |
| Donna Summer - Love ..> | 2026-05-22 19:31 | 87K | |
| Donna Summer - Love ..> | 2026-05-22 19:39 | 47K | |
| Donna Summer - Last ..> | 2026-05-22 19:31 | 85K | |
| Donna Summer - Lady ..> | 2026-05-22 19:31 | 29K | |
| Donna Summer - I Fee..> | 2026-05-22 19:31 | 89K | |
| Donna Summer - Hot S..> | 2026-05-22 19:31 | 62K | |
| Donna Summer - Could..> | 2026-05-22 19:31 | 51K | |
| Donna Summer - Bad G..> | 2026-05-22 19:31 | 76K | |
| Donna Lynton - Charl..> | 2026-05-22 19:31 | 45K | |
| Donna Lynton - (That..> | 2026-05-22 19:39 | 306K | |
| Donna Lewis - I Love..> | 2026-05-22 19:39 | 28K | |
| Donna Hightower - Th..> | 2026-05-22 19:31 | 353K | |
| Donna Fargo - When W..> | 2026-05-22 20:20 | 49K | |
| Donna Fargo - The Ha..> | 2026-05-22 20:20 | 140K | |
| Donna Fargo - That W..> | 2026-05-22 20:20 | 123K | |
| Donna Fargo - Superm..> | 2026-05-22 20:20 | 136K | |
| Donna Allen - Serio..> | 2026-05-22 19:39 | 23K | |
| Donna Allen - Joy an..> | 2026-05-22 19:39 | 195K | |
| Donald Fagen - New F..> | 2026-05-22 19:39 | 35K | |
| Donald Fagen - I.G.Y..> | 2026-05-22 19:56 | 45K | |
| Donald Fagen - I.G.Y..> | 2026-05-22 19:39 | 124K | |
| Don Williams - You'r..> | 2026-05-22 20:20 | 108K | |
| Don Williams - You..> | 2026-05-22 20:20 | 55K | |
| Don Williams - Tulsa..> | 2026-05-22 20:20 | 127K | |
| Don Williams - Till ..> | 2026-05-22 20:20 | 330K | |
| Don Williams - Some ..> | 2026-05-22 20:20 | 108K | |
| Don Williams - She N..> | 2026-05-22 20:20 | 330K | |
| Don Williams - Say i..> | 2026-05-22 20:19 | 144K | |
| Don Williams - Rake ..> | 2026-05-22 20:19 | 377K | |
| Don Williams - Mista..> | 2026-05-22 20:19 | 167K | |
| Don Williams - Love ..> | 2026-05-22 20:19 | 109K | |
| Don Williams - Liste..> | 2026-05-22 20:19 | 167K | |
| Don Williams - Lay D..> | 2026-05-22 20:19 | 109K | |
| Don Williams - It Mu..> | 2026-05-22 20:19 | 109K | |
| Don Williams - If Ho..> | 2026-05-22 20:19 | 330K | |
| Don Williams - I Wou..> | 2026-05-22 20:19 | 88K | |
| Don Williams - I Rec..> | 2026-05-22 20:19 | 28K | |
| Don Williams - I Bel..> | 2026-05-22 20:19 | 108K | |
| Don Williams - I've ..> | 2026-05-22 20:19 | 186K | |
| Don Williams - I'm J..> | 2026-05-22 20:19 | 144K | |
| Don Williams - Good ..> | 2026-05-22 20:19 | 109K | |
| Don Williams - Amand..> | 2026-05-22 20:34 | 92K | |
| Don Rosenbaum - Swim..> | 2026-05-22 20:34 | 41K | |
| Don Partridge - Rosi..> | 2026-05-22 20:33 | 265K | |
| Don Partridge - Blue..> | 2026-05-22 20:33 | 265K | |
| Don Omar Ft. Lucenzo..> | 2026-05-22 20:05 | 229K | |
| Don Mercedes - Rocky..> | 2026-05-22 19:56 | 75K | |
| Don Mclean - Vincent..> | 2026-05-22 20:33 | 9.8K | |
| Don Mclean - Castles..> | 2026-05-22 19:39 | 29K | |
| Don Mclean - And I L..> | 2026-05-22 19:31 | 43K | |
| Don Mclean - America..> | 2026-05-22 19:31 | 45K | |
| Don McLean - Crying.jpg | 2026-05-22 20:33 | 46K | |
| Don Johnson - Tell I..> | 2026-05-22 19:39 | 32K | |
| Don Johnson - Heartb..> | 2026-05-22 19:39 | 40K | |
| Don Henley - The Boy..> | 2026-05-22 19:39 | 181K | |
| Don Henley - New Yor..> | 2026-05-22 19:56 | 40K | |
| Don Henley - 06 - Th..> | 2026-05-22 19:56 | 27K | |
| Don Gibson - Woman (..> | 2026-05-22 20:19 | 137K | |
| Don Gibson - Why Don..> | 2026-05-22 20:19 | 333K | |
| Don Gibson - Who Car..> | 2026-05-22 20:19 | 95K | |
| Don Gibson - What Ab..> | 2026-05-22 20:19 | 234K | |
| Don Gibson - What()s..> | 2026-05-22 20:19 | 13K | |
| Don Gibson - Sweet D..> | 2026-05-22 20:19 | 77K | |
| Don Gibson - Sweet, ..> | 2026-05-22 20:19 | 241K | |
| Don Gibson - Sittin(..> | 2026-05-22 20:19 | 109K | |
| Don Gibson - Sea of ..> | 2026-05-22 20:19 | 203K | |
| Don Gibson - Oh Lone..> | 2026-05-22 20:19 | 173K | |
| Don Gibson - Oh Lone..> | 2026-05-22 20:19 | 138K | |
| Don Gibson - My Hand..> | 2026-05-22 20:19 | 157K | |
| Don Gibson - Look Wh..> | 2026-05-22 20:19 | 129K | |
| Don Gibson - Lonesom..> | 2026-05-22 20:19 | 164K | |
| Don Gibson - Just On..> | 2026-05-22 20:19 | 225K | |
| Don Gibson - Ice Col..> | 2026-05-22 20:19 | 303K | |
| Don Gibson - I Must ..> | 2026-05-22 20:19 | 95K | |
| Don Gibson - I Can't..> | 2026-05-22 20:19 | 203K | |
| Don Gibson - I Ain()..> | 2026-05-22 20:19 | 138K | |
| Don Gibson - I()m Mo..> | 2026-05-22 20:19 | 134K | |
| Don Gibson - Hurtin(..> | 2026-05-22 20:19 | 3.2M | |
| Don Gibson - Give My..> | 2026-05-22 20:19 | 132K | |
| Don Gibson - Far Far..> | 2026-05-22 20:19 | 238K | |
| Don Gibson - Everybo..> | 2026-05-22 20:19 | 195K | |
| Don Gibson - Even Th..> | 2026-05-22 20:19 | 106K | |
| Don Gibson - Don()t ..> | 2026-05-22 20:19 | 2.1M | |
| Don Gibson - Didn()t..> | 2026-05-22 20:19 | 96K | |
| Don Gibson - Blue Bl..> | 2026-05-22 20:19 | 293K | |
| Don Gibson - Blue Bl..> | 2026-05-22 20:19 | 152K | |
| Don Gibson - Big Hea..> | 2026-05-22 20:19 | 243K | |
| Don Gibson - Bad Bad..> | 2026-05-22 20:19 | 311K | |
| Don Gibson - Ah-Ha.jpg | 2026-05-22 20:19 | 312K | |
| Don Gibson - (I’d ..> | 2026-05-22 20:19 | 129K | |
| Don Bailey - That's ..> | 2026-05-22 20:19 | 145K | |
| Don Bailey - Bouquet..> | 2026-05-22 20:19 | 254K | |
| Dominic - I Won't Le..> | 2026-05-22 19:39 | 185K | |
| Domenico Modugno - V..> | 2026-05-22 20:33 | 271K | |
| Domenico Modugno - V..> | 2026-05-22 19:31 | 41K | |
| Dolly Parton with Wi..> | 2026-05-22 20:33 | 481K | |
| Dolly Parton Linda R..> | 2026-05-22 20:33 | 71K | |
| Dolly Parton - You A..> | 2026-05-22 19:39 | 57K | |
| Dolly Parton - You'r..> | 2026-05-22 20:19 | 216K | |
| Dolly Parton - Yello..> | 2026-05-22 20:19 | 202K | |
| Dolly Parton - Why'd..> | 2026-05-22 20:19 | 202K | |
| Dolly Parton - We Us..> | 2026-05-22 20:19 | 168K | |
| Dolly Parton - Toget..> | 2026-05-22 20:19 | 57K | |
| Dolly Parton - Think..> | 2026-05-22 20:19 | 94K | |
| Dolly Parton - Tenne..> | 2026-05-22 20:19 | 144K | |
| Dolly Parton - Silve..> | 2026-05-22 20:19 | 218K | |
| Dolly Parton - Romeo..> | 2026-05-22 20:19 | 69K | |
| Dolly Parton - Real ..> | 2026-05-22 20:19 | 22K | |
| Dolly Parton - Puppy..> | 2026-05-22 20:19 | 136K | |
| Dolly Parton - Old F..> | 2026-05-22 20:19 | 144K | |
| Dolly Parton - Makin..> | 2026-05-22 20:19 | 79K | |
| Dolly Parton - Make ..> | 2026-05-22 20:33 | 45K | |
| Dolly Parton - Just ..> | 2026-05-22 20:19 | 58K | |
| Dolly Parton - Jolen..> | 2026-05-22 20:19 | 125K | |
| Dolly Parton - It Wa..> | 2026-05-22 20:19 | 246K | |
| Dolly Parton - It's ..> | 2026-05-22 20:19 | 191K | |
| Dolly Parton - I Wil..> | 2026-05-22 19:31 | 178K | |
| Dolly Parton - Here ..> | 2026-05-22 20:19 | 191K | |
| Dolly Parton - Here ..> | 2026-05-22 19:31 | 323K | |
| Dolly Parton - Heart..> | 2026-05-22 20:19 | 168K | |
| Dolly Parton - Girl ..> | 2026-05-22 20:19 | 249K | |
| Dolly Parton - Every..> | 2026-05-22 20:19 | 156K | |
| Dolly Parton - Coat ..> | 2026-05-22 20:19 | 127K | |
| Dolly Parton - But Y..> | 2026-05-22 20:19 | 97K | |
| Dolly Parton - 9 to ..> | 2026-05-22 20:19 | 55K | |
| Dolly Parton - 9 to ..> | 2026-05-22 20:19 | 51K | |
| Dolly Parton, Ricky ..> | 2026-05-22 20:19 | 137K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 20K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:33 | 233K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 71K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 51K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 51K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 51K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 100K | |
| Dolly Parton, Linda ..> | 2026-05-22 20:19 | 13K | |
| Dolly Parton, Kenny ..> | 2026-05-22 19:39 | 176K | |
| Dolly Dots - Stop.jpg | 2026-05-22 19:39 | 264K | |
| Dolly Dots - She's A..> | 2026-05-22 19:39 | 49K | |
| Dolly Dots - Radio.jpg | 2026-05-22 19:31 | 95K | |
| Dolly Dots - P.S.jpg | 2026-05-22 19:39 | 59K | |
| Dolly Dots - Only Th..> | 2026-05-22 19:39 | 60K | |
| Dolly Dots - Love Me..> | 2026-05-22 19:39 | 308K | |
| Dolly Dots - Love Me..> | 2026-05-22 19:39 | 49K | |
| Dolly Dots - Leila.jpg | 2026-05-22 19:39 | 84K | |
| Dolly Dots - Hela-Di..> | 2026-05-22 19:39 | 168K | |
| Dolly Dots - Do Wah ..> | 2026-05-22 19:39 | 35K | |
| Dolly Dots - All The..> | 2026-05-22 19:39 | 429K | |
| Dolly Dots - 1979 - ..> | 2026-05-22 19:31 | 103K | |
| Doja Cat - Paint the..> | 2026-05-22 20:05 | 150K | |
| Doenja - Groovy Kind..> | 2026-05-22 19:39 | 131K | |
| Do You Remeber.jpg | 2026-05-22 19:29 | 3.1K | |
| Dnce - Cake By The O..> | 2026-05-22 20:05 | 48K | |
| Dna Featuring Suzann..> | 2026-05-22 19:56 | 46K | |
| Dna Featuring Suzann..> | 2026-05-22 20:33 | 20K | |
| Djumbo - The Djumbo ..> | 2026-05-22 20:05 | 60K | |
| Djs@work - Someday (..> | 2026-05-22 20:05 | 100K | |
| Dj fresh feat. rita ..> | 2026-05-22 20:05 | 51K | |
| Dj Tiesto - Lethal I..> | 2026-05-22 20:05 | 416K | |
| Dj Tiësto Vs Diplo ..> | 2026-05-22 20:05 | 84K | |
| Dj Tiësto Feat. Max..> | 2026-05-22 20:05 | 30K | |
| Dj Tiësto - Love Co..> | 2026-05-22 20:05 | 32K | |
| Dj Snake Feat. Justi..> | 2026-05-22 20:05 | 44K | |
| Dj Sammy & Yanou & D..> | 2026-05-22 20:33 | 20K | |
| Dj Quicksilver - Bel..> | 2026-05-22 19:56 | 63K | |
| Dj Quicksilver - Ame..> | 2026-05-22 20:05 | 609K | |
| Dj Porny - Me So Hor..> | 2026-05-22 20:05 | 100K | |
| Dj Paul V. - Smash M..> | 2026-05-22 20:19 | 42K | |
| Dj Paul Elstak - Luv..> | 2026-05-22 19:56 | 81K | |
| Dj Maurice - Carnava..> | 2026-05-22 20:05 | 119K | |
| Dj Klubbingman - Rev..> | 2026-05-22 20:05 | 56K | |
| Dj Kicken & Mc -Q - ..> | 2026-05-22 20:05 | 24K | |
| Dj Jurgen - Higher &..> | 2026-05-22 20:05 | 3.2M | |
| Dj Jurgen - Better O..> | 2026-05-22 19:56 | 58K | |
| Dj Jurgen - A Higher..> | 2026-05-22 20:05 | 104K | |
| Dj Jose - House Of J..> | 2026-05-22 20:05 | 44K | |
| Dj Jean - The Launch..> | 2026-05-22 20:05 | 78K | |
| Dj Jean - The Launch..> | 2026-05-22 19:56 | 44K | |
| Dj Jean - It's The N..> | 2026-05-22 20:05 | 36K | |
| Dj Jazzy Jeff & The ..> | 2026-05-22 19:56 | 49K | |
| Dj Jazzy Jeff & Fres..> | 2026-05-22 19:56 | 418K | |
| Dj Boozywoozy - Part..> | 2026-05-22 20:05 | 44K | |
| Dj Boozywoozy - One ..> | 2026-05-22 20:05 | 38K | |
| Dj Bobo - Somebody D..> | 2026-05-22 19:56 | 34K | |
| Dj Ötzi - Anton Aus..> | 2026-05-22 20:05 | 127K | |
| Dizzy Man's Band - T..> | 2026-05-22 19:31 | 268K | |
| Dizzy Man's Band - T..> | 2026-05-22 19:31 | 190K | |
| Dixie Cups - Chapel ..> | 2026-05-22 20:33 | 249K | |
| Dixie Chicks - You W..> | 2026-05-22 20:19 | 659K | |
| Dixie Chicks - Wide ..> | 2026-05-22 20:19 | 8.7M | |
| Dixie Chicks - There..> | 2026-05-22 20:19 | 680K | |
| Dixie Chicks - Stand..> | 2026-05-22 20:19 | 680K | |
| Dixie Chicks - Ready..> | 2026-05-22 20:19 | 100K | |
| Dixie Chicks - Goodb..> | 2026-05-22 20:19 | 680K | |
| Dixie Chicks - Cowbo..> | 2026-05-22 20:19 | 853K | |
| Divine -Shoot Your S..> | 2026-05-22 19:39 | 52K | |
| Divine - Native Love..> | 2026-05-22 19:39 | 48K | |
| Divine - Love Reacti..> | 2026-05-22 19:39 | 30K | |
| Disturbed - The Soun..> | 2026-05-22 20:05 | 186K | |
| Disturbed - The Soun..> | 2026-05-22 20:05 | 67K | |
| Discover the best da..> | 2026-05-22 19:29 | 3.1K | |
| Discotheque - Introd..> | 2026-05-22 19:31 | 14K | |
| Dire Straits - Your ..> | 2026-05-22 19:39 | 4.0M | |
| Dire Straits - Why W..> | 2026-05-22 20:33 | 244K | |
| Dire Straits - Water..> | 2026-05-22 19:31 | 14K | |
| Dire Straits - Walk ..> | 2026-05-22 20:33 | 43K | |
| Dire Straits - Twist..> | 2026-05-22 19:39 | 20K | |
| Dire Straits - Tunne..> | 2026-05-22 19:39 | 11K | |
| Dire Straits - The B..> | 2026-05-22 20:19 | 387K | |
| Dire Straits - Teleg..> | 2026-05-22 19:56 | 27K | |
| Dire Straits - Sulta..> | 2026-05-22 19:31 | 198K | |
| Dire Straits - So Fa..> | 2026-05-22 19:39 | 30K | |
| Dire Straits - Priva..> | 2026-05-22 20:33 | 21K | |
| Dire Straits - Money..> | 2026-05-22 19:39 | 36K | |
| Dire Straits - Heavy..> | 2026-05-22 19:56 | 54K | |
| Dire Straits - Down ..> | 2026-05-22 19:31 | 22K | |
| Dire Straits - Calli..> | 2026-05-22 19:56 | 54K | |
| Dire Straits - Broth..> | 2026-05-22 19:39 | 36K | |
| Dionne Warwick - Wha..> | 2026-05-22 20:33 | 44K | |
| Dionne Warwick - Wal..> | 2026-05-22 19:39 | 52K | |
| Dionne Warwick - Tha..> | 2026-05-22 19:39 | 325K | |
| Dionne Warwick - I'l..> | 2026-05-22 19:39 | 21K | |
| Dionne Warwick - I'l..> | 2026-05-22 19:39 | 325K | |
| Dionne Warwick - Hea..> | 2026-05-22 20:33 | 85K | |
| Dionne Warwick - Do ..> | 2026-05-22 20:33 | 325K | |
| Dionne Warwick - Any..> | 2026-05-22 20:33 | 38K | |
| Dionne Warwick - All..> | 2026-05-22 20:33 | 85K | |
| Dionne Warwick - Alf..> | 2026-05-22 20:05 | 32K | |
| Dionne Warwick & Fri..> | 2026-05-22 20:33 | 52K | |
| Dion - The Wanderer.jpg | 2026-05-22 20:33 | 42K | |
| Dion - Runaround Sue..> | 2026-05-22 20:33 | 183K | |
| Dion & The Belmonts ..> | 2026-05-22 19:56 | 42K | |
| Dinand Woesthoff - D..> | 2026-05-22 20:05 | 30K | |
| Dinah Washington - W..> | 2026-05-22 20:33 | 152K | |
| Dinah Washington - M..> | 2026-05-22 20:33 | 73K | |
| Dinah Washington - C..> | 2026-05-22 20:33 | 71K | |
| Dinah Shore - My Hea..> | 2026-05-22 20:33 | 238K | |
| Dinah Shore - It Had..> | 2026-05-22 20:33 | 71K | |
| Dinah Shore - Foreve..> | 2026-05-22 19:56 | 53K | |
| Dimitri Vegas & Like..> | 2026-05-22 20:05 | 193K | |
| Dimitri Vegas & Like..> | 2026-05-22 20:05 | 697K | |
| Dimitri Vegas & Like..> | 2026-05-22 20:05 | 458K | |
| Dimitri Vegas & Like..> | 2026-05-22 20:05 | 194K | |
| Dimitri Vegas & Like..> | 2026-05-22 20:05 | 89K | |
| Dimitri Dourakine - ..> | 2026-05-22 20:33 | 242K | |
| Dillinger - Cokane I..> | 2026-05-22 19:31 | 234K | |
| Digno Garcia Y Sus C..> | 2026-05-22 20:33 | 17K | |
| Digno Garcia - La Fe..> | 2026-05-22 20:33 | 39K | |
| Digno Garcia - Guant..> | 2026-05-22 20:33 | 45K | |
| Digno Garcia - Brigi..> | 2026-05-22 20:33 | 204K | |
| Diesel - Sausolito S..> | 2026-05-22 19:31 | 51K | |
| Diesel - Sausalito S..> | 2026-05-22 19:39 | 61K | |
| Diesel - Down In The..> | 2026-05-22 19:39 | 61K | |
| Diego Modena & Jean-..> | 2026-05-22 19:56 | 274K | |
| Diego MirandaAdrian ..> | 2026-05-22 20:05 | 46K | |
| Die Toten Hosen - Ze..> | 2026-05-22 19:56 | 249K | |
| Dido - White Flag.jpg | 2026-05-22 20:05 | 40K | |
| Dido - Thank You.jpg | 2026-05-22 20:05 | 18K | |
| Dido - Life For Rent..> | 2026-05-22 20:05 | 40K | |
| Dido - Here With Me.jpg | 2026-05-22 20:05 | 18K | |
| Dick Haymes - The Mo..> | 2026-05-22 20:33 | 18K | |
| Dianne Marchal - San..> | 2026-05-22 19:31 | 173K | |
| Diana Ross - You Kee..> | 2026-05-22 19:31 | 381K | |
| Diana Ross - You Can..> | 2026-05-22 19:31 | 287K | |
| Diana Ross - Why Do ..> | 2026-05-22 19:39 | 20K | |
| Diana Ross - Where D..> | 2026-05-22 19:31 | 184K | |
| Diana Ross - Upside ..> | 2026-05-22 19:39 | 29K | |
| Diana Ross - Touch b..> | 2026-05-22 19:56 | 35K | |
| Diana Ross - Theme F..> | 2026-05-22 19:31 | 77K | |
| Diana Ross - Theme F..> | 2026-05-22 20:33 | 20K | |
| Diana Ross - The Bos..> | 2026-05-22 20:05 | 42K | |
| Diana Ross - My Old ..> | 2026-05-22 19:39 | 45K | |
| Diana Ross - Muscles..> | 2026-05-22 19:39 | 146K | |
| Diana Ross - Missing..> | 2026-05-22 19:39 | 35K | |
| Diana Ross - I'm Sti..> | 2026-05-22 19:31 | 170K | |
| Diana Ross - I'm Com..> | 2026-05-22 19:39 | 45K | |
| Diana Ross - Endless..> | 2026-05-22 19:31 | 41K | |
| Diana Ross - Chain R..> | 2026-05-22 19:39 | 346K | |
| Diana Ross - Ain't N..> | 2026-05-22 19:31 | 170K | |
| Diana Ross - A Brand..> | 2026-05-22 19:31 | 182K | |
| Diana Ross & the Sup..> | 2026-05-22 20:33 | 41K | |
| Diana Ross & The Sup..> | 2026-05-22 19:56 | 153K | |
| Diana Ross & The Sup..> | 2026-05-22 20:33 | 35K | |
| Diana Ross & The Sup..> | 2026-05-22 19:31 | 292K | |
| Diana Ross & The Sup..> | 2026-05-22 20:33 | 41K | |
| Diana Ross & Marvin ..> | 2026-05-22 19:31 | 159K | |
| Diana Ross & Lionel ..> | 2026-05-22 20:33 | 53K | |
| Diana Krall - You Go..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Yeh Ye..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - When t..> | 2026-05-22 20:33 | 62K | |
| Diana Krall - Wallfl..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Walk O..> | 2026-05-22 20:33 | 96K | |
| Diana Krall - The Lo..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Supers..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Sorry ..> | 2026-05-22 20:33 | 55K | |
| Diana Krall - Sorry ..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - S'Wond..> | 2026-05-22 20:33 | 66K | |
| Diana Krall - Pick Y..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Peel M..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Operat..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Narrow..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Let's ..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - L-O-V-..> | 2026-05-22 20:33 | 29K | |
| Diana Krall - Just T..> | 2026-05-22 20:33 | 54K | |
| Diana Krall - In My ..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - If I T..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - I Can'..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - I've G..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - I'm No..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Frim F..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Fly Me..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Feels ..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - East O..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Don't ..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Desper..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Cry Me..> | 2026-05-22 20:33 | 33K | |
| Diana Krall - Califo..> | 2026-05-22 20:33 | 55K | |
| Diana Krall - Besame..> | 2026-05-22 20:33 | 33K | |
| Diana Krall - Alone ..> | 2026-05-22 20:33 | 31K | |
| Diana Krall - Almost..> | 2026-05-22 20:33 | 62K | |
| Diana Krall - 'S Won..> | 2026-05-22 20:33 | 31K | |
| Diana King - Shy Guy..> | 2026-05-22 19:56 | 31K | |
| Diana King - Ain't N..> | 2026-05-22 19:56 | 127K | |
| Diamond Rio - You're..> | 2026-05-22 20:19 | 159K | |
| Diamond Rio - Unbeli..> | 2026-05-22 20:19 | 159K | |
| Diamond Rio - Oh Me,..> | 2026-05-22 20:19 | 172K | |
| Diamond Rio - Nowher..> | 2026-05-22 20:19 | 177K | |
| Diamond Rio - Norma ..> | 2026-05-22 20:19 | 160K | |
| Diamond Rio - Mirror..> | 2026-05-22 20:19 | 177K | |
| Diamond Rio - Meet I..> | 2026-05-22 20:19 | 160K | |
| Diamond Rio - Mama D..> | 2026-05-22 20:19 | 177K | |
| Diamond Rio - Love a..> | 2026-05-22 20:19 | 175K | |
| Diamond Rio - In a W..> | 2026-05-22 20:19 | 160K | |
| Diamond Rio - Imagin..> | 2026-05-22 20:19 | 173K | |
| Diamond Rio - I Know..> | 2026-05-22 20:19 | 159K | |
| Diamond Rio - How Yo..> | 2026-05-22 20:19 | 160K | |
| Diamond Rio - Holdin..> | 2026-05-22 20:19 | 160K | |
| Diamond Rio - Bubba ..> | 2026-05-22 20:19 | 98K | |
| Di-Rect - Times Are ..> | 2026-05-22 20:05 | 41K | |
| Di-Rect - This Is Wh..> | 2026-05-22 20:05 | 41K | |
| Di-Rect - Inside My ..> | 2026-05-22 20:05 | 55K | |
| Dexys Midnight Runne..> | 2026-05-22 19:56 | 89K | |
| Dexy's Midnight Runn..> | 2026-05-22 19:39 | 88K | |
| Dexy's Midnight Runn..> | 2026-05-22 19:56 | 77K | |
| Dexy's Midnight Runn..> | 2026-05-22 19:39 | 53K | |
| Devo - (I Can't Get ..> | 2026-05-22 19:31 | 82K | |
| Detroit Spinners - W..> | 2026-05-22 19:39 | 110K | |
| Detroit Spinners - T..> | 2026-05-22 19:31 | 253K | |
| Detroit Spinners - C..> | 2026-05-22 19:31 | 305K | |
| Detroit Emeralds - F..> | 2026-05-22 19:31 | 114K | |
| Destiny's Child - Su..> | 2026-05-22 19:56 | 53K | |
| Destiny's Child - Sa..> | 2026-05-22 20:05 | 38K | |
| Destiny's Child - In..> | 2026-05-22 20:05 | 50K | |
| Desmond Dekker - You..> | 2026-05-22 19:31 | 229K | |
| Desmond Dekker & the..> | 2026-05-22 20:33 | 47K | |
| Desmond Dekker & The..> | 2026-05-22 20:33 | 249K | |
| Desireless - Voyage ..> | 2026-05-22 19:39 | 33K | |
| Desert Rose Band - S..> | 2026-05-22 20:19 | 129K | |
| Desert Rose Band - S..> | 2026-05-22 20:19 | 129K | |
| Desert Rose Band - S..> | 2026-05-22 20:19 | 189K | |
| Desert Rose Band - O..> | 2026-05-22 20:19 | 760K | |
| Desert Rose Band - L..> | 2026-05-22 20:19 | 1.8M | |
| Desert Rose Band - H..> | 2026-05-22 20:19 | 129K | |
| Des'ree - Life.jpg | 2026-05-22 19:56 | 1.0M | |
| Des'ree - Feel So Hi..> | 2026-05-22 20:05 | 30K | |
| Dermot Kennedy - Pow..> | 2026-05-22 20:05 | 34K | |
| Derek & The Dominos ..> | 2026-05-22 19:31 | 163K | |
| Depeche Mode - Peopl..> | 2026-05-22 19:38 | 45K | |
| Depeche Mode - Maste..> | 2026-05-22 19:38 | 52K | |
| Depeche Mode - Just ..> | 2026-05-22 19:38 | 43K | |
| Depeche Mode - Enjoy..> | 2026-05-22 19:38 | 26K | |
| Deodato - S.O.S Fire..> | 2026-05-22 19:56 | 72K | |
| Deodato - S.O.S. Fir..> | 2026-05-22 19:38 | 55K | |
| Deodato - Happy Hour..> | 2026-05-22 19:38 | 74K | |
| Deodato - Also Sprac..> | 2026-05-22 19:31 | 116K | |
| Deodato - Also Sprac..> | 2026-05-22 20:33 | 141K | |
| Dennis Jones - Heart..> | 2026-05-22 19:56 | 78K | |
| Dennis Hromek - By t..> | 2026-05-22 20:19 | 261K | |
| Dennis Edwards - Don..> | 2026-05-22 19:31 | 65K | |
| Dennis Edwards & Sie..> | 2026-05-22 19:38 | 37K | |
| Dennie Christian - R..> | 2026-05-22 19:38 | 49K | |
| Denis Azor - Ala Li ..> | 2026-05-22 19:56 | 160K | |
| Deniece Williams - L..> | 2026-05-22 19:38 | 48K | |
| Deniece Williams - I..> | 2026-05-22 19:38 | 59K | |
| Deniece Williams - F..> | 2026-05-22 20:05 | 46K | |
| Demis Roussos - We S..> | 2026-05-22 19:31 | 32K | |
| Demis Roussos -Schö..> | 2026-05-22 19:31 | 74K | |
| Demis Roussos - Sch..> | 2026-05-22 19:56 | 43K | |
| Demis Roussos - My o..> | 2026-05-22 19:31 | 74K | |
| Demis Roussos - My F..> | 2026-05-22 19:31 | 74K | |
| Demis Roussos - Good..> | 2026-05-22 19:31 | 39K | |
| Demis Roussos - Fore..> | 2026-05-22 19:31 | 74K | |
| Delerium & Sarah Mcl..> | 2026-05-22 20:05 | 219K | |
| Delerium & Sarah Mcl..> | 2026-05-22 20:05 | 101K | |
| Delena Stevens - Wel..> | 2026-05-22 20:33 | 278K | |
| Delain - Frozen.jpg | 2026-05-22 20:05 | 636K | |
| Del Shannon with Orc..> | 2026-05-22 20:33 | 31K | |
| Del Shannon - The Sw..> | 2026-05-22 19:56 | 34K | |
| Def Leppard - Animal..> | 2026-05-22 19:38 | 419K | |
| Def Dames Dope - It'..> | 2026-05-22 19:56 | 78K | |
| Deep River Quartet -..> | 2026-05-22 19:38 | 178K | |
| Deep Purple - Woman ..> | 2026-05-22 19:31 | 48K | |
| Deep Purple - Smoke ..> | 2026-05-22 19:31 | 21K | |
| Deep Purple - Child ..> | 2026-05-22 19:31 | 55K | |
| Deep Purple - Black ..> | 2026-05-22 19:31 | 51K | |
| Deep Dish Ft. Stevie..> | 2026-05-22 20:05 | 51K | |
| Deep Dish & Morel - ..> | 2026-05-22 20:05 | 47K | |
| Deep Blue Something ..> | 2026-05-22 19:56 | 133K | |
| Deee-Lite - Groove I..> | 2026-05-22 20:05 | 73K | |
| Dee Jay - Gloria.jpg | 2026-05-22 19:31 | 40K | |
| Dee Dee - I put a sp..> | 2026-05-22 19:31 | 301K | |
| Debby Boone - You Li..> | 2026-05-22 20:19 | 266K | |
| Debby Boone - Are Yo..> | 2026-05-22 20:19 | 253K | |
| Debbie Reynolds - Ta..> | 2026-05-22 19:56 | 36K | |
| Debbie Harry - Frenc..> | 2026-05-22 19:38 | 47K | |
| Debbie D - Hit The R..> | 2026-05-22 19:38 | 50K | |
| Debbie - Everybody J..> | 2026-05-22 19:31 | 82K | |
| Debbie - Everybody J..> | 2026-05-22 19:38 | 82K | |
| Debarge - Rhythm Of ..> | 2026-05-22 19:38 | 90K | |
| Debarge - All This L..> | 2026-05-22 19:38 | 73K | |
| Deana Carter - We Da..> | 2026-05-22 20:19 | 181K | |
| Deana Carter - Straw..> | 2026-05-22 20:19 | 181K | |
| Deana Carter - How D..> | 2026-05-22 20:19 | 181K | |
| Dean Martin - The Do..> | 2026-05-22 19:56 | 36K | |
| Dean Martin - That's..> | 2026-05-22 20:33 | 53K | |
| Dean Martin - That's..> | 2026-05-22 19:56 | 378K | |
| Dean Martin - Sway.jpg | 2026-05-22 20:33 | 51K | |
| Dean Martin - Send M..> | 2026-05-22 20:33 | 105K | |
| Dean Martin - Return..> | 2026-05-22 20:33 | 38K | |
| Dean Martin - Memori..> | 2026-05-22 20:33 | 57K | |
| Dean Martin - Kiss.jpg | 2026-05-22 20:33 | 71K | |
| Dean Martin - Everyb..> | 2026-05-22 20:33 | 55K | |
| Dean Martin - Ain't ..> | 2026-05-22 20:33 | 44K | |
| Dean Martin - Ain't ..> | 2026-05-22 19:56 | 63K | |
| Dean Martin, Frank S..> | 2026-05-22 20:33 | 24K | |
| Dean Martin & Nancy ..> | 2026-05-22 19:31 | 6.1M | |
| Dean Martin & Helen ..> | 2026-05-22 20:33 | 31K | |
| Dean Friedman - Lydi..> | 2026-05-22 19:31 | 268K | |
| Dead Or Alive - You ..> | 2026-05-22 19:38 | 64K | |
| Deacon Blue - Your T..> | 2026-05-22 19:56 | 36K | |
| De Oln'zelse Köpper..> | 2026-05-22 19:31 | 188K | |
| De La Soul - Ring Ri..> | 2026-05-22 20:05 | 41K | |
| De La Soul - Me Myse..> | 2026-05-22 19:38 | 33K | |
| De Kermisklanten - C..> | 2026-05-22 20:33 | 100K | |
| De Elektronica's - D..> | 2026-05-22 19:38 | 247K | |
| Dayton - The Sound O..> | 2026-05-22 19:38 | 36K | |
| Dawn - Tie A Yellow ..> | 2026-05-22 19:56 | 67K | |
| Dawn & Tony Orlando ..> | 2026-05-22 19:31 | 260K | |
| Davina Michelle - Sk..> | 2026-05-22 20:05 | 42K | |
| Davina Michelle - Be..> | 2026-05-22 20:05 | 82K | |
| David Withaker Orche..> | 2026-05-22 20:33 | 119K | |
| David Withaker Orche..> | 2026-05-22 20:33 | 119K | |
| David Whitaker Orche..> | 2026-05-22 20:33 | 90K | |
| David Whitaker Orche..> | 2026-05-22 20:33 | 119K | |
| David Stewart & Cand..> | 2026-05-22 19:38 | 18K | |
| David Soul - Don't G..> | 2026-05-22 19:31 | 213K | |
| David Ray - High Soc..> | 2026-05-22 19:38 | 8.2K | |
| David Parton - Isn't..> | 2026-05-22 19:31 | 295K | |
| David McWilliams - T..> | 2026-05-22 19:31 | 271K | |
| David McWilliams - D..> | 2026-05-22 20:33 | 58K | |
| David Lee Murphy - P..> | 2026-05-22 20:19 | 236K | |
| David Lee Murphy - D..> | 2026-05-22 20:19 | 236K | |
| David Lee Murphy - A..> | 2026-05-22 20:19 | 79K | |
| David Kersh - Wonder..> | 2026-05-22 20:33 | 49K | |
| David Kersh - Goodni..> | 2026-05-22 20:19 | 143K | |
| David Kersh - Day In..> | 2026-05-22 20:19 | 330K | |
| David Houston - You'..> | 2026-05-22 20:19 | 54K | |
| David Hasselhoff - L..> | 2026-05-22 19:38 | 67K | |
| David Guetta Ft. Rih..> | 2026-05-22 20:05 | 50K | |
| David Guetta Ft. Est..> | 2026-05-22 20:05 | 36K | |
| David Guetta Featuri..> | 2026-05-22 20:05 | 104K | |
| David Guetta Featuri..> | 2026-05-22 20:05 | 189K | |
| David Guetta Feat. S..> | 2026-05-22 20:05 | 78K | |
| David Guetta Feat. R..> | 2026-05-22 20:05 | 220K | |
| David Guetta Feat. K..> | 2026-05-22 20:05 | 372K | |
| David Guetta Feat. K..> | 2026-05-22 20:05 | 34K | |
| David Guetta Feat. A..> | 2026-05-22 20:05 | 48K | |
| David GuettaBenny Be..> | 2026-05-22 20:05 | 8.4M | |
| David GuettaAnne-Mar..> | 2026-05-22 20:05 | 26K | |
| David Guetta; Kim Pe..> | 2026-05-22 20:05 | 343K | |
| David Guetta - Witho..> | 2026-05-22 20:05 | 40K | |
| David Guetta - When ..> | 2026-05-22 20:05 | 34K | |
| David Guetta - One L..> | 2026-05-22 20:05 | 165K | |
| David Guetta - Memor..> | 2026-05-22 20:05 | 372K | |
| David Guetta - I'm G..> | 2026-05-22 20:05 | 317K | |
| David Guetta, Bebe R..> | 2026-05-22 20:05 | 317K | |
| David Guetta & Sia -..> | 2026-05-22 20:05 | 27K | |
| David Guetta & Sia -..> | 2026-05-22 20:05 | 36K | |
| David Guetta & Anne..> | 2026-05-22 20:05 | 73K | |
| David Grant & Jaki G..> | 2026-05-22 19:38 | 47K | |
| David Grant & Jaki G..> | 2026-05-22 19:38 | 47K | |
| David Garrick - Unch..> | 2026-05-22 20:33 | 49K | |
| David Garrick - Spic..> | 2026-05-22 20:33 | 82K | |
| David Garrick - Lady..> | 2026-05-22 20:33 | 49K | |
| David Garrick - I've..> | 2026-05-22 20:33 | 250K | |
| David Garrick - Dear..> | 2026-05-22 20:33 | 161K | |
| David Garrick - Avé..> | 2026-05-22 20:33 | 49K | |
| David Frizzell - You..> | 2026-05-22 20:19 | 219K | |
| David Frizzell - Los..> | 2026-05-22 20:19 | 301K | |
| David Frizzell - I'm..> | 2026-05-22 20:19 | 312K | |
| David Essex - Oh Wha..> | 2026-05-22 19:31 | 164K | |
| David Dundas - Jeans..> | 2026-05-22 19:31 | 458K | |
| David Christie - Sad..> | 2026-05-22 19:38 | 23K | |
| David Bowie - Ziggy ..> | 2026-05-22 19:31 | 333K | |
| David Bowie - Young ..> | 2026-05-22 19:31 | 187K | |
| David Bowie - This I..> | 2026-05-22 19:38 | 119K | |
| David Bowie - The Ma..> | 2026-05-22 19:31 | 234K | |
| David Bowie - The Je..> | 2026-05-22 20:05 | 52K | |
| David Bowie - The Je..> | 2026-05-22 19:31 | 51K | |
| David Bowie - Starma..> | 2026-05-22 19:31 | 249K | |
| David Bowie - Space ..> | 2026-05-22 20:33 | 30K | |
| David Bowie - Sound ..> | 2026-05-22 19:31 | 199K | |
| David Bowie - Rebel ..> | 2026-05-22 19:31 | 45K | |
| David Bowie - Modern..> | 2026-05-22 19:38 | 63K | |
| David Bowie - Life O..> | 2026-05-22 19:31 | 45K | |
| David Bowie - Let's ..> | 2026-05-22 19:31 | 51K | |
| David Bowie - Let's ..> | 2026-05-22 19:38 | 37K | |
| David Bowie - Let's ..> | 2026-05-22 19:38 | 245K | |
| David Bowie - Heroes..> | 2026-05-22 20:05 | 27K | |
| David Bowie - Golden..> | 2026-05-22 19:31 | 42K | |
| David Bowie - Fame.jpg | 2026-05-22 19:31 | 27K | |
| David Bowie - China ..> | 2026-05-22 19:38 | 57K | |
| David Bowie - China ..> | 2026-05-22 19:38 | 245K | |
| David Bowie - Blue J..> | 2026-05-22 19:38 | 119K | |
| David Bowie - Ashes ..> | 2026-05-22 19:38 | 304K | |
| David Bowie - Ashes ..> | 2026-05-22 19:38 | 67K | |
| David Bowie - Absolu..> | 2026-05-22 19:38 | 46K | |
| David Bowie & Tina T..> | 2026-05-22 19:38 | 61K | |
| David Bowie & Mick J..> | 2026-05-22 19:38 | 47K | |
| David Ball - Thinkin..> | 2026-05-22 20:19 | 245K | |
| David Allan Coe - Yo..> | 2026-05-22 20:19 | 221K | |
| David Allan Coe - Wi..> | 2026-05-22 20:19 | 89K | |
| David Allan Coe - Th..> | 2026-05-22 20:19 | 89K | |
| David Allan Coe - Mo..> | 2026-05-22 20:19 | 328K | |
| David A. Stewart Ft...> | 2026-05-22 20:33 | 160K | |
| Dave Stewart Feat. B..> | 2026-05-22 19:38 | 58K | |
| Dave Stewart & Colin..> | 2026-05-22 19:38 | 136K | |
| Dave Stewart & Barba..> | 2026-05-22 19:38 | 41K | |
| Dave Edmunds - I Hea..> | 2026-05-22 19:31 | 401K | |
| Dave Edmunds - Girls..> | 2026-05-22 19:31 | 106K | |
| Dave Dee, Dozy, Beak..> | 2026-05-22 20:33 | 158K | |
| Dave Dee, Dozy, Beak..> | 2026-05-22 20:33 | 373K | |
| Dave Dee, Dozy, Beak..> | 2026-05-22 20:33 | 39K | |
| Dave Dee, Dozy, Beak..> | 2026-05-22 20:33 | 102K | |
| Dave Davies - Death ..> | 2026-05-22 20:33 | 454K | |
| Dave Darell VS Nelly..> | 2026-05-22 20:05 | 294K | |
| Dave Darell - Childr..> | 2026-05-22 20:05 | 165K | |
| Dave Clark Five - Ev..> | 2026-05-22 20:33 | 57K | |
| Dave Brubeck - Take ..> | 2026-05-22 20:33 | 32K | |
| Dave Berry - This St..> | 2026-05-22 20:33 | 86K | |
| Dave Berry - Now.jpg | 2026-05-22 19:56 | 58K | |
| Dave Berry - Little ..> | 2026-05-22 20:33 | 58K | |
| Dave - Nathalie.jpg | 2026-05-22 20:33 | 21K | |
| Dave - Dansez Mainte..> | 2026-05-22 20:33 | 34K | |
| Dave & Ansil Collins..> | 2026-05-22 19:31 | 225K | |
| Dash Berlin - Waitin..> | 2026-05-22 20:05 | 49K | |
| Daryle Singletary - ..> | 2026-05-22 20:19 | 153K | |
| Daryle Singletary - ..> | 2026-05-22 20:19 | 153K | |
| Daryle Singletary - ..> | 2026-05-22 20:18 | 153K | |
| Daryl Hall & John Oa..> | 2026-05-22 19:31 | 370K | |
| Daryl Hall & John Oa..> | 2026-05-22 19:31 | 235K | |
| Daryl Hall & John Oa..> | 2026-05-22 19:31 | 250K | |
| Daryl Hall & John Oa..> | 2026-05-22 19:38 | 174K | |
| Daryl Hall & John Oa..> | 2026-05-22 19:38 | 207K | |
| Darude - Sandstorm.jpg | 2026-05-22 20:05 | 36K | |
| Darts - Daddy Cool T..> | 2026-05-22 19:31 | 317K | |
| Darrell Glenn - Cryi..> | 2026-05-22 20:18 | 218K | |
| Darrel Bell - Carele..> | 2026-05-22 19:56 | 57K | |
| Darlene Love - All A..> | 2026-05-22 20:05 | 49K | |
| Darius & Finlay, Kya..> | 2026-05-22 20:05 | 155K | |
| Dario G - Sunchyme.jpg | 2026-05-22 19:56 | 73K | |
| Dario G - Carnaval D..> | 2026-05-22 19:56 | 66K | |
| Danyel Gérard - But..> | 2026-05-22 20:33 | 68K | |
| Dan the Banjoman - D..> | 2026-05-22 19:31 | 178K | |
| Dante Thomas & Pras ..> | 2026-05-22 20:05 | 41K | |
| Danny Williams - I'v..> | 2026-05-22 20:33 | 41K | |
| Danny Vera - Roller ..> | 2026-05-22 20:18 | 115K | |
| Danny Mirror - I Rem..> | 2026-05-22 19:31 | 374K | |
| Danny Malando & His ..> | 2026-05-22 20:33 | 727K | |
| Danny Kaye - Wonderf..> | 2026-05-22 20:33 | 77K | |
| Danny Kaye - I've Go..> | 2026-05-22 20:33 | 405K | |
| Danny & The Juniors ..> | 2026-05-22 19:56 | 83K | |
| Daniel Sahuleka - Wa..> | 2026-05-22 19:38 | 73K | |
| Daniel Powter - Bad ..> | 2026-05-22 20:33 | 45K | |
| Daniel Boone - Beaut..> | 2026-05-22 19:31 | 66K | |
| Daniel Bedingfield -..> | 2026-05-22 20:05 | 38K | |
| Daniel - Julie.jpg | 2026-05-22 19:38 | 26K | |
| Dandy Warhols - Bohe..> | 2026-05-22 20:05 | 25K | |
| Dance Reaction - Dis..> | 2026-05-22 19:38 | 428K | |
| Dance Nation - Sunsh..> | 2026-05-22 20:05 | 50K | |
| Dance Fruits MusicSt..> | 2026-05-22 20:05 | 2.1M | |
| Dance 2 Trance - Pow..> | 2026-05-22 19:56 | 53K | |
| Dance 2 Trance - Pow..> | 2026-05-22 19:56 | 79K | |
| Dana Int. - Diva.jpg | 2026-05-22 19:56 | 19K | |
| Dana - It's Gonna Be..> | 2026-05-22 20:33 | 104K | |
| Dana - I Love How Yo..> | 2026-05-22 19:31 | 51K | |
| Dana - Fairytale.jpg | 2026-05-22 19:31 | 180K | |
| Dana - All Kinds Of ..> | 2026-05-22 20:33 | 68K | |
| Dan Seals - You Stil..> | 2026-05-22 20:18 | 286K | |
| Dan Seals - Three Ti..> | 2026-05-22 20:18 | 143K | |
| Dan Seals - They Rag..> | 2026-05-22 20:18 | 207K | |
| Dan Seals - One Frie..> | 2026-05-22 20:18 | 195K | |
| Dan Seals - My Baby'..> | 2026-05-22 20:18 | 320K | |
| Dan Seals - I Will B..> | 2026-05-22 20:18 | 286K | |
| Dan Seals - Good Tim..> | 2026-05-22 20:18 | 286K | |
| Dan Seals - God Must..> | 2026-05-22 20:18 | 377K | |
| Dan Seals - Everythi..> | 2026-05-22 20:18 | 262K | |
| Dan Seals - Bop.jpg | 2026-05-22 20:18 | 147K | |
| Dan Seals - Big Whee..> | 2026-05-22 20:18 | 207K | |
| Dan Seals - Addicted..> | 2026-05-22 20:18 | 207K | |
| Dan Seals - (You Bri..> | 2026-05-22 20:18 | 320K | |
| Dan Seals, Marie Osm..> | 2026-05-22 20:18 | 166K | |
| Dan Hill - Sometimes..> | 2026-05-22 19:31 | 334K | |
| Dan Hill & Vonda She..> | 2026-05-22 19:38 | 55K | |
| Dan Hartman - We Are..> | 2026-05-22 19:38 | 19K | |
| Dan Hartman - Religh..> | 2026-05-22 19:31 | 25K | |
| Dan Hartman - I Can ..> | 2026-05-22 19:38 | 67K | |
| Dan Fogelberg - Long..> | 2026-05-22 19:31 | 38K | |
| Damien Rice & Lisa H..> | 2026-05-22 20:33 | 242K | |
| Dalida - La Vie En R..> | 2026-05-22 20:33 | 210K | |
| Dalida - J'attendrai..> | 2026-05-22 19:56 | 62K | |
| Dalida - Gigi L'amor..> | 2026-05-22 19:31 | 216K | |
| Dalida, Raymond Lef..> | 2026-05-22 20:33 | 43K | |
| Dalida & Alain Delon..> | 2026-05-22 20:33 | 339K | |
| Dalida & Alain Delon..> | 2026-05-22 19:31 | 57K | |
| Dakota Staton - Dedi..> | 2026-05-22 20:33 | 51K | |
| Daft Punk ft. Pharre..> | 2026-05-22 20:05 | 29K | |
| Daft Punk - One More..> | 2026-05-22 20:05 | 64K | |
| Daft Punk - Around T..> | 2026-05-22 19:56 | 83K | |
| Daft. Punk Ft. Pharr..> | 2026-05-22 20:05 | 20K | |
| Daan - Icon.jpg | 2026-05-22 20:18 | 48K | |
| Da Hool - Meet Her A..> | 2026-05-22 19:56 | 133K | |
| DVBBS & Borgeous - T..> | 2026-05-22 20:06 | 102K | |
| DR HOOK & THE MEDICI..> | 2026-05-22 19:31 | 159K | |
| DJ Shog - Another Wo..> | 2026-05-22 20:05 | 236K | |
| DJ Sammy Feat. Caris..> | 2026-05-22 20:05 | 161K | |
| DJ Sammy - Heaven.jpg | 2026-05-22 20:05 | 109K | |
| DJ Quicksilver - Bel..> | 2026-05-22 20:05 | 63K | |
| DJ Paul Elstak - Rai..> | 2026-05-22 19:56 | 57K | |
| DJ Kicken - Happy To..> | 2026-05-22 20:05 | 24K | |
| DJ Jean - Sexy Lady.jpg | 2026-05-22 20:05 | 352K | |
| DJ Gollum, Scarlet -..> | 2026-05-22 20:05 | 109K | |
| DJ Dean - If I Could..> | 2026-05-22 20:05 | 48K | |
| DJ Bobo - There is a..> | 2026-05-22 19:56 | 129K | |
| DJ Antoine Fea. The ..> | 2026-05-22 20:05 | 236K | |
| D.J. Paul Elstak - T..> | 2026-05-22 19:56 | 56K | |
| D.J. Paul Elstak - R..> | 2026-05-22 19:56 | 64K | |
| D.J. Jazzy Jeff & Th..> | 2026-05-22 19:56 | 68K | |
| D.J. Bobo - Everybod..> | 2026-05-22 19:56 | 33K | |
| D'Arby, Terence Tren..> | 2026-05-22 20:33 | 34K | |
| Döf - Codo (Düse I..> | 2026-05-22 19:39 | 57K | |
| Cyril - Stumblin' In..> | 2026-05-22 20:05 | 306K | |
| Cyndi Lauper - What'..> | 2026-05-22 19:38 | 18K | |
| Cyndi Lauper - True ..> | 2026-05-22 20:33 | 41K | |
| Cyndi Lauper - Time ..> | 2026-05-22 20:33 | 64K | |
| Cyndi Lauper - I Dro..> | 2026-05-22 19:38 | 50K | |
| Cyndi Lauper - Girls..> | 2026-05-22 19:38 | 64K | |
| Cygnus X - Superstri..> | 2026-05-22 19:56 | 45K | |
| Cutting Crew - I Jus..> | 2026-05-22 19:38 | 33K | |
| Cutting Crew - (I Ju..> | 2026-05-22 20:33 | 33K | |
| Curtis Stigers - I W..> | 2026-05-22 19:56 | 76K | |
| Curtis Mayfield - M..> | 2026-05-22 20:05 | 43K | |
| Curtis Mayfield - Mo..> | 2026-05-22 19:31 | 34K | |
| Curiosity Killed the..> | 2026-05-22 19:38 | 33K | |
| Cure - In Between Da..> | 2026-05-22 19:38 | 68K | |
| Cure - Close To Me.jpg | 2026-05-22 19:38 | 44K | |
| Cure - A Forest.jpg | 2026-05-22 19:38 | 44K | |
| Cure, The - Lullaby.jpg | 2026-05-22 19:38 | 33K | |
| Cunningham - Norma J..> | 2026-05-22 19:31 | 162K | |
| Culture Club - Victi..> | 2026-05-22 19:38 | 47K | |
| Culture Club - Time ..> | 2026-05-22 19:38 | 47K | |
| Culture Club - The W..> | 2026-05-22 19:38 | 7.3K | |
| Culture Club - Karma..> | 2026-05-22 19:38 | 416K | |
| Culture Club - It's ..> | 2026-05-22 19:38 | 47K | |
| Culture Club - It's ..> | 2026-05-22 19:38 | 8.5K | |
| Culture Club - Do Yo..> | 2026-05-22 19:38 | 61K | |
| Culture Club - Churc..> | 2026-05-22 19:38 | 47K | |
| Culture Beat - Mr. V..> | 2026-05-22 19:56 | 83K | |
| Culture Beat - Got T..> | 2026-05-22 19:56 | 83K | |
| Crystals - Da Doo Ro..> | 2026-05-22 19:56 | 44K | |
| Crystal Waters - Gyp..> | 2026-05-22 19:56 | 127K | |
| Crystal Gayle - You ..> | 2026-05-22 20:18 | 369K | |
| Crystal Gayle - Why ..> | 2026-05-22 20:18 | 257K | |
| Crystal Gayle - Turn..> | 2026-05-22 20:18 | 287K | |
| Crystal Gayle - Till..> | 2026-05-22 20:18 | 366K | |
| Crystal Gayle - Til ..> | 2026-05-22 20:33 | 53K | |
| Crystal Gayle - The ..> | 2026-05-22 20:18 | 287K | |
| Crystal Gayle - Talk..> | 2026-05-22 20:18 | 257K | |
| Crystal Gayle - Stra..> | 2026-05-22 20:18 | 340K | |
| Crystal Gayle - Some..> | 2026-05-22 20:33 | 59K | |
| Crystal Gayle - Some..> | 2026-05-22 20:18 | 312K | |
| Crystal Gayle - Read..> | 2026-05-22 20:18 | 358K | |
| Crystal Gayle - Our ..> | 2026-05-22 20:18 | 366K | |
| Crystal Gayle - Nobo..> | 2026-05-22 20:18 | 254K | |
| Crystal Gayle - Maki..> | 2026-05-22 20:18 | 30K | |
| Crystal Gayle - It's..> | 2026-05-22 20:18 | 216K | |
| Crystal Gayle - If Y..> | 2026-05-22 20:18 | 322K | |
| Crystal Gayle - I Do..> | 2026-05-22 20:18 | 287K | |
| Crystal Gayle - I Do..> | 2026-05-22 20:33 | 60K | |
| Crystal Gayle - I()l..> | 2026-05-22 20:18 | 369K | |
| Crystal Gayle - I'll..> | 2026-05-22 20:18 | 157K | |
| Crystal Gayle - I'll..> | 2026-05-22 20:33 | 53K | |
| Crystal Gayle - Half..> | 2026-05-22 20:18 | 257K | |
| Crystal Gayle - Don'..> | 2026-05-22 20:18 | 76K | |
| Crystal Gayle - Don'..> | 2026-05-22 20:18 | 257K | |
| Crystal Gayle - Cry.jpg | 2026-05-22 20:18 | 53K | |
| Crystal Gayle - Baby..> | 2026-05-22 20:18 | 366K | |
| Crystal Gayle - Baby..> | 2026-05-22 20:33 | 48K | |
| Crystal Gayle & Gary..> | 2026-05-22 20:33 | 30K | |
| Crusaders Ft. Randy ..> | 2026-05-22 19:31 | 48K | |
| Crowded House - Weat..> | 2026-05-22 20:33 | 115K | |
| Crowded House - Into..> | 2026-05-22 19:38 | 64K | |
| Crowded House - Four..> | 2026-05-22 19:56 | 132K | |
| Crowded House - Don'..> | 2026-05-22 20:33 | 112K | |
| Crowded House - Bett..> | 2026-05-22 19:56 | 73K | |
| Crosby, Stills, Nash..> | 2026-05-22 20:33 | 35K | |
| Crosby, Stills, Nash..> | 2026-05-22 19:31 | 52K | |
| Crosby, Stills & Nas..> | 2026-05-22 20:33 | 48K | |
| Crispian St. Peters ..> | 2026-05-22 20:33 | 49K | |
| Crispian St. Peter -..> | 2026-05-22 20:33 | 58K | |
| Crew Cuts - Sh-Boom ..> | 2026-05-22 19:31 | 427K | |
| Creeds - Push Up (ma..> | 2026-05-22 20:05 | 218K | |
| Creedence Clearwater..> | 2026-05-22 19:31 | 92K | |
| Creedence Clearwater..> | 2026-05-22 20:33 | 516K | |
| Creedence Clearwater..> | 2026-05-22 20:33 | 82K | |
| Creedence Clearwater..> | 2026-05-22 19:31 | 92K | |
| Creedence Clearwater..> | 2026-05-22 19:31 | 131K | |
| Creedence Clearwater..> | 2026-05-22 19:31 | 92K | |
| Creedence Clearwater..> | 2026-05-22 19:31 | 243K | |
| Creedence Clearwater..> | 2026-05-22 19:31 | 66K | |
| Creedence Clearwater..> | 2026-05-22 20:18 | 236K | |
| Creedence Clearwater..> | 2026-05-22 20:33 | 38K | |
| Creedence Clearwater..> | 2026-05-22 20:18 | 87K | |
| Cream - White Room.jpg | 2026-05-22 20:33 | 254K | |
| Crazy World Of Arthu..> | 2026-05-22 20:33 | 71K | |
| Crazy Horse - Downto..> | 2026-05-22 19:31 | 178K | |
| Crazy Frog - Axel F.jpg | 2026-05-22 19:56 | 53K | |
| Crash Test Dummies -..> | 2026-05-22 19:56 | 93K | |
| Craig David - Walkin..> | 2026-05-22 20:05 | 30K | |
| Craig David - 7 Days..> | 2026-05-22 20:05 | 30K | |
| Cozy Powell - Na Na ..> | 2026-05-22 19:31 | 320K | |
| Cozy Powell - Dance ..> | 2026-05-22 19:31 | 282K | |
| Cover Girls - Wishin..> | 2026-05-22 19:56 | 23K | |
| Courtney Visser - Wa..> | 2026-05-22 20:33 | 86K | |
| Courtney Visser - Su..> | 2026-05-22 20:33 | 86K | |
| Courtney Visser - Mo..> | 2026-05-22 20:33 | 86K | |
| Courtney Visser - Ma..> | 2026-05-22 20:33 | 86K | |
| Courtney Visser - Le..> | 2026-05-22 20:33 | 86K | |
| Courtney Visser - Ke..> | 2026-05-22 20:33 | 86K | |
| Courtney Visser - Ha..> | 2026-05-22 20:33 | 86K | |
| Courtney Visser - Ci..> | 2026-05-22 20:33 | 86K | |
| Courtney Visser - Be..> | 2026-05-22 20:33 | 86K | |
| Country Joe & The Fi..> | 2026-05-22 19:31 | 52K | |
| Counting Crows - Mr...> | 2026-05-22 20:05 | 82K | |
| Counting Crows - Big..> | 2026-05-22 20:33 | 83K | |
| Counting Crows - Acc..> | 2026-05-22 20:33 | 76K | |
| Counting Crows & Bl..> | 2026-05-22 20:05 | 343K | |
| Countdown All Star B..> | 2026-05-22 19:38 | 210K | |
| Count Basie & Sarah ..> | 2026-05-22 20:33 | 63K | |
| Cotton Lloyd & Chris..> | 2026-05-22 19:31 | 366K | |
| Costas Papadopoules ..> | 2026-05-22 20:05 | 38K | |
| Cosmic Gate - The Wa..> | 2026-05-22 20:05 | 239K | |
| Cosmic Gate - The Wa..> | 2026-05-22 20:05 | 27K | |
| Cory Day - Wiggle An..> | 2026-05-22 19:31 | 163K | |
| Corrs - Radio.jpg | 2026-05-22 19:56 | 75K | |
| Corrs - Old Town.jpg | 2026-05-22 20:05 | 59K | |
| Corrs - Breathless.jpg | 2026-05-22 20:33 | 42K | |
| Corona - The Rhythm ..> | 2026-05-22 19:56 | 53K | |
| Corona - Rhythm Of T..> | 2026-05-22 19:56 | 72K | |
| Corey Hart - Sunglas..> | 2026-05-22 19:38 | 38K | |
| Coosje Smid - Fields..> | 2026-05-22 20:33 | 58K | |
| Coolio Feat. L.V. - ..> | 2026-05-22 19:56 | 95K | |
| Cool Notes - Spend T..> | 2026-05-22 20:05 | 55K | |
| Cool Notes - Spend T..> | 2026-05-22 19:38 | 46K | |
| Conway Twitty - Tigh..> | 2026-05-22 20:18 | 236K | |
| Conway Twitty - The ..> | 2026-05-22 20:33 | 315K | |
| Conway Twitty - The ..> | 2026-05-22 20:18 | 223K | |
| Conway Twitty - The ..> | 2026-05-22 20:18 | 41K | |
| Conway Twitty - Some..> | 2026-05-22 20:18 | 307K | |
| Conway Twitty - Slow..> | 2026-05-22 20:18 | 95K | |
| Conway Twitty - She'..> | 2026-05-22 20:18 | 268K | |
| Conway Twitty - Rest..> | 2026-05-22 20:18 | 337K | |
| Conway Twitty - It's..> | 2026-05-22 19:56 | 40K | |
| Conway Twitty - I've..> | 2026-05-22 20:18 | 133K | |
| Conway Twitty - Hell..> | 2026-05-22 20:18 | 236K | |
| Conway Twitty - Afte..> | 2026-05-22 20:18 | 42K | |
| Conway Twitty & Lore..> | 2026-05-22 20:33 | 72K | |
| Contours - Do You Lo..> | 2026-05-22 19:38 | 342K | |
| Consortium - All The..> | 2026-05-22 20:33 | 449K | |
| Conquistador - Argen..> | 2026-05-22 20:33 | 53K | |
| Conquistador - Aqua.jpg | 2026-05-22 20:33 | 44K | |
| Conny Vandenbos - Pa..> | 2026-05-22 20:33 | 133K | |
| Conny Froboess - Zwe..> | 2026-05-22 20:33 | 46K | |
| Conny Froboess - Mid..> | 2026-05-22 19:56 | 46K | |
| Conny Froboess & Wil..> | 2026-05-22 19:56 | 46K | |
| Connie Francis - Who..> | 2026-05-22 20:33 | 212K | |
| Connie Francis - Stu..> | 2026-05-22 20:33 | 29K | |
| Connie Francis - My ..> | 2026-05-22 19:56 | 54K | |
| Connie Francis - Lip..> | 2026-05-22 20:33 | 121K | |
| Connie Francis - Eve..> | 2026-05-22 20:33 | 431K | |
| Connie Francis - Bre..> | 2026-05-22 19:56 | 49K | |
| Connie Francis - Bar..> | 2026-05-22 20:33 | 59K | |
| Connells - '74 - '75..> | 2026-05-22 19:56 | 95K | |
| Confettis - C In Chi..> | 2026-05-22 19:38 | 20K | |
| Confetti's - The Sou..> | 2026-05-22 19:38 | 20K | |
| Confetti's - Megamix..> | 2026-05-22 19:56 | 292K | |
| Confetti's - Medley ..> | 2026-05-22 19:56 | 61K | |
| Confetti's - Keep Sm..> | 2026-05-22 19:38 | 20K | |
| Confetti's - C Day.jpg | 2026-05-22 19:38 | 65K | |
| Confetti's - C'count..> | 2026-05-22 19:38 | 241K | |
| Confederate Railroad..> | 2026-05-22 20:18 | 166K | |
| Confederate Railroad..> | 2026-05-22 20:18 | 414K | |
| Condors - Tomorrow.jpg | 2026-05-22 20:33 | 333K | |
| Concrete Blonde - Jo..> | 2026-05-22 19:56 | 77K | |
| ConKi - Tu Es Foutu.jpg | 2026-05-22 20:05 | 49K | |
| Communards - So Cold..> | 2026-05-22 19:38 | 5.3K | |
| Communards - Never C..> | 2026-05-22 19:38 | 53K | |
| Communards, The - Do..> | 2026-05-22 19:38 | 29K | |
| Commodores - Three T..> | 2026-05-22 19:31 | 15K | |
| Commodores - Sail On..> | 2026-05-22 19:31 | 50K | |
| Commodores - Lady.jpg | 2026-05-22 19:38 | 2.0M | |
| Commodores - Goin' T..> | 2026-05-22 19:38 | 75K | |
| Commodores - Brick H..> | 2026-05-22 19:31 | 121K | |
| Commodores, The - Ni..> | 2026-05-22 19:38 | 87K | |
| Color Me Badd - I Wa..> | 2026-05-22 19:56 | 64K | |
| Color Me Badd - All ..> | 2026-05-22 19:56 | 60K | |
| Colonel Abrams - Tra..> | 2026-05-22 19:38 | 21K | |
| Collin Raye - What t..> | 2026-05-22 20:18 | 3.2M | |
| Collin Raye - That's..> | 2026-05-22 20:18 | 201K | |
| Collin Raye - Someon..> | 2026-05-22 20:18 | 201K | |
| Collin Raye - On the..> | 2026-05-22 20:18 | 138K | |
| Collin Raye - One Bo..> | 2026-05-22 20:18 | 164K | |
| Collin Raye - Not Th..> | 2026-05-22 20:18 | 138K | |
| Collin Raye - My Kin..> | 2026-05-22 20:18 | 137K | |
| Collin Raye - Man Of..> | 2026-05-22 20:18 | 137K | |
| Collin Raye - Love R..> | 2026-05-22 20:18 | 138K | |
| Collin Raye - Love, ..> | 2026-05-22 20:18 | 183K | |
| Collin Raye - Little..> | 2026-05-22 20:18 | 137K | |
| Collin Raye - Little..> | 2026-05-22 20:18 | 199K | |
| Collin Raye - In Thi..> | 2026-05-22 20:18 | 149K | |
| Collin Raye - If I W..> | 2026-05-22 20:18 | 201K | |
| Collin Raye - I Thin..> | 2026-05-22 20:18 | 201K | |
| Collin Raye - I Can ..> | 2026-05-22 20:18 | 130K | |
| Collin Raye - Every ..> | 2026-05-22 20:18 | 201K | |
| Collin Raye - Anyone..> | 2026-05-22 20:18 | 131K | |
| Colinda - Let Me In.jpg | 2026-05-22 19:38 | 297K | |
| Colin Blunstone - Wo..> | 2026-05-22 19:31 | 44K | |
| Colin Blunstone - I ..> | 2026-05-22 19:31 | 135K | |
| Colin Blunstone - An..> | 2026-05-22 19:31 | 135K | |
| Coldplay - Viva La V..> | 2026-05-22 20:05 | 64K | |
| Coldplay - Viva La V..> | 2026-05-22 20:05 | 48K | |
| Coldplay - Paradise.jpg | 2026-05-22 20:05 | 53K | |
| Coldplay - Magic.jpg | 2026-05-22 20:05 | 34K | |
| Coldplay - Life In T..> | 2026-05-22 20:05 | 581K | |
| Coldplay - Hymn For ..> | 2026-05-22 20:05 | 66K | |
| Coldplay - Fix You.jpg | 2026-05-22 20:05 | 8.9K | |
| Coldplay - Every Tea..> | 2026-05-22 20:05 | 53K | |
| Coldplay - Everglow.jpg | 2026-05-22 20:05 | 66K | |
| Coldplay - Clocks.jpg | 2026-05-22 20:05 | 22K | |
| Coldplay - Clocks (S..> | 2026-05-22 20:05 | 34K | |
| Coldplay - Christmas..> | 2026-05-22 20:05 | 48K | |
| Coldplay - A sky ful..> | 2026-05-22 20:05 | 54K | |
| Coldplay - Adventure..> | 2026-05-22 20:05 | 55K | |
| Coldcut - Autunm Lea..> | 2026-05-22 20:33 | 64K | |
| Coldcut & Lisa Stans..> | 2026-05-22 19:38 | 32K | |
| Coco M - Walk On The..> | 2026-05-22 19:38 | 100K | |
| Cockney Rebel - Seba..> | 2026-05-22 19:31 | 209K | |
| Cock Robin - When Yo..> | 2026-05-22 19:38 | 36K | |
| Cock Robin - Thought..> | 2026-05-22 19:38 | 36K | |
| Cock Robin - The Pro..> | 2026-05-22 19:38 | 32K | |
| Cock Robin - Just Ar..> | 2026-05-22 19:38 | 273K | |
| Coasters - Yakety Ya..> | 2026-05-22 20:33 | 201K | |
| Co.Ro Feat Tarlisa -..> | 2026-05-22 19:56 | 139K | |
| Clubhouse - Do It Ag..> | 2026-05-22 19:38 | 190K | |
| Club Nouveau - Lean ..> | 2026-05-22 19:38 | 27K | |
| Club 69 - Let Me Be ..> | 2026-05-22 19:56 | 60K | |
| Clout - Substitute.jpg | 2026-05-22 19:31 | 301K | |
| Clout - Save Me.jpg | 2026-05-22 19:31 | 390K | |
| Close Ii You - Baby ..> | 2026-05-22 19:56 | 193K | |
| Clokx - Catch Your F..> | 2026-05-22 20:05 | 79K | |
| Clokx - Catch Your F..> | 2026-05-22 20:05 | 69K | |
| Clock - Axel F (Radi..> | 2026-05-22 19:56 | 110K | |
| Clivilles & Cole - A..> | 2026-05-22 19:56 | 58K | |
| Clivillés & Cole - ..> | 2026-05-22 20:05 | 192K | |
| Clive Griffin - When..> | 2026-05-22 20:33 | 76K | |
| Clinton Ford - Dandy..> | 2026-05-22 20:18 | 23K | |
| Clint Eastwood & Gen..> | 2026-05-22 19:38 | 87K | |
| Clint Black - You Do..> | 2026-05-22 20:18 | 103K | |
| Clint Black - Where ..> | 2026-05-22 20:33 | 32K | |
| Clint Black - When M..> | 2026-05-22 20:18 | 152K | |
| Clint Black - When I..> | 2026-05-22 20:18 | 321K | |
| Clint Black - We Tel..> | 2026-05-22 20:18 | 486K | |
| Clint Black - Walkin..> | 2026-05-22 20:18 | 311K | |
| Clint Black - Til’..> | 2026-05-22 20:18 | 1.1M | |
| Clint Black - The Sh..> | 2026-05-22 20:18 | 152K | |
| Clint Black - State ..> | 2026-05-22 20:18 | 65K | |
| Clint Black - Someth..> | 2026-05-22 20:18 | 103K | |
| Clint Black - Put Yo..> | 2026-05-22 20:18 | 65K | |
| Clint Black - One Mo..> | 2026-05-22 20:18 | 122K | |
| Clint Black - Nothin..> | 2026-05-22 20:18 | 311K | |
| Clint Black - Nothin..> | 2026-05-22 20:18 | 152K | |
| Clint Black - Nobody..> | 2026-05-22 20:18 | 311K | |
| Clint Black - No Tim..> | 2026-05-22 20:18 | 247K | |
| Clint Black - Loving..> | 2026-05-22 20:18 | 152K | |
| Clint Black - Like t..> | 2026-05-22 20:18 | 152K | |
| Clint Black - Leavin..> | 2026-05-22 20:18 | 486K | |
| Clint Black - Killin..> | 2026-05-22 20:18 | 152K | |
| Clint Black - Half W..> | 2026-05-22 20:18 | 65K | |
| Clint Black - Desper..> | 2026-05-22 20:33 | 14K | |
| Clint Black - Desper..> | 2026-05-22 20:18 | 91K | |
| Clint Black - Cadill..> | 2026-05-22 20:18 | 65K | |
| Clint Black - Burn O..> | 2026-05-22 20:18 | 486K | |
| Clint Black - A Good..> | 2026-05-22 20:18 | 152K | |
| Clint Black, Wynonna..> | 2026-05-22 20:18 | 88K | |
| Clint Black, Martina..> | 2026-05-22 20:18 | 56K | |
| Climie Fisher - Rise..> | 2026-05-22 20:33 | 19K | |
| Climie Fisher - Rise..> | 2026-05-22 19:38 | 199K | |
| Climie Fisher - Love..> | 2026-05-22 20:33 | 16K | |
| Cliff RichardThe Sha..> | 2026-05-22 20:33 | 768K | |
| Cliff RichardThe Sha..> | 2026-05-22 20:33 | 77K | |
| Cliff RichardThe Sha..> | 2026-05-22 20:33 | 65K | |
| Cliff Richard -We Do..> | 2026-05-22 19:31 | 17K | |
| Cliff Richard - We D..> | 2026-05-22 19:38 | 17K | |
| Cliff Richard - Trav..> | 2026-05-22 19:56 | 100K | |
| Cliff Richard - The ..> | 2026-05-22 19:31 | 32K | |
| Cliff Richard - The ..> | 2026-05-22 19:56 | 32K | |
| Cliff Richard - The ..> | 2026-05-22 19:31 | 147K | |
| Cliff Richard - Summ..> | 2026-05-22 19:31 | 32K | |
| Cliff Richard - Some..> | 2026-05-22 19:31 | 16K | |
| Cliff Richard - Powe..> | 2026-05-22 19:31 | 70K | |
| Cliff Richard - Move..> | 2026-05-22 19:31 | 36K | |
| Cliff Richard - Miss..> | 2026-05-22 19:31 | 62K | |
| Cliff Richard - Mari..> | 2026-05-22 19:38 | 81K | |
| Cliff Richard - Luck..> | 2026-05-22 19:56 | 65K | |
| Cliff Richard - Livi..> | 2026-05-22 19:38 | 99K | |
| Cliff Richard - It's..> | 2026-05-22 19:56 | 48K | |
| Cliff Richard - Good..> | 2026-05-22 19:31 | 71K | |
| Cliff Richard - Fall..> | 2026-05-22 20:33 | 32K | |
| Cliff Richard - Drea..> | 2026-05-22 19:38 | 34K | |
| Cliff Richard - Do Y..> | 2026-05-22 19:56 | 51K | |
| Cliff Richard - Dadd..> | 2026-05-22 19:38 | 31K | |
| Cliff Richard - Cons..> | 2026-05-22 19:38 | 50K | |
| Cliff Richard - Cong..> | 2026-05-22 20:33 | 37K | |
| Cliff Richard - Blue..> | 2026-05-22 19:56 | 32K | |
| Cliff Richard - Bach..> | 2026-05-22 19:38 | 38K | |
| Cliff Richard - All ..> | 2026-05-22 19:38 | 238K | |
| Cliff Richard & The ..> | 2026-05-22 19:31 | 36K | |
| Cliff Richard & The ..> | 2026-05-22 20:33 | 32K | |
| Cliff Richard & The ..> | 2026-05-22 20:33 | 33K | |
| Cliff Richard & The ..> | 2026-05-22 19:31 | 36K | |
| Cliff Richard & The ..> | 2026-05-22 19:31 | 83K | |
| Cliff Richard & The ..> | 2026-05-22 20:33 | 34K | |
| Cliff Richard & The ..> | 2026-05-22 20:33 | 36K | |
| Cliff Richard & The ..> | 2026-05-22 20:33 | 36K | |
| Cliff Richard & The ..> | 2026-05-22 19:56 | 36K | |
| Cliff Richard & The ..> | 2026-05-22 20:33 | 34K | |
| Cliff Richard & The ..> | 2026-05-22 20:33 | 43K | |
| Cliff Richard & Sara..> | 2026-05-22 19:38 | 52K | |
| Cliff Nobles - The H..> | 2026-05-22 20:33 | 272K | |
| Cliff Bennett & the ..> | 2026-05-22 20:33 | 72K | |
| Clean Bandit ft. Zar..> | 2026-05-22 20:05 | 89K | |
| Clean Bandit Ft. Sea..> | 2026-05-22 20:05 | 64K | |
| Clean Bandit Ft. Jes..> | 2026-05-22 20:05 | 44K | |
| Clay Walker - You're..> | 2026-05-22 20:18 | 186K | |
| Clay Walker - Who Ne..> | 2026-05-22 20:18 | 175K | |
| Clay Walker - White ..> | 2026-05-22 20:18 | 185K | |
| Clay Walker - What's..> | 2026-05-22 20:18 | 185K | |
| Clay Walker - Watch ..> | 2026-05-22 20:18 | 232K | |
| Clay Walker - This W..> | 2026-05-22 20:18 | 266K | |
| Clay Walker - Then W..> | 2026-05-22 20:18 | 232K | |
| Clay Walker - She's ..> | 2026-05-22 20:18 | 201K | |
| Clay Walker - Rumor ..> | 2026-05-22 20:18 | 166K | |
| Clay Walker - One, T..> | 2026-05-22 20:18 | 182K | |
| Clay Walker - Once i..> | 2026-05-22 20:18 | 201K | |
| Clay Walker - Live U..> | 2026-05-22 20:18 | 166K | |
| Clay Walker - Live, ..> | 2026-05-22 20:18 | 201K | |
| Clay Walker - If I C..> | 2026-05-22 20:18 | 213K | |
| Clay Walker - Hypnot..> | 2026-05-22 20:18 | 175K | |
| Clay Walker - Holdin..> | 2026-05-22 20:18 | 201K | |
| Claudia Sylva - J'ai..> | 2026-05-22 20:33 | 44K | |
| Claude King - Wolver..> | 2026-05-22 20:18 | 105K | |
| Claude François - C..> | 2026-05-22 20:33 | 135K | |
| Claude - Layla.jpg | 2026-05-22 20:05 | 7.1M | |
| Claude - Ladada (Mon..> | 2026-05-22 20:05 | 194K | |
| Claude - Écoutez-M..> | 2026-05-22 20:05 | 194K | |
| Classics IV - Spooky..> | 2026-05-22 20:33 | 207K | |
| Classics - Yellow Su..> | 2026-05-22 19:31 | 320K | |
| Classics - Russian L..> | 2026-05-22 19:31 | 194K | |
| Classics - My lady o..> | 2026-05-22 19:31 | 49K | |
| Class Action - Weeke..> | 2026-05-22 19:38 | 99K | |
| Clash - Rock The Cas..> | 2026-05-22 19:38 | 29K | |
| Clarence Clemons & J..> | 2026-05-22 19:56 | 34K | |
| Clarence Clemmons & ..> | 2026-05-22 19:38 | 53K | |
| Clarence Carter - Pa..> | 2026-05-22 19:31 | 43K | |
| Clannad Feat. Bono -..> | 2026-05-22 20:33 | 49K | |
| Clannad - White Fool..> | 2026-05-22 20:33 | 42K | |
| Clannad - Tower Hill..> | 2026-05-22 20:33 | 176K | |
| Clannad - Theme From..> | 2026-05-22 20:33 | 43K | |
| Clannad - The Fairy ..> | 2026-05-22 20:32 | 176K | |
| Clannad - Thíos Fá..> | 2026-05-22 20:33 | 176K | |
| Clannad - Tá’ Mé..> | 2026-05-22 20:32 | 176K | |
| Clannad - Something ..> | 2026-05-22 20:32 | 57K | |
| Clannad - Seachrán ..> | 2026-05-22 20:32 | 176K | |
| Clannad - Robin (The..> | 2026-05-22 20:32 | 57K | |
| Clannad - Passing Ti..> | 2026-05-22 20:32 | 176K | |
| Clannad - Newgrange.jpg | 2026-05-22 20:32 | 57K | |
| Clannad - Listen To ..> | 2026-05-22 20:32 | 86K | |
| Clannad - I See Red.jpg | 2026-05-22 20:32 | 176K | |
| Clannad - Coinleach ..> | 2026-05-22 20:32 | 176K | |
| Clannad - Closer to ..> | 2026-05-22 20:32 | 49K | |
| Clannad - Almost See..> | 2026-05-22 20:32 | 49K | |
| Clannad & Bono - In ..> | 2026-05-22 19:38 | 49K | |
| City to City - The R..> | 2026-05-22 20:32 | 283K | |
| City To City - The R..> | 2026-05-22 20:32 | 57K | |
| Cirque Du Soleil - A..> | 2026-05-22 19:56 | 282K | |
| Circus - Beer or san..> | 2026-05-22 19:31 | 102K | |
| Cindy & Bert - Immer..> | 2026-05-22 19:56 | 46K | |
| Cindy & Bert - Immer..> | 2026-05-22 19:31 | 497K | |
| Cindy & Bert - Freit..> | 2026-05-22 19:31 | 770K | |
| Cilla Black - You've..> | 2026-05-22 20:32 | 40K | |
| Cilla Black - You're..> | 2026-05-22 20:32 | 29K | |
| Cilla Black - Love's..> | 2026-05-22 19:38 | 111K | |
| Cilla Black - It's F..> | 2026-05-22 20:32 | 51K | |
| Cilla Black - Anyone..> | 2026-05-22 20:32 | 14K | |
| Cidinho & Doca - Rap..> | 2026-05-22 20:05 | 25K | |
| Cidinho & Doca - Rap..> | 2026-05-22 20:05 | 252K | |
| Chumbawamba - Tubthu..> | 2026-05-22 19:56 | 62K | |
| Chuck Berry - Sweet ..> | 2026-05-22 20:32 | 46K | |
| Chuck Berry - No Par..> | 2026-05-22 20:32 | 315K | |
| Chuck Berry - Johnny..> | 2026-05-22 20:32 | 46K | |
| Chubby Checker - The..> | 2026-05-22 20:32 | 226K | |
| Chubby Checker - Pon..> | 2026-05-22 20:32 | 44K | |
| Chubby Checker - Lov..> | 2026-05-22 20:32 | 94K | |
| Chubby Checker - Lim..> | 2026-05-22 19:56 | 44K | |
| Chubby Checker - Let..> | 2026-05-22 19:31 | 249K | |
| Chubby Checker & de ..> | 2026-05-22 20:32 | 15K | |
| Chubby Checker & Fat..> | 2026-05-22 19:38 | 41K | |
| Christopher Plummer ..> | 2026-05-22 20:32 | 33K | |
| Christopher Cross - ..> | 2026-05-22 19:38 | 185K | |
| Christopher Cross - ..> | 2026-05-22 19:56 | 40K | |
| Christopher Cross - ..> | 2026-05-22 19:38 | 53K | |
| Christopher Cross - ..> | 2026-05-22 20:32 | 57K | |
| Christopher Cross - ..> | 2026-05-22 19:56 | 62K | |
| Christopher Cross & ..> | 2026-05-22 19:38 | 22K | |
| Christophe - Les Mar..> | 2026-05-22 20:32 | 271K | |
| Christophe - Aline.jpg | 2026-05-22 20:32 | 52K | |
| Christina Milian - W..> | 2026-05-22 20:05 | 30K | |
| Christina Milian - A..> | 2026-05-22 20:05 | 149K | |
| Christina Aguilera F..> | 2026-05-22 20:05 | 5.9M | |
| Christina Aguilera -..> | 2026-05-22 20:05 | 35K | |
| Christina Aguilera -..> | 2026-05-22 20:05 | 33K | |
| Christina Aguilera -..> | 2026-05-22 19:56 | 65K | |
| Christina Aguilera -..> | 2026-05-22 20:05 | 18K | |
| Christina Aguilera &..> | 2026-05-22 20:05 | 45K | |
| Christie - Yellow Ri..> | 2026-05-22 19:38 | 442K | |
| Christians - Words.jpg | 2026-05-22 19:56 | 43K | |
| Christians, Holly Jo..> | 2026-05-22 19:38 | 47K | |
| Christian Anders - G..> | 2026-05-22 19:38 | 117K | |
| Chris Thompson & Nig..> | 2026-05-22 19:31 | 289K | |
| Chris Stapleton - Yo..> | 2026-05-22 20:18 | 8.8K | |
| Chris Stapleton - Te..> | 2026-05-22 20:18 | 227K | |
| Chris Roberts - Du K..> | 2026-05-22 19:31 | 53K | |
| Chris Rea - On The B..> | 2026-05-22 19:38 | 16K | |
| Chris Rea - Josephin..> | 2026-05-22 20:32 | 37K | |
| Chris Rea - I Can He..> | 2026-05-22 19:38 | 23K | |
| Chris Rea - Fool [If..> | 2026-05-22 19:31 | 210K | |
| Chris Rea - Driving ..> | 2026-05-22 20:05 | 28K | |
| Chris Rea - All Summ..> | 2026-05-22 19:38 | 20K | |
| Chris Norman - Midni..> | 2026-05-22 19:38 | 11K | |
| Chris Norman & Suzie..> | 2026-05-22 19:31 | 332K | |
| Chris Montez - The M..> | 2026-05-22 20:32 | 29K | |
| Chris Montez - Loco ..> | 2026-05-22 19:31 | 284K | |
| Chris Montez - Let's..> | 2026-05-22 19:31 | 29K | |
| Chris Montez & Raza ..> | 2026-05-22 19:31 | 119K | |
| Chris LeDoux - Dalla..> | 2026-05-22 20:18 | 111K | |
| Chris LeDoux - Cadil..> | 2026-05-22 20:18 | 281K | |
| Chris Isaak - Wicked..> | 2026-05-22 19:56 | 57K | |
| Chris Isaak - Blue H..> | 2026-05-22 20:32 | 39K | |
| Chris Howland - Frau..> | 2026-05-22 19:56 | 33K | |
| Chris Farlowe - Out ..> | 2026-05-22 20:32 | 186K | |
| Chris De Burgh - The..> | 2026-05-22 19:38 | 22K | |
| Chris De Burgh - Sai..> | 2026-05-22 19:38 | 31K | |
| Chris De Burgh - Mis..> | 2026-05-22 19:38 | 31K | |
| Chris De Burgh - Lad..> | 2026-05-22 19:38 | 142K | |
| Chris Barber - Bourb..> | 2026-05-22 19:38 | 1.9M | |
| Chris Barber's Jazz ..> | 2026-05-22 20:32 | 45K | |
| Chris Andrews - Yest..> | 2026-05-22 20:32 | 57K | |
| Chris Andrews - Pret..> | 2026-05-22 20:32 | 57K | |
| Chris Andréws - To ..> | 2026-05-22 20:32 | 57K | |
| Chordettes - Mr Sand..> | 2026-05-22 20:32 | 281K | |
| Chordettes - Mr. San..> | 2026-05-22 20:32 | 72K | |
| Chordettes - Mister ..> | 2026-05-22 20:18 | 169K | |
| Chordettes - Lollipo..> | 2026-05-22 19:56 | 49K | |
| Chocolate - Ritmo De..> | 2026-05-22 19:56 | 138K | |
| Chip Taylor - Same O..> | 2026-05-22 19:31 | 35K | |
| China Crisis - Wishf..> | 2026-05-22 19:38 | 46K | |
| Chiffons - One Fine ..> | 2026-05-22 19:38 | 1.7M | |
| Chicory Tip - Son Of..> | 2026-05-22 19:31 | 227K | |
| Chico & Roberta - Fr..> | 2026-05-22 19:56 | 79K | |
| Chicken Shack - I Ra..> | 2026-05-22 20:32 | 55K | |
| Chicken Shack - I'd ..> | 2026-05-22 19:31 | 261K | |
| Chicken Shack - I'd ..> | 2026-05-22 20:32 | 47K | |
| Chicane, Moya Brenna..> | 2026-05-22 20:05 | 208K | |
| Chicago - You're The..> | 2026-05-22 20:32 | 56K | |
| Chicago - Wishing Yo..> | 2026-05-22 19:31 | 58K | |
| Chicago - Stay The N..> | 2026-05-22 19:38 | 56K | |
| Chicago - Look Away.jpg | 2026-05-22 19:38 | 98K | |
| Chicago - If You Lea..> | 2026-05-22 19:31 | 34K | |
| Chicago - I'm a Man ..> | 2026-05-22 20:32 | 34K | |
| Chicago - Hard To Sa..> | 2026-05-22 19:38 | 44K | |
| Chicago - Baby, What..> | 2026-05-22 19:31 | 251K | |
| Chicago - 25 Or 6 To..> | 2026-05-22 19:31 | 109K | |
| Chic - You Are Beaut..> | 2026-05-22 19:38 | 309K | |
| Chic - Le Freak.jpg | 2026-05-22 19:31 | 18K | |
| Chic - Jack Le Freak..> | 2026-05-22 19:38 | 44K | |
| Chic - I Want Your L..> | 2026-05-22 20:05 | 27K | |
| Chic - Good Times.jpg | 2026-05-22 19:31 | 287K | |
| Chic - Good Times (..> | 2026-05-22 19:38 | 94K | |
| Chi Coltrane - You W..> | 2026-05-22 20:32 | 40K | |
| Chi Coltrane - Go Li..> | 2026-05-22 20:32 | 100K | |
| Chi-Lites - Have You..> | 2026-05-22 19:31 | 212K | |
| Cheyenne Toney - For..> | 2026-05-22 20:05 | 63K | |
| Chet Baker - They Al..> | 2026-05-22 20:32 | 71K | |
| Chess - I Dreamed A ..> | 2026-05-22 19:56 | 39K | |
| Chesney Hawkes - The..> | 2026-05-22 19:56 | 138K | |
| Cher - Walking In Me..> | 2026-05-22 19:56 | 120K | |
| Cher - The Shoop Sho..> | 2026-05-22 19:56 | 66K | |
| Cher - Sunny.jpg | 2026-05-22 20:32 | 60K | |
| Cher - Strong Enough..> | 2026-05-22 19:31 | 38K | |
| Cher - Love And Unde..> | 2026-05-22 19:31 | 45K | |
| Cher - If I Could Tu..> | 2026-05-22 20:32 | 88K | |
| Cher - Gypsies, Tram..> | 2026-05-22 19:31 | 126K | |
| Cher - Gypsies, Tra..> | 2026-05-22 19:56 | 46K | |
| Cher - Believe.jpg | 2026-05-22 19:56 | 71K | |
| Cher - Believe.jpg | 2026-05-22 19:31 | 38K | |
| Cher - Bang Bang (My..> | 2026-05-22 20:32 | 129K | |
| Cher - All I really ..> | 2026-05-22 20:32 | 76K | |
| Cher & Beavis & Butt..> | 2026-05-22 19:56 | 52K | |
| Chemise - She Can't ..> | 2026-05-22 19:38 | 72K | |
| Chely Wright - Singl..> | 2026-05-22 20:18 | 164K | |
| Chelsea - Every show..> | 2026-05-22 19:29 | 3.1K | |
| Chef'special - In Yo..> | 2026-05-22 20:05 | 7.5K | |
| Chef'Special - Afrai..> | 2026-05-22 20:05 | 264K | |
| Cheeky Girls - Cheek..> | 2026-05-22 20:05 | 56K | |
| Cheap Trick - I Want..> | 2026-05-22 19:31 | 289K | |
| Chase - Get It On.jpg | 2026-05-22 19:31 | 128K | |
| Charly Mcclain - Who..> | 2026-05-22 20:18 | 92K | |
| Charly Mcclain - Rad..> | 2026-05-22 20:18 | 120K | |
| Charly Lownoise Ment..> | 2026-05-22 19:56 | 399K | |
| Charly Lownoise & Me..> | 2026-05-22 20:05 | 105K | |
| Charly Lownoise & Me..> | 2026-05-22 19:56 | 137K | |
| Charly Lownoise & Me..> | 2026-05-22 19:56 | 139K | |
| Charly Lownoise & Me..> | 2026-05-22 19:56 | 114K | |
| Charlie Walker - Who..> | 2026-05-22 20:18 | 93K | |
| Charlie Walker - Pic..> | 2026-05-22 20:18 | 184K | |
| Charlie Rich - The M..> | 2026-05-22 20:18 | 33K | |
| Charlie Rich - The M..> | 2026-05-22 19:31 | 226K | |
| Charlie Rich - The M..> | 2026-05-22 20:18 | 227K | |
| Charlie Rich - On My..> | 2026-05-22 20:18 | 131K | |
| Charlie Rich - My El..> | 2026-05-22 20:18 | 205K | |
| Charlie Rich - I Lov..> | 2026-05-22 20:18 | 174K | |
| Charlie Rich - Every..> | 2026-05-22 20:18 | 131K | |
| Charlie Rich - Behin..> | 2026-05-22 20:18 | 227K | |
| Charlie Rich - All O..> | 2026-05-22 20:18 | 174K | |
| Charlie Rich - A VER..> | 2026-05-22 20:18 | 131K | |
| Charlie Puth Ft Megh..> | 2026-05-22 20:05 | 26K | |
| Charley Pride - You ..> | 2026-05-22 20:18 | 221K | |
| Charley Pride - You'..> | 2026-05-22 20:18 | 222K | |
| Charley Pride - You'..> | 2026-05-22 20:18 | 149K | |
| Charley Pride - When..> | 2026-05-22 20:18 | 191K | |
| Charley Pride - Some..> | 2026-05-22 20:18 | 203K | |
| Charley Pride - Shou..> | 2026-05-22 20:18 | 240K | |
| Charley Pride - Roll..> | 2026-05-22 20:18 | 222K | |
| Charley Pride - Nigh..> | 2026-05-22 20:18 | 92K | |
| Charley Pride - Neve..> | 2026-05-22 20:18 | 222K | |
| Charley Pride - Moun..> | 2026-05-22 20:18 | 222K | |
| Charley Pride - Kiss..> | 2026-05-22 20:18 | 96K | |
| Charley Pride - Is A..> | 2026-05-22 20:18 | 222K | |
| Charley Pride - Burg..> | 2026-05-22 20:18 | 222K | |
| Charles Trenet - La ..> | 2026-05-22 19:56 | 22K | |
| Charles D. Lewis - S..> | 2026-05-22 19:56 | 44K | |
| Charles Aznavour - Y..> | 2026-05-22 20:32 | 43K | |
| Charles Aznavour - T..> | 2026-05-22 20:32 | 18K | |
| Charles Aznavour - S..> | 2026-05-22 19:31 | 216K | |
| Charles Aznavour - S..> | 2026-05-22 19:56 | 53K | |
| Charles Aznavour - Q..> | 2026-05-22 20:32 | 25K | |
| Charles Aznavour - M..> | 2026-05-22 19:56 | 38K | |
| Charles Aznavour - L..> | 2026-05-22 20:32 | 25K | |
| Charles Aznavour - L..> | 2026-05-22 20:32 | 56K | |
| Charles Aznavour - L..> | 2026-05-22 20:32 | 28K | |
| Charles Aznavour - F..> | 2026-05-22 19:38 | 118K | |
| Charles & Eddie - Wo..> | 2026-05-22 19:56 | 52K | |
| Charlene -I've Never..> | 2026-05-22 19:38 | 41K | |
| Chaps - Rawhide.jpg | 2026-05-22 19:38 | 65K | |
| Chaplin Band - Il Ve..> | 2026-05-22 19:56 | 119K | |
| Change - Change Of H..> | 2026-05-22 19:38 | 22K | |
| Change - A Lover's H..> | 2026-05-22 20:05 | 70K | |
| Champs - Tequila.jpg | 2026-05-22 20:32 | 138K | |
| Champaign - How 'Bou..> | 2026-05-22 19:38 | 48K | |
| Chaka Khan - I Feel ..> | 2026-05-22 19:38 | 40K | |
| Chaka Khan - I'm eve..> | 2026-05-22 19:31 | 32K | |
| Chaka Demus & Pliers..> | 2026-05-22 19:56 | 76K | |
| Chaka Demus & Pliers..> | 2026-05-22 19:56 | 19K | |
| Chainsmokers - Selfi..> | 2026-05-22 20:05 | 35K | |
| Chainsmokers & Coldp..> | 2026-05-22 20:05 | 32K | |
| Chad Brock - Ordinar..> | 2026-05-22 20:18 | 80K | |
| Chad Brock - A Count..> | 2026-05-22 20:18 | 158K | |
| Ch!pz - Studio 54.jpg | 2026-05-22 20:05 | 88K | |
| Ch!pz - One Two Thre..> | 2026-05-22 20:05 | 81K | |
| Ch!Pz - One Day When..> | 2026-05-22 20:05 | 72K | |
| Ch!Pz - Cowboy.jpg | 2026-05-22 20:05 | 48K | |
| Ch!Pz - Ch!Pz In Bla..> | 2026-05-22 20:05 | 66K | |
| Ch!Pz - 1001 Arabian..> | 2026-05-22 20:05 | 90K | |
| Centerfold - Radar L..> | 2026-05-22 19:38 | 40K | |
| Centerfold - Dictato..> | 2026-05-22 19:38 | 40K | |
| Celine Dion - Where ..> | 2026-05-22 19:56 | 80K | |
| Celine Dion - Think ..> | 2026-05-22 19:56 | 84K | |
| Celine Dion - The Po..> | 2026-05-22 20:32 | 223K | |
| Celine Dion - The Po..> | 2026-05-22 19:56 | 84K | |
| Celine Dion - That's..> | 2026-05-22 19:56 | 59K | |
| Celine Dion - River ..> | 2026-05-22 20:32 | 162K | |
| Celine Dion - My Hea..> | 2026-05-22 20:32 | 24K | |
| Celine Dion - I Drov..> | 2026-05-22 20:32 | 26K | |
| Celine Dion - I'm Al..> | 2026-05-22 20:32 | 37K | |
| Celine Dion - Fallin..> | 2026-05-22 19:56 | 68K | |
| Celine Dion - Becaus..> | 2026-05-22 20:32 | 27K | |
| Celine Dion - All By..> | 2026-05-22 19:56 | 24K | |
| Celine Dion - A New ..> | 2026-05-22 20:32 | 321K | |
| Celine Dion & The Be..> | 2026-05-22 19:56 | 57K | |
| Celine Dion & Anne G..> | 2026-05-22 20:32 | 26K | |
| Celine Dion & Anne G..> | 2026-05-22 20:32 | 26K | |
| Ce Ce Peniston - We ..> | 2026-05-22 19:56 | 41K | |
| Ce Ce Peniston - Fin..> | 2026-05-22 19:56 | 89K | |
| Cb Milton - Send Me ..> | 2026-05-22 19:56 | 185K | |
| Cats The - Vaya Con ..> | 2026-05-22 20:32 | 43K | |
| Cats The - Save The ..> | 2026-05-22 20:32 | 43K | |
| Cats - Why.jpg | 2026-05-22 19:38 | 297K | |
| Cats - Where Have I ..> | 2026-05-22 19:31 | 146K | |
| Cats - What is the w..> | 2026-05-22 20:32 | 63K | |
| Cats - Vaya Con Dios..> | 2026-05-22 19:31 | 83K | |
| Cats - Turn Around A..> | 2026-05-22 19:38 | 250K | |
| Cats - Times were wh..> | 2026-05-22 20:32 | 63K | |
| Cats -There Has Been..> | 2026-05-22 19:31 | 44K | |
| Cats - The End Of Th..> | 2026-05-22 19:31 | 34K | |
| Cats - Sure he's a c..> | 2026-05-22 20:32 | 43K | |
| Cats - She Was Too Y..> | 2026-05-22 19:31 | 291K | |
| Cats - Scarlet ribbo..> | 2026-05-22 20:32 | 349K | |
| Cats - Rock 'n' Roll..> | 2026-05-22 19:38 | 65K | |
| Cats - One Way Wind.jpg | 2026-05-22 19:31 | 12K | |
| Cats - Maribaja.jpg | 2026-05-22 19:31 | 213K | |
| Cats - Marian.jpg | 2026-05-22 20:32 | 73K | |
| Cats - Magical Myste..> | 2026-05-22 19:31 | 675K | |
| Cats - Let's Dance.jpg | 2026-05-22 19:31 | 34K | |
| Cats - Lea.jpg | 2026-05-22 20:32 | 83K | |
| Cats - Come Sunday.jpg | 2026-05-22 19:38 | 14K | |
| Cats - Be My Day.jpg | 2026-05-22 19:31 | 12K | |
| Cathy Dennis - Touch..> | 2026-05-22 19:56 | 40K | |
| Catherine Ferry - Un..> | 2026-05-22 20:32 | 469K | |
| Caterina Valente - T..> | 2026-05-22 20:32 | 40K | |
| Caterina Valente - T..> | 2026-05-22 20:32 | 40K | |
| Catapult - Teeny Bop..> | 2026-05-22 19:31 | 120K | |
| Catapult - Let Your ..> | 2026-05-22 19:31 | 420K | |
| Cat Stevens - Mornin..> | 2026-05-22 19:31 | 25K | |
| Cat Stevens - Matthe..> | 2026-05-22 20:32 | 43K | |
| Cat Stevens - Lady D..> | 2026-05-22 20:32 | 47K | |
| Cat Stevens - I Love..> | 2026-05-22 20:32 | 43K | |
| Casuals - Jesamine [..> | 2026-05-22 20:32 | 134K | |
| Casuals - Jesamine.jpg | 2026-05-22 19:56 | 45K | |
| Cast West Side Story..> | 2026-05-22 20:32 | 34K | |
| Cassö & Raye & D - ..> | 2026-05-22 20:05 | 56K | |
| Cashmere - Love's Wh..> | 2026-05-22 19:31 | 158K | |
| Casey Jones & the Go..> | 2026-05-22 20:32 | 57K | |
| CascadaJax Jones - A..> | 2026-05-22 20:05 | 52K | |
| Cascada - Truly madl..> | 2026-05-22 20:05 | 54K | |
| Cascada - Everytime ..> | 2026-05-22 20:05 | 44K | |
| Cascada - Evacuate T..> | 2026-05-22 20:05 | 47K | |
| Cascada - Evacuate T..> | 2026-05-22 20:05 | 52K | |
| Cascada - Dangerous.jpg | 2026-05-22 20:05 | 54K | |
| Cascada - Because Th..> | 2026-05-22 20:05 | 46K | |
| Cartoons - Witch Doc..> | 2026-05-22 19:56 | 88K | |
| Cartoons - Doo Dah!.jpg | 2026-05-22 19:56 | 88K | |
| Cars - My Best Frien..> | 2026-05-22 19:31 | 155K | |
| Cars - Drive.jpg | 2026-05-22 19:38 | 35K | |
| Carrilio - Samba De ..> | 2026-05-22 19:56 | 474K | |
| Carrie Underwood - B..> | 2026-05-22 20:18 | 43K | |
| Carpenters - Yesterd..> | 2026-05-22 20:32 | 43K | |
| Carpenters - We've o..> | 2026-05-22 20:32 | 29K | |
| Carpenters - We've O..> | 2026-05-22 19:31 | 148K | |
| Carpenters - Top Of ..> | 2026-05-22 20:32 | 34K | |
| Carpenters - Ticket ..> | 2026-05-22 20:32 | 29K | |
| Carpenters - Those g..> | 2026-05-22 20:32 | 50K | |
| Carpenters - This ma..> | 2026-05-22 20:32 | 43K | |
| Carpenters - There's..> | 2026-05-22 20:32 | 35K | |
| Carpenters - Sweet, ..> | 2026-05-22 19:31 | 2.5M | |
| Carpenters - Superst..> | 2026-05-22 19:31 | 50K | |
| Carpenters - Superst..> | 2026-05-22 20:32 | 50K | |
| Carpenters - Solitai..> | 2026-05-22 20:32 | 51K | |
| Carpenters - Sing.jpg | 2026-05-22 20:32 | 34K | |
| Carpenters - Rainy d..> | 2026-05-22 20:32 | 16K | |
| Carpenters - Rainy D..> | 2026-05-22 19:38 | 295K | |
| Carpenters - Please ..> | 2026-05-22 20:32 | 51K | |
| Carpenters - Only Ye..> | 2026-05-22 20:32 | 68K | |
| Carpenters - Jambala..> | 2026-05-22 19:31 | 43K | |
| Carpenters - I Won't..> | 2026-05-22 19:31 | 40K | |
| Carpenters - Hurting..> | 2026-05-22 20:32 | 36K | |
| Carpenters - Goodbye..> | 2026-05-22 20:32 | 36K | |
| Carpenters - For All..> | 2026-05-22 19:38 | 38K | |
| Carpenters - Close T..> | 2026-05-22 20:32 | 27K | |
| Carpenters, The - Ye..> | 2026-05-22 19:31 | 43K | |
| Carole King - You've..> | 2026-05-22 20:32 | 48K | |
| Carole King - It's T..> | 2026-05-22 19:31 | 45K | |
| Carole King - (You M..> | 2026-05-22 19:31 | 45K | |
| Carol Line - Single ..> | 2026-05-22 19:31 | 68K | |
| Caro Emerald - Tangl..> | 2026-05-22 20:32 | 38K | |
| Caro Emerald - Stuck..> | 2026-05-22 20:32 | 42K | |
| Caro Emerald - Rivie..> | 2026-05-22 20:32 | 24K | |
| Caro Emerald - Back ..> | 2026-05-22 20:32 | 24K | |
| Caro Emerald - A Nig..> | 2026-05-22 20:32 | 24K | |
| Carly Simon - You're..> | 2026-05-22 20:32 | 33K | |
| Carly Simon - You're..> | 2026-05-22 19:31 | 339K | |
| Carly Simon - Why.jpg | 2026-05-22 19:38 | 56K | |
| Carly Simon - Nobody..> | 2026-05-22 20:32 | 31K | |
| Carly Simon - It's H..> | 2026-05-22 20:32 | 31K | |
| Carly Simon - Coming..> | 2026-05-22 20:32 | 40K | |
| Carly Rae Jepsen - C..> | 2026-05-22 20:05 | 56K | |
| Carlsberg - All The ..> | 2026-05-22 19:30 | 392K | |
| Carlos - The Silmari..> | 2026-05-22 20:05 | 43K | |
| Carlos - The Silmari..> | 2026-05-22 19:55 | 67K | |
| Carlo Vuur - Ik Zoek..> | 2026-05-22 19:55 | 132K | |
| Carlene Carter - Eve..> | 2026-05-22 20:18 | 66K | |
| Carlene Carter - Com..> | 2026-05-22 20:18 | 145K | |
| Carla Thomas & Otis ..> | 2026-05-22 20:32 | 146K | |
| Carl Wayne - Way Bac..> | 2026-05-22 19:30 | 131K | |
| Carl Perkins - Dixie..> | 2026-05-22 20:18 | 218K | |
| Carl Perkins - Blue ..> | 2026-05-22 19:55 | 62K | |
| Carl Jackson, John S..> | 2026-05-22 20:18 | 33K | |
| Carl Douglas - Kung ..> | 2026-05-22 19:30 | 281K | |
| Carl Douglas - Dance..> | 2026-05-22 19:30 | 365K | |
| Carl Belew - Lonely ..> | 2026-05-22 20:18 | 172K | |
| Carl Belew - Am I Th..> | 2026-05-22 20:18 | 218K | |
| Carel Kraayenhof - A..> | 2026-05-22 20:32 | 62K | |
| Cardigans - My Favou..> | 2026-05-22 19:55 | 42K | |
| Cardigans - Lovefool..> | 2026-05-22 19:55 | 42K | |
| Captain Sensible - W..> | 2026-05-22 19:38 | 91K | |
| Captain Jack - Toget..> | 2026-05-22 19:55 | 281K | |
| Captain Jack - Soldi..> | 2026-05-22 19:55 | 279K | |
| Captain Jack - Drill..> | 2026-05-22 19:55 | 61K | |
| Captain Jack - Capta..> | 2026-05-22 19:55 | 61K | |
| Captain Jack - Anoth..> | 2026-05-22 19:55 | 91K | |
| Captain Hollywood Pr..> | 2026-05-22 19:55 | 90K | |
| Captain Hollywood Pr..> | 2026-05-22 19:55 | 56K | |
| Captain And Tennille..> | 2026-05-22 19:30 | 263K | |
| Captain & Tennille -..> | 2026-05-22 19:30 | 50K | |
| Captain & Tennille -..> | 2026-05-22 19:30 | 249K | |
| Captain & Tennille -..> | 2026-05-22 19:38 | 99K | |
| Cappella - U Got 2 L..> | 2026-05-22 19:55 | 186K | |
| Capella - U Got 2 Kn..> | 2026-05-22 19:55 | 87K | |
| Capella - Move On Ba..> | 2026-05-22 19:55 | 184K | |
| Capella - Everybody.jpg | 2026-05-22 19:55 | 60K | |
| Canned Heat - On the..> | 2026-05-22 20:32 | 79K | |
| Candyman - Knockin' ..> | 2026-05-22 19:55 | 51K | |
| Candy Dulfer - Saxua..> | 2026-05-22 19:55 | 18K | |
| Candy Dulfer & Dave ..> | 2026-05-22 20:32 | 18K | |
| Candi Staton - Young..> | 2026-05-22 19:30 | 173K | |
| Canadian Sweethearts..> | 2026-05-22 20:32 | 43K | |
| Campbell & Alcemist ..> | 2026-05-22 20:05 | 310K | |
| Camila Cabello - Hav..> | 2026-05-22 20:05 | 49K | |
| Cameo - Word Up.jpg | 2026-05-22 19:38 | 72K | |
| Cameo - Word Up!.jpg | 2026-05-22 19:55 | 72K | |
| Camaros Gang - Ali S..> | 2026-05-22 19:38 | 88K | |
| Calvin Harris ft. Ra..> | 2026-05-22 20:05 | 46K | |
| Calvin Harris Ft. Ke..> | 2026-05-22 20:05 | 44K | |
| Calvin Harris Feat. ..> | 2026-05-22 20:05 | 59K | |
| Calvin Harris - Summ..> | 2026-05-22 20:05 | 39K | |
| Calvin Harris - One ..> | 2026-05-22 20:05 | 40K | |
| Calvin Harris & Sam ..> | 2026-05-22 20:05 | 79K | |
| Calvin Harris & Rag ..> | 2026-05-22 20:05 | 212K | |
| Calvin Harris & Dua ..> | 2026-05-22 20:05 | 40K | |
| Calvin Harris & Disc..> | 2026-05-22 20:05 | 32K | |
| Calum Scott - Dancin..> | 2026-05-22 20:05 | 40K | |
| Cal Smith - Country ..> | 2026-05-22 20:18 | 189K | |
| Cal Smith - Amanda.jpg | 2026-05-22 20:18 | 142K | |
| Cactus Choir - Step ..> | 2026-05-22 20:32 | 21K | |
| CYRIL; LUNAX - Stumb..> | 2026-05-22 20:05 | 306K | |
| CYREES - Murder On T..> | 2026-05-22 20:05 | 166K | |
| CJ Stone - Infinity.jpg | 2026-05-22 20:05 | 104K | |
| C Jérôme - C'est M..> | 2026-05-22 20:32 | 35K | |
| CCCP - Made In Russi..> | 2026-05-22 19:38 | 184K | |
| C.W. Mccall - Convoy..> | 2026-05-22 19:30 | 354K | |
| C. Jerome - C'est mo..> | 2026-05-22 19:30 | 131K | |
| C. Jérôme - C’es..> | 2026-05-22 20:32 | 30K | |
| C.B. Milton - Open Y..> | 2026-05-22 19:55 | 92K | |
| C + C Music Factory ..> | 2026-05-22 19:38 | 24K | |
| C+C Music Factory - ..> | 2026-05-22 19:55 | 62K | |
| C'est Tout - De Tand..> | 2026-05-22 19:56 | 51K | |
| C&C Music Factory - ..> | 2026-05-22 19:55 | 32K | |
| Céline Dion - Treat..> | 2026-05-22 20:32 | 143K | |
| Céline Dion - Pour ..> | 2026-05-22 20:32 | 24K | |
| Céline Dion - It's ..> | 2026-05-22 20:32 | 19K | |
| Céline Dion - Immor..> | 2026-05-22 20:32 | 191K | |
| Céline Dion & Barbr..> | 2026-05-22 19:56 | 57K | |
| Bzn - Waiting for Yo..> | 2026-05-22 20:32 | 37K | |
| Bzn - The Banjo Man.jpg | 2026-05-22 19:55 | 39K | |
| Bzn - Sweet Silver A..> | 2026-05-22 19:30 | 235K | |
| Bzn - Rockin´ The T..> | 2026-05-22 19:38 | 69K | |
| Bzn - Pearlydumm.jpg | 2026-05-22 19:38 | 10K | |
| Bzn - Mon Amour.jpg | 2026-05-22 19:30 | 88K | |
| Bzn - Le Legionnaire..> | 2026-05-22 19:55 | 67K | |
| Bzn - Le Legionaire.jpg | 2026-05-22 19:38 | 38K | |
| Bzn - Lady Mccorey.jpg | 2026-05-22 19:30 | 303K | |
| Bzn - La Saison Fran..> | 2026-05-22 19:38 | 38K | |
| Bzn - La France.jpg | 2026-05-22 19:38 | 303K | |
| Bzn - Just An Illusi..> | 2026-05-22 19:38 | 10K | |
| Bzn - If I Say The W..> | 2026-05-22 19:38 | 42K | |
| Bzn - If I Had Only ..> | 2026-05-22 19:38 | 86K | |
| Bzn - Che Sarà.jpg | 2026-05-22 19:55 | 55K | |
| Bzn - Chanson D´Amo..> | 2026-05-22 19:38 | 38K | |
| Bzn - Banjo Man (Liv..> | 2026-05-22 20:05 | 79K | |
| Byrds - So You Want ..> | 2026-05-22 20:32 | 95K | |
| Byrds - Set You Free..> | 2026-05-22 20:32 | 239K | |
| Byrds - My Back Page..> | 2026-05-22 20:32 | 170K | |
| Byrds - Mr. Tambouri..> | 2026-05-22 20:32 | 57K | |
| Byrds - Mr. Spaceman..> | 2026-05-22 20:32 | 56K | |
| Byrds - Jesus Is Jus..> | 2026-05-22 19:30 | 165K | |
| Byrds - Fifth Dimens..> | 2026-05-22 20:32 | 123K | |
| Byrds - Eight Miles ..> | 2026-05-22 20:32 | 178K | |
| Byrds - All I Really..> | 2026-05-22 19:38 | 213K | |
| Buzzy Bus - You Don'..> | 2026-05-22 19:55 | 64K | |
| Buzz Wilson - El Pas..> | 2026-05-22 20:18 | 373K | |
| Buster Poindexter - ..> | 2026-05-22 19:38 | 68K | |
| Buster Poindexter & ..> | 2026-05-22 19:38 | 367K | |
| Burt Blanca & the Ki..> | 2026-05-22 20:32 | 254K | |
| Buggles - Video Kill..> | 2026-05-22 19:30 | 398K | |
| Buffy the Vampire Sl..> | 2026-05-22 19:55 | 539K | |
| Buffoons - Tomorrow ..> | 2026-05-22 20:05 | 74K | |
| Buffoons - To Know Y..> | 2026-05-22 19:30 | 81K | |
| Buffoons - Sunday Wi..> | 2026-05-22 20:32 | 371K | |
| Buffoons - My World ..> | 2026-05-22 20:32 | 418K | |
| Buffoons - Lovely Lo..> | 2026-05-22 20:32 | 330K | |
| Buffoons - Let It Be..> | 2026-05-22 19:30 | 81K | |
| Buffoons - Goodbye M..> | 2026-05-22 20:32 | 330K | |
| Buffoons - Catarina ..> | 2026-05-22 20:32 | 330K | |
| Buena Vista Social C..> | 2026-05-22 19:55 | 38K | |
| Buddy Holly - Words ..> | 2026-05-22 20:32 | 36K | |
| Buddy Holly - Well....> | 2026-05-22 20:32 | 36K | |
| Buddy Holly - That'l..> | 2026-05-22 20:32 | 44K | |
| Buddy Holly - Rave O..> | 2026-05-22 20:32 | 36K | |
| Buddy Holly - Rainin..> | 2026-05-22 20:32 | 60K | |
| Buddy Holly - Peggy ..> | 2026-05-22 20:32 | 64K | |
| Buddy Holly - Oh Boy..> | 2026-05-22 20:32 | 42K | |
| Buddy Holly - Oh Boy..> | 2026-05-22 20:32 | 44K | |
| Buddy Holly - It Doe..> | 2026-05-22 20:32 | 72K | |
| Buddy Holly - I'm Go..> | 2026-05-22 20:32 | 36K | |
| Buddy Holly - Heartb..> | 2026-05-22 20:32 | 30K | |
| Buddy Holly - Brown-..> | 2026-05-22 20:32 | 61K | |
| Buddy Holly - Becaus..> | 2026-05-22 20:32 | 49K | |
| Buckshot Lefonque - ..> | 2026-05-22 20:32 | 113K | |
| Bucks Fizz - The Lan..> | 2026-05-22 19:38 | 19K | |
| Bucks Fizz - Making ..> | 2026-05-22 19:38 | 19K | |
| Buck Roberts - Big B..> | 2026-05-22 20:18 | 77K | |
| Buck Owens - Under Y..> | 2026-05-22 20:18 | 232K | |
| Buck Owens - Streets..> | 2026-05-22 20:18 | 273K | |
| Buck Owens - Love's ..> | 2026-05-22 20:18 | 216K | |
| Buck Owens - Excuse ..> | 2026-05-22 20:18 | 191K | |
| Buck Owens - Amsterd..> | 2026-05-22 19:30 | 251K | |
| Buck Owens - Above a..> | 2026-05-22 20:18 | 192K | |
| Bryan White - So Muc..> | 2026-05-22 20:18 | 134K | |
| Bryan White - Rebecc..> | 2026-05-22 20:18 | 178K | |
| Bryan White - I'm No..> | 2026-05-22 20:18 | 134K | |
| Bryan White & Shania..> | 2026-05-22 20:32 | 59K | |
| Bryan Ferry - The Pr..> | 2026-05-22 19:30 | 24K | |
| Bryan Ferry - Slave ..> | 2026-05-22 19:38 | 37K | |
| Bryan Ferry - Let's ..> | 2026-05-22 19:30 | 289K | |
| Bryan Ferry - I Put ..> | 2026-05-22 19:55 | 83K | |
| Bryan Ferry - Don't ..> | 2026-05-22 19:38 | 68K | |
| Bryan Adams - Summer..> | 2026-05-22 19:55 | 64K | |
| Bryan Adams - Somebo..> | 2026-05-22 19:38 | 3.0K | |
| Bryan Adams - Run To..> | 2026-05-22 19:38 | 22K | |
| Bryan Adams - Please..> | 2026-05-22 19:55 | 42K | |
| Bryan Adams - I'm Re..> | 2026-05-22 19:55 | 42K | |
| Bryan Adams - Here I..> | 2026-05-22 20:05 | 20K | |
| Bryan Adams - Heaven..> | 2026-05-22 19:38 | 22K | |
| Bryan Adams - Have Y..> | 2026-05-22 19:55 | 39K | |
| Bryan Adams - Can't ..> | 2026-05-22 19:55 | 45K | |
| Bryan Adams -(Everyt..> | 2026-05-22 19:38 | 45K | |
| Bryan Adams - (Every..> | 2026-05-22 19:55 | 72K | |
| Bryan Adams, Rod Ste..> | 2026-05-22 20:05 | 44K | |
| Bryan Adams & Tina T..> | 2026-05-22 19:38 | 22K | |
| Bryan Adams & Melani..> | 2026-05-22 19:55 | 42K | |
| Bruno Mars - When I ..> | 2026-05-22 20:05 | 34K | |
| Bruno Mars - Treasur..> | 2026-05-22 20:05 | 41K | |
| Bruno Mars - The Laz..> | 2026-05-22 20:05 | 21K | |
| Bruno Mars - Marry Y..> | 2026-05-22 20:05 | 21K | |
| Bruno Mars - Locked ..> | 2026-05-22 20:05 | 34K | |
| Bruno Mars - Just Th..> | 2026-05-22 20:32 | 21K | |
| Bruno Mars - Grenade..> | 2026-05-22 20:05 | 22K | |
| Bruno Mars - Finesse..> | 2026-05-22 20:05 | 31K | |
| Bruno Mars - 24K Mag..> | 2026-05-22 20:05 | 31K | |
| Bruce Willis - Under..> | 2026-05-22 20:32 | 37K | |
| Bruce Willis - Respe..> | 2026-05-22 19:38 | 37K | |
| Bruce Springsteen - ..> | 2026-05-22 19:38 | 37K | |
| Bruce Springsteen - ..> | 2026-05-22 19:38 | 63K | |
| Bruce Springsteen - ..> | 2026-05-22 19:55 | 22K | |
| Bruce Springsteen - ..> | 2026-05-22 20:05 | 40K | |
| Bruce Springsteen - ..> | 2026-05-22 19:38 | 60K | |
| Bruce Springsteen - ..> | 2026-05-22 19:38 | 32K | |
| Bruce Springsteen - ..> | 2026-05-22 19:55 | 44K | |
| Bruce Springsteen - ..> | 2026-05-22 19:38 | 32K | |
| Bruce Springsteen - ..> | 2026-05-22 19:38 | 32K | |
| Bruce Springsteen - ..> | 2026-05-22 19:38 | 2.3M | |
| Bruce Springsteen - ..> | 2026-05-22 19:30 | 52K | |
| Bruce Springsteen - ..> | 2026-05-22 19:38 | 32K | |
| Bruce Springsteen & ..> | 2026-05-22 19:38 | 48K | |
| Bruce Springsteen & ..> | 2026-05-22 19:38 | 48K | |
| Bruce Hornsby & The ..> | 2026-05-22 19:38 | 84K | |
| Bruce Channel - Hey ..> | 2026-05-22 20:32 | 255K | |
| Bruce & Bongo - Geil..> | 2026-05-22 19:38 | 69K | |
| Browns - Scarlet Rib..> | 2026-05-22 20:32 | 38K | |
| Brothers Johnson - S..> | 2026-05-22 19:30 | 355K | |
| Brothers Johnson - S..> | 2026-05-22 19:38 | 515K | |
| Brothers Four - Gree..> | 2026-05-22 19:55 | 47K | |
| Brothers Four - Come..> | 2026-05-22 20:32 | 112K | |
| Brotherhood of Man -..> | 2026-05-22 20:32 | 87K | |
| Brotherhood Of Man -..> | 2026-05-22 19:55 | 79K | |
| Brotherhood Of Man -..> | 2026-05-22 19:30 | 309K | |
| Brotherhood Of Man -..> | 2026-05-22 19:30 | 47K | |
| Brother Beyond - The..> | 2026-05-22 19:38 | 28K | |
| Bros - When Will I B..> | 2026-05-22 19:38 | 84K | |
| Brooks & Dunn - You'..> | 2026-05-22 20:18 | 315K | |
| Brooks & Dunn - Why ..> | 2026-05-22 20:18 | 261K | |
| Brooks & Dunn - Whis..> | 2026-05-22 20:18 | 358K | |
| Brooks & Dunn - We'l..> | 2026-05-22 20:18 | 99K | |
| Brooks & Dunn - That..> | 2026-05-22 20:18 | 315K | |
| Brooks & Dunn - She ..> | 2026-05-22 20:18 | 99K | |
| Brooks & Dunn - She'..> | 2026-05-22 20:18 | 296K | |
| Brooks & Dunn - Rock..> | 2026-05-22 20:18 | 315K | |
| Brooks & Dunn - Neon..> | 2026-05-22 20:18 | 99K | |
| Brooks & Dunn - My N..> | 2026-05-22 20:18 | 315K | |
| Brooks & Dunn - My M..> | 2026-05-22 20:18 | 315K | |
| Brooks & Dunn - Miss..> | 2026-05-22 20:18 | 420K | |
| Brooks & Dunn - Lost..> | 2026-05-22 20:18 | 315K | |
| Brooks & Dunn - Litt..> | 2026-05-22 20:18 | 315K | |
| Brooks & Dunn - I Ca..> | 2026-05-22 20:18 | 453K | |
| Brooks & Dunn - Husb..> | 2026-05-22 20:18 | 453K | |
| Brooks & Dunn - How ..> | 2026-05-22 20:18 | 99K | |
| Brooks & Dunn - Honk..> | 2026-05-22 20:18 | 315K | |
| Brooks & Dunn - He's..> | 2026-05-22 20:18 | 99K | |
| Brooks & Dunn - Hard..> | 2026-05-22 20:18 | 315K | |
| Brooks & Dunn - Bran..> | 2026-05-22 20:17 | 326K | |
| Brooks & Dunn - Boot..> | 2026-05-22 20:17 | 296K | |
| Brooks & Dunn - Beer..> | 2026-05-22 20:17 | 420K | |
| Brooks & Dunn - A Ma..> | 2026-05-22 20:17 | 261K | |
| Brooklyn Express - (..> | 2026-05-22 19:38 | 271K | |
| Brooklyn Bounce - Bo..> | 2026-05-22 20:04 | 194K | |
| Brook Benton - Rainy..> | 2026-05-22 20:17 | 42K | |
| Brook Benton - Endle..> | 2026-05-22 20:04 | 51K | |
| Brook Benton & Dinah..> | 2026-05-22 19:55 | 38K | |
| Bronski Beat - Why.jpg | 2026-05-22 19:38 | 45K | |
| Bronski Beat - Small..> | 2026-05-22 19:38 | 45K | |
| Bronski Beat - It Ai..> | 2026-05-22 19:38 | 33K | |
| Bronski Beat - Hit T..> | 2026-05-22 19:38 | 31K | |
| Bronski Beat & Marc ..> | 2026-05-22 19:38 | 36K | |
| Broads - Sing Sing S..> | 2026-05-22 19:38 | 64K | |
| Broads & Big Band - ..> | 2026-05-22 19:38 | 42K | |
| Britney Spears - You..> | 2026-05-22 20:04 | 305K | |
| Britney Spears - Tox..> | 2026-05-22 20:04 | 40K | |
| Britney Spears - Str..> | 2026-05-22 20:04 | 66K | |
| Britney Spears - Som..> | 2026-05-22 19:55 | 34K | |
| Britney Spears - Oop..> | 2026-05-22 20:04 | 80K | |
| Britney Spears - Luc..> | 2026-05-22 20:04 | 66K | |
| Britney Spears - Bor..> | 2026-05-22 20:04 | 309K | |
| Britney Spears - Bab..> | 2026-05-22 19:55 | 105K | |
| Bringing Back The Ol..> | 2026-05-22 19:29 | 3.1K | |
| Brilliant - It's A M..> | 2026-05-22 19:38 | 71K | |
| Brigitte BardotSerge..> | 2026-05-22 20:32 | 72K | |
| Brigitte Bardot - Ay..> | 2026-05-22 20:32 | 221K | |
| Brighouse & Rastrick..> | 2026-05-22 19:30 | 279K | |
| Bridget Mendler - Re..> | 2026-05-22 20:04 | 71K | |
| Brian May - Too Much..> | 2026-05-22 20:32 | 40K | |
| Brian Hyland - Seale..> | 2026-05-22 19:55 | 52K | |
| Brian Hyland - Seale..> | 2026-05-22 20:32 | 121K | |
| Brian Hyland - Itsy ..> | 2026-05-22 20:32 | 15K | |
| Brian Hyland - Ginny..> | 2026-05-22 19:55 | 29K | |
| Brian - Give and Tak..> | 2026-05-22 20:32 | 78K | |
| Brennan Heart and A-..> | 2026-05-22 20:04 | 73K | |
| Brendan Bowyer & The..> | 2026-05-22 20:32 | 370K | |
| Brenda Lee - Ich wil..> | 2026-05-22 20:32 | 63K | |
| Brenda Lee - I()m So..> | 2026-05-22 20:17 | 105K | |
| Brenda Lee - I'm Sor..> | 2026-05-22 20:17 | 109K | |
| Brenda Lee - Emotion..> | 2026-05-22 20:17 | 156K | |
| Brenda Lee - All Alo..> | 2026-05-22 20:17 | 36K | |
| Breakfast Club - Rig..> | 2026-05-22 19:37 | 128K | |
| Bread - The Guitar M..> | 2026-05-22 19:30 | 322K | |
| Bread - Make It With..> | 2026-05-22 19:55 | 76K | |
| Bread - Lost Without..> | 2026-05-22 19:30 | 49K | |
| Bread - If.jpg | 2026-05-22 19:30 | 369K | |
| Bread - Guitar Man.jpg | 2026-05-22 20:32 | 49K | |
| Bread - Everything I..> | 2026-05-22 19:30 | 473K | |
| Bread - Baby I'm A W..> | 2026-05-22 20:04 | 49K | |
| Brandy - What About ..> | 2026-05-22 20:04 | 216K | |
| Brandy - Another Day..> | 2026-05-22 20:04 | 69K | |
| Brandy & Ray J -Anot..> | 2026-05-22 20:04 | 69K | |
| Brandy & Monica - Th..> | 2026-05-22 19:55 | 31K | |
| Bram Tchaikovsky - S..> | 2026-05-22 19:30 | 329K | |
| Brainbox - Summertim..> | 2026-05-22 20:32 | 209K | |
| Brainbox - Sea Of De..> | 2026-05-22 20:32 | 309K | |
| Brainbox - Down Man.jpg | 2026-05-22 20:32 | 231K | |
| Brainbox - Dark Rose..> | 2026-05-22 20:32 | 209K | |
| Braids - Bohemian Rh..> | 2026-05-22 19:55 | 22K | |
| Brady Seals - Anothe..> | 2026-05-22 20:17 | 121K | |
| Brad Paisley - Who N..> | 2026-05-22 20:17 | 260K | |
| Brad Paisley - She..> | 2026-05-22 20:17 | 38K | |
| Brad Paisley - He Di..> | 2026-05-22 20:17 | 79K | |
| Boz Scaggs - What Ca..> | 2026-05-22 19:30 | 223K | |
| Boz Scaggs - Lowdown..> | 2026-05-22 19:37 | 46K | |
| Boz Scaggs - Lido Sh..> | 2026-05-22 19:30 | 174K | |
| Boyzone - Picture Of..> | 2026-05-22 20:04 | 41K | |
| Boyzone - No Matter ..> | 2026-05-22 19:55 | 42K | |
| Boyzone - Love Me Fo..> | 2026-05-22 19:55 | 34K | |
| Boyzone - Father And..> | 2026-05-22 19:55 | 34K | |
| Boyz Ii Men - End Of..> | 2026-05-22 19:55 | 44K | |
| Boyz Ii Men & Tony S..> | 2026-05-22 19:55 | 7.1K | |
| Boystown Gang - Just..> | 2026-05-22 19:37 | 44K | |
| Boys Town Gang - Sig..> | 2026-05-22 19:37 | 39K | |
| Boys Town Gang - Com..> | 2026-05-22 19:37 | 43K | |
| Boys Town Gang -Can'..> | 2026-05-22 19:37 | 43K | |
| Boys Town Gang - Ain..> | 2026-05-22 19:37 | 60K | |
| Boy Meets Girl - Wai..> | 2026-05-22 20:04 | 38K | |
| Boy Krazy - That's W..> | 2026-05-22 19:55 | 29K | |
| Boy Howdy - They Don..> | 2026-05-22 20:17 | 248K | |
| Boy Howdy - She'd Gi..> | 2026-05-22 20:17 | 248K | |
| Boy George - Everyth..> | 2026-05-22 19:37 | 59K | |
| Boxcar Willie - My H..> | 2026-05-22 20:17 | 34K | |
| Boxcar Willie - Hey ..> | 2026-05-22 20:17 | 38K | |
| Box Tops - The Lette..> | 2026-05-22 20:32 | 59K | |
| Box Tops - The Lette..> | 2026-05-22 19:55 | 59K | |
| Bow Wow Wow - The Ma..> | 2026-05-22 19:37 | 187K | |
| Bow Wow Wow - Do You..> | 2026-05-22 19:37 | 253K | |
| Boston - More Than A..> | 2026-05-22 19:30 | 294K | |
| Boston - Don't Look ..> | 2026-05-22 19:30 | 73K | |
| Boston - Amanda.jpg | 2026-05-22 20:17 | 243K | |
| Boris Gardiner - I W..> | 2026-05-22 19:37 | 52K | |
| Boots - In The Begin..> | 2026-05-22 20:32 | 355K | |
| Boone, Pat - Bernadi..> | 2026-05-22 20:32 | 151K | |
| Boomtown Rats - I Do..> | 2026-05-22 19:30 | 305K | |
| Booker T & The Mg's ..> | 2026-05-22 20:32 | 41K | |
| Booker T & The Mg's ..> | 2026-05-22 20:32 | 45K | |
| Booker T & The Mg's ..> | 2026-05-22 19:30 | 188K | |
| Boogie Box High - Ji..> | 2026-05-22 19:37 | 97K | |
| Bonnie Tyler - Total..> | 2026-05-22 19:37 | 15K | |
| Bonnie Tyler - Makin..> | 2026-05-22 19:55 | 89K | |
| Bonnie Tyler - Lost ..> | 2026-05-22 19:30 | 225K | |
| Bonnie Tyler - It's ..> | 2026-05-22 20:32 | 36K | |
| Bonnie Tyler - It’..> | 2026-05-22 20:17 | 36K | |
| Bonnie Tyler - Holdi..> | 2026-05-22 19:37 | 77K | |
| Bonnie Tyler & Shaki..> | 2026-05-22 19:37 | 34K | |
| Bonnie St Claire & U..> | 2026-05-22 19:30 | 295K | |
| Bonnie St. Clarie - ..> | 2026-05-22 20:32 | 128K | |
| Bonnie St. Claire - ..> | 2026-05-22 20:32 | 174K | |
| Bonnie St. Claire - ..> | 2026-05-22 19:30 | 348K | |
| Bonnie St. Claire & ..> | 2026-05-22 19:30 | 22K | |
| Bonnie St. Claire & ..> | 2026-05-22 19:55 | 164K | |
| Bonnie Raitt - Nick ..> | 2026-05-22 19:37 | 51K | |
| Bonnie Raitt - I Can..> | 2026-05-22 19:55 | 28K | |
| Bonnie Raitt - Have ..> | 2026-05-22 20:32 | 241K | |
| Bonnie Raitt - Have ..> | 2026-05-22 19:55 | 51K | |
| Bonnie Pointer - I C..> | 2026-05-22 19:37 | 25K | |
| Boney M Vs Horny Uni..> | 2026-05-22 20:04 | 64K | |
| Boney M. - Sunny.jpg | 2026-05-22 19:30 | 25K | |
| Boney M. - Rivers ..> | 2026-05-22 19:30 | 162K | |
| Boney M. - Ma Baker.jpg | 2026-05-22 19:30 | 6.8M | |
| Boney M. - Happy Son..> | 2026-05-22 19:37 | 216K | |
| Boney M. - Gotta Go ..> | 2026-05-22 19:30 | 224K | |
| Boney M - Rivers Of ..> | 2026-05-22 19:55 | 40K | |
| Boney M - Rasputin.jpg | 2026-05-22 19:30 | 34K | |
| Boney M - Painter Ma..> | 2026-05-22 19:30 | 266K | |
| Boney M - Megamix.jpg | 2026-05-22 19:55 | 68K | |
| Boney M - Mary's Boy..> | 2026-05-22 19:30 | 143K | |
| Boney M - Kalimba De..> | 2026-05-22 19:37 | 321K | |
| Boney M - I See A Bo..> | 2026-05-22 19:37 | 445K | |
| Boney M - Hooray Hoo..> | 2026-05-22 19:30 | 180K | |
| Boney M - El Lute (S..> | 2026-05-22 19:30 | 321K | |
| Boney M - Dreadlock ..> | 2026-05-22 19:37 | 31K | |
| Boney M - Daddy Cool..> | 2026-05-22 19:30 | 36K | |
| Boney M - Brown Girl..> | 2026-05-22 19:30 | 266K | |
| Boney M - Belfast.jpg | 2026-05-22 19:30 | 36K | |
| Bon Jovi - You Give ..> | 2026-05-22 19:37 | 91K | |
| Bon Jovi - Wanted De..> | 2026-05-22 19:37 | 1.1M | |
| Bon Jovi - This Ain'..> | 2026-05-22 19:55 | 48K | |
| Bon Jovi - Livin' On..> | 2026-05-22 19:37 | 91K | |
| Bon Jovi - Keep The ..> | 2026-05-22 19:55 | 52K | |
| Bon Jovi - It's My L..> | 2026-05-22 20:04 | 42K | |
| Bon Jovi - In These ..> | 2026-05-22 19:55 | 52K | |
| Bon Jovi - I'll Be T..> | 2026-05-22 19:37 | 280K | |
| Bon Jovi - Bed Of Ro..> | 2026-05-22 19:55 | 52K | |
| Bon Jovi - Bad Medic..> | 2026-05-22 19:37 | 31K | |
| Bon Jovi - Always.jpg | 2026-05-22 19:55 | 19K | |
| Bomfunk Mc's - Frees..> | 2026-05-22 20:04 | 38K | |
| Bombi -Oh Mandy.jpg | 2026-05-22 20:04 | 22K | |
| Bomb The Bass - Say..> | 2026-05-22 19:37 | 23K | |
| Bolland - You're In ..> | 2026-05-22 19:37 | 39K | |
| Bojoura - The letter..> | 2026-05-22 19:30 | 228K | |
| Bojoura - Frank Mill..> | 2026-05-22 19:55 | 87K | |
| Boemerang - Tiroler ..> | 2026-05-22 19:30 | 342K | |
| Body Lotion - Always..> | 2026-05-22 19:55 | 23K | |
| Bobbysocks - La Det ..> | 2026-05-22 19:37 | 44K | |
| Bobbysocks! - Let It..> | 2026-05-22 19:37 | 44K | |
| Bobby Vinton - Seale..> | 2026-05-22 20:32 | 31K | |
| Bobby Vinton - Roses..> | 2026-05-22 20:32 | 177K | |
| Bobby Vinton - Mr. L..> | 2026-05-22 19:30 | 229K | |
| Bobby Vinton - Hurt.jpg | 2026-05-22 19:30 | 241K | |
| Bobby Vinton - Blue ..> | 2026-05-22 20:32 | 42K | |
| Bobby Vee - The Nigh..> | 2026-05-22 20:32 | 91K | |
| Bobby Vee - Take Goo..> | 2026-05-22 20:32 | 47K | |
| Bobby Vee - Rubber B..> | 2026-05-22 20:32 | 39K | |
| Bobby Solo - Una La ..> | 2026-05-22 19:37 | 402K | |
| Bobby Mcferrin - Don..> | 2026-05-22 19:37 | 44K | |
| Bobby Helms - Jaquel..> | 2026-05-22 20:17 | 670K | |
| Bobby Hebb - Sunny.jpg | 2026-05-22 20:32 | 74K | |
| Bobby Goldsboro - Su..> | 2026-05-22 19:30 | 130K | |
| Bobby Goldsboro - Ho..> | 2026-05-22 20:32 | 13K | |
| Bobby Goldsboro - He..> | 2026-05-22 19:30 | 196K | |
| Bobby Darin - The Mo..> | 2026-05-22 20:32 | 38K | |
| Bobby Darin - Mack t..> | 2026-05-22 20:17 | 71K | |
| Bobby Darin - La Mer..> | 2026-05-22 20:32 | 307K | |
| Bobby Darin - If I w..> | 2026-05-22 20:32 | 75K | |
| Bobby Darin - Fly Me..> | 2026-05-22 20:32 | 290K | |
| Bobby Darin - Dream ..> | 2026-05-22 20:32 | 40K | |
| Bobby Brown - Two Ca..> | 2026-05-22 19:55 | 53K | |
| Bobby Brown - My pre..> | 2026-05-22 19:55 | 85K | |
| Bobby Brown - My Pre..> | 2026-05-22 19:37 | 85K | |
| Bobby Brown - Humpin..> | 2026-05-22 19:55 | 110K | |
| Bobby Brown - Every ..> | 2026-05-22 20:04 | 74K | |
| Bobby Brown - Don't ..> | 2026-05-22 19:37 | 85K | |
| Bobby Bond - King of..> | 2026-05-22 20:17 | 179K | |
| Bobby Bond - He'll H..> | 2026-05-22 20:17 | 109K | |
| Bobby Bond - Distant..> | 2026-05-22 20:17 | 145K | |
| Bobby Bond - Dang Me..> | 2026-05-22 20:17 | 247K | |
| Bobby Bond - Billy B..> | 2026-05-22 20:17 | 145K | |
| Bobby Bloom - Monteg..> | 2026-05-22 19:30 | 321K | |
| Bobby Bland - Member..> | 2026-05-22 19:37 | 53K | |
| Bobby Bare - Vampira..> | 2026-05-22 20:17 | 434K | |
| Bobby Bare - The Liv..> | 2026-05-22 20:17 | 102K | |
| Bobby Bare - That´s..> | 2026-05-22 20:17 | 126K | |
| Bobby Bare - Sweet S..> | 2026-05-22 20:17 | 126K | |
| Bobby Bare - More Th..> | 2026-05-22 20:17 | 126K | |
| Bobby Bare - Lynchin..> | 2026-05-22 20:17 | 51K | |
| Bobby Bare - I´m Ha..> | 2026-05-22 20:17 | 126K | |
| Bobby Bare - Four St..> | 2026-05-22 20:17 | 105K | |
| Bobby Bare - Down on..> | 2026-05-22 20:17 | 481K | |
| Bobby Bare - Detroit..> | 2026-05-22 20:17 | 167K | |
| Bobby Bare - All Ame..> | 2026-05-22 20:17 | 508K | |
| Bobbie Gentry - Son ..> | 2026-05-22 20:32 | 35K | |
| Bobbie Gentry - Son ..> | 2026-05-22 20:17 | 184K | |
| Bobbie Gentry - Ode ..> | 2026-05-22 20:17 | 88K | |
| Bobbie Gentry - Ode ..> | 2026-05-22 20:17 | 88K | |
| Bobbie Gentry & Glen..> | 2026-05-22 20:17 | 32K | |
| Bob Taylor Feat. Inn..> | 2026-05-22 20:04 | 62K | |
| Bob Sinclar ft. Stev..> | 2026-05-22 20:04 | 182K | |
| Bob Sinclar Ft. Pitb..> | 2026-05-22 20:04 | 88K | |
| Bob Sinclar Ft. Gary..> | 2026-05-22 20:04 | 7.9K | |
| Bob Sinclar Feat. St..> | 2026-05-22 20:04 | 17K | |
| Bob Sinclar -Rock Th..> | 2026-05-22 20:04 | 75K | |
| Bob Sinclar - Love G..> | 2026-05-22 20:04 | 57K | |
| Bob Sinclar, Hendogg..> | 2026-05-22 20:04 | 59K | |
| Bob Sinclar (Feat. T..> | 2026-05-22 20:04 | 15K | |
| Bob Sinclar & Raffae..> | 2026-05-22 20:04 | 125K | |
| Bob Sinclar & Pitbul..> | 2026-05-22 20:04 | 88K | |
| Bob Seger & The Silv..> | 2026-05-22 19:55 | 38K | |
| Bob Seger & The Silv..> | 2026-05-22 19:30 | 105K | |
| Bob Seger & The Silv..> | 2026-05-22 20:17 | 138K | |
| Bob Moore - Mexico.jpg | 2026-05-22 19:55 | 46K | |
| Bob Marley vs Funkst..> | 2026-05-22 19:55 | 222K | |
| Bob Marley - One Lov..> | 2026-05-22 19:37 | 42K | |
| Bob Marley & Wailers..> | 2026-05-22 19:30 | 145K | |
| Bob Marley & Wailers..> | 2026-05-22 19:30 | 132K | |
| Bob Marley & The Wai..> | 2026-05-22 19:30 | 66K | |
| Bob Marley & The Wai..> | 2026-05-22 19:30 | 39K | |
| Bob Marley & The Wai..> | 2026-05-22 19:55 | 50K | |
| Bob Marley & The Wai..> | 2026-05-22 19:55 | 62K | |
| Bob Marley & The Wai..> | 2026-05-22 20:32 | 258K | |
| Bob Marley & The Wai..> | 2026-05-22 19:30 | 42K | |
| Bob Marley & The Wai..> | 2026-05-22 19:55 | 62K | |
| Bob Marley & The Wai..> | 2026-05-22 19:30 | 303K | |
| Bob Marley & The Wai..> | 2026-05-22 19:37 | 25K | |
| Bob Marley & The Wai..> | 2026-05-22 19:37 | 25K | |
| Bob Marley & The Wai..> | 2026-05-22 19:55 | 37K | |
| Bob Marley & The Wai..> | 2026-05-22 20:04 | 68K | |
| Bob Luman - You()ve ..> | 2026-05-22 20:17 | 18K | |
| Bob Luman - Why, Why..> | 2026-05-22 20:17 | 146K | |
| Bob Luman - Throwin(..> | 2026-05-22 20:17 | 46K | |
| Bob Luman - Oh Lones..> | 2026-05-22 20:17 | 305K | |
| Bob Luman - My Baby ..> | 2026-05-22 20:17 | 233K | |
| Bob Luman - Let's Th..> | 2026-05-22 20:17 | 237K | |
| Bob Luman - Jealous ..> | 2026-05-22 20:17 | 165K | |
| Bob Luman - I Love Y..> | 2026-05-22 20:17 | 127K | |
| Bob Luman - Everytim..> | 2026-05-22 20:17 | 358K | |
| Bob Luman - Buttercu..> | 2026-05-22 20:17 | 209K | |
| Bob Luman - Bad Bad ..> | 2026-05-22 20:17 | 168K | |
| Bob Luhman - Oh Lone..> | 2026-05-22 20:32 | 192K | |
| Bob Dylan - Wigwam.jpg | 2026-05-22 19:30 | 275K | |
| Bob Dylan - The Time..> | 2026-05-22 20:32 | 255K | |
| Bob Dylan - Rainy Da..> | 2026-05-22 20:32 | 41K | |
| Bob Dylan - Like a R..> | 2026-05-22 20:32 | 193K | |
| Bob Dylan - Lay Lady..> | 2026-05-22 20:17 | 33K | |
| Bob Dylan - Knockin'..> | 2026-05-22 19:30 | 182K | |
| Bob Dylan - Just Lik..> | 2026-05-22 20:32 | 314K | |
| Bob Dylan - I Want Y..> | 2026-05-22 20:32 | 41K | |
| Bob Dylan - I Threw ..> | 2026-05-22 20:32 | 186K | |
| Bob Dylan - I'll Be ..> | 2026-05-22 20:32 | 35K | |
| Bob Dylan - Hurrican..> | 2026-05-22 19:55 | 41K | |
| Bob Dylan - Blowin' ..> | 2026-05-22 20:32 | 259K | |
| Bob Carlisle - Butte..> | 2026-05-22 20:17 | 163K | |
| Bob & Marcia - Pied ..> | 2026-05-22 19:30 | 9.9K | |
| Bob & Earl - Harlem ..> | 2026-05-22 20:32 | 94K | |
| Bo Diddley - Bo Didd..> | 2026-05-22 20:32 | 54K | |
| Blues Dimension - Ge..> | 2026-05-22 20:32 | 522K | |
| Blues Brothers - The..> | 2026-05-22 20:17 | 37K | |
| Blues Brothers - Gim..> | 2026-05-22 19:37 | 41K | |
| Blues Brothers - Eve..> | 2026-05-22 19:37 | 76K | |
| Blue Swede - Hooked ..> | 2026-05-22 19:30 | 148K | |
| Blue Rodeo - Hasn't ..> | 2026-05-22 20:17 | 436K | |
| Blue Ridge Rangers -..> | 2026-05-22 19:30 | 189K | |
| Blue Nile - Tinselto..> | 2026-05-22 20:32 | 30K | |
| Blue Nile - Tinselto..> | 2026-05-22 19:37 | 72K | |
| Blue Mink - The Bann..> | 2026-05-22 19:30 | 74K | |
| Blue Mink - Melting ..> | 2026-05-22 19:30 | 194K | |
| Blue Haze - Unchaine..> | 2026-05-22 19:30 | 89K | |
| Blue Haze - Smoke Ge..> | 2026-05-22 20:32 | 28K | |
| Blue Ft. Elton John ..> | 2026-05-22 20:04 | 39K | |
| Blue Feat. Stevie Wo..> | 2026-05-22 20:04 | 59K | |
| Blue Diamonds - You ..> | 2026-05-22 19:30 | 78K | |
| Blue Diamonds - That..> | 2026-05-22 20:32 | 85K | |
| Blue Diamonds - Ramo..> | 2026-05-22 20:32 | 211K | |
| Blue Diamonds - Litt..> | 2026-05-22 19:55 | 78K | |
| Blue Diamonds - Lady..> | 2026-05-22 19:55 | 6.4K | |
| Blue Diamonds - In A..> | 2026-05-22 19:30 | 37K | |
| Blue Diamonds - Cath..> | 2026-05-22 20:32 | 342K | |
| Blue Boy - Remember ..> | 2026-05-22 19:55 | 172K | |
| Blue Öyster Cult - ..> | 2026-05-22 19:30 | 235K | |
| Blow Monkeys - Diggi..> | 2026-05-22 19:37 | 59K | |
| Blood, Sweat & Tears..> | 2026-05-22 20:32 | 34K | |
| Blood, Sweat & Tears..> | 2026-05-22 20:32 | 24K | |
| Blondie - rapture.jpg | 2026-05-22 19:37 | 45K | |
| Blondie - maria.jpg | 2026-05-22 19:55 | 64K | |
| Blondie -The Tide Is..> | 2026-05-22 19:37 | 30K | |
| Blondie - One Way Or..> | 2026-05-22 19:30 | 65K | |
| Blondie -Maria.jpg | 2026-05-22 19:37 | 41K | |
| Blondie - I'm Gonna ..> | 2026-05-22 19:30 | 235K | |
| Blondie - Heart Of G..> | 2026-05-22 19:30 | 65K | |
| Blondie - Hanging On..> | 2026-05-22 19:30 | 352K | |
| Blondie - Denis.jpg | 2026-05-22 19:30 | 176K | |
| Blondie - Call Me.jpg | 2026-05-22 19:37 | 23K | |
| Blondie - Atomic.jpg | 2026-05-22 19:37 | 45K | |
| Blink 182 - All The ..> | 2026-05-22 20:04 | 38K | |
| Blind Melon - No Rai..> | 2026-05-22 19:55 | 72K | |
| Blank & Jones - Afte..> | 2026-05-22 20:04 | 274K | |
| Blackstreet Feat. Dr..> | 2026-05-22 19:55 | 41K | |
| Black Slate - Amigo.jpg | 2026-05-22 20:04 | 48K | |
| Black Sabbath - Para..> | 2026-05-22 19:30 | 228K | |
| Black Lace - Agadoo.jpg | 2026-05-22 19:37 | 91K | |
| BlackHawk - There Yo..> | 2026-05-22 20:17 | 186K | |
| BlackHawk - I'm Not ..> | 2026-05-22 20:17 | 40K | |
| BlackHawk - Hole In ..> | 2026-05-22 20:17 | 177K | |
| BlackHawk - Goodbye ..> | 2026-05-22 20:17 | 40K | |
| BlackHawk - Every On..> | 2026-05-22 20:17 | 40K | |
| Black Eyed Peas - Wh..> | 2026-05-22 20:04 | 32K | |
| Black Eyed Peas - Th..> | 2026-05-22 20:04 | 112K | |
| Black Eyed Peas -The..> | 2026-05-22 20:04 | 32K | |
| Black Eyed Peas - Me..> | 2026-05-22 20:04 | 75K | |
| Black Eyed Peas -Jus..> | 2026-05-22 20:04 | 26K | |
| Black Eyed Peas - I ..> | 2026-05-22 20:04 | 54K | |
| Black Eyed Peas, the..> | 2026-05-22 20:04 | 30K | |
| Black Crowes - Remed..> | 2026-05-22 19:55 | 93K | |
| Black Box - Strike I..> | 2026-05-22 19:55 | 41K | |
| Black Box - Ride On ..> | 2026-05-22 19:37 | 41K | |
| Black Box - Fantasy ..> | 2026-05-22 19:55 | 239K | |
| Black Box - Bright O..> | 2026-05-22 19:55 | 65K | |
| Black - Wonderful Li..> | 2026-05-22 19:37 | 46K | |
| Bj Thomas - Another ..> | 2026-05-22 19:30 | 90K | |
| Björk - It's Oh So ..> | 2026-05-22 19:55 | 276K | |
| Björk & David Arnol..> | 2026-05-22 19:55 | 40K | |
| Bitty Mclean - It Ke..> | 2026-05-22 19:55 | 54K | |
| Birgit - I Know.jpg | 2026-05-22 20:04 | 69K | |
| Birdy - Skinny Love.jpg | 2026-05-22 20:32 | 82K | |
| Bintangs - Riding On..> | 2026-05-22 20:32 | 381K | |
| Bino - Mama Leone.jpg | 2026-05-22 19:30 | 333K | |
| Bingo Players - Devo..> | 2026-05-22 20:04 | 192K | |
| Bingo! - Arabeat.jpg | 2026-05-22 19:55 | 57K | |
| Bing Crosby - White ..> | 2026-05-22 20:31 | 49K | |
| Bing Crosby - We've ..> | 2026-05-22 20:31 | 71K | |
| Bing Crosby - Swingi..> | 2026-05-22 19:55 | 39K | |
| Bing Crosby, Gary Cr..> | 2026-05-22 20:31 | 15K | |
| Bing Crosby & Peggy ..> | 2026-05-22 20:31 | 240K | |
| Bing Crosby & Grace ..> | 2026-05-22 20:31 | 60K | |
| Binary Finary - 1998..> | 2026-05-22 20:04 | 85K | |
| Bimbo Jet - El Bimbo..> | 2026-05-22 19:30 | 260K | |
| Billy Yates - Flower..> | 2026-05-22 20:17 | 272K | |
| Billy Vera & The Bea..> | 2026-05-22 19:55 | 19K | |
| Billy Vera & Judy Cl..> | 2026-05-22 20:31 | 35K | |
| Billy Vaughn Orchest..> | 2026-05-22 19:37 | 137K | |
| Billy Vaughn - Wheel..> | 2026-05-22 20:31 | 256K | |
| Billy Vaughn - Sail ..> | 2026-05-22 20:31 | 237K | |
| Billy The KitBarry H..> | 2026-05-22 20:04 | 458K | |
| Billy Swan - I Can H..> | 2026-05-22 19:30 | 127K | |
| Billy Stewart - Summ..> | 2026-05-22 20:31 | 186K | |
| Billy Ray Cyrus - Th..> | 2026-05-22 20:17 | 34K | |
| Billy Ray Cyrus - Th..> | 2026-05-22 19:55 | 34K | |
| Billy Ray Cyrus - So..> | 2026-05-22 20:17 | 232K | |
| Billy Ray Cyrus - Sh..> | 2026-05-22 20:17 | 348K | |
| Billy Ray Cyrus - In..> | 2026-05-22 20:17 | 28K | |
| Billy Ray Cyrus - Co..> | 2026-05-22 20:17 | 45K | |
| Billy Ray Cyrus - Bu..> | 2026-05-22 20:17 | 73K | |
| Billy Ray Cyrus - Ac..> | 2026-05-22 20:17 | 276K | |
| Billy Preston - That..> | 2026-05-22 20:31 | 126K | |
| Billy Preston & Syre..> | 2026-05-22 19:37 | 32K | |
| Billy Preston & Syre..> | 2026-05-22 19:37 | 32K | |
| Billy Paul - Your So..> | 2026-05-22 19:30 | 95K | |
| Billy Paul - Thanks ..> | 2026-05-22 19:30 | 95K | |
| Billy Paul - Me And ..> | 2026-05-22 20:31 | 28K | |
| Billy Ocean - When T..> | 2026-05-22 19:37 | 78K | |
| Billy Ocean - There'..> | 2026-05-22 19:37 | 30K | |
| Billy Ocean - Sudden..> | 2026-05-22 19:37 | 52K | |
| Billy Ocean - Red Li..> | 2026-05-22 19:30 | 157K | |
| Billy Ocean - Red Li..> | 2026-05-22 19:55 | 74K | |
| Billy Ocean - Loverb..> | 2026-05-22 19:55 | 30K | |
| Billy Ocean - Loverb..> | 2026-05-22 19:37 | 78K | |
| Billy Ocean - Love R..> | 2026-05-22 19:30 | 157K | |
| Billy Ocean - Get Ou..> | 2026-05-22 19:37 | 66K | |
| Billy Ocean - Europe..> | 2026-05-22 19:37 | 75K | |
| Billy Ocean - Are Yo..> | 2026-05-22 20:04 | 30K | |
| Billy Joel - You're ..> | 2026-05-22 19:37 | 20K | |
| Billy Joel -Uptown G..> | 2026-05-22 19:37 | 53K | |
| Billy Joel - The Lon..> | 2026-05-22 19:37 | 53K | |
| Billy Joel - She's a..> | 2026-05-22 20:31 | 30K | |
| Billy Joel - Scenes ..> | 2026-05-22 19:30 | 199K | |
| Billy Joel - Piano M..> | 2026-05-22 19:30 | 129K | |
| Billy Joel - New Yor..> | 2026-05-22 19:30 | 279K | |
| Billy Joel - My Life..> | 2026-05-22 19:30 | 231K | |
| Billy Joel - James.jpg | 2026-05-22 19:37 | 55K | |
| Billy Joel - Honesty..> | 2026-05-22 20:31 | 77K | |
| Billy Joel - Goodnig..> | 2026-05-22 19:37 | 29K | |
| Billy Joe Royal - I ..> | 2026-05-22 20:17 | 167K | |
| Billy Joe Royal - Hu..> | 2026-05-22 20:31 | 79K | |
| Billy Joe Royal - Do..> | 2026-05-22 20:31 | 19K | |
| Billy Jo Spears - He..> | 2026-05-22 20:31 | 67K | |
| Billy Jo Spears - Cr..> | 2026-05-22 20:31 | 67K | |
| Billy Joël - We Did..> | 2026-05-22 19:37 | 36K | |
| Billy Joël - The Ri..> | 2026-05-22 19:55 | 96K | |
| Billy Joël - Tell H..> | 2026-05-22 19:37 | 53K | |
| Billy Joël - Lening..> | 2026-05-22 19:37 | 36K | |
| Billy J. Kramer & Th..> | 2026-05-22 20:31 | 47K | |
| Billy J. Kramer & Th..> | 2026-05-22 20:04 | 41K | |
| Billy Jöel - Just T..> | 2026-05-22 19:30 | 332K | |
| Billy Idol - White W..> | 2026-05-22 19:55 | 39K | |
| Billy Idol - Sweet S..> | 2026-05-22 19:37 | 387K | |
| Billy Idol - Hot In ..> | 2026-05-22 19:37 | 387K | |
| Billy Idol - Eyes Wi..> | 2026-05-22 19:37 | 36K | |
| Billy Fury - In Thou..> | 2026-05-22 19:55 | 42K | |
| Billy Dean - You Don..> | 2026-05-22 20:17 | 42K | |
| Billy Dean - Somewhe..> | 2026-05-22 20:17 | 51K | |
| Billy Dean - Only Th..> | 2026-05-22 20:17 | 45K | |
| Billy Dean - Only He..> | 2026-05-22 20:17 | 45K | |
| Billy Dean - If Ther..> | 2026-05-22 20:17 | 42K | |
| Billy Dean - Billy T..> | 2026-05-22 20:17 | 49K | |
| Billy Crawford -Trac..> | 2026-05-22 19:37 | 50K | |
| Billy Bremner - Loud..> | 2026-05-22 19:37 | 56K | |
| Billy ()Crash() Crad..> | 2026-05-22 20:17 | 120K | |
| Billie Jo Spears - W..> | 2026-05-22 20:17 | 59K | |
| Billie Jo Spears - W..> | 2026-05-22 20:17 | 59K | |
| Billie Jo Spears - W..> | 2026-05-22 20:17 | 42K | |
| Billie Jo Spears - S..> | 2026-05-22 20:17 | 59K | |
| Billie Jo Spears - H..> | 2026-05-22 20:17 | 64K | |
| Billie Jo Spears - C..> | 2026-05-22 20:17 | 64K | |
| Billie Jo Spears - B..> | 2026-05-22 20:17 | 347K | |
| Billie Holiday - Sto..> | 2026-05-22 19:55 | 47K | |
| Billie Holiday - Lad..> | 2026-05-22 20:31 | 40K | |
| Billie Eilish - Bad ..> | 2026-05-22 20:04 | 19K | |
| Bill Wyman - Je Suis..> | 2026-05-22 19:37 | 45K | |
| Bill Withers - Lovel..> | 2026-05-22 19:30 | 159K | |
| Bill Withers - Lovel..> | 2026-05-22 20:31 | 26K | |
| Bill Withers - Love..> | 2026-05-22 19:37 | 387K | |
| Bill Withers - Lean ..> | 2026-05-22 19:30 | 57K | |
| Bill Withers - Ain't..> | 2026-05-22 20:31 | 89K | |
| Bill Withers - Ain't..> | 2026-05-22 19:37 | 89K | |
| Bill Phillips - Don'..> | 2026-05-22 20:17 | 208K | |
| Bill Medley - He Ain..> | 2026-05-22 19:37 | 1.9M | |
| Bill Medley & Jennif..> | 2026-05-22 19:37 | 54K | |
| Bill Justis Ernie F..> | 2026-05-22 20:31 | 40K | |
| Bill Justis - Raunch..> | 2026-05-22 20:17 | 35K | |
| Bill Haley & his Com..> | 2026-05-22 20:31 | 22K | |
| Bill Haley & His Com..> | 2026-05-22 19:55 | 34K | |
| Bill Haley & His Com..> | 2026-05-22 19:37 | 92K | |
| Bill Anderson - The ..> | 2026-05-22 20:17 | 33K | |
| Bill Amesbury - Virg..> | 2026-05-22 19:30 | 35K | |
| Big Wild - 6’s to ..> | 2026-05-22 20:04 | 30K | |
| Big Wheel - If I Sta..> | 2026-05-22 20:31 | 355K | |
| Big Mountain - Baby,..> | 2026-05-22 19:55 | 37K | |
| Big Country - Chance..> | 2026-05-22 20:04 | 47K | |
| Big Brother & The Ho..> | 2026-05-22 20:31 | 194K | |
| Big Bopper - Chantil..> | 2026-05-22 19:30 | 387K | |
| Beyonce -Single Ladi..> | 2026-05-22 20:04 | 18K | |
| Beyonce - If I Were ..> | 2026-05-22 20:04 | 18K | |
| Beyonce - Halo.jpg | 2026-05-22 20:04 | 18K | |
| Beyoncé - Single La..> | 2026-05-22 20:04 | 26K | |
| Beyoncé - Love On T..> | 2026-05-22 20:04 | 35K | |
| Beyoncé - Listen.jpg | 2026-05-22 20:04 | 151K | |
| Beyoncé - JOLENE.jpg | 2026-05-22 20:04 | 123K | |
| Beyoncé - Irreplace..> | 2026-05-22 20:04 | 57K | |
| Beyoncé & Jay - Z -..> | 2026-05-22 20:04 | 53K | |
| Beverley Craven - Pr..> | 2026-05-22 20:31 | 30K | |
| Betty Wright - Tonig..> | 2026-05-22 19:30 | 147K | |
| Betty Everett - The ..> | 2026-05-22 20:31 | 27K | |
| Bette Midler - Wind ..> | 2026-05-22 19:37 | 44K | |
| Bette Midler - To De..> | 2026-05-22 19:55 | 54K | |
| Bette Midler - The r..> | 2026-05-22 20:31 | 307K | |
| Bette Midler - In Th..> | 2026-05-22 19:30 | 52K | |
| Bette Midler - From ..> | 2026-05-22 19:55 | 43K | |
| Bette Midler - Beast..> | 2026-05-22 19:37 | 49K | |
| Beth Hart - Leave Th..> | 2026-05-22 20:04 | 72K | |
| Beth Hart - La Song.jpg | 2026-05-22 19:55 | 14K | |
| Bertolf - Another Da..> | 2026-05-22 20:04 | 236K | |
| Bertolf -Another Day..> | 2026-05-22 20:04 | 76K | |
| Bert Melia Orchestra..> | 2026-05-22 20:31 | 381K | |
| Bert Melia & his Orc..> | 2026-05-22 20:31 | 58K | |
| Bert Kaempfert Orche..> | 2026-05-22 20:31 | 171K | |
| Bert Kaempfert Orche..> | 2026-05-22 20:31 | 231K | |
| Bert Kaempfert - Mor..> | 2026-05-22 20:31 | 151K | |
| Bert Kaempfert & Syl..> | 2026-05-22 19:30 | 121K | |
| Bert Kaempfert & Orc..> | 2026-05-22 19:37 | 37K | |
| Bert Kaempfert & Orc..> | 2026-05-22 19:30 | 67K | |
| Bert Kaempfert & Orc..> | 2026-05-22 19:55 | 39K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 67K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 207K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 41K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 106K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 106K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 106K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 106K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 13K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 45K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 35K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 66K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 106K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 46K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 74K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 59K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 182K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 40K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 43K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 43K | |
| Bert Kaempfert & His..> | 2026-05-22 20:31 | 82K | |
| Bernd Cluver - Der J..> | 2026-05-22 20:31 | 51K | |
| Bernd Clüver - Der ..> | 2026-05-22 19:30 | 1.1M | |
| Bernard Cribbins - H..> | 2026-05-22 20:17 | 149K | |
| Bernadette - Sing Me..> | 2026-05-22 19:37 | 74K | |
| Berlin - Take My Bre..> | 2026-05-22 19:37 | 30K | |
| Berlin - Like Flames..> | 2026-05-22 19:37 | 1.8M | |
| Berdien Stenberg - V..> | 2026-05-22 19:37 | 82K | |
| Berdien Stenberg - R..> | 2026-05-22 20:31 | 59K | |
| Benny Goodman - Memo..> | 2026-05-22 19:55 | 67K | |
| Bennett - Vois sur t..> | 2026-05-22 20:04 | 248K | |
| Bennet & Bee - Take ..> | 2026-05-22 19:37 | 36K | |
| Ben Saunders - If Yo..> | 2026-05-22 20:04 | 233K | |
| Ben Liebrand - Dance..> | 2026-05-22 19:55 | 113K | |
| Ben Liebrand - Dance..> | 2026-05-22 19:37 | 69K | |
| Ben L'Oncle Soul - S..> | 2026-05-22 20:04 | 93K | |
| Ben Howard - Keep Yo..> | 2026-05-22 20:04 | 34K | |
| Ben E. King - Stand ..> | 2026-05-22 20:31 | 150K | |
| Ben E. King - Spanis..> | 2026-05-22 20:31 | 53K | |
| Ben Cramer - Lady Of..> | 2026-05-22 19:30 | 278K | |
| Bellini - Samba De J..> | 2026-05-22 19:55 | 64K | |
| Belle Stars -Sign Of..> | 2026-05-22 19:37 | 65K | |
| Belle Stars - Sign O..> | 2026-05-22 19:55 | 65K | |
| Belle Epoque - Black..> | 2026-05-22 19:30 | 458K | |
| Bellatrax Featuring ..> | 2026-05-22 20:04 | 34K | |
| Bellamy Brothers - L..> | 2026-05-22 20:31 | 40K | |
| Bellamy Brothers - I..> | 2026-05-22 20:31 | 49K | |
| Bellamy Brothers, Th..> | 2026-05-22 19:30 | 163K | |
| Belinda Carlisle - L..> | 2026-05-22 19:37 | 69K | |
| Belinda Carlisle - H..> | 2026-05-22 19:37 | 72K | |
| Belinda Carlisle - C..> | 2026-05-22 19:37 | 72K | |
| Beef - Alice (I Want..> | 2026-05-22 20:04 | 21K | |
| Bee Gees - You shoul..> | 2026-05-22 19:30 | 38K | |
| Bee Gees - You Win A..> | 2026-05-22 19:37 | 48K | |
| Bee Gees - World.jpg | 2026-05-22 20:31 | 95K | |
| Bee Gees - Words.jpg | 2026-05-22 20:31 | 29K | |
| Bee Gees - Too Much ..> | 2026-05-22 19:30 | 49K | |
| Bee Gees - Tomorrow ..> | 2026-05-22 20:31 | 431K | |
| Bee Gees - To Love S..> | 2026-05-22 20:31 | 49K | |
| Bee Gees - The Singe..> | 2026-05-22 20:31 | 346K | |
| Bee Gees - Stayin' A..> | 2026-05-22 20:31 | 105K | |
| Bee Gees - Stayin' A..> | 2026-05-22 19:30 | 52K | |
| Bee Gees - Spicks An..> | 2026-05-22 20:31 | 68K | |
| Bee Gees - Saved by ..> | 2026-05-22 20:31 | 51K | |
| Bee Gees - New York ..> | 2026-05-22 20:31 | 49K | |
| Bee Gees - My World.jpg | 2026-05-22 19:30 | 82K | |
| Bee Gees - More Than..> | 2026-05-22 20:31 | 63K | |
| Bee Gees - Massachus..> | 2026-05-22 20:31 | 29K | |
| Bee Gees - Lonely Da..> | 2026-05-22 19:55 | 21K | |
| Bee Gees - Jive Talk..> | 2026-05-22 19:30 | 76K | |
| Bee Gees - I started..> | 2026-05-22 20:31 | 95K | |
| Bee Gees - I've Gott..> | 2026-05-22 20:31 | 45K | |
| Bee Gees - How Deep ..> | 2026-05-22 20:31 | 53K | |
| Bee Gees - How Can Y..> | 2026-05-22 19:30 | 75K | |
| Bee Gees - Holiday.jpg | 2026-05-22 20:31 | 49K | |
| Bee Gees - Don't For..> | 2026-05-22 20:31 | 49K | |
| Bee Gees, The - Nigh..> | 2026-05-22 19:30 | 63K | |
| Bee Gees, The - My W..> | 2026-05-22 19:30 | 82K | |
| Becky Hill + Galanti..> | 2026-05-22 20:04 | 181K | |
| Beckie Bell - Steppi..> | 2026-05-22 19:55 | 45K | |
| Beck - Loser.jpg | 2026-05-22 19:55 | 82K | |
| Bebe RexhaDavid Guet..> | 2026-05-22 20:04 | 148K | |
| Bebe Rexha - Sacrifi..> | 2026-05-22 20:04 | 285K | |
| Beautiful South - So..> | 2026-05-22 20:31 | 339K | |
| Beautiful South - So..> | 2026-05-22 19:37 | 340K | |
| Beautiful South - A ..> | 2026-05-22 19:55 | 43K | |
| Beats International ..> | 2026-05-22 19:55 | 71K | |
| Beatles - Yesterday.jpg | 2026-05-22 20:31 | 15K | |
| Beatles - Yellow sub..> | 2026-05-22 20:31 | 15K | |
| Beatles - While My G..> | 2026-05-22 20:31 | 48K | |
| Beatles - When I'm S..> | 2026-05-22 20:31 | 18K | |
| Beatles - We Can Wor..> | 2026-05-22 20:31 | 15K | |
| Beatles - Till There..> | 2026-05-22 20:31 | 88K | |
| Beatles - Ticket to ..> | 2026-05-22 20:31 | 15K | |
| Beatles - There's A ..> | 2026-05-22 20:31 | 66K | |
| Beatles - The Long &..> | 2026-05-22 20:31 | 37K | |
| Beatles - The Ballad..> | 2026-05-22 19:30 | 33K | |
| Beatles - She Loves ..> | 2026-05-22 20:31 | 18K | |
| Beatles - Sgt Pepper..> | 2026-05-22 20:31 | 55K | |
| Beatles - Rock and r..> | 2026-05-22 20:31 | 75K | |
| Beatles - Please, Pl..> | 2026-05-22 20:31 | 27K | |
| Beatles - Paperback ..> | 2026-05-22 20:31 | 54K | |
| Beatles - P.s. I Lov..> | 2026-05-22 20:31 | 105K | |
| Beatles - Ob-La-Di, ..> | 2026-05-22 20:31 | 4.4K | |
| Beatles - Norwegian ..> | 2026-05-22 20:31 | 42K | |
| Beatles - Norwegian ..> | 2026-05-22 19:37 | 474K | |
| Beatles - No reply.jpg | 2026-05-22 20:31 | 75K | |
| Beatles - Magical My..> | 2026-05-22 20:31 | 61K | |
| Beatles - Love Me Do..> | 2026-05-22 20:31 | 105K | |
| Beatles - Let It Be.jpg | 2026-05-22 20:31 | 264K | |
| Beatles - Lady Madon..> | 2026-05-22 20:31 | 15K | |
| Beatles - I should h..> | 2026-05-22 20:31 | 14K | |
| Beatles - I feel fin..> | 2026-05-22 20:31 | 15K | |
| Beatles - If I fell.jpg | 2026-05-22 20:31 | 49K | |
| Beatles - I Want To ..> | 2026-05-22 20:31 | 48K | |
| Beatles - I Saw Her ..> | 2026-05-22 20:31 | 30K | |
| Beatles - I'll Follo..> | 2026-05-22 19:37 | 182K | |
| Beatles - Here Comes..> | 2026-05-22 20:31 | 80K | |
| Beatles - Help!.jpg | 2026-05-22 20:31 | 15K | |
| Beatles - Hello Good..> | 2026-05-22 20:31 | 56K | |
| Beatles - Hello, goo..> | 2026-05-22 20:31 | 15K | |
| Beatles - Girl.jpg | 2026-05-22 20:31 | 48K | |
| Beatles - Get back.jpg | 2026-05-22 20:31 | 15K | |
| Beatles - Eleanor Ri..> | 2026-05-22 20:31 | 15K | |
| Beatles - Eight days..> | 2026-05-22 20:31 | 15K | |
| Beatles - Day Trippe..> | 2026-05-22 20:31 | 196K | |
| Beatles - Come Toget..> | 2026-05-22 20:31 | 15K | |
| Beatles - Can't Buy ..> | 2026-05-22 20:31 | 63K | |
| Beatles - Blackbird.jpg | 2026-05-22 20:31 | 6.3K | |
| Beatles - Bad boy [E..> | 2026-05-22 20:31 | 14K | |
| Beatles - Back In Th..> | 2026-05-22 20:31 | 48K | |
| Beatles - Baby's In ..> | 2026-05-22 20:31 | 39K | |
| Beatles - And I Love..> | 2026-05-22 20:31 | 15K | |
| Beatles - All you ne..> | 2026-05-22 20:31 | 70K | |
| Beatles - A Hard Day..> | 2026-05-22 19:30 | 201K | |
| Beatles, The - Let I..> | 2026-05-22 19:30 | 364K | |
| Beatfreakz - Somebod..> | 2026-05-22 20:04 | 76K | |
| Beat - Tears Of A Cl..> | 2026-05-22 19:37 | 34K | |
| Beastie Boys - Fight..> | 2026-05-22 19:55 | 35K | |
| Beastie Boys - (You ..> | 2026-05-22 19:37 | 39K | |
| Beam Vs. Cyrus - Tak..> | 2026-05-22 20:04 | 168K | |
| Beachbag - We Are Yo..> | 2026-05-22 20:04 | 398K | |
| Beach Boys - Then I ..> | 2026-05-22 20:31 | 51K | |
| Beach Boys - Tears I..> | 2026-05-22 20:31 | 70K | |
| Beach Boys - Surfin'..> | 2026-05-22 19:55 | 38K | |
| Beach Boys - Sloop J..> | 2026-05-22 20:31 | 41K | |
| Beach Boys - Kokomo.jpg | 2026-05-22 19:37 | 68K | |
| Beach Boys - I Can H..> | 2026-05-22 20:31 | 57K | |
| Beach Boys - Help me..> | 2026-05-22 20:31 | 42K | |
| Beach Boys - God onl..> | 2026-05-22 20:31 | 41K | |
| Beach Boys - Califor..> | 2026-05-22 20:31 | 92K | |
| Beach Boys - Barbara..> | 2026-05-22 20:31 | 92K | |
| Bc-52's - (Meet) The..> | 2026-05-22 19:55 | 95K | |
| Bb & Q Band - Starle..> | 2026-05-22 19:30 | 10K | |
| Bb&Q Band - On The B..> | 2026-05-22 19:37 | 95K | |
| Bb & Q Band - Genie ..> | 2026-05-22 19:37 | 21K | |
| Baz Luhrmann -Everyb..> | 2026-05-22 20:31 | 49K | |
| Bay City Rollers - S..> | 2026-05-22 19:30 | 311K | |
| Bay City Rollers - L..> | 2026-05-22 19:30 | 215K | |
| Bay City Rollers - I..> | 2026-05-22 19:30 | 106K | |
| Bata Illic - Michael..> | 2026-05-22 19:30 | 156K | |
| Basto! - Gregory's T..> | 2026-05-22 20:04 | 39K | |
| Bastille - Things We..> | 2026-05-22 20:04 | 38K | |
| Bastille - Pompeii.jpg | 2026-05-22 20:04 | 63K | |
| Bassjackers - All Ar..> | 2026-05-22 20:04 | 440K | |
| Basshunter - Botten ..> | 2026-05-22 20:04 | 66K | |
| Basement Jaxx - Red ..> | 2026-05-22 20:04 | 50K | |
| Baseballs - Umbrella..> | 2026-05-22 20:04 | 38K | |
| Barthezz - On The Mo..> | 2026-05-22 20:04 | 328K | |
| Bart Simpson - Do Th..> | 2026-05-22 19:55 | 54K | |
| Bart Peeters & Radio..> | 2026-05-22 19:37 | 31K | |
| Barry White - You Se..> | 2026-05-22 19:30 | 156K | |
| Barry White - You're..> | 2026-05-22 19:30 | 75K | |
| Barry White - Never,..> | 2026-05-22 19:30 | 149K | |
| Barry White - Let Th..> | 2026-05-22 19:30 | 45K | |
| Barry White - Just T..> | 2026-05-22 19:30 | 113K | |
| Barry White - I'm Go..> | 2026-05-22 19:30 | 38K | |
| Barry White - Can't ..> | 2026-05-22 19:55 | 30K | |
| Barry White - Can't ..> | 2026-05-22 19:30 | 170K | |
| Barry Sisters - Hava..> | 2026-05-22 20:31 | 42K | |
| Barry Ryan - Love Is..> | 2026-05-22 20:31 | 212K | |
| Barry Ryan - Eloise.jpg | 2026-05-22 20:31 | 212K | |
| Barry McGuire - Eve ..> | 2026-05-22 20:31 | 259K | |
| Barry Manilow - Mand..> | 2026-05-22 20:31 | 65K | |
| Barry Manilow - I Wr..> | 2026-05-22 19:37 | 37K | |
| Barry Manilow - Copa..> | 2026-05-22 20:31 | 56K | |
| Barry Manilow - Copa..> | 2026-05-22 19:30 | 191K | |
| Barry Manilow - Can'..> | 2026-05-22 19:30 | 20K | |
| Barry Eileen - If Yo..> | 2026-05-22 20:31 | 236K | |
| Barry Biggs - Love C..> | 2026-05-22 19:55 | 28K | |
| Barry & Eileen - Sum..> | 2026-05-22 19:30 | 294K | |
| Barry & Eileen - If ..> | 2026-05-22 19:30 | 236K | |
| Barrabas - On the ro..> | 2026-05-22 19:37 | 70K | |
| Barclay James Harves..> | 2026-05-22 19:30 | 108K | |
| Barbra Streisand - W..> | 2026-05-22 20:31 | 33K | |
| Barbra Streisand - T..> | 2026-05-22 20:31 | 47K | |
| Barbra Streisand - T..> | 2026-05-22 20:31 | 38K | |
| Barbra Streisand - S..> | 2026-05-22 20:31 | 30K | |
| Barbra Streisand - P..> | 2026-05-22 20:31 | 28K | |
| Barbra Streisand - M..> | 2026-05-22 20:31 | 77K | |
| Barbra Streisand - F..> | 2026-05-22 19:55 | 31K | |
| Barbra Streisand - E..> | 2026-05-22 19:30 | 86K | |
| Barbra Streisand - A..> | 2026-05-22 19:37 | 38K | |
| Barbra Streisand & N..> | 2026-05-22 20:31 | 45K | |
| Barbra Streisand & D..> | 2026-05-22 19:37 | 38K | |
| Barbra Streisand & C..> | 2026-05-22 19:55 | 40K | |
| Barbra Streisand & B..> | 2026-05-22 19:55 | 65K | |
| Barbra Streisand & B..> | 2026-05-22 20:31 | 33K | |
| Barbarella - We Chee..> | 2026-05-22 19:37 | 39K | |
| Barbara Mandrell - Y..> | 2026-05-22 20:17 | 10K | |
| Barbara Mandrell - W..> | 2026-05-22 20:17 | 10K | |
| Barbara Mandrell - W..> | 2026-05-22 20:17 | 12K | |
| Barbara Mandrell - S..> | 2026-05-22 20:17 | 10K | |
| Barbara Mandrell - S..> | 2026-05-22 20:17 | 154K | |
| Barbara Mandrell - O..> | 2026-05-22 20:17 | 49K | |
| Barbara Mandrell - M..> | 2026-05-22 20:17 | 10K | |
| Barbara Mandrell - F..> | 2026-05-22 20:17 | 54K | |
| Barbara Mandrell - F..> | 2026-05-22 20:17 | 37K | |
| Barbara Mandrell - C..> | 2026-05-22 20:17 | 47K | |
| Barbara Dickson - My..> | 2026-05-22 20:31 | 50K | |
| Barbara Dickson - Ja..> | 2026-05-22 19:37 | 34K | |
| Barbara Dickson & El..> | 2026-05-22 20:31 | 91K | |
| Baracuda - Damn! (Re..> | 2026-05-22 20:04 | 231K | |
| Bar-Kays - Soul Fing..> | 2026-05-22 20:31 | 326K | |
| Bap - Kristallnaach.jpg | 2026-05-22 19:37 | 30K | |
| Banners - Someone To..> | 2026-05-22 20:04 | 178K | |
| Bangles - Walk Like ..> | 2026-05-22 19:37 | 53K | |
| Bangles - Hazy Shade..> | 2026-05-22 19:37 | 21K | |
| Bangles - Eternal Fl..> | 2026-05-22 20:31 | 53K | |
| Bangles, The - Etern..> | 2026-05-22 19:37 | 53K | |
| Bandolero - Paris La..> | 2026-05-22 19:37 | 90K | |
| Band Of Gold - This ..> | 2026-05-22 19:37 | 31K | |
| Band Of Gold - Loves..> | 2026-05-22 19:37 | 301K | |
| Band Aid - Do They K..> | 2026-05-22 19:37 | 56K | |
| Bananarama - Venus.jpg | 2026-05-22 19:37 | 148K | |
| Bananarama - Shy boy..> | 2026-05-22 19:37 | 51K | |
| Bananarama - Rough J..> | 2026-05-22 19:37 | 225K | |
| Bananarama - Robert ..> | 2026-05-22 19:37 | 112K | |
| Bananarama - Really ..> | 2026-05-22 19:37 | 47K | |
| Bananarama - Love In..> | 2026-05-22 19:37 | 43K | |
| Bananarama - Last Th..> | 2026-05-22 19:55 | 15K | |
| Bananarama - I Heard..> | 2026-05-22 19:37 | 43K | |
| Bananarama - Cruel S..> | 2026-05-22 19:37 | 65K | |
| Bananarama & Lananee..> | 2026-05-22 19:37 | 56K | |
| Bananarama & Fun Boy..> | 2026-05-22 19:37 | 47K | |
| Baltimora - Tarzan B..> | 2026-05-22 19:37 | 81K | |
| Baillie & the Boys -..> | 2026-05-22 20:17 | 37K | |
| Baillie & the Boys -..> | 2026-05-22 20:17 | 61K | |
| Baillie & the Boys -..> | 2026-05-22 20:17 | 61K | |
| Baillie & the Boys -..> | 2026-05-22 20:17 | 50K | |
| Baillie & the Boys -..> | 2026-05-22 20:17 | 61K | |
| Baillie & The Boys -..> | 2026-05-22 20:31 | 760K | |
| Baha Men - Who Let T..> | 2026-05-22 20:04 | 82K | |
| BadgerNatasha Beding..> | 2026-05-22 20:04 | 3.6M | |
| Badfinger - No Matte..> | 2026-05-22 19:30 | 175K | |
| Badfinger - Come And..> | 2026-05-22 19:30 | 164K | |
| Badesaltz - I Still ..> | 2026-05-22 19:55 | 80K | |
| Bad Manners - Can Ca..> | 2026-05-22 19:37 | 51K | |
| Bad English - Time S..> | 2026-05-22 19:55 | 42K | |
| Bad English - Straig..> | 2026-05-22 19:55 | 42K | |
| Bad English & John W..> | 2026-05-22 19:55 | 147K | |
| Bad Candy - Girls Ju..> | 2026-05-22 20:04 | 75K | |
| Bad Boys Blue - You'..> | 2026-05-22 19:55 | 29K | |
| Bad Boys Blue - You'..> | 2026-05-22 19:37 | 63K | |
| Bad Boys Blue - Don'..> | 2026-05-22 19:37 | 285K | |
| Bad Boys Blue - Come..> | 2026-05-22 19:37 | 160K | |
| Backstreet Boys - We..> | 2026-05-22 19:55 | 67K | |
| Backstreet Boys - Sh..> | 2026-05-22 20:31 | 39K | |
| Backstreet Boys - Qu..> | 2026-05-22 19:55 | 39K | |
| Backstreet Boys - La..> | 2026-05-22 19:55 | 32K | |
| Backstreet Boys - I ..> | 2026-05-22 19:55 | 32K | |
| Backstreet Boys - I'..> | 2026-05-22 19:55 | 39K | |
| Backstreet Boys - Ge..> | 2026-05-22 19:55 | 67K | |
| Backstreet Boys - Ev..> | 2026-05-22 19:55 | 55K | |
| Backstreet Boys - As..> | 2026-05-22 19:55 | 55K | |
| Bachman Turner Overd..> | 2026-05-22 19:30 | 152K | |
| Bachman-Turner Overd..> | 2026-05-22 19:30 | 152K | |
| Baccara -Yes Sir, I ..> | 2026-05-22 19:30 | 141K | |
| Baccara - Yes Sir, I..> | 2026-05-22 19:55 | 36K | |
| Baccara - Sorry I'm ..> | 2026-05-22 19:30 | 146K | |
| Baccara - Parlez-Vou..> | 2026-05-22 19:30 | 116K | |
| Babysitters Circus -..> | 2026-05-22 20:04 | 42K | |
| Babys - Everytime I ..> | 2026-05-22 19:30 | 16K | |
| Babyface & Stevie Wo..> | 2026-05-22 19:55 | 98K | |
| Baby's - Isn't It Ti..> | 2026-05-22 19:30 | 187K | |
| Babe Team - A Team T..> | 2026-05-22 20:04 | 52K | |
| Babe Team - A Team T..> | 2026-05-22 20:04 | 52K | |
| Babe - The Drunken S..> | 2026-05-22 19:37 | 43K | |
| Babe - Minnie The Mo..> | 2026-05-22 19:37 | 48K | |
| Babe - I'm A Rocking..> | 2026-05-22 19:37 | 65K | |
| Babe - (Never Listen..> | 2026-05-22 19:30 | 311K | |
| BZN - Waltzing Maria..> | 2026-05-22 19:38 | 461K | |
| BZN - Twilight.jpg | 2026-05-22 19:38 | 39K | |
| BZN - The Summertime..> | 2026-05-22 19:38 | 303K | |
| BZN - Sevilla.jpg | 2026-05-22 19:30 | 461K | |
| BZN - Old Calahan.jpg | 2026-05-22 19:38 | 121K | |
| BZN - Love Me Like A..> | 2026-05-22 19:30 | 339K | |
| BZN - La différence..> | 2026-05-22 19:38 | 261K | |
| BZN - La Primavera.jpg | 2026-05-22 19:38 | 261K | |
| BZN - Felicidad.jpg | 2026-05-22 19:30 | 357K | |
| BZN - Everyday I Hav..> | 2026-05-22 20:32 | 355K | |
| BZN - Blue eyes.jpg | 2026-05-22 19:38 | 39K | |
| BBE - Seven Days and..> | 2026-05-22 20:04 | 200K | |
| BADDIES ONLY - Set F..> | 2026-05-22 20:04 | 27K | |
| B 52S - Love Shack.jpg | 2026-05-22 19:30 | 83K | |
| B 52's - Love Shack.jpg | 2026-05-22 19:37 | 83K | |
| B.o.b. Ft. Bruno Mar..> | 2026-05-22 20:04 | 97K | |
| B.j. Thomas - Raindr..> | 2026-05-22 20:31 | 57K | |
| B.J. Thomas - I Just..> | 2026-05-22 20:17 | 15K | |
| B.J. Thomas - Hooked..> | 2026-05-22 20:31 | 205K | |
| B. J. Thomas - (Hey ..> | 2026-05-22 20:31 | 19K | |
| B.B King - Ain't Nob..> | 2026-05-22 19:55 | 29K | |
| B.B. Queen - Bluesho..> | 2026-05-22 19:55 | 40K | |
| Béla Fleck and the ..> | 2026-05-22 20:17 | 46K | |
| Béla Fleck and the ..> | 2026-05-22 20:17 | 41K | |
| Azoto - San Salvador..> | 2026-05-22 19:37 | 49K | |
| Az Yet - Last Night.jpg | 2026-05-22 19:55 | 56K | |
| Az Yet - Last Night ..> | 2026-05-22 19:55 | 87K | |
| Az Yet & Peter Ceter..> | 2026-05-22 19:55 | 48K | |
| Az Yet & Peter Ceter..> | 2026-05-22 19:55 | 29K | |
| Axwell Ingrosso - M..> | 2026-05-22 20:04 | 291K | |
| Axwell & Ingrosso -S..> | 2026-05-22 20:04 | 81K | |
| Axwell & Bob Sinclar..> | 2026-05-22 20:04 | 30K | |
| Axwell & Bob Sinclar..> | 2026-05-22 20:04 | 30K | |
| Axwell Λ Ingrosso -..> | 2026-05-22 20:04 | 94K | |
| Axis - Ela Ela.jpg | 2026-05-22 19:30 | 101K | |
| Avril Lavigne - Sk8e..> | 2026-05-22 20:04 | 40K | |
| Avril Lavigne - I'm ..> | 2026-05-22 20:04 | 33K | |
| Avril Lavigne - Here..> | 2026-05-22 20:04 | 55K | |
| Avril Lavigna - Comp..> | 2026-05-22 20:04 | 40K | |
| Avicii Vs. Nicky Rom..> | 2026-05-22 20:04 | 27K | |
| Avicii Ft Rita Ora -..> | 2026-05-22 20:04 | 148K | |
| Avicii Ft. Aloe Blac..> | 2026-05-22 20:04 | 259K | |
| Avicii Cover Band - ..> | 2026-05-22 20:04 | 64K | |
| Avicii - Wake me up.jpg | 2026-05-22 20:04 | 31K | |
| Avicii -The Nights.jpg | 2026-05-22 20:04 | 27K | |
| Avicii -The Days.jpg | 2026-05-22 20:04 | 27K | |
| Avicii - Levels.jpg | 2026-05-22 20:04 | 48K | |
| Avicii - Levels ((Or..> | 2026-05-22 20:04 | 178K | |
| Avicii -Hey Brother.jpg | 2026-05-22 20:04 | 31K | |
| Avicii - Heaven.jpg | 2026-05-22 20:04 | 22K | |
| Avicii - Addicted to..> | 2026-05-22 20:04 | 31K | |
| Ava Max - Sweet but ..> | 2026-05-22 20:04 | 83K | |
| Ava Max - Salt.jpg | 2026-05-22 20:04 | 214K | |
| Ava Max - Kings & Qu..> | 2026-05-22 20:04 | 33K | |
| Ava Max - Choose You..> | 2026-05-22 20:04 | 72K | |
| Autry Inman - That's..> | 2026-05-22 20:17 | 26K | |
| Autry Inman - Indian..> | 2026-05-22 20:17 | 88K | |
| Audrey Landers - Pla..> | 2026-05-22 19:37 | 50K | |
| Audrey Landers - Man..> | 2026-05-22 19:37 | 50K | |
| Atomic Rooster - Tom..> | 2026-05-22 19:30 | 381K | |
| Atomic Kitten - Whol..> | 2026-05-22 20:04 | 19K | |
| Atomic Kitten - The ..> | 2026-05-22 20:04 | 144K | |
| Atomic Kitten - Eter..> | 2026-05-22 20:04 | 19K | |
| Atlantic Ocean - Wat..> | 2026-05-22 20:04 | 36K | |
| Atlantic Ocean - Wat..> | 2026-05-22 19:55 | 277K | |
| Atenna - Zorba The G..> | 2026-05-22 19:55 | 83K | |
| Atc - Around The Wor..> | 2026-05-22 20:04 | 76K | |
| Atb X Topic X A7S - ..> | 2026-05-22 20:04 | 53K | |
| Atb - Don't Stop.jpg | 2026-05-22 19:55 | 72K | |
| Atb - 9 Pm (Till I C..> | 2026-05-22 19:55 | 72K | |
| Aswad - Shine.jpg | 2026-05-22 19:55 | 67K | |
| Aswad - Don't Turn A..> | 2026-05-22 19:37 | 74K | |
| Astrud Gilberto - Th..> | 2026-05-22 19:30 | 267K | |
| Astrud Gilberto & An..> | 2026-05-22 20:31 | 92K | |
| Astor Piazzolla - Ad..> | 2026-05-22 20:31 | 69K | |
| Association - Windy.jpg | 2026-05-22 19:55 | 70K | |
| Association - Along ..> | 2026-05-22 20:31 | 278K | |
| Assekruus - Slavenko..> | 2026-05-22 19:55 | 48K | |
| Asleep at the Wheel ..> | 2026-05-22 20:17 | 85K | |
| Asleep at the Wheel ..> | 2026-05-22 20:17 | 79K | |
| Asleep at the Wheel ..> | 2026-05-22 20:17 | 2.7M | |
| Asia - Heat Of The M..> | 2026-05-22 19:37 | 154K | |
| Ashford And Simpson ..> | 2026-05-22 19:37 | 64K | |
| Ashford & Simpson - ..> | 2026-05-22 19:30 | 258K | |
| Asaf Avidan & the Mo..> | 2026-05-22 20:04 | 33K | |
| Art of Noise Feat. M..> | 2026-05-22 20:31 | 48K | |
| Artists United Again..> | 2026-05-22 19:37 | 17K | |
| Arthur Ebeling - Mar..> | 2026-05-22 20:17 | 42K | |
| Arthur Conley - Swee..> | 2026-05-22 20:31 | 70K | |
| Arthur Baker & Backb..> | 2026-05-22 19:37 | 46K | |
| Art Of Noise & Tom J..> | 2026-05-22 19:37 | 23K | |
| Art Garfunkel - Brig..> | 2026-05-22 20:31 | 28K | |
| Aronchupa - Im an al..> | 2026-05-22 20:04 | 76K | |
| Arno Kolenbrander - ..> | 2026-05-22 19:55 | 63K | |
| Army Of Lovers - Giv..> | 2026-05-22 19:55 | 65K | |
| Army Of Lovers - Cru..> | 2026-05-22 19:55 | 57K | |
| Armin van Buuren - T..> | 2026-05-22 20:04 | 24K | |
| Armin van Buuren - F..> | 2026-05-22 20:04 | 353K | |
| Armin van Buuren - C..> | 2026-05-22 20:04 | 273K | |
| Armin van Buuren - B..> | 2026-05-22 20:04 | 106K | |
| Armin Van Buuren ft...> | 2026-05-22 20:04 | 53K | |
| Armin Van Buuren Vs ..> | 2026-05-22 20:04 | 36K | |
| Armin Van Buuren Ft...> | 2026-05-22 20:04 | 24K | |
| Armin Van Buuren Ft...> | 2026-05-22 20:04 | 51K | |
| Armin Van Buuren - T..> | 2026-05-22 20:04 | 183K | |
| Armin Van Buuren - N..> | 2026-05-22 20:04 | 81K | |
| Armand van Helden & ..> | 2026-05-22 20:04 | 312K | |
| Armand - Blommenkind..> | 2026-05-22 20:31 | 88K | |
| Arjan Brass - Leonie..> | 2026-05-22 20:31 | 67K | |
| Arielle Dombasle by ..> | 2026-05-22 20:31 | 53K | |
| Arielle Dombasle by ..> | 2026-05-22 20:31 | 53K | |
| Arielle Dombasle by ..> | 2026-05-22 20:31 | 53K | |
| Arielle Dombasle by ..> | 2026-05-22 20:31 | 53K | |
| Arielle Dombasle by ..> | 2026-05-22 20:31 | 53K | |
| Arielle Dombasle by ..> | 2026-05-22 20:31 | 53K | |
| Arielle Dombasle by ..> | 2026-05-22 20:31 | 53K | |
| Arielle Dombasle by ..> | 2026-05-22 20:31 | 53K | |
| Arielle Dombasle by ..> | 2026-05-22 20:31 | 53K | |
| Arielle Dombasle by ..> | 2026-05-22 20:31 | 53K | |
| Arielle Dombasle by ..> | 2026-05-22 20:31 | 53K | |
| Ariana Grande - One ..> | 2026-05-22 20:04 | 23K | |
| Are you ready_..... ..> | 2026-05-22 19:29 | 3.1K | |
| Aretha Franklin - Wh..> | 2026-05-22 19:30 | 279K | |
| Aretha Franklin - Sp..> | 2026-05-22 20:31 | 32K | |
| Aretha Franklin - Re..> | 2026-05-22 20:31 | 38K | |
| Aretha Franklin - I ..> | 2026-05-22 20:31 | 78K | |
| Aretha Franklin - Ch..> | 2026-05-22 20:31 | 409K | |
| Aretha Franklin - Ch..> | 2026-05-22 20:04 | 157K | |
| Aretha Franklin - (Y..> | 2026-05-22 20:31 | 34K | |
| Aretha Franklin & Ge..> | 2026-05-22 19:37 | 166K | |
| Archies - Sugar, sug..> | 2026-05-22 20:31 | 19K | |
| Archie Bleyer's Orch..> | 2026-05-22 19:55 | 62K | |
| Arcadia - Election D..> | 2026-05-22 19:37 | 41K | |
| Aquagen - Hard To Sa..> | 2026-05-22 20:04 | 287K | |
| AquaTiësto - Barbie..> | 2026-05-22 20:04 | 2.2M | |
| Aqua - Turn Back Tim..> | 2026-05-22 19:55 | 44K | |
| Aqua - My Oh My.jpg | 2026-05-22 19:55 | 44K | |
| Aqua - Dr.Jones.jpg | 2026-05-22 19:55 | 44K | |
| Aqua - Barbie Girl.jpg | 2026-05-22 19:55 | 44K | |
| Apotheosis - O Fortu..> | 2026-05-22 19:55 | 71K | |
| Apollonia 6 - Sex Sh..> | 2026-05-22 19:37 | 9.4K | |
| Apollo 100 - Joy.jpg | 2026-05-22 19:30 | 314K | |
| Apollo 100 - Fourth ..> | 2026-05-22 19:30 | 314K | |
| Apollo 100 - Besame ..> | 2026-05-22 19:30 | 314K | |
| Aphrodite's Child - ..> | 2026-05-22 19:30 | 488K | |
| Aphrodite's Child - ..> | 2026-05-22 20:31 | 195K | |
| Aphrodite's Child - ..> | 2026-05-22 19:37 | 163K | |
| Aphrodite's Child - ..> | 2026-05-22 19:30 | 205K | |
| Aphrodite's Child - ..> | 2026-05-22 20:31 | 45K | |
| Anya - Moscow Nights..> | 2026-05-22 19:37 | 35K | |
| Antonio Carlos Jambi..> | 2026-05-22 20:31 | 84K | |
| Anthony Keyrouz & Pa..> | 2026-05-22 20:04 | 412K | |
| Anouk .jpg | 2026-05-22 20:04 | 60K | |
| Anouk - Three Days I..> | 2026-05-22 20:04 | 76K | |
| Anouk - Sacrifice.jpg | 2026-05-22 19:55 | 54K | |
| Anouk - R U Kiddin' ..> | 2026-05-22 20:04 | 14K | |
| Anouk - One Word.jpg | 2026-05-22 20:04 | 44K | |
| Anouk - Nobody's Wif..> | 2026-05-22 19:55 | 54K | |
| Anouk - Modern World..> | 2026-05-22 20:04 | 60K | |
| Anouk - Michel.jpg | 2026-05-22 20:31 | 14K | |
| Anouk - Lost.jpg | 2026-05-22 20:04 | 44K | |
| Anouk - I Don't Wann..> | 2026-05-22 20:04 | 60K | |
| Anouk - Girl.jpg | 2026-05-22 20:04 | 44K | |
| Anouk - Birds.jpg | 2026-05-22 20:31 | 89K | |
| Anouk & Douwe Bob - ..> | 2026-05-22 20:04 | 86K | |
| Another Level - Frea..> | 2026-05-22 20:04 | 29K | |
| Anny Schilder - You ..> | 2026-05-22 19:37 | 47K | |
| Annie Lennox - Why.jpg | 2026-05-22 19:55 | 43K | |
| Annie Lennox - No Mo..> | 2026-05-22 19:37 | 28K | |
| Annie Lennox & Al Gr..> | 2026-05-22 19:37 | 60K | |
| Anneke Grönloh - Ci..> | 2026-05-22 20:04 | 50K | |
| Anne Murray - You Ne..> | 2026-05-22 20:31 | 35K | |
| Anne Murray - Walk R..> | 2026-05-22 20:31 | 37K | |
| Anne Murray - Time D..> | 2026-05-22 20:17 | 35K | |
| Anne Murray - There ..> | 2026-05-22 20:17 | 13K | |
| Anne Murray - Snowbi..> | 2026-05-22 19:55 | 35K | |
| Anne Murray - Shadow..> | 2026-05-22 20:17 | 35K | |
| Anne Murray - Now An..> | 2026-05-22 20:17 | 35K | |
| Anne Murray - Nobody..> | 2026-05-22 20:17 | 35K | |
| Anne Murray - Lucky ..> | 2026-05-22 20:17 | 32K | |
| Anne Murray - Just A..> | 2026-05-22 20:17 | 35K | |
| Anne Murray - I Just..> | 2026-05-22 20:17 | 35K | |
| Anne Murray - Danny'..> | 2026-05-22 20:17 | 35K | |
| Anne Murray - Could ..> | 2026-05-22 20:17 | 35K | |
| Anne Murray - Broken..> | 2026-05-22 20:17 | 35K | |
| Anne Murray - Both S..> | 2026-05-22 20:17 | 98K | |
| Anne Murray - Blesse..> | 2026-05-22 20:17 | 35K | |
| Anne Murray - Anothe..> | 2026-05-22 20:17 | 35K | |
| Anne Murray - A Litt..> | 2026-05-22 20:17 | 35K | |
| Anne-Marie David - T..> | 2026-05-22 20:31 | 42K | |
| Anne‐Marie feat. S..> | 2026-05-22 20:04 | 71K | |
| Annagrace - Love Kee..> | 2026-05-22 20:04 | 73K | |
| AnnabelGareth EmeryL..> | 2026-05-22 20:04 | 112K | |
| Anna Kendrick - Cups..> | 2026-05-22 20:04 | 68K | |
| Ann Peebles - I Can'..> | 2026-05-22 19:30 | 109K | |
| Ann Lee - 2 Times.jpg | 2026-05-22 19:55 | 21K | |
| Anita Ward - Ring My..> | 2026-05-22 19:30 | 285K | |
| Anita Meyer -Why Tel..> | 2026-05-22 19:37 | 43K | |
| Anita Meyer - Why Te..> | 2026-05-22 19:55 | 43K | |
| Anita Meyer - They D..> | 2026-05-22 19:37 | 43K | |
| Anita Meyer - The on..> | 2026-05-22 19:37 | 136K | |
| Anita Meyer - Idaho.jpg | 2026-05-22 19:37 | 72K | |
| Anita Meyer - Freedo..> | 2026-05-22 19:55 | 37K | |
| Anita Meyer & Lee To..> | 2026-05-22 19:37 | 29K | |
| Anita Meyer & Lee To..> | 2026-05-22 19:37 | 29K | |
| Anita Meyer & Lee To..> | 2026-05-22 20:04 | 80K | |
| Anita Meyer & Hans V..> | 2026-05-22 19:30 | 80K | |
| Anita Kerr Singers -..> | 2026-05-22 19:30 | 85K | |
| Anita Kerr Singers -..> | 2026-05-22 19:30 | 97K | |
| Anita Cochran, Steve..> | 2026-05-22 20:17 | 196K | |
| Anita Baker - Sweet ..> | 2026-05-22 19:37 | 33K | |
| Animals - We've gott..> | 2026-05-22 20:31 | 83K | |
| Animals - The House ..> | 2026-05-22 19:55 | 78K | |
| Animals - It's My Li..> | 2026-05-22 20:31 | 223K | |
| Animals - Inside-Loo..> | 2026-05-22 20:31 | 294K | |
| Animals - Don't let ..> | 2026-05-22 20:31 | 83K | |
| Animals - Bring it o..> | 2026-05-22 20:31 | 83K | |
| Angie Stone - I Wish..> | 2026-05-22 20:04 | 64K | |
| Aneka - Japanese Boy..> | 2026-05-22 19:37 | 36K | |
| Andy Williams - [Whe..> | 2026-05-22 19:30 | 26K | |
| Andy Williams - The ..> | 2026-05-22 20:31 | 41K | |
| Andy Williams - The ..> | 2026-05-22 20:31 | 155K | |
| Andy Williams - Spea..> | 2026-05-22 20:31 | 121K | |
| Andy Williams - Spea..> | 2026-05-22 19:30 | 62K | |
| Andy Williams - She'..> | 2026-05-22 20:31 | 26K | |
| Andy Williams - Musi..> | 2026-05-22 20:31 | 17K | |
| Andy Williams - Moon..> | 2026-05-22 20:31 | 38K | |
| Andy Williams - May ..> | 2026-05-22 20:31 | 35K | |
| Andy Williams - It's..> | 2026-05-22 20:31 | 44K | |
| Andy Williams - Hawa..> | 2026-05-22 20:31 | 85K | |
| Andy Williams - Can'..> | 2026-05-22 19:30 | 38K | |
| Andy Williams - Can'..> | 2026-05-22 20:31 | 52K | |
| Andy Williams - Butt..> | 2026-05-22 20:31 | 57K | |
| Andy Williams - Batt..> | 2026-05-22 20:31 | 22K | |
| Andy Tielman - Toget..> | 2026-05-22 20:17 | 35K | |
| Andy Tielman - Hey G..> | 2026-05-22 20:17 | 35K | |
| Andy Kim - So Good T..> | 2026-05-22 20:31 | 244K | |
| Andy Kim - Baby, I L..> | 2026-05-22 20:31 | 45K | |
| Andy Griggs - You Wo..> | 2026-05-22 20:17 | 36K | |
| Andy Gibb - An Everl..> | 2026-05-22 19:30 | 149K | |
| Andy Fisher - Mr. Ca..> | 2026-05-22 20:31 | 41K | |
| Andy Fisher - Crazy ..> | 2026-05-22 20:31 | 139K | |
| Andy Fischer - Oh, O..> | 2026-05-22 20:31 | 40K | |
| Andy Borg - Adios am..> | 2026-05-22 19:37 | 26K | |
| Andrews Sisters & Bi..> | 2026-05-22 19:55 | 53K | |
| Andrew Sisters - Rum..> | 2026-05-22 20:31 | 46K | |
| Andrew Sisters - Bei..> | 2026-05-22 20:31 | 39K | |
| Andrew Gold - Thank ..> | 2026-05-22 20:31 | 50K | |
| Andrew Gold - Never ..> | 2026-05-22 19:30 | 33K | |
| Andrew Gold - Lonely..> | 2026-05-22 20:31 | 50K | |
| Andrea Bocelli - Viv..> | 2026-05-22 20:31 | 114K | |
| Andrea Bocelli - Con..> | 2026-05-22 20:31 | 114K | |
| Andrea Bocelli (Feat..> | 2026-05-22 19:55 | 48K | |
| Andrea Bocelli & Sar..> | 2026-05-22 20:31 | 53K | |
| Andrea Bocelli & Gio..> | 2026-05-22 19:55 | 114K | |
| Andrea - I Am A Love..> | 2026-05-22 19:37 | 60K | |
| Andre Rieu - Zorba t..> | 2026-05-22 20:31 | 73K | |
| Andre Rieu - The Bea..> | 2026-05-22 20:31 | 73K | |
| Andre Rieu - Ta Pedi..> | 2026-05-22 20:31 | 73K | |
| Andre Rieu - Sweet C..> | 2026-05-22 20:31 | 73K | |
| Andre Rieu - Strauss..> | 2026-05-22 20:31 | 73K | |
| Andre Rieu - Radetzk..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Phantom..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Panis A..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Ob Blon..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Nearer ..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Marina.jpg | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Iv. I P..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Granada..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - España..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Entry o..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Delilah..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Dancing..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Can't H..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Blaze A..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Ben-Hur..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Arv 19.jpg | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Arv 10.jpg | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Arv.jpg | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Alte Ka..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Alte Ka..> | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Aida.jpg | 2026-05-22 20:30 | 73K | |
| Andre Rieu - Adieu, ..> | 2026-05-22 20:30 | 73K | |
| André Rieu - Second..> | 2026-05-22 20:30 | 294K | |
| André Rieu - Geen H..> | 2026-05-22 19:55 | 39K | |
| André Rieu & Straus..> | 2026-05-22 19:55 | 38K | |
| André Rieu & Straus..> | 2026-05-22 19:55 | 45K | |
| André Moss - Rosita..> | 2026-05-22 19:30 | 39K | |
| André Moss - My Spa..> | 2026-05-22 19:30 | 42K | |
| André Moss - Let Th..> | 2026-05-22 19:30 | 19K | |
| André Moss - Ella.jpg | 2026-05-22 19:30 | 79K | |
| André Brasseur - Ea..> | 2026-05-22 19:55 | 31K | |
| André Brasseur - Ea..> | 2026-05-22 20:30 | 22K | |
| André Brasseur - Bi..> | 2026-05-22 20:04 | 31K | |
| And now - Duke.jpg | 2026-05-22 19:29 | 3.1K | |
| Anders Nilsen -Salsa..> | 2026-05-22 20:04 | 42K | |
| Anastacia - Sick And..> | 2026-05-22 20:04 | 66K | |
| Anastacia - Paid My ..> | 2026-05-22 20:04 | 46K | |
| Anastacia - One Day ..> | 2026-05-22 20:04 | 46K | |
| Anastacia - Not That..> | 2026-05-22 20:04 | 66K | |
| Anastacia - Left Out..> | 2026-05-22 20:04 | 36K | |
| Anastacia - I'm Outt..> | 2026-05-22 20:04 | 30K | |
| Anarchic System - Po..> | 2026-05-22 19:30 | 227K | |
| Amy Winehouse Ft. Ma..> | 2026-05-22 20:04 | 73K | |
| Amy Winehouse - You ..> | 2026-05-22 20:04 | 51K | |
| Amy Winehouse - Tear..> | 2026-05-22 20:04 | 51K | |
| Amy Winehouse - Reha..> | 2026-05-22 20:04 | 77K | |
| Amy Winehouse - Our ..> | 2026-05-22 20:04 | 16K | |
| Amy Winehouse - Love..> | 2026-05-22 20:04 | 51K | |
| Amy Winehouse - Back..> | 2026-05-22 20:04 | 51K | |
| Amy Studt - Misfit.jpg | 2026-05-22 20:04 | 85K | |
| Amy Macdonald - This..> | 2026-05-22 20:04 | 42K | |
| Amy Macdonald - Mr R..> | 2026-05-22 20:04 | 63K | |
| Amy Grant - Baby Bab..> | 2026-05-22 19:55 | 71K | |
| Amii Stewart - Knock..> | 2026-05-22 19:30 | 57K | |
| Ames Brothers - Melo..> | 2026-05-22 19:55 | 45K | |
| American Breed - Ben..> | 2026-05-22 20:30 | 12K | |
| America - You Can Do..> | 2026-05-22 19:55 | 53K | |
| America - Ventura Hi..> | 2026-05-22 19:30 | 39K | |
| America - The Border..> | 2026-05-22 19:37 | 51K | |
| America - Sister Gol..> | 2026-05-22 19:30 | 455K | |
| America - A Horse Wi..> | 2026-05-22 19:30 | 54K | |
| Amen Corner - If par..> | 2026-05-22 20:30 | 276K | |
| Amen Corner - Hello ..> | 2026-05-22 20:30 | 167K | |
| Amber - This Is Your..> | 2026-05-22 20:04 | 44K | |
| Amazulu - Wonderful ..> | 2026-05-22 19:37 | 56K | |
| Amazulu - Too Good T..> | 2026-05-22 19:37 | 34K | |
| Amanda Marshall - Be..> | 2026-05-22 19:55 | 48K | |
| Amanda Lear - Follow..> | 2026-05-22 19:30 | 16K | |
| Amália Rodrigues - ..> | 2026-05-22 20:04 | 42K | |
| Alyssa Reid - Alone ..> | 2026-05-22 20:04 | 66K | |
| Alvin Stardust - Pre..> | 2026-05-22 19:37 | 34K | |
| Alvaro Soler - Sofia..> | 2026-05-22 20:04 | 67K | |
| Alvaro Soler - El Mi..> | 2026-05-22 20:04 | 113K | |
| Alphaville - Sounds ..> | 2026-05-22 19:55 | 93K | |
| Alphaville - Sound L..> | 2026-05-22 19:37 | 46K | |
| Alphaville - Forever..> | 2026-05-22 20:30 | 42K | |
| Alphaville - Big In ..> | 2026-05-22 19:37 | 69K | |
| Alphabeat - Fascinat..> | 2026-05-22 20:04 | 35K | |
| Alok x Ella Eyre x K..> | 2026-05-22 20:04 | 62K | |
| Alok Zeeba; Bruno Ma..> | 2026-05-22 20:04 | 234K | |
| Alok THRDL!FE - Hear..> | 2026-05-22 20:04 | 289K | |
| Alok Sigala,Ellie Go..> | 2026-05-22 20:04 | 766K | |
| Alok; Zeeba; Bruno M..> | 2026-05-22 20:04 | 27K | |
| Alok; THRDL!FE - Hea..> | 2026-05-22 20:04 | 103K | |
| Alok,Sigala,Ellie Go..> | 2026-05-22 20:04 | 197K | |
| Alok & Ava Max - Car..> | 2026-05-22 20:04 | 163K | |
| Aloe Blacc - I Need ..> | 2026-05-22 20:04 | 43K | |
| Alma Cogan - Eight D..> | 2026-05-22 20:30 | 33K | |
| Alma Cogan - Dreambo..> | 2026-05-22 20:30 | 58K | |
| Allure -All Cried Ou..> | 2026-05-22 20:04 | 55K | |
| Allman Brothers Band..> | 2026-05-22 19:30 | 520K | |
| Allman Brothers Band..> | 2026-05-22 19:30 | 159K | |
| Allisons - Are You S..> | 2026-05-22 19:55 | 46K | |
| Allisons, The - Are ..> | 2026-05-22 20:30 | 222K | |
| Allison Moorer - A S..> | 2026-05-22 20:17 | 16K | |
| Allen Toussaint - So..> | 2026-05-22 20:17 | 65K | |
| Alle Farben ft. Grah..> | 2026-05-22 20:04 | 57K | |
| All Star Tribute -Wh..> | 2026-05-22 20:04 | 88K | |
| All Saints -Under Th..> | 2026-05-22 20:04 | 15K | |
| All Saints - Pure Sh..> | 2026-05-22 20:04 | 52K | |
| All Saints - Never E..> | 2026-05-22 19:55 | 52K | |
| All Saints - Lady Ma..> | 2026-05-22 19:55 | 15K | |
| All 4 One - I Swear.jpg | 2026-05-22 20:04 | 46K | |
| Alizée - Moi... Lol..> | 2026-05-22 20:04 | 40K | |
| Alizée - Moi ...Lol..> | 2026-05-22 20:04 | 40K | |
| Alison Moyet - Weak ..> | 2026-05-22 19:37 | 22K | |
| Alison Moyet - That ..> | 2026-05-22 19:37 | 208K | |
| Alison Moyet - Love ..> | 2026-05-22 20:04 | 739K | |
| Alison Moyet - Is Th..> | 2026-05-22 19:37 | 37K | |
| Alison Moyet - All C..> | 2026-05-22 19:37 | 59K | |
| Alison Krauss & Unio..> | 2026-05-22 20:30 | 38K | |
| Alisha - Baby Talk.jpg | 2026-05-22 19:37 | 24K | |
| Alisha - Baby Talk (..> | 2026-05-22 19:37 | 306K | |
| Alien Ant Farm - Smo..> | 2026-05-22 20:04 | 53K | |
| Alicia Keys - You Do..> | 2026-05-22 20:04 | 45K | |
| Alicia Keys - Underd..> | 2026-05-22 20:04 | 129K | |
| Alicia Keys - No One..> | 2026-05-22 20:04 | 47K | |
| Alicia Keys - If I A..> | 2026-05-22 20:30 | 47K | |
| Alicia Keys - Girl O..> | 2026-05-22 20:04 | 42K | |
| Alicia Keys - Fallin..> | 2026-05-22 20:30 | 63K | |
| Alicia Keys - Empire..> | 2026-05-22 20:04 | 59K | |
| Alicia Keys - A Woma..> | 2026-05-22 20:04 | 26K | |
| Alicia Bridges - I L..> | 2026-05-22 19:30 | 19K | |
| Alicia Bridges - I L..> | 2026-05-22 19:30 | 63K | |
| Alice Deejay - Will ..> | 2026-05-22 19:55 | 54K | |
| Alice Deejay - The L..> | 2026-05-22 19:55 | 40K | |
| Alice Deejay - Back ..> | 2026-05-22 19:55 | 40K | |
| Alice Cooper - Schoo..> | 2026-05-22 19:30 | 20K | |
| Alice Cooper - Poiso..> | 2026-05-22 19:30 | 65K | |
| Alice Cooper - How Y..> | 2026-05-22 19:30 | 149K | |
| Alice & Franco Batti..> | 2026-05-22 19:37 | 44K | |
| Alf - Stuck On Earth..> | 2026-05-22 19:37 | 14K | |
| Alexis Jordan -Happi..> | 2026-05-22 20:04 | 91K | |
| Alexia - Uh La La La..> | 2026-05-22 19:55 | 65K | |
| Alexandra Stan -Mr. ..> | 2026-05-22 20:04 | 49K | |
| Alexandra Burke Feat..> | 2026-05-22 20:04 | 138K | |
| Alexander Rybak - Fa..> | 2026-05-22 20:04 | 268K | |
| Alexander O'neal - C..> | 2026-05-22 20:04 | 62K | |
| Alexander O'neal & C..> | 2026-05-22 19:55 | 70K | |
| Alexander O'Neal - F..> | 2026-05-22 19:37 | 270K | |
| Alexander Curly -I'l..> | 2026-05-22 19:30 | 220K | |
| Alexander Curly - I'..> | 2026-05-22 19:55 | 52K | |
| Alex Warren - Carry ..> | 2026-05-22 20:04 | 210K | |
| Alex Harvey - To Mak..> | 2026-05-22 20:30 | 213K | |
| Alex Gaudino Feat. C..> | 2026-05-22 20:04 | 15K | |
| Alesso & Nate Smith ..> | 2026-05-22 20:04 | 211K | |
| Alessi Brothers, The..> | 2026-05-22 19:30 | 125K | |
| Alessandro Safina - ..> | 2026-05-22 20:30 | 33K | |
| Alesha Dixon -The Bo..> | 2026-05-22 20:03 | 50K | |
| Alesha Dixon - The B..> | 2026-05-22 20:03 | 50K | |
| Alderliefste & Ramse..> | 2026-05-22 20:30 | 31K | |
| Alcazar - Sexual Gua..> | 2026-05-22 20:03 | 20K | |
| Alcazar - Crying At ..> | 2026-05-22 20:03 | 23K | |
| Alberto & Ska Boys -..> | 2026-05-22 20:30 | 42K | |
| Albert West - Tell L..> | 2026-05-22 19:30 | 398K | |
| Albert West - Put yo..> | 2026-05-22 19:30 | 423K | |
| Albert West - O What..> | 2026-05-22 20:17 | 42K | |
| Albert West - Munich..> | 2026-05-22 19:37 | 244K | |
| Albert West - Mocki'..> | 2026-05-22 19:55 | 47K | |
| Albert West - Hot Ha..> | 2026-05-22 19:37 | 96K | |
| Albert West - Ginny ..> | 2026-05-22 19:30 | 45K | |
| Albert West - For th..> | 2026-05-22 19:30 | 43K | |
| Albert West - Amaril..> | 2026-05-22 19:30 | 47K | |
| Albert West & Brian ..> | 2026-05-22 19:37 | 43K | |
| Albert Hammond - To ..> | 2026-05-22 20:17 | 65K | |
| Albert Hammond - The..> | 2026-05-22 19:30 | 58K | |
| Albert Hammond - It ..> | 2026-05-22 20:30 | 45K | |
| Albert Hammond - I D..> | 2026-05-22 19:30 | 26K | |
| Albert Hammond - I D..> | 2026-05-22 20:30 | 26K | |
| Albert Hammond - I'm..> | 2026-05-22 19:30 | 26K | |
| Albert Hammond - Dow..> | 2026-05-22 19:30 | 45K | |
| Albert Hammond & Alb..> | 2026-05-22 19:55 | 40K | |
| Alannah Myles - Blac..> | 2026-05-22 19:37 | 49K | |
| Alanis Morissette - ..> | 2026-05-22 19:55 | 73K | |
| Alanis Morissette - ..> | 2026-05-22 19:55 | 74K | |
| Alanis Morissette - ..> | 2026-05-22 19:55 | 40K | |
| Alanis Morissette - ..> | 2026-05-22 19:54 | 73K | |
| Alanis Morissette - ..> | 2026-05-22 20:03 | 54K | |
| Alanis Morissette - ..> | 2026-05-22 20:03 | 71K | |
| Alan Walker X Imanbe..> | 2026-05-22 20:03 | 73K | |
| Alan Walker Dash Ber..> | 2026-05-22 20:03 | 192K | |
| Alan Walker; Dash Be..> | 2026-05-22 20:03 | 41K | |
| Alan Walker - Faded.jpg | 2026-05-22 20:03 | 40K | |
| Alan Walker & Sasha ..> | 2026-05-22 20:03 | 233K | |
| Alan Walker & Ava Ma..> | 2026-05-22 20:03 | 233K | |
| Alan Price Set - Wil..> | 2026-05-22 20:30 | 75K | |
| Alan Price Set - The..> | 2026-05-22 20:30 | 43K | |
| Alan Price Set - Sha..> | 2026-05-22 20:30 | 228K | |
| Alan Price Set - I P..> | 2026-05-22 20:30 | 45K | |
| Alan Price Set - Hi-..> | 2026-05-22 20:30 | 230K | |
| Alan Price Set - Don..> | 2026-05-22 20:30 | 42K | |
| Alan Price & Georgie..> | 2026-05-22 19:30 | 20K | |
| Alan Jackson - Who's..> | 2026-05-22 20:17 | 47K | |
| Alan Jackson - Wante..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - Tonig..> | 2026-05-22 20:17 | 56K | |
| Alan Jackson - There..> | 2026-05-22 20:17 | 47K | |
| Alan Jackson - Tequi..> | 2026-05-22 20:17 | 331K | |
| Alan Jackson - Tall,..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - Summe..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - Somed..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - She's..> | 2026-05-22 20:17 | 56K | |
| Alan Jackson - Right..> | 2026-05-22 20:17 | 40K | |
| Alan Jackson - Pop a..> | 2026-05-22 20:17 | 44K | |
| Alan Jackson - Once ..> | 2026-05-22 20:17 | 46K | |
| Alan Jackson - Midni..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - Mercu..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - Love'..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - Livin..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - Littl..> | 2026-05-22 20:17 | 35K | |
| Alan Jackson - Littl..> | 2026-05-22 20:17 | 50K | |
| Alan Jackson - I Don..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - I'll ..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - I'll ..> | 2026-05-22 20:17 | 43K | |
| Alan Jackson - I'd L..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - Honky..> | 2026-05-22 20:17 | 41K | |
| Alan Jackson - Here ..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - Gone ..> | 2026-05-22 20:17 | 40K | |
| Alan Jackson - Gone ..> | 2026-05-22 20:17 | 30K | |
| Alan Jackson - Don't..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - Dalla..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - Chatt..> | 2026-05-22 20:17 | 30K | |
| Alan Jackson - Chasi..> | 2026-05-22 20:17 | 48K | |
| Alan Jackson - Betwe..> | 2026-05-22 20:17 | 47K | |
| Alan Jackson - (Who ..> | 2026-05-22 20:17 | 48K | |
| Alain Morisod & Swee..> | 2026-05-22 20:30 | 188K | |
| Alain Delon & Shirle..> | 2026-05-22 19:37 | 96K | |
| Alain Clark Ft. Ben ..> | 2026-05-22 20:03 | 26K | |
| Alain Clark - Father..> | 2026-05-22 20:30 | 66K | |
| Alain Clark - Father..> | 2026-05-22 20:03 | 33K | |
| Alain Barriere - Ma ..> | 2026-05-22 20:30 | 158K | |
| Alain Barriere & Noe..> | 2026-05-22 20:30 | 38K | |
| Alabama - You've Got..> | 2026-05-22 20:17 | 64K | |
| Alabama - Why Lady W..> | 2026-05-22 20:17 | 56K | |
| Alabama - When We Ma..> | 2026-05-22 20:17 | 58K | |
| Alabama - Touch Me W..> | 2026-05-22 20:17 | 1.1M | |
| Alabama - There's No..> | 2026-05-22 20:17 | 56K | |
| Alabama - Then Again..> | 2026-05-22 20:17 | 24K | |
| Alabama - The Closer..> | 2026-05-22 20:17 | 24K | |
| Alabama - Tennessee ..> | 2026-05-22 20:17 | 56K | |
| Alabama - Tar Top.jpg | 2026-05-22 20:17 | 58K | |
| Alabama - Take Me Do..> | 2026-05-22 20:17 | 56K | |
| Alabama - Take A Lit..> | 2026-05-22 20:17 | 51K | |
| Alabama - Southern S..> | 2026-05-22 20:17 | 31K | |
| Alabama - Song of th..> | 2026-05-22 20:17 | 31K | |
| Alabama - She and I.jpg | 2026-05-22 20:17 | 61K | |
| Alabama - Sad Lookin..> | 2026-05-22 20:17 | 41K | |
| Alabama - Roll On (E..> | 2026-05-22 20:17 | 58K | |
| Alabama - Reckless.jpg | 2026-05-22 20:17 | 56K | |
| Alabama - Pass It On..> | 2026-05-22 20:17 | 51K | |
| Alabama - Once Upon ..> | 2026-05-22 20:17 | 51K | |
| Alabama - Old Flame.jpg | 2026-05-22 20:17 | 59K | |
| Alabama - My Sweet C..> | 2026-05-22 20:17 | 88K | |
| Alabama - Mountain M..> | 2026-05-22 20:17 | 56K | |
| Alabama - Love in th..> | 2026-05-22 20:17 | 56K | |
| Alabama - Lady Down ..> | 2026-05-22 20:17 | 56K | |
| Alabama - Jukebox in..> | 2026-05-22 20:17 | 56K | |
| Alabama - In Picture..> | 2026-05-22 20:17 | 58K | |
| Alabama - If You're ..> | 2026-05-22 20:17 | 56K | |
| Alabama - If I Had Y..> | 2026-05-22 20:17 | 31K | |
| Alabama - I'm in a H..> | 2026-05-22 20:17 | 51K | |
| Alabama - How Do You..> | 2026-05-22 20:17 | 41K | |
| Alabama - Hometown H..> | 2026-05-22 20:17 | 51K | |
| Alabama - High Cotto..> | 2026-05-22 20:17 | 31K | |
| Alabama - Here We Ar..> | 2026-05-22 20:17 | 51K | |
| Alabama - God Must H..> | 2026-05-22 20:17 | 43K | |
| Alabama - Forty Hour..> | 2026-05-22 20:17 | 49K | |
| Alabama - Forever's ..> | 2026-05-22 20:17 | 51K | |
| Alabama - Feels So R..> | 2026-05-22 20:17 | 244K | |
| Alabama - Fallin' Ag..> | 2026-05-22 20:17 | 41K | |
| Alabama - Face to Fa..> | 2026-05-22 20:17 | 74K | |
| Alabama - Down Home.jpg | 2026-05-22 20:17 | 56K | |
| Alabama - Dixieland ..> | 2026-05-22 20:17 | 42K | |
| Alabama - Dancin', S..> | 2026-05-22 20:17 | 101K | |
| Alabama - Close Enou..> | 2026-05-22 20:17 | 34K | |
| Alabama - Can't Keep..> | 2026-05-22 20:17 | 49K | |
| Alabama - Born Count..> | 2026-05-22 20:17 | 56K | |
| Alabama - Angels Amo..> | 2026-05-22 20:17 | 46K | |
| Al Stewart - Year Of..> | 2026-05-22 19:30 | 35K | |
| Al Stewart - On The ..> | 2026-05-22 20:30 | 51K | |
| Al Martino - Volare.jpg | 2026-05-22 19:30 | 20K | |
| Al Martino - Take My..> | 2026-05-22 20:30 | 43K | |
| Al Martino - Spanish..> | 2026-05-22 20:30 | 63K | |
| Al Martino - Moon Ov..> | 2026-05-22 20:30 | 36K | |
| Al Martino - Here In..> | 2026-05-22 19:54 | 39K | |
| Al Jolson - Swanee.jpg | 2026-05-22 20:30 | 64K | |
| Al Jarreau - Roof Ga..> | 2026-05-22 19:37 | 202K | |
| Al Jarreau - Mornin'..> | 2026-05-22 19:37 | 264K | |
| Al Jarreau - Boogie ..> | 2026-05-22 19:37 | 19K | |
| Al Hudson & The Part..> | 2026-05-22 19:30 | 325K | |
| Al Green - Let's Sta..> | 2026-05-22 19:30 | 84K | |
| Al Bano & Romina Pow..> | 2026-05-22 19:37 | 217K | |
| Al Bano & Romina Pow..> | 2026-05-22 19:37 | 74K | |
| Al Bano & Romina Pow..> | 2026-05-22 20:30 | 54K | |
| Al - The best muscia..> | 2026-05-22 19:29 | 3.1K | |
| Akon - Lonely.jpg | 2026-05-22 20:03 | 60K | |
| Akcent - Kylie.jpg | 2026-05-22 20:03 | 31K | |
| Air Supply - The One..> | 2026-05-22 19:37 | 223K | |
| Air Supply - Making ..> | 2026-05-22 20:30 | 87K | |
| Air Supply - All Out..> | 2026-05-22 19:37 | 69K | |
| Air Media - Artist P..> | 2026-05-22 19:29 | 3.1K | |
| Air - All I Need.jpg | 2026-05-22 20:03 | 44K | |
| Agnetha Faltskog -Wr..> | 2026-05-22 19:37 | 29K | |
| Agnetha Fältskog - ..> | 2026-05-22 19:37 | 34K | |
| Agnes - Release Me (..> | 2026-05-22 20:03 | 61K | |
| Afroman - Because I ..> | 2026-05-22 20:03 | 48K | |
| Afrojack Feat. Wrabe..> | 2026-05-22 20:03 | 141K | |
| Afrojack Feat. Eva S..> | 2026-05-22 20:03 | 55K | |
| Afrika Bambaataa & U..> | 2026-05-22 19:37 | 21K | |
| African Business - I..> | 2026-05-22 19:54 | 52K | |
| Afric Simone - Ramay..> | 2026-05-22 19:30 | 206K | |
| Afric Simone - Playa..> | 2026-05-22 19:30 | 207K | |
| Afric Simone - Hafan..> | 2026-05-22 19:30 | 207K | |
| Aerosmith And Run DM..> | 2026-05-22 20:03 | 37K | |
| Aerosmith - Walk Thi..> | 2026-05-22 19:30 | 284K | |
| Aerosmith - Rag Doll..> | 2026-05-22 19:37 | 57K | |
| Aerosmith - Love In ..> | 2026-05-22 19:37 | 61K | |
| Aerosmith - Jaded.jpg | 2026-05-22 20:03 | 44K | |
| Aerosmith - I Don't ..> | 2026-05-22 19:54 | 56K | |
| Aerosmith - Dream On..> | 2026-05-22 19:30 | 51K | |
| Aerosmith - Cryin'.jpg | 2026-05-22 19:54 | 54K | |
| Aerosmith - Crazy.jpg | 2026-05-22 19:54 | 40K | |
| Aerosmith - Amazing.jpg | 2026-05-22 19:54 | 40K | |
| Adventures Of Stevie..> | 2026-05-22 19:54 | 41K | |
| Adriano Celentano - ..> | 2026-05-22 19:30 | 1.1M | |
| Adriano Celentano - ..> | 2026-05-22 20:30 | 50K | |
| Adrian Lux - Teenage..> | 2026-05-22 20:03 | 98K | |
| Adlicious - Maniac.jpg | 2026-05-22 20:03 | 56K | |
| Adina Howard - Freak..> | 2026-05-22 19:54 | 44K | |
| Adele - When We Were..> | 2026-05-22 20:03 | 36K | |
| Adele - Water Under ..> | 2026-05-22 20:03 | 36K | |
| Adele - Turning Tabl..> | 2026-05-22 20:03 | 63K | |
| Adele - Turning Tabl..> | 2026-05-22 20:03 | 68K | |
| Adele -Someone Like ..> | 2026-05-22 20:03 | 63K | |
| Adele - Skyfall.jpg | 2026-05-22 20:03 | 20K | |
| Adele -Set Fire To T..> | 2026-05-22 20:03 | 63K | |
| Adele - Send My Love..> | 2026-05-22 20:03 | 36K | |
| Adele - Rumour Has I..> | 2026-05-22 20:03 | 35K | |
| Adele - Rolling In T..> | 2026-05-22 20:03 | 35K | |
| Adele - Million Year..> | 2026-05-22 20:03 | 36K | |
| Adele - Make You Fee..> | 2026-05-22 20:03 | 26K | |
| Adele - Hometown Glo..> | 2026-05-22 20:03 | 26K | |
| Adele - Hello.jpg | 2026-05-22 20:03 | 36K | |
| Adele - Chasing Pave..> | 2026-05-22 20:03 | 40K | |
| Adele -Chasing Pavem..> | 2026-05-22 20:03 | 40K | |
| Adele - All I Ask.jpg | 2026-05-22 20:03 | 36K | |
| Adamski Feat. Seal -..> | 2026-05-22 19:54 | 287K | |
| Adamski - Killer.jpg | 2026-05-22 19:37 | 76K | |
| Adamo - Vous Permett..> | 2026-05-22 19:37 | 142K | |
| Adamo - Petit Bonheu..> | 2026-05-22 19:30 | 48K | |
| Adamo - Les Filles D..> | 2026-05-22 20:30 | 28K | |
| Adamo - Inch Allah.jpg | 2026-05-22 20:30 | 32K | |
| Adamo - Dolce Paola.jpg | 2026-05-22 20:30 | 52K | |
| Adam Lambert - Whata..> | 2026-05-22 20:03 | 46K | |
| Adam Lambert - Whata..> | 2026-05-22 20:03 | 45K | |
| Adam Lambert - Mad W..> | 2026-05-22 20:03 | 31K | |
| Adam Lambert - Ghost..> | 2026-05-22 20:30 | 38K | |
| Adam Faith - What Do..> | 2026-05-22 19:54 | 43K | |
| Adam Ant - Goody Two..> | 2026-05-22 19:37 | 35K | |
| Adam & The Ants - St..> | 2026-05-22 19:37 | 35K | |
| Ad Visser & Daniel S..> | 2026-05-22 19:37 | 39K | |
| Acropolis - Zorba s ..> | 2026-05-22 20:30 | 38K | |
| A crazy mix and mash..> | 2026-05-22 19:29 | 3.1K | |
| Ace Of Base - Wheel ..> | 2026-05-22 19:54 | 52K | |
| Ace Of Base - The Si..> | 2026-05-22 19:54 | 52K | |
| Ace Of Base - Happy ..> | 2026-05-22 19:54 | 25K | |
| Ace Of Base - Don´t..> | 2026-05-22 19:54 | 97K | |
| Ace Of Base - Crule ..> | 2026-05-22 19:54 | 42K | |
| Ace Of Base - All Th..> | 2026-05-22 19:54 | 52K | |
| Ace - How Long.jpg | 2026-05-22 19:30 | 70K | |
| Acdc - You Shook Me ..> | 2026-05-22 19:54 | 65K | |
| Acdc - Thunderstruck..> | 2026-05-22 19:54 | 32K | |
| Acdc - Back In Black..> | 2026-05-22 19:37 | 65K | |
| Ac Dc - Highway To H..> | 2026-05-22 19:54 | 20K | |
| Abigail Mead & Nigel..> | 2026-05-22 19:37 | 42K | |
| Abdul Hassan & Orche..> | 2026-05-22 19:30 | 8.6K | |
| Abc - When Smokey Si..> | 2026-05-22 19:37 | 58K | |
| Abc - The Night You ..> | 2026-05-22 19:37 | 61K | |
| Abc - The Look Of Lo..> | 2026-05-22 19:54 | 58K | |
| Abc - The Look Of Lo..> | 2026-05-22 19:37 | 47K | |
| Abc - Poison Arrow.jpg | 2026-05-22 19:37 | 58K | |
| Abc - King Without A..> | 2026-05-22 19:36 | 82K | |
| Abc - All Of My Hear..> | 2026-05-22 19:54 | 47K | |
| Abc - All Of My Hear..> | 2026-05-22 19:36 | 297K | |
| Abba Teens - Mamma M..> | 2026-05-22 19:54 | 353K | |
| Abba - When I Kissed..> | 2026-05-22 19:54 | 52K | |
| Abba - Waterloo.jpg | 2026-05-22 19:30 | 41K | |
| Abba - Voulez Vous.jpg | 2026-05-22 19:30 | 64K | |
| Abba - Voulez-Vous.jpg | 2026-05-22 19:54 | 106K | |
| Abba - Under attack.jpg | 2026-05-22 19:36 | 65K | |
| Abba -The Winner Tak..> | 2026-05-22 19:36 | 41K | |
| Abba - The Winner Ta..> | 2026-05-22 19:54 | 68K | |
| Abba - The Piper.jpg | 2026-05-22 19:36 | 150K | |
| Abba - The Name Of T..> | 2026-05-22 19:30 | 41K | |
| Abba - The Day Befor..> | 2026-05-22 19:36 | 16K | |
| Abba - Thank You For..> | 2026-05-22 19:30 | 41K | |
| Abba - Take A Chance..> | 2026-05-22 19:30 | 41K | |
| Abba - Super Trouper..> | 2026-05-22 19:36 | 41K | |
| Abba - Summer Night ..> | 2026-05-22 19:30 | 64K | |
| Abba - Sos.jpg | 2026-05-22 19:30 | 41K | |
| Abba - S.o.s..jpg | 2026-05-22 19:36 | 18K | |
| Abba - Ring Ring.jpg | 2026-05-22 19:30 | 46K | |
| Abba - One Of Us.jpg | 2026-05-22 19:36 | 16K | |
| Abba - Money Money M..> | 2026-05-22 19:36 | 18K | |
| Abba - Money, Money,..> | 2026-05-22 19:30 | 41K | |
| Abba - Mamma Mia.jpg | 2026-05-22 19:30 | 41K | |
| Abba - Lay All Your ..> | 2026-05-22 19:36 | 2.6M | |
| Abba - Knowing Me, K..> | 2026-05-22 19:30 | 41K | |
| Abba - I Have A Drea..> | 2026-05-22 19:30 | 41K | |
| Abba - I Do I Do I D..> | 2026-05-22 20:03 | 16K | |
| Abba - I Do, I Do, I..> | 2026-05-22 19:30 | 237K | |
| Abba - Honey, Honey.jpg | 2026-05-22 19:30 | 36K | |
| Abba - Head Over Hee..> | 2026-05-22 19:36 | 16K | |
| Abba - Happy New Yea..> | 2026-05-22 19:36 | 32K | |
| Abba - Gimme! Gimme!..> | 2026-05-22 19:30 | 41K | |
| Abba - Gimme! Gimme!..> | 2026-05-22 20:03 | 18K | |
| Abba - Fernando.jpg | 2026-05-22 19:29 | 79K | |
| Abba - Eagle.jpg | 2026-05-22 19:29 | 54K | |
| Abba - Does Your Mot..> | 2026-05-22 19:29 | 41K | |
| Abba - Dancing Queen..> | 2026-05-22 19:29 | 41K | |
| Abba - Chiquitita.jpg | 2026-05-22 19:29 | 41K | |
| Aaron Tippin - You'v..> | 2026-05-22 20:17 | 42K | |
| Aaron Tippin - Worki..> | 2026-05-22 20:17 | 52K | |
| Aaron Tippin - That'..> | 2026-05-22 20:17 | 43K | |
| Aaron Tippin - My Bl..> | 2026-05-22 20:17 | 43K | |
| Aaron Tippin - Kiss ..> | 2026-05-22 20:16 | 33K | |
| Aaron Tippin - I Wou..> | 2026-05-22 20:16 | 38K | |
| Aaron Tippin - I'm L..> | 2026-05-22 20:16 | 33K | |
| Aaron Neville - With..> | 2026-05-22 20:30 | 58K | |
| Aaron Neville - Warm..> | 2026-05-22 20:30 | 58K | |
| Aaron Neville - That..> | 2026-05-22 20:30 | 58K | |
| Aaron Neville - Some..> | 2026-05-22 20:30 | 58K | |
| Aaron Neville - Loui..> | 2026-05-22 20:30 | 58K | |
| Aaron Neville - La V..> | 2026-05-22 20:30 | 58K | |
| Aaron Neville - It F..> | 2026-05-22 20:30 | 58K | |
| Aaron Neville - I Bi..> | 2026-05-22 20:30 | 58K | |
| Aaron Neville - Hous..> | 2026-05-22 20:30 | 58K | |
| Aaron Neville - Ever..> | 2026-05-22 20:30 | 58K | |
| Aaron Neville - Don'..> | 2026-05-22 20:30 | 58K | |
| Aaron Neville - Clos..> | 2026-05-22 20:30 | 58K | |
| Aaron Neville - Ave ..> | 2026-05-22 20:30 | 58K | |
| Aaron Neville - Ango..> | 2026-05-22 20:30 | 58K | |
| Aaron Neville & Tris..> | 2026-05-22 20:16 | 53K | |
| Aaron Nevile - Tell ..> | 2026-05-22 20:30 | 155K | |
| ATC (A Touch Of Clas..> | 2026-05-22 20:04 | 205K | |
| ATB - Your Love (9PM..> | 2026-05-22 20:04 | 219K | |
| ATB - Don't Stop! (A..> | 2026-05-22 20:04 | 70K | |
| A Ha - Stay On These..> | 2026-05-22 19:36 | 75K | |
| A Ha - Crying In The..> | 2026-05-22 19:54 | 37K | |
| A Flock of Seagulls ..> | 2026-05-22 19:36 | 48K | |
| A Flock Of Seagulls ..> | 2026-05-22 20:03 | 47K | |
| AC-DC - Whole Lotta ..> | 2026-05-22 19:30 | 37K | |
| AC-DC - Highway To H..> | 2026-05-22 19:30 | 58K | |
| ABBA - Don't Shut M..> | 2026-05-22 20:03 | 41K | |
| A-Teens - Super Trou..> | 2026-05-22 19:55 | 43K | |
| A-Teens - Mamma Mia.jpg | 2026-05-22 19:55 | 43K | |
| A-Teens - Dancing Qu..> | 2026-05-22 20:04 | 43K | |
| A-Ha - Touchy!.jpg | 2026-05-22 19:37 | 45K | |
| A-Ha - The Sun Alway..> | 2026-05-22 19:37 | 39K | |
| A-Ha - The Living Da..> | 2026-05-22 19:37 | 45K | |
| A-Ha - Take On Me.jpg | 2026-05-22 19:37 | 74K | |
| A-Ha - Stay On These..> | 2026-05-22 19:54 | 75K | |
| A-Ha - I've Been Los..> | 2026-05-22 19:54 | 32K | |
| A-Ha - Hunting High ..> | 2026-05-22 20:30 | 39K | |
| A-Ha - Cry Wolf.jpg | 2026-05-22 19:37 | 155K | |
| 5000 Volts - I'm On ..> | 2026-05-22 19:29 | 374K | |
| 1910 Fruitgum Co. - ..> | 2026-05-22 20:30 | 194K | |
| 666 - Alarma!.jpg | 2026-05-22 19:54 | 18K | |
| 101 Strings Orchestr..> | 2026-05-22 20:16 | 219K | |
| 98 Degrees & Stevie ..> | 2026-05-22 19:54 | 534K | |
| 50 Cent Feat. Justin..> | 2026-05-22 20:03 | 328K | |
| 30 Seconds To Mars -..> | 2026-05-22 20:03 | 40K | |
| 10cc - im not in lo..> | 2026-05-22 19:36 | 41K | |
| 10cc - The Wall Stre..> | 2026-05-22 19:29 | 230K | |
| 10cc - The Things We..> | 2026-05-22 19:29 | 78K | |
| 10cc - Silly Love.jpg | 2026-05-22 19:29 | 230K | |
| 10cc - Life is a min..> | 2026-05-22 19:29 | 41K | |
| 10cc - I'm Mandy Fly..> | 2026-05-22 19:29 | 336K | |
| 10cc -Feel The Love.jpg | 2026-05-22 19:36 | 34K | |
| 10cc - Dreadlock Hol..> | 2026-05-22 19:29 | 47K | |
| 10Cc - The Wallstree..> | 2026-05-22 19:54 | 80K | |
| 10Cc - I'm Not In Lo..> | 2026-05-22 19:29 | 78K | |
| 10Cc - Feel The Love..> | 2026-05-22 19:54 | 34K | |
| 10 CC - Donna.jpg | 2026-05-22 20:30 | 183K | |
| 4 Tune Fairytales - ..> | 2026-05-22 19:54 | 53K | |
| 4 The Cause - Stand ..> | 2026-05-22 19:54 | 36K | |
| 4 Non Blondes - What..> | 2026-05-22 19:54 | 53K | |
| 3rd Nation - I Belie..> | 2026-05-22 19:54 | 60K | |
| 3T - Anything.jpg | 2026-05-22 19:54 | 208K | |
| 3 Drives On A Vinyl ..> | 2026-05-22 19:54 | 107K | |
| 2 Unlimited - Twilig..> | 2026-05-22 19:54 | 35K | |
| 2 Unlimited - Tribal..> | 2026-05-22 19:54 | 135K | |
| 2 Unlimited - Tribal..> | 2026-05-22 19:54 | 309K | |
| 2 Unlimited - Nothin..> | 2026-05-22 19:54 | 30K | |
| 2 Unlimited - No One..> | 2026-05-22 19:54 | 83K | |
| 2 Unlimited - No Lim..> | 2026-05-22 19:54 | 85K | |
| 2 Unlimited - No Lim..> | 2026-05-22 19:54 | 309K | |
| 2 Unlimited - Maximu..> | 2026-05-22 19:54 | 60K | |
| 2 Unlimited - Let Th..> | 2026-05-22 19:54 | 27K | |
| 2 Unlimited - Jump F..> | 2026-05-22 19:54 | 69K | |
| 2 Unlimited - Get Re..> | 2026-05-22 19:54 | 63K | |
| 2 Unlimited - Faces.jpg | 2026-05-22 19:54 | 27K | |
| 2Pac ft. Dr. Dre & R..> | 2026-05-22 19:54 | 68K | |
| 2Pac - Dear Mama.jpg | 2026-05-22 20:03 | 36K | |
| 2Pac - Changes.jpg | 2026-05-22 19:54 | 17K | |
| 2 Live Crew - Me So ..> | 2026-05-22 19:54 | 87K | |
| 2 Live Crew - Do Wah..> | 2026-05-22 19:36 | 28K | |
| 2 Eivissa - Oh Lalal..> | 2026-05-22 19:54 | 65K | |
| 2 Cowboys - Everybod..> | 2026-05-22 19:54 | 12K | |
| 2 Brothers On The 4t..> | 2026-05-22 19:54 | 44K | |
| 2 Brothers On The 4t..> | 2026-05-22 19:54 | 29K | |
| 2 Brothers On The 4t..> | 2026-05-22 19:54 | 18K | |
| 2 Brothers On The 4t..> | 2026-05-22 19:54 | 125K | |
| 2 Brothers On The 4t..> | 2026-05-22 19:54 | 34K | |
| 2 Brothers On The 4t..> | 2026-05-22 19:54 | 91K | |
| 2 Brothers On The 4T..> | 2026-05-22 20:03 | 31K | |
| 2 Brothers On The 4T..> | 2026-05-22 19:54 | 35K | |
| 2 Brothers On The 4T..> | 2026-05-22 19:54 | 75K | |
| 2 Boys - I won't let..> | 2026-05-22 19:54 | 53K | |
| 2 Belgen - Opératio..> | 2026-05-22 19:36 | 159K | |
| 2 Belgen - Lena (200..> | 2026-05-22 19:36 | 159K | |
| 2-4 Grooves - Writin..> | 2026-05-22 19:54 | 237K | |
| (Mike) Right Here.jpg | 2026-05-22 19:29 | 3.1K | |
| (Amy) The Best Music..> | 2026-05-22 19:29 | 3.1K | |
|
|---|
Apache/2.4.58 (Win64) OpenSSL/3.1.3 PHP/8.2.12 Server at computerdokter.eu Port 80
.jpg){kind=link}
%20(Video%20Mix).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Clean.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(Single%20Version).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(feat.%20Willie%20Nelson).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20-%20Walk%20The%20Dinosaur.jpg){kind=link}
%20-%20Spy%20In%20The%20House%20Of%20Love.jpg){kind=link}
%20-%20Papa%20Was%20A%20Rolling%20Stone%20(Single%20Version).jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Pretty%20Woman.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(Radio%20Edit).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Falling%20In%20Love%20With%20You.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
s%20What%20I%20Like%20About%20You.jpg){kind=link}
.jpg){kind=link}
%20Devil%20in%20Disguise.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
t%20Grow.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20New%20York%20City.jpg){kind=link}
).jpg){kind=link}
%20No%20Thinkin'%20Thing.jpg){kind=link}
(I'm%20Never%20Gonna%20Dance%20Again).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Amarillo.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20New%20York%20City.jpg){kind=link}
.jpg){kind=link}
%20-%20Feel%20It%202009%20(Remix).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Balla%20Balla.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
%20Featuring%20Tammy%20Wynette.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
s%20Gone.jpg){kind=link}
s%20Crazy.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Ultimix%20Remix.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(1999%20Remaster).jpg){kind=link}
%20When%20You're%20in%20Love.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20What%20Do%20I%20Do%20With%20Me.jpg){kind=link}
.jpg){kind=link}
t%20Wanna%20Play%20House.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Sexy%20+%2017.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
m%20Yours.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20-%20Damn%20(I%20Think%20I%20Love%20You).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
%20%5bwith%20Daddy%20Yankee%5d.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
1979%20Version.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(Single%20Version).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20%5bRadio%20Edit%5d.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
t!.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20I%e2%80%99m%20Outta%20Here!.jpg){kind=link}
%20I%e2%80%99m%20Outta%20Here!%20(livedirect%20TV%20mix).jpg){kind=link}
%20(feat.%20Freshlyground).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(Kindervater%20Radio%20Edit).jpg){kind=link}
%20(Kindervater%20radio%20edit).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Maria%20Magdalena.jpg){kind=link}
%20Always%20Something%20There%20To%20Remind%20Me.jpg){kind=link}
%20((Special%20Ambient%20Remix)).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20((VIZE%20Remix)).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Wonderful%20World.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
%20(Radio%20Edit).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Dream%20You.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20No%20Gettin'%20Over%20Me.jpg){kind=link}
%20Stand%20by%20My%20Woman%20Man.jpg){kind=link}
%20A%20Legend%20in%20My%20Time.jpg){kind=link}
s%20Mine.jpg){kind=link}
.jpg){kind=link}
%20Satisfaction%20%7b%20New%20Remix%20%7d.jpg){kind=link}
%20A%20Fool%20Such%20As%20I.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Rock%20Steady%20Crew.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Higher%20and%20Higher.jpg){kind=link}
.jpg){kind=link}
%20Clean.jpg){kind=link}
.jpg){kind=link}
%20Mar%c3%ada.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Up%20To%20Heaven.jpg){kind=link}
t%20Lie.jpg){kind=link}
(Single%20Version).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
t%20Made%20of%20Stone.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
%20(Single%20Version).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20((Radio%20Edit)).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(2016%20Remaster).jpg){kind=link}
%20Don't%20Look%20Back.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Nanana.jpg){kind=link}
%20Nanana%20((Edit)).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Clean.jpg){kind=link}
.jpg){kind=link}
t%20Even%20Know%20Who%20I%20Am.jpg){kind=link}
.jpg){kind=link}
%20That%20Doggie%20in%20the%20Window.jpg){kind=link}
%20That%20Doggie%20In%20The%20Window.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20After%20Midnight.jpg){kind=link}
.jpg){kind=link}
s%20Got%20You.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(ATB%20Remix).jpg){kind=link}
%20((ATB%20Remix)).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20-%20King%20-%20Copy.jpg){kind=link}
John%20-%20Take%20Me%20Home,%20Country%20Roads.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(Radio%20Edit).jpg){kind=link}
%20((Radio%20Edit)).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20((Radio%20Edit)).jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
%20Devotion.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20%5bradio%20Edit%5d.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
%20(Single%20Version).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
t%20Know%20Me.jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20natural%20woman.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
ve%20Never%20Been.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20-%20Koning%20Voetbal.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20%5bfeat.%20Leila%20K%5d.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Rose%20Garden.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
t%20Know%20Much.jpg){kind=link}
s%20So%20Easy.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
ve%20Got%20to%20Talk%20to%20Me.jpg){kind=link}
).jpg){kind=link}
%20Now%20You%20Don't.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
%20So%20Strong.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
ve%20Got%20a%20Lot%20to%20Learn.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
%20Shake%20Your%20Booty.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20in%20San%20Francisco.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Riders%20in%20the%20Sky.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Starting%20Over.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20%5bAlbum%20Version%5d.jpg){kind=link}
.jpg){kind=link}
%20(clean%20version).jpg){kind=link}
%20The%20Healer.jpg){kind=link}
.jpg){kind=link}
m%20a%20Country%20Boy.jpg){kind=link}
.jpg){kind=link}
t%20Say%20That%20Anymore.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20for%20a%20Train.jpg){kind=link}
.jpg){kind=link}
t%20Forget%20You.jpg){kind=link}
t%20Stop%20Loving%20You.jpg){kind=link}
m%20Hurtin()%20Inside.jpg){kind=link}
%20The%20White%20Cliffs%20of%20Dover.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20NASA.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20-%20Lucky.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(Single%20Version).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Higher%20And%20Higher.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
m%20Not%20So%20Tough.jpg){kind=link}
d%20Be%20Yours.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20-%202023%20Mix.jpg){kind=link}
%20((2023%20Mix)).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Just%20Say%20Yes.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20%5bSingle%20Version%5d.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
s%20Cave.jpg){kind=link}
%20a%20Rainbow.jpg){kind=link}
m%20Falling.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
t%20Left%20Me%20Yet.jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
m%20in%20Love%20Again.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
re%20Gonna%20Hold%20On.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
t%20Stop%20the%20Music.jpg){kind=link}
%20The%20Jet%20Set.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Little%20Paraquayo.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Lovin'%20Feelin'.jpg){kind=link}
%20Liberty%20Valance.jpg){kind=link}
%20Cold%20Light%20Of%20Day.jpg){kind=link}
%20Love%20My%20Life%20Away.jpg){kind=link}
%20Count%20The%20Days.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
%20Wind.jpg){kind=link}
s%20Gonna%20Make%20It.jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
%20((Live)).jpg){kind=link}
t%20Matter%20to%20the%20Sun.jpg){kind=link}
.jpg){kind=link}
s%20Eyes.jpg){kind=link}
.jpg){kind=link}
%20Clean.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Remix%201988%20-%20December%201963%20(Oh%20What%20A%20Night).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20-%20Right%20Round.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Heaven.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20I%20Do%20It%20for%20You.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(bonus%20Track).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(Single).jpg){kind=link}
.jpg){kind=link}
%20Way%20To%20Eternity,%20(B)%20Hallelujah,%20(C)%20The%20Rivers%20Of%20Belief.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
%20C'est%20La%20Vie.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Devil%20In%20Disguise.jpg){kind=link}
%20A%20Fool%20Such%20As%20I.jpg){kind=link}
%20His%20Latest%20Flame.jpg){kind=link}
%20Teddy%20Bear.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
s%20On%20The%20Line.jpg){kind=link}
.jpg){kind=link}
d%20Say.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20You.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
![ERA - Mother [Remix]..>](ERA%20-%20Mother%20%5bRemix%5d.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
(Repost).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20I%20Will%20Always%20Love%20You.jpg){kind=link}
%20(Single%20Version).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
s%20the%20Reason.jpg){kind=link}
%20Here%20Cryin().jpg){kind=link}
.jpg){kind=link}
s%20Blue.jpg){kind=link}
t%20Gonna%20Waste%20My%20Time.jpg){kind=link}
m%20Moving%20On.jpg){kind=link}
%20Inside.jpg){kind=link}
.jpg){kind=link}
t%20Tell%20Me%20Your%20Troubles.jpg){kind=link}
t%20Work%20Out,%20Did%20It.jpg){kind=link}
).jpg){kind=link}
%20A%20Legend%20in%20My%20Time.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Years.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
s%20Your%20Trouble.jpg){kind=link}
%20(Single%20Version).jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(Duet%20with%20Michael%20Buble).jpg){kind=link}
%20Satisfaction.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20The%20Wild%20Side%20Of%20Me.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Died%20In%20Your%20Arms%20Tonight.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
%20Up%20for%20Lost%20Time.jpg){kind=link}
ll%20Do%20It%20All%20Over%20Again.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20A%20Natural%20Woman.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20I%20Do%20It%20For%20You.jpg){kind=link}
%20I%20Do%20It%20For%20You.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Sixty-Nine%20(Single%20Version).jpg){kind=link}
%20(Video%20Edit).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
m%20Sorry.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Party.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20-%20The%20La%20La%20Song.jpg){kind=link}
%20(Single%20Version).jpg){kind=link}
%20(Single%20Version).jpg){kind=link}
.jpg){kind=link}
ve%20Got%20Everything.jpg){kind=link}
%20Kisses.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20The%20Reaper.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
Crash()%20Craddock%20-%20Ruby%20Baby.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20The%20Time%20Of%20My%20Life.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Fight%20For%20Your%20Right%20(To%20Party).jpg){kind=link}
%20(Radio%20Remix).jpg){kind=link}
%20The%20Flintstones.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(Single%20Version).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(Original%20Radio).jpg){kind=link}
%20Heart%20of%20Stone.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Bouzouki%20Player.jpg){kind=link}
%20Another%20Somebody%20Done%20Somebody%20Wrong%20Song.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20%5bRadio%20Edit%5d%20Copy.jpg){kind=link}
%20(2017%20Remastered%20Version).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20A%20Natural%20Woman.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20-%20Time%20To%20Say%20Goodbye%20-%20Con%20Te%20Partiro.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20Broken%20Down.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
).jpg){kind=link}
%20You%20Can't%20Have%20It%20All.jpg){kind=link}
re%20Dancing.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20-%20Around%20The%20World%20(La%20La%20La%20La%20La)%20(Radio%20Version).jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20(Topmodelz%20Remix).jpg){kind=link}
%20Right%20Here.jpg){kind=link}
%20The%20Best%20Music%20On%20The%20Best%20Radio%20Show.jpg){kind=link}